Mercurial > repos > lain > history_metadata_extractor
comparison test-data/out.html @ 0:426b0f85a311 draft
" master branch Updating"
| author | lain |
|---|---|
| date | Tue, 19 Jul 2022 07:36:57 +0000 |
| parents | |
| children | c7f4f2ac38f2 |
comparison
equal
deleted
inserted
replaced
| -1:000000000000 | 0:426b0f85a311 |
|---|---|
| 1 | |
| 2 <!doctype HTML> | |
| 3 <html> | |
| 4 <style> | |
| 5 html, body { | |
| 6 height: 100% ; | |
| 7 } | |
| 8 | |
| 9 .history_metadata_extractor_h2.kawaii:before, | |
| 10 .history_metadata_extractor_h2.kawaii:after{content:'≧◡≦'} | |
| 11 .history_metadata_extractor_status.kawaii:after, | |
| 12 .history_metadata_extractor_status.kawaii:before{content: '(●´ω`●)'} | |
| 13 .history_metadata_extractor_glitter.kawaii:before{content: '(ノ◕ヮ◕)ノ*:・゚✧'} | |
| 14 #glitter-generator{cursor: pointer} | |
| 15 @charset "UTF-8";/*! | |
| 16 * Bootstrap v5.2.0-beta1 (https://getbootstrap.com/) | |
| 17 * Copyright 2011-2022 The Bootstrap Authors | |
| 18 * Copyright 2011-2022 Twitter, Inc. | |
| 19 * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) | |
| 20 */:root{--bs-blue:#0d6efd;--bs-indigo:#6610f2;--bs-purple:#6f42c1;--bs-pink:#d63384;--bs-red:#dc3545;--bs-orange:#fd7e14;--bs-yellow:#ffc107;--bs-green:#198754;--bs-teal:#20c997;--bs-cyan:#0dcaf0;--bs-black:#000;--bs-white:#fff;--bs-gray:#6c757d;--bs-gray-dark:#343a40;--bs-gray-100:#f8f9fa;--bs-gray-200:#e9ecef;--bs-gray-300:#dee2e6;--bs-gray-400:#ced4da;--bs-gray-500:#adb5bd;--bs-gray-600:#6c757d;--bs-gray-700:#495057;--bs-gray-800:#343a40;--bs-gray-900:#212529;--bs-primary:#0d6efd;--bs-secondary:#6c757d;--bs-success:#198754;--bs-info:#0dcaf0;--bs-warning:#ffc107;--bs-danger:#dc3545;--bs-light:#f8f9fa;--bs-dark:#212529;--bs-primary-rgb:13,110,253;--bs-secondary-rgb:108,117,125;--bs-success-rgb:25,135,84;--bs-info-rgb:13,202,240;--bs-warning-rgb:255,193,7;--bs-danger-rgb:220,53,69;--bs-light-rgb:248,249,250;--bs-dark-rgb:33,37,41;--bs-white-rgb:255,255,255;--bs-black-rgb:0,0,0;--bs-body-color-rgb:33,37,41;--bs-body-bg-rgb:255,255,255;--bs-font-sans-serif:system-ui,-apple-system,"Segoe UI",Roboto,"Helvetica Neue","Noto Sans","Liberation Sans",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji";--bs-font-monospace:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace;--bs-gradient:linear-gradient(180deg, rgba(255, 255, 255, 0.15), rgba(255, 255, 255, 0));--bs-body-font-family:var(--bs-font-sans-serif);--bs-body-font-size:1rem;--bs-body-font-weight:400;--bs-body-line-height:1.5;--bs-body-color:#212529;--bs-body-bg:#fff;--bs-border-width:1px;--bs-border-style:solid;--bs-border-color:#dee2e6;--bs-border-color-translucent:rgba(0, 0, 0, 0.175);--bs-border-radius:0.375rem;--bs-border-radius-sm:0.25rem;--bs-border-radius-lg:0.5rem;--bs-border-radius-xl:1rem;--bs-border-radius-2xl:2rem;--bs-border-radius-pill:50rem;--bs-heading-color: ;--bs-link-color:#0d6efd;--bs-link-hover-color:#0a58ca;--bs-code-color:#d63384;--bs-highlight-bg:#fff3cd}*,::after,::before{box-sizing:border-box}@media (prefers-reduced-motion:no-preference){:root{scroll-behavior:smooth}}body{margin:0;font-family:var(--bs-body-font-family);font-size:var(--bs-body-font-size);font-weight:var(--bs-body-font-weight);line-height:var(--bs-body-line-height);color:var(--bs-body-color);text-align:var(--bs-body-text-align);background-color:var(--bs-body-bg);-webkit-text-size-adjust:100%;-webkit-tap-highlight-color:transparent}hr{margin:1rem 0;color:inherit;border:0;border-top:1px solid;opacity:.25}.h1,.h2,.h3,.h4,.h5,.h6,h1,h2,h3,h4,h5,h6{margin-top:0;margin-bottom:.5rem;font-weight:500;line-height:1.2;color:var(--bs-heading-color)}.h1,h1{font-size:calc(1.375rem + 1.5vw)}@media (min-width:1200px){.h1,h1{font-size:2.5rem}}.h2,h2{font-size:calc(1.325rem + .9vw)}@media (min-width:1200px){.h2,h2{font-size:2rem}}.h3,h3{font-size:calc(1.3rem + .6vw)}@media (min-width:1200px){.h3,h3{font-size:1.75rem}}.h4,h4{font-size:calc(1.275rem + .3vw)}@media (min-width:1200px){.h4,h4{font-size:1.5rem}}.h5,h5{font-size:1.25rem}.h6,h6{font-size:1rem}p{margin-top:0;margin-bottom:1rem}abbr[title]{-webkit-text-decoration:underline dotted;text-decoration:underline dotted;cursor:help;-webkit-text-decoration-skip-ink:none;text-decoration-skip-ink:none}address{margin-bottