comparison dimorphite_dl.py @ 5:67ee76f0e497 draft default tip

"planemo upload for repository https://github.com/bgruening/galaxytools/tree/master/chemicaltoolbox/rdkit commit c1d813d3f0fec60ea6efe8a11e59d98bfdc1636f"

4:bbbf5fb356dd

This script identifies and enumerates the possible protonation sites of SMILES
strings.
"""

from __future__ import print_function
import os
import argparse
import sys

try:
    # Python2
    from StringIO import StringIO

try:
    import rdkit
    from rdkit import Chem
    from rdkit.Chem import AllChem
except:
    msg = "Dimorphite-DL requires RDKit. See https://www.rdkit.org/"
    print(msg)
    raise Exception(msg)

def main(params=None):
    """The main definition run when you call the script from the commandline.

    :param params: The parameters to use. Entirely optional. If absent,

        if "output_file" in args and args["output_file"] is not None:
            # An output file was specified, so write to that.
            with open(args["output_file"], "w") as file:
                for protonated_smi in Protonate(args):
                    file.write(protonated_smi + "\n")
        elif "return_as_list" in args and args["return_as_list"] == True:
            return list(Protonate(args))
        else:
            # No output file specified. Just print it to the screen.
            for protonated_smi in Protonate(args):
                print(protonated_smi)

class MyParser(argparse.ArgumentParser):
    """Overwrite default parse so it displays help file on error. See
    https://stackoverflow.com/questions/4042452/display-help-message-with-python-argparse-when-script-is-called-without-any-argu"""

    def error(self, message):

        print("")

        if file is None:
            file = sys.stdout
        self._print_message(self.format_help(), file)
        print("""
examples:
  python dimorphite_dl.py --smiles_file sample_molecules.smi
  python dimorphite_dl.py --smiles "CCC(=O)O" --min_ph -3.0 --max_ph -2.0
  python dimorphite_dl.py --smiles "CCCN" --min_ph -3.0 --max_ph -2.0 --output_file output.smi
  python dimorphite_dl.py --smiles_file sample_molecules.smi --pka_precision 2.0 --label_states
  python dimorphite_dl.py --test""")
        print("")

class ArgParseFuncs:
    """A namespace for storing functions that are useful for processing
    command-line arguments. To keep things organized."""

        """Gets the arguments from the command line.

        :return: A parser object.
        """

        parser = MyParser(description="Dimorphite 1.2: Creates models of " +
                                    "appropriately protonated small moleucles. " +
                                    "Apache 2.0 License. Copyright 2018 Jacob D. " +
                                    "Durrant.")
        parser.add_argument('--min_ph', metavar='MIN', type=float, default=6.4,
                            help='minimum pH to consider (default: 6.4)')
        parser.add_argument('--max_ph', metavar='MAX', type=float, default=8.4,
                            help='maximum pH to consider (default: 8.4)')
        parser.add_argument('--pka_precision', metavar='PRE', type=float, default=1.0,
                            help='pKa precision factor (number of standard devations, default: 1.0)')
        parser.add_argument('--smiles', metavar='SMI', type=str,
                            help='SMILES string to protonate')
        parser.add_argument('--smiles_file', metavar="FILE", type=str,
                            help='file that contains SMILES strings to protonate')
        parser.add_argument('--output_file', metavar="FILE", type=str,
                            help='output file to write protonated SMILES (optional)')
        parser.add_argument('--label_states', action="store_true",
                            help='label protonated SMILES with target state ' + \
                                '(i.e., "DEPROTONATED", "PROTONATED", or "BOTH").')
        parser.add_argument('--test', action="store_true",
                            help='run unit tests (for debugging)')

        return parser

    @staticmethod
    def clean_args(args):

        :param args: A dictionary containing the arguments.
        :type args: dict
        :raises Exception: No SMILES in params.
        """

        defaults = {'min_ph' : 6.4,
                    'max_ph' : 8.4,
                    'pka_precision' : 1.0,
                    'label_states' : False,
                    'test' : False}

        for key in defaults:
            if key not in args:
                args[key] = defaults[key]

        # If the user provides a smiles string, turn it into a file-like StringIO
        # object.
        if "smiles" in args:
            if isinstance(args["smiles"], str):
                args["smiles_file"]  = StringIO(args["smiles"])

        args["smiles_and_data"] = LoadSMIFile(args["smiles_file"])

        return args

class UtilFuncs:
    """A namespace to store functions for manipulating mol objects. To keep
    things organized."""

        :return: The neutralized Mol object.
        """

        # Get the reaction data
        rxn_data = [
            ['[Ov1-1:1]', '[Ov2+0:1]-[H]'],  # To handle O- bonded to only one atom (add hydrogen).
            ['[#7v4+1:1]-[H]', '[#7v3+0:1]'],  # To handle N+ bonded to a hydrogen (remove hydrogen).
            ['[Ov2-:1]', '[Ov2+0:1]'],  # To handle O- bonded to two atoms. Should not be Negative.
            ['[#7v3+1:1]', '[#7v3+0:1]'],  # To handle N+ bonded to three atoms. Should not be positive.
            ['[#7v2-1:1]', '[#7+0:1]-[H]'],  # To handle N- Bonded to two atoms. Add hydrogen.
            # ['[N:1]=[N+0:2]=[N:3]-[H]', '[N:1]=[N+1:2]=[N+0:3]-[H]'],  # To
            # handle bad azide. Must be protonated. (Now handled elsewhere, before
            # SMILES converted to Mol object.)
            ['[H]-[N:1]-[N:2]#[N:3]', '[N:1]=[N+1:2]=[N:3]-[H]']  # To handle bad azide. R-N-N#N should be R-N=[N+]=N
        ]

        # Add substructures and reactions (initially none)
        for i, rxn_datum in enumerate(rxn_data):
            rxn_data[i].append(Chem.MolFromSmarts(rxn_datum[0]))

        while True:  # Keep going until all these issues have been resolved.
            current_rxn = None  # The reaction to perform.
            current_rxn_str = None

            for i, rxn_datum in enumerate(rxn_data):
                reactant_smarts, product_smarts, substruct_match_mol, rxn_placeholder = rxn_datum
                if mol.HasSubstructMatch(substruct_match_mol):
                    if rxn_placeholder is None:
                        current_rxn_str = reactant_smarts + '>>' + product_smarts
                        current_rxn = AllChem.ReactionFromSmarts(current_rxn_str)
                        rxn_data[i][3] = current_rxn  # Update the placeholder.
                    else:
                        current_rxn = rxn_data[i][3]
                    break

        # The mols have been altered from the reactions described above, we need
        # to resanitize them. Make sure aromatic rings are shown as such This
        # catches all RDKit Errors. without the catchError and sanitizeOps the
        # Chem.SanitizeMol can crash the program.
        sanitize_string =  Chem.SanitizeMol(
            mol,
            sanitizeOps=rdkit.Chem.rdmolops.SanitizeFlags.SANITIZE_ALL,
            catchErrors = True
        )

        return mol if sanitize_string.name == "SANITIZE_NONE" else None

    @staticmethod

        """Error messages should be printed to STDERR. See
        https://stackoverflow.com/questions/5574702/how-to-print-to-stderr-in-python"""

        print(*args, file=sys.stderr, **kwargs)

class LoadSMIFile(object):
    """A generator class for loading in the SMILES strings from a file, one at
    a time."""

    def __init__(self, filename):

            # Convert from SMILES string to RDKIT Mol. This series of tests is
            # to make sure the SMILES string is properly formed and to get it
            # into a canonical form. Filter if failed.
            mol = UtilFuncs.convert_smiles_str_to_mol(smiles_str)
            if mol is None:
                UtilFuncs.eprint("WARNING: Skipping poorly formed SMILES string: " + line)
                return self.next()

            # Handle nuetralizing the molecules. Filter if failed.
            mol = UtilFuncs.neutralize_mol(mol)
            if mol is None:
                UtilFuncs.eprint("WARNING: Skipping poorly formed SMILES string: " + line)
                return self.next()

            # Remove the hydrogens.
            try:
                mol = Chem.RemoveHs(mol)
            except:
                UtilFuncs.eprint("WARNING: Skipping poorly formed SMILES string: " + line)
                return self.next()

            if mol is None:
                UtilFuncs.eprint("WARNING: Skipping poorly formed SMILES string: " + line)
                return self.next()

            # Regenerate the smiles string (to standardize).
            new_mol_string = Chem.MolToSmiles(mol, isomericSmiles=True)

            return {
                "smiles": new_mol_string,
                "data": splits[1:]
            }
        else:
            # Blank line? Go to next one.
            return self.next()

class Protonate(object):
    """A generator class for protonating SMILES strings, one at a time."""

    def __init__(self, args):

            # There are no more input smiles strings...
            raise StopIteration()

        smi = smile_and_datum["smiles"]
        data = smile_and_datum["data"]  # Everything on SMILES line but the
                                        # SMILES string itself (e.g., the
                                        # molecule name).

        # Collect the data associated with this smiles (e.g., the molecule
        # name).
        tag = " ".join(data)

            new_smis = ProtSubstructFuncs.protonate_site(new_smis, site)
            # print(site, new_smis)  # Good for debugging.

            # Only add new smiles if not already in the list.
            # for s in new_smis_to_perhaps_add:
                # if not s in new_smis:
                    # new_smis.append(s)

        # In some cases, the script might generate redundant molecules.
        # Phosphonates, when the pH is between the two pKa values and the
        # stdev value is big enough, for example, will generate two identical
        # BOTH states. Let's remove this redundancy.

        new_smis = [s.replace("[nH-]", "[n-]") for s in new_smis]

        # Sometimes Dimorphite-DL generates molecules that aren't actually
        # possible. Simply convert these to mol objects to eliminate the bad
        # ones (that are None).
        new_smis = [s for s in new_smis if UtilFuncs.convert_smiles_str_to_mol(s) is not None]

        # If there are no smi left, return the input one at the very least.
        # All generated forms have apparently been judged
        # inappropriate/mal-formed.
        if len(new_smis) == 0:
            new_smis = [smi]

        # If the user wants to see the target states, add those
        # to the ends of each line.
        if self.args["label_states"]:
            states = '\t'.join([x[1] for x in sites])
            new_lines = [x + "\t" + tag + "\t" + states for x in new_smis]
        else:
            new_lines = [x + "\t" + tag for x in new_smis]

        self.cur_prot_SMI = new_lines

        return self.next()

class ProtSubstructFuncs:
    """A namespace to store functions for loading the substructures that can
    be protonated. To keep things organized."""

    @staticmethod
    def load_protonation_substructs_calc_state_for_ph(min_ph=6.4, max_ph=8.4, pka_std_range=1):
        """A pre-calculated list of R-groups with protonation sites, with their
        likely pKa bins.

        :param float min_ph:  The lower bound on the pH range, defaults to 6.4.
        :param float max_ph:  The upper bound on the pH range, defaults to 8.4.

        subs = []
        pwd = os.path.dirname(os.path.realpath(__file__))

        site_structures_file = "{}/{}".format(pwd, "site_substructures.smarts")
        with open(site_structures_file, 'r') as substruct:
            for line in substruct:
                line = line.strip()
                sub = {}
                if line is not "":
                    splits = line.split()
                    sub["name"] = splits[0]
                    sub["smart"] = splits[1]
                    sub["mol"] = Chem.MolFromSmarts(sub["smart"])

                    # NEED TO DIVIDE THIS BY 3s
                    pka_ranges = [splits[i:i+3] for i in range(2, len(splits)-1, 3)]

                    prot = []
                    for pka_range in pka_ranges:
                        site = pka_range[0]
                        std = float(pka_range[2]) * pka_std_range

        max_pka = mean + std

        # This needs to be reassigned, and 'ERROR' should never make it past the
        # next set of checks.
        if min_pka <= max_ph and min_ph <= max_pka:
            protonation_state = 'BOTH'
        elif mean > max_ph:
            protonation_state = 'PROTONATED'
        else:
            protonation_state = 'DEPROTONATED'

        return protonation_state

    @staticmethod
    def get_prot_sites_and_target_states(smi, subs):

            UtilFuncs.eprint("ERROR:   ", smi)
            return []

        # Try to Add hydrogens. if failed return []
        try:
            mol =  Chem.AddHs(mol)
        except:
            UtilFuncs.eprint("ERROR:   ", smi)
            return []

        # Check adding Hs worked
        if mol is None:

        idx, target_prot_state, prot_site_name = site

        # Initialize the output list
        output_smis = []

        state_to_charge = {"DEPROTONATED": [-1],
                        "PROTONATED": [0],
                        "BOTH": [-1, 0]}

        charges = state_to_charge[target_prot_state]

        # Now make the actual smiles match the target protonation state.
        output_smis = ProtSubstructFuncs.set_protonation_charge(smis, idx, charges, prot_site_name)

        return output_smis

    @staticmethod
    def set_protonation_charge(smis, idx, charges, prot_site_name):

                    atom.SetFormalCharge(nitro_charge)
                else:
                    atom.SetFormalCharge(charge)

                # Convert back to SMILE and add to output
                out_smile = Chem.MolToSmiles(mol, isomericSmiles=True,canonical=True)
                output.append(out_smile)

        return output

class ProtectUnprotectFuncs:
    """A namespace for storing functions that are useful for protecting and
    unprotecting molecules. To keep things organized. We need to identify and
    mark groups that have been matched with a substructure."""

        :param rdkit.Chem.rdchem.Mol mol: The rdkit Mol object.
        :type mol: The rdkit Mol object with atoms unprotected.
        """

        for atom in mol.GetAtoms():
            atom.SetProp('_protected', '0')

    @staticmethod
    def protect_molecule(mol, match):
        """Given a 'match', a list of molecules idx's, we set the protected status
        of each atom to 1. This will prevent any matches using that atom in the

        :param list match: A list of molecule idx's.
        """

        for idx in match:
            atom = mol.GetAtomWithIdx(idx)
            atom.SetProp('_protected', '1')

    @staticmethod
    def get_unprotected_matches(mol, substruct):
        """Finds substructure matches with atoms that have not been protected.
        Returns list of matches, each match a list of atom idxs.

            protected = atom.GetProp("_protected")
            if protected == "1":
                return False
        return True

class TestFuncs:
    """A namespace for storing functions that perform tests on the code. To
    keep things organized."""

    @staticmethod
    def test():
        """Tests all the 38 groups."""

        smis = [
            # [input smiles, pka, protonated, deprotonated, category]
            ["C#CCO",                  "C#CCO",                     "C#CC[O-]",                 "Alcohol"],
            ["C(=O)N",                 "NC=O",                      "[NH-]C=O",                 "Amide"],
            ["CC(=O)NOC(C)=O",         "CC(=O)NOC(C)=O",            "CC(=O)[N-]OC(C)=O",        "Amide_electronegative"],
            ["COC(=N)N",               "COC(N)=[NH2+]",             "COC(=N)N",                 "AmidineGuanidine2"],
            ["Brc1ccc(C2NCCS2)cc1",    "Brc1ccc(C2[NH2+]CCS2)cc1",  "Brc1ccc(C2NCCS2)cc1",      "Amines_primary_secondary_tertiary"],
            ["CC(=O)[n+]1ccc(N)cc1",   "CC(=O)[n+]1ccc([NH3+])cc1", "CC(=O)[n+]1ccc(N)cc1",     "Anilines_primary"],
            ["CCNc1ccccc1",            "CC[NH2+]c1ccccc1",          "CCNc1ccccc1",              "Anilines_secondary"],
            ["Cc1ccccc1N(C)C",         "Cc1ccccc1[NH+](C)C",        "Cc1ccccc1N(C)C",           "Anilines_tertiary"],
            ["BrC1=CC2=C(C=C1)NC=C2",  "Brc1ccc2[nH]ccc2c1",        "Brc1ccc2[n-]ccc2c1",       "Indole_pyrrole"],
            ["O=c1cc[nH]cc1",          "O=c1cc[nH]cc1",             "O=c1cc[n-]cc1",            "Aromatic_nitrogen_protonated"],
            ["C-N=[N+]=[N@H]",         "CN=[N+]=N",                 "CN=[N+]=[N-]",             "Azide"],
            ["BrC(C(O)=O)CBr",         "O=C(O)C(Br)CBr",            "O=C([O-])C(Br)CBr",        "Carboxyl"],
            ["NC(NN=O)=N",             "NC(=[NH2+])NN=O",           "N=C(N)NN=O",               "AmidineGuanidine1"],
            ["C(F)(F)(F)C(=O)NC(=O)C", "CC(=O)NC(=O)C(F)(F)F",      "CC(=O)[N-]C(=O)C(F)(F)F",  "Imide"],
            ["O=C(C)NC(C)=O",          "CC(=O)NC(C)=O",             "CC(=O)[N-]C(C)=O",         "Imide2"],
            ["CC(C)(C)C(N(C)O)=O",     "CN(O)C(=O)C(C)(C)C",        "CN([O-])C(=O)C(C)(C)C",    "N-hydroxyamide"],
            ["C[N+](O)=O",             "C[N+](=O)O",                "C[N+](=O)[O-]",            "Nitro"],
            ["O=C1C=C(O)CC1",          "O=C1C=C(O)CC1",             "O=C1C=C([O-])CC1",         "O=C-C=C-OH"],
            ["C1CC1OO",                "OOC1CC1",                   "[O-]OC1CC1",               "Peroxide2"],
            ["C(=O)OO",                "O=COO",                     "O=CO[O-]",                 "Peroxide1"],
            ["Brc1cc(O)cc(Br)c1",      "Oc1cc(Br)cc(Br)c1",         "[O-]c1cc(Br)cc(Br)c1",     "Phenol"],
            ["CC(=O)c1ccc(S)cc1",      "CC(=O)c1ccc(S)cc1",         "CC(=O)c1ccc([S-])cc1",     "Phenyl_Thiol"],
            ["C=CCOc1ccc(C(=O)O)cc1",  "C=CCOc1ccc(C(=O)O)cc1",     "C=CCOc1ccc(C(=O)[O-])cc1", "Phenyl_carboxyl"],
            ["COP(=O)(O)OC",           "COP(=O)(O)OC",              "COP(=O)([O-])OC",          "Phosphate_diester"],
            ["CP(C)(=O)O",             "CP(C)(=O)O",                "CP(C)(=O)[O-]",            "Phosphinic_acid"],
            ["CC(C)OP(C)(=O)O",        "CC(C)OP(C)(=O)O",           "CC(C)OP(C)(=O)[O-]",       "Phosphonate_ester"],
            ["CC1(C)OC(=O)NC1=O",      "CC1(C)OC(=O)NC1=O",         "CC1(C)OC(=O)[N-]C1=O",     "Ringed_imide1"],
            ["O=C(N1)C=CC1=O",         "O=C1C=CC(=O)N1",            "O=C1C=CC(=O)[N-]1",        "Ringed_imide2"],
            ["O=S(OC)(O)=O",           "COS(=O)(=O)O",              "COS(=O)(=O)[O-]",          "Sulfate"],
            ["COc1ccc(S(=O)O)cc1",     "COc1ccc(S(=O)O)cc1",        "COc1ccc(S(=O)[O-])cc1",    "Sulfinic_acid"],
            ["CS(N)(=O)=O",            "CS(N)(=O)=O",               "CS([NH-])(=O)=O",          "Sulfonamide"],
            ["CC(=O)CSCCS(O)(=O)=O",   "CC(=O)CSCCS(=O)(=O)O",      "CC(=O)CSCCS(=O)(=O)[O-]",  "Sulfonate"],
            ["CC(=O)S",                "CC(=O)S",                   "CC(=O)[S-]",               "Thioic_acid"],
            ["C(C)(C)(C)(S)",          "CC(C)(C)S",                 "CC(C)(C)[S-]",             "Thiol"],
            ["Brc1cc[nH+]cc1",         "Brc1cc[nH+]cc1",            "Brc1ccncc1",               "Aromatic_nitrogen_unprotonated"],
            ["C=C(O)c1c(C)cc(C)cc1C",  "C=C(O)c1c(C)cc(C)cc1C",     "C=C([O-])c1c(C)cc(C)cc1C", "Vinyl_alcohol"],
            ["CC(=O)ON",               "CC(=O)O[NH3+]",             "CC(=O)ON",                 "Primary_hydroxyl_amine"]
        ]

        smis_phos = [
            ["O=P(O)(O)OCCCC", "CCCCOP(=O)(O)O", "CCCCOP(=O)([O-])O", "CCCCOP(=O)([O-])[O-]", "Phosphate"],
            ["CC(P(O)(O)=O)C", "CC(C)P(=O)(O)O", "CC(C)P(=O)([O-])O", "CC(C)P(=O)([O-])[O-]", "Phosphonate"]
        ]

        # Load the average pKa values.
        average_pkas = {l.split()[0].replace("*", ""):float(l.split()[3]) for l in open("site_substructures.smarts") if l.split()[0] not in ["Phosphate", "Phosphonate"]}
        average_pkas_phos = {l.split()[0].replace("*", ""):[float(l.split()[3]), float(l.split()[6])] for l in open("site_substructures.smarts") if l.split()[0] in ["Phosphate", "Phosphonate"]}

        print("Running Tests")
        print("=============")
        print("")

        args = {
            "min_ph": -10000000,
            "max_ph": -10000000,
            "pka_precision": 0.5,
            "smiles": "",
            "label_states": True
        }

        for smi, protonated, deprotonated, category in smis:
            args["smiles"] = smi
            TestFuncs.test_check(args, [protonated], ["PROTONATED"])

            avg_pka = average_pkas_phos[category][1]
            args["min_ph"] = avg_pka
            args["max_ph"] = avg_pka

            TestFuncs.test_check(args, [mix, deprotonated], ["DEPROTONATED", "DEPROTONATED"])

            avg_pka = 0.5 * (average_pkas_phos[category][0] + average_pkas_phos[category][1])
            args["min_ph"] = avg_pka
            args["max_ph"] = avg_pka
            args["pka_precision"] = 5  # Should give all three

            TestFuncs.test_check(args, [mix, deprotonated, protonated], ["BOTH", "BOTH"])

    @staticmethod
    def test_check(args, expected_output, labels):
        """Tests most ionizable groups. The ones that can only loose or gain a single proton.

        output = list(Protonate(args))
        output = [o.split() for o in output]

        num_states = len(expected_output)

        if (len(output) != num_states):
            msg = args["smiles"] + " should have " + str(num_states) + \
                " states at at pH " + str(args["min_ph"]) + ": " + str(output)
            print(msg)
            raise Exception(msg)

        if (len(set([l[0] for l in output]) - set(expected_output)) != 0):
            msg = args["smiles"] + " is not " + " AND ".join(expected_output) + \
                " at pH " + str(args["min_ph"]) + " - " + str(args["max_ph"]) + \
                "; it is " + " AND ".join([l[0] for l in output])
            print(msg)
            raise Exception(msg)

        if (len(set([l[1] for l in output]) - set(labels)) != 0):
            msg = args["smiles"] + " not labeled as " + " AND ".join(labels) + \
                "; it is " + " AND ".join([l[1] for l in output])
            print(msg)
            raise Exception(msg)

        ph_range = sorted(list(set([args["min_ph"], args["max_ph"]])))
        ph_range_str = "(" + " - ".join("{0:.2f}".format(n) for n in ph_range) + ")"
        print("(CORRECT) " + ph_range_str.ljust(10) + " " + args["smiles"] + " => " + " AND ".join([l[0] for l in output]))

def run(**kwargs):
    """A helpful, importable function for those who want to call Dimorphite-DL
    from another Python script rather than the command line. Note that this
    function accepts keyword arguments that match the command-line parameters

    :type kwargs: dict
    """

    # Run the main function with the specified arguments.
    main(kwargs)

def run_with_mol_list(mol_lst, **kwargs):
    """A helpful, importable function for those who want to call Dimorphite-DL
    from another Python script rather than the command line. Note that this
    function is for passing Dimorphite-DL a list of RDKit Mol objects, together

    """

    # Do a quick check to make sure the user input makes sense.
    for bad_arg in ["smiles", "smiles_file", "output_file", "test"]:
        if bad_arg in kwargs:
            msg = "You're using Dimorphite-DL's run_with_mol_list(mol_lst, " + \
                   "**kwargs) function, but you also passed the \"" + \
                   bad_arg + "\" argument. Did you mean to use the " + \
                   "run(**kwargs) function instead?"
            print(msg)
            raise Exception(msg)

    # Set the return_as_list flag so main() will return the protonated smiles
    # as a list.

                    m.SetBoolProp(prop, val)
                else:
                    m.SetProp(prop, str(val))
            mols.append(m)
        else:
            UtilFuncs.eprint("WARNING: Could not process molecule with SMILES string " + s + " and properties " + str(props))

    return mols

if __name__ == "__main__":
    main()

5:67ee76f0e497

This script identifies and enumerates the possible protonation sites of SMILES
strings.
"""

from __future__ import print_function

import argparse
import os
import sys

try:
    # Python2
    from StringIO import StringIO

try:
    import rdkit
    from rdkit import Chem
    from rdkit.Chem import AllChem
except Exception:
    msg = "Dimorphite-DL requires RDKit. See https://www.rdkit.org/"
    print(msg)
    raise Exception(msg)


def main(params=None):
    """The main definition run when you call the script from the commandline.

    :param params: The parameters to use. Entirely optional. If absent,

        if "output_file" in args and args["output_file"] is not None:
            # An output file was specified, so write to that.
            with open(args["output_file"], "w") as file:
                for protonated_smi in Protonate(args):
                    file.write(protonated_smi + "\n")
        elif "return_as_list" in args and args["return_as_list"]:
            return list(Protonate(args))
        else:
            # No output file specified. Just print it to the screen.
            for protonated_smi in Protonate(args):
                print(protonated_smi)


class MyParser(argparse.ArgumentParser):
    """Overwrite default parse so it displays help file on error. See
    https://stackoverflow.com/questions/4042452/display-help-message-with-python-argparse-when-script-is-called-without-any-argu"""

    def error(self, message):

        print("")

        if file is None:
            file = sys.stdout
        self._print_message(self.format_help(), file)
        print(
            """
examples:
  python dimorphite_dl.py --smiles_file sample_molecules.smi
  python dimorphite_dl.py --smiles "CCC(=O)O" --min_ph -3.0 --max_ph -2.0
  python dimorphite_dl.py --smiles "CCCN" --min_ph -3.0 --max_ph -2.0 --output_file output.smi
  python dimorphite_dl.py --smiles_file sample_molecules.smi --pka_precision 2.0 --label_states
  python dimorphite_dl.py --test"""
        )
        print("")


class ArgParseFuncs:
    """A namespace for storing functions that are useful for processing
    command-line arguments. To keep things organized."""

        """Gets the arguments from the command line.

        :return: A parser object.
        """

        parser = MyParser(
            description="Dimorphite 1.2: Creates models of "
            + "appropriately protonated small moleucles. "
            + "Apache 2.0 License. Copyright 2018 Jacob D. "
            + "Durrant."
        )
        parser.add_argument(
            "--min_ph",
            metavar="MIN",
            type=float,
            default=6.4,
            help="minimum pH to consider (default: 6.4)",
        )
        parser.add_argument(
            "--max_ph",
            metavar="MAX",
            type=float,
            default=8.4,
            help="maximum pH to consider (default: 8.4)",
        )
        parser.add_argument(
            "--pka_precision",
            metavar="PRE",
            type=float,
            default=1.0,
            help="pKa precision factor (number of standard devations, default: 1.0)",
        )
        parser.add_argument(
            "--smiles", metavar="SMI", type=str, help="SMILES string to protonate"
        )
        parser.add_argument(
            "--smiles_file",
            metavar="FILE",
            type=str,
            help="file that contains SMILES strings to protonate",
        )
        parser.add_argument(
            "--output_file",
            metavar="FILE",
            type=str,
            help="output file to write protonated SMILES (optional)",
        )
        parser.add_argument(
            "--label_states",
            action="store_true",
            help="label protonated SMILES with target state "
            + '(i.e., "DEPROTONATED", "PROTONATED", or "BOTH").',
        )
        parser.add_argument(
            "--test", action="store_true", help="run unit tests (for debugging)"
        )

        return parser

    @staticmethod
    def clean_args(args):

        :param args: A dictionary containing the arguments.
        :type args: dict
        :raises Exception: No SMILES in params.
        """

        defaults = {
            "min_ph": 6.4,
            "max_ph": 8.4,
            "pka_precision": 1.0,
            "label_states": False,
            "test": False,
        }

        for key in defaults:
            if key not in args:
                args[key] = defaults[key]

        # If the user provides a smiles string, turn it into a file-like StringIO
        # object.
        if "smiles" in args:
            if isinstance(args["smiles"], str):
                args["smiles_file"] = StringIO(args["smiles"])

        args["smiles_and_data"] = LoadSMIFile(args["smiles_file"])

        return args


class UtilFuncs:
    """A namespace to store functions for manipulating mol objects. To keep
    things organized."""

        :return: The neutralized Mol object.
        """

        # Get the reaction data
        rxn_data = [
            [
                "[Ov1-1:1]",
                "[Ov2+0:1]-[H]",
            ],  # To handle O- bonded to only one atom (add hydrogen).
            [
                "[#7v4+1:1]-[H]",
                "[#7v3+0:1]",
            ],  # To handle N+ bonded to a hydrogen (remove hydrogen).
            [
                "[Ov2-:1]",
                "[Ov2+0:1]",
            ],  # To handle O- bonded to two atoms. Should not be Negative.
            [
                "[#7v3+1:1]",
                "[#7v3+0:1]",
            ],  # To handle N+ bonded to three atoms. Should not be positive.
            [
                "[#7v2-1:1]",
                "[#7+0:1]-[H]",
            ],  # To handle N- Bonded to two atoms. Add hydrogen.
            # ['[N:1]=[N+0:2]=[N:3]-[H]', '[N:1]=[N+1:2]=[N+0:3]-[H]'],  # To
            # handle bad azide. Must be protonated. (Now handled elsewhere, before
            # SMILES converted to Mol object.)
            [
                "[H]-[N:1]-[N:2]#[N:3]",
                "[N:1]=[N+1:2]=[N:3]-[H]",
            ],  # To handle bad azide. R-N-N#N should be R-N=[N+]=N
        ]

        # Add substructures and reactions (initially none)
        for i, rxn_datum in enumerate(rxn_data):
            rxn_data[i].append(Chem.MolFromSmarts(rxn_datum[0]))

        while True:  # Keep going until all these issues have been resolved.
            current_rxn = None  # The reaction to perform.
            current_rxn_str = None

            for i, rxn_datum in enumerate(rxn_data):
                (
                    reactant_smarts,
                    product_smarts,
                    substruct_match_mol,
                    rxn_placeholder,
                ) = rxn_datum
                if mol.HasSubstructMatch(substruct_match_mol):
                    if rxn_placeholder is None:
                        current_rxn_str = reactant_smarts + ">>" + product_smarts
                        current_rxn = AllChem.ReactionFromSmarts(current_rxn_str)
                        rxn_data[i][3] = current_rxn  # Update the placeholder.
                    else:
                        current_rxn = rxn_data[i][3]
                    break

        # The mols have been altered from the reactions described above, we need
        # to resanitize them. Make sure aromatic rings are shown as such This
        # catches all RDKit Errors. without the catchError and sanitizeOps the
        # Chem.SanitizeMol can crash the program.
        sanitize_string = Chem.SanitizeMol(
            mol,
            sanitizeOps=rdkit.Chem.rdmolops.SanitizeFlags.SANITIZE_ALL,
            catchErrors=True,
        )

        return mol if sanitize_string.name == "SANITIZE_NONE" else None

    @staticmethod

        """Error messages should be printed to STDERR. See
        https://stackoverflow.com/questions/5574702/how-to-print-to-stderr-in-python"""

        print(*args, file=sys.stderr, **kwargs)


class LoadSMIFile(object):
    """A generator class for loading in the SMILES strings from a file, one at
    a time."""

    def __init__(self, filename):

            # Convert from SMILES string to RDKIT Mol. This series of tests is
            # to make sure the SMILES string is properly formed and to get it
            # into a canonical form. Filter if failed.
            mol = UtilFuncs.convert_smiles_str_to_mol(smiles_str)
            if mol is None:
                UtilFuncs.eprint(
                    "WARNING: Skipping poorly formed SMILES string: " + line
                )
                return self.next()

            # Handle nuetralizing the molecules. Filter if failed.
            mol = UtilFuncs.neutralize_mol(mol)
            if mol is None:
                UtilFuncs.eprint(
                    "WARNING: Skipping poorly formed SMILES string: " + line
                )
                return self.next()

            # Remove the hydrogens.
            try:
                mol = Chem.RemoveHs(mol)
            except Exception:
                UtilFuncs.eprint(
                    "WARNING: Skipping poorly formed SMILES string: " + line
                )
                return self.next()

            if mol is None:
                UtilFuncs.eprint(
                    "WARNING: Skipping poorly formed SMILES string: " + line
                )
                return self.next()

            # Regenerate the smiles string (to standardize).
            new_mol_string = Chem.MolToSmiles(mol, isomericSmiles=True)

            return {"smiles": new_mol_string, "data": splits[1:]}
        else:
            # Blank line? Go to next one.
            return self.next()


class Protonate(object):
    """A generator class for protonating SMILES strings, one at a time."""

    def __init__(self, args):

            # There are no more input smiles strings...
            raise StopIteration()

        smi = smile_and_datum["smiles"]
        data = smile_and_datum["data"]  # Everything on SMILES line but the
        # SMILES string itself (e.g., the
        # molecule name).

        # Collect the data associated with this smiles (e.g., the molecule
        # name).
        tag = " ".join(data)

            new_smis = ProtSubstructFuncs.protonate_site(new_smis, site)
            # print(site, new_smis)  # Good for debugging.

            # Only add new smiles if not already in the list.
            # for s in new_smis_to_perhaps_add:
            # if not s in new_smis:
            # new_smis.append(s)

        # In some cases, the script might generate redundant molecules.
        # Phosphonates, when the pH is between the two pKa values and the
        # stdev value is big enough, for example, will generate two identical
        # BOTH states. Let's remove this redundancy.

        new_smis = [s.replace("[nH-]", "[n-]") for s in new_smis]

        # Sometimes Dimorphite-DL generates molecules that aren't actually
        # possible. Simply convert these to mol objects to eliminate the bad
        # ones (that are None).
        new_smis = [
            s for s in new_smis if UtilFuncs.convert_smiles_str_to_mol(s) is not None
        ]

        # If there are no smi left, return the input one at the very least.
        # All generated forms have apparently been judged
        # inappropriate/mal-formed.
        if len(new_smis) == 0:
            new_smis = [smi]

        # If the user wants to see the target states, add those
        # to the ends of each line.
        if self.args["label_states"]:
            states = "\t".join([x[1] for x in sites])
            new_lines = [x + "\t" + tag + "\t" + states for x in new_smis]
        else:
            new_lines = [x + "\t" + tag for x in new_smis]

        self.cur_prot_SMI = new_lines

        return self.next()


class ProtSubstructFuncs:
    """A namespace to store functions for loading the substructures that can
    be protonated. To keep things organized."""

    @staticmethod
    def load_protonation_substructs_calc_state_for_ph(
        min_ph=6.4, max_ph=8.4, pka_std_range=1
    ):
        """A pre-calculated list of R-groups with protonation sites, with their
        likely pKa bins.

        :param float min_ph:  The lower bound on the pH range, defaults to 6.4.
        :param float max_ph:  The upper bound on the pH range, defaults to 8.4.

        subs = []
        pwd = os.path.dirname(os.path.realpath(__file__))

        site_structures_file = "{}/{}".format(pwd, "site_substructures.smarts")
        with open(site_structures_file, "r") as substruct:
            for line in substruct:
                line = line.strip()
                sub = {}
                if line is not "":
                    splits = line.split()
                    sub["name"] = splits[0]
                    sub["smart"] = splits[1]
                    sub["mol"] = Chem.MolFromSmarts(sub["smart"])

                    # NEED TO DIVIDE THIS BY 3s
                    pka_ranges = [
                        splits[i : i + 3] for i in range(2, len(splits) - 1, 3)
                    ]

                    prot = []
                    for pka_range in pka_ranges:
                        site = pka_range[0]
                        std = float(pka_range[2]) * pka_std_range

        max_pka = mean + std

        # This needs to be reassigned, and 'ERROR' should never make it past the
        # next set of checks.
        if min_pka <= max_ph and min_ph <= max_pka:
            protonation_state = "BOTH"
        elif mean > max_ph:
            protonation_state = "PROTONATED"
        else:
            protonation_state = "DEPROTONATED"

        return protonation_state

    @staticmethod
    def get_prot_sites_and_target_states(smi, subs):

            UtilFuncs.eprint("ERROR:   ", smi)
            return []

        # Try to Add hydrogens. if failed return []
        try:
            mol = Chem.AddHs(mol)
        except Exception:
            UtilFuncs.eprint("ERROR:   ", smi)
            return []

        # Check adding Hs worked
        if mol is None:

        idx, target_prot_state, prot_site_name = site

        # Initialize the output list
        output_smis = []

        state_to_charge = {"DEPROTONATED": [-1], "PROTONATED": [0], "BOTH": [-1, 0]}

        charges = state_to_charge[target_prot_state]

        # Now make the actual smiles match the target protonation state.
        output_smis = ProtSubstructFuncs.set_protonation_charge(
            smis, idx, charges, prot_site_name
        )

        return output_smis

    @staticmethod
    def set_protonation_charge(smis, idx, charges, prot_site_name):

                    atom.SetFormalCharge(nitro_charge)
                else:
                    atom.SetFormalCharge(charge)

                # Convert back to SMILE and add to output
                out_smile = Chem.MolToSmiles(mol, isomericSmiles=True, canonical=True)
                output.append(out_smile)

        return output


class ProtectUnprotectFuncs:
    """A namespace for storing functions that are useful for protecting and
    unprotecting molecules. To keep things organized. We need to identify and
    mark groups that have been matched with a substructure."""

        :param rdkit.Chem.rdchem.Mol mol: The rdkit Mol object.
        :type mol: The rdkit Mol object with atoms unprotected.
        """

        for atom in mol.GetAtoms():
            atom.SetProp("_protected", "0")

    @staticmethod
    def protect_molecule(mol, match):
        """Given a 'match', a list of molecules idx's, we set the protected status
        of each atom to 1. This will prevent any matches using that atom in the

        :param list match: A list of molecule idx's.
        """

        for idx in match:
            atom = mol.GetAtomWithIdx(idx)
            atom.SetProp("_protected", "1")

    @staticmethod
    def get_unprotected_matches(mol, substruct):
        """Finds substructure matches with atoms that have not been protected.
        Returns list of matches, each match a list of atom idxs.

            protected = atom.GetProp("_protected")
            if protected == "1":
                return False
        return True


class TestFuncs:
    """A namespace for storing functions that perform tests on the code. To
    keep things organized."""

    @staticmethod
    def test():
        """Tests all the 38 groups."""

        smis = [
            # [input smiles, pka, protonated, deprotonated, category]
            ["C#CCO", "C#CCO", "C#CC[O-]", "Alcohol"],
            ["C(=O)N", "NC=O", "[NH-]C=O", "Amide"],
            [
                "CC(=O)NOC(C)=O",
                "CC(=O)NOC(C)=O",
                "CC(=O)[N-]OC(C)=O",
                "Amide_electronegative",
            ],
            ["COC(=N)N", "COC(N)=[NH2+]", "COC(=N)N", "AmidineGuanidine2"],
            [
                "Brc1ccc(C2NCCS2)cc1",
                "Brc1ccc(C2[NH2+]CCS2)cc1",
                "Brc1ccc(C2NCCS2)cc1",
                "Amines_primary_secondary_tertiary",
            ],
            [
                "CC(=O)[n+]1ccc(N)cc1",
                "CC(=O)[n+]1ccc([NH3+])cc1",
                "CC(=O)[n+]1ccc(N)cc1",
                "Anilines_primary",
            ],
            ["CCNc1ccccc1", "CC[NH2+]c1ccccc1", "CCNc1ccccc1", "Anilines_secondary"],
            [
                "Cc1ccccc1N(C)C",
                "Cc1ccccc1[NH+](C)C",
                "Cc1ccccc1N(C)C",
                "Anilines_tertiary",
            ],
            [
                "BrC1=CC2=C(C=C1)NC=C2",
                "Brc1ccc2[nH]ccc2c1",
                "Brc1ccc2[n-]ccc2c1",
                "Indole_pyrrole",
            ],
            [
                "O=c1cc[nH]cc1",
                "O=c1cc[nH]cc1",
                "O=c1cc[n-]cc1",
                "Aromatic_nitrogen_protonated",
            ],
            ["C-N=[N+]=[N@H]", "CN=[N+]=N", "CN=[N+]=[N-]", "Azide"],
            ["BrC(C(O)=O)CBr", "O=C(O)C(Br)CBr", "O=C([O-])C(Br)CBr", "Carboxyl"],
            ["NC(NN=O)=N", "NC(=[NH2+])NN=O", "N=C(N)NN=O", "AmidineGuanidine1"],
            [
                "C(F)(F)(F)C(=O)NC(=O)C",
                "CC(=O)NC(=O)C(F)(F)F",
                "CC(=O)[N-]C(=O)C(F)(F)F",
                "Imide",
            ],
            ["O=C(C)NC(C)=O", "CC(=O)NC(C)=O", "CC(=O)[N-]C(C)=O", "Imide2"],
            [
                "CC(C)(C)C(N(C)O)=O",
                "CN(O)C(=O)C(C)(C)C",
                "CN([O-])C(=O)C(C)(C)C",
                "N-hydroxyamide",
            ],
            ["C[N+](O)=O", "C[N+](=O)O", "C[N+](=O)[O-]", "Nitro"],
            ["O=C1C=C(O)CC1", "O=C1C=C(O)CC1", "O=C1C=C([O-])CC1", "O=C-C=C-OH"],
            ["C1CC1OO", "OOC1CC1", "[O-]OC1CC1", "Peroxide2"],
            ["C(=O)OO", "O=COO", "O=CO[O-]", "Peroxide1"],
            [
                "Brc1cc(O)cc(Br)c1",
                "Oc1cc(Br)cc(Br)c1",
                "[O-]c1cc(Br)cc(Br)c1",
                "Phenol",
            ],
            [
                "CC(=O)c1ccc(S)cc1",
                "CC(=O)c1ccc(S)cc1",
                "CC(=O)c1ccc([S-])cc1",
                "Phenyl_Thiol",
            ],
            [
                "C=CCOc1ccc(C(=O)O)cc1",
                "C=CCOc1ccc(C(=O)O)cc1",
                "C=CCOc1ccc(C(=O)[O-])cc1",
                "Phenyl_carboxyl",
            ],
            ["COP(=O)(O)OC", "COP(=O)(O)OC", "COP(=O)([O-])OC", "Phosphate_diester"],
            ["CP(C)(=O)O", "CP(C)(=O)O", "CP(C)(=O)[O-]", "Phosphinic_acid"],
            [
                "CC(C)OP(C)(=O)O",
                "CC(C)OP(C)(=O)O",
                "CC(C)OP(C)(=O)[O-]",
                "Phosphonate_ester",
            ],
            [
                "CC1(C)OC(=O)NC1=O",
                "CC1(C)OC(=O)NC1=O",
                "CC1(C)OC(=O)[N-]C1=O",
                "Ringed_imide1",
            ],
            ["O=C(N1)C=CC1=O", "O=C1C=CC(=O)N1", "O=C1C=CC(=O)[N-]1", "Ringed_imide2"],
            ["O=S(OC)(O)=O", "COS(=O)(=O)O", "COS(=O)(=O)[O-]", "Sulfate"],
            [
                "COc1ccc(S(=O)O)cc1",
                "COc1ccc(S(=O)O)cc1",
                "COc1ccc(S(=O)[O-])cc1",
                "Sulfinic_acid",
            ],
            ["CS(N)(=O)=O", "CS(N)(=O)=O", "CS([NH-])(=O)=O", "Sulfonamide"],
            [
                "CC(=O)CSCCS(O)(=O)=O",
                "CC(=O)CSCCS(=O)(=O)O",
                "CC(=O)CSCCS(=O)(=O)[O-]",
                "Sulfonate",
            ],
            ["CC(=O)S", "CC(=O)S", "CC(=O)[S-]", "Thioic_acid"],
            ["C(C)(C)(C)(S)", "CC(C)(C)S", "CC(C)(C)[S-]", "Thiol"],
            [
                "Brc1cc[nH+]cc1",
                "Brc1cc[nH+]cc1",
                "Brc1ccncc1",
                "Aromatic_nitrogen_unprotonated",
            ],
            [
                "C=C(O)c1c(C)cc(C)cc1C",
                "C=C(O)c1c(C)cc(C)cc1C",
                "C=C([O-])c1c(C)cc(C)cc1C",
                "Vinyl_alcohol",
            ],
            ["CC(=O)ON", "CC(=O)O[NH3+]", "CC(=O)ON", "Primary_hydroxyl_amine"],
        ]

        smis_phos = [
            [
                "O=P(O)(O)OCCCC",
                "CCCCOP(=O)(O)O",
                "CCCCOP(=O)([O-])O",
                "CCCCOP(=O)([O-])[O-]",
                "Phosphate",
            ],
            [
                "CC(P(O)(O)=O)C",
                "CC(C)P(=O)(O)O",
                "CC(C)P(=O)([O-])O",
                "CC(C)P(=O)([O-])[O-]",
                "Phosphonate",
            ],
        ]

        # Load the average pKa values.
        average_pkas = {
            l.split()[0].replace("*", ""): float(l.split()[3])
            for l in open("site_substructures.smarts")
            if l.split()[0] not in ["Phosphate", "Phosphonate"]
        }
        average_pkas_phos = {
            l.split()[0].replace("*", ""): [float(l.split()[3]), float(l.split()[6])]
            for l in open("site_substructures.smarts")
            if l.split()[0] in ["Phosphate", "Phosphonate"]
        }

        print("Running Tests")
        print("=============")
        print("")

        args = {
            "min_ph": -10000000,
            "max_ph": -10000000,
            "pka_precision": 0.5,
            "smiles": "",
            "label_states": True,
        }

        for smi, protonated, deprotonated, category in smis:
            args["smiles"] = smi
            TestFuncs.test_check(args, [protonated], ["PROTONATED"])

            avg_pka = average_pkas_phos[category][1]
            args["min_ph"] = avg_pka
            args["max_ph"] = avg_pka

            TestFuncs.test_check(
                args, [mix, deprotonated], ["DEPROTONATED", "DEPROTONATED"]
            )

            avg_pka = 0.5 * (
                average_pkas_phos[category][0] + average_pkas_phos[category][1]
            )
            args["min_ph"] = avg_pka
            args["max_ph"] = avg_pka
            args["pka_precision"] = 5  # Should give all three

            TestFuncs.test_check(
                args, [mix, deprotonated, protonated], ["BOTH", "BOTH"]
            )

    @staticmethod
    def test_check(args, expected_output, labels):
        """Tests most ionizable groups. The ones that can only loose or gain a single proton.

        output = list(Protonate(args))
        output = [o.split() for o in output]

        num_states = len(expected_output)

        if len(output) != num_states:
            msg = (
                args["smiles"]
                + " should have "
                + str(num_states)
                + " states at at pH "
                + str(args["min_ph"])
                + ": "
                + str(output)
            )
            print(msg)
            raise Exception(msg)

        if len(set([l[0] for l in output]) - set(expected_output)) != 0:
            msg = (
                args["smiles"]
                + " is not "
                + " AND ".join(expected_output)
                + " at pH "
                + str(args["min_ph"])
                + " - "
                + str(args["max_ph"])
                + "; it is "
                + " AND ".join([l[0] for l in output])
            )
            print(msg)
            raise Exception(msg)

        if len(set([l[1] for l in output]) - set(labels)) != 0:
            msg = (
                args["smiles"]
                + " not labeled as "
                + " AND ".join(labels)
                + "; it is "
                + " AND ".join([l[1] for l in output])
            )
            print(msg)
            raise Exception(msg)

        ph_range = sorted(list(set([args["min_ph"], args["max_ph"]])))
        ph_range_str = "(" + " - ".join("{0:.2f}".format(n) for n in ph_range) + ")"
        print(
            "(CORRECT) "
            + ph_range_str.ljust(10)
            + " "
            + args["smiles"]
            + " => "
            + " AND ".join([l[0] for l in output])
        )


def run(**kwargs):
    """A helpful, importable function for those who want to call Dimorphite-DL
    from another Python script rather than the command line. Note that this
    function accepts keyword arguments that match the command-line parameters

    :type kwargs: dict
    """

    # Run the main function with the specified arguments.
    main(kwargs)


def run_with_mol_list(mol_lst, **kwargs):
    """A helpful, importable function for those who want to call Dimorphite-DL
    from another Python script rather than the command line. Note that this
    function is for passing Dimorphite-DL a list of RDKit Mol objects, together

    """

    # Do a quick check to make sure the user input makes sense.
    for bad_arg in ["smiles", "smiles_file", "output_file", "test"]:
        if bad_arg in kwargs:
            msg = (
                "You're using Dimorphite-DL's run_with_mol_list(mol_lst, "
                + '**kwargs) function, but you also passed the "'
                + bad_arg
                + '" argument. Did you mean to use the '
                + "run(**kwargs) function instead?"
            )
            print(msg)
            raise Exception(msg)

    # Set the return_as_list flag so main() will return the protonated smiles
    # as a list.

                    m.SetBoolProp(prop, val)
                else:
                    m.SetProp(prop, str(val))
            mols.append(m)
        else:
            UtilFuncs.eprint(
                "WARNING: Could not process molecule with SMILES string "
                + s
                + " and properties "
                + str(props)
            )

    return mols


if __name__ == "__main__":
    main()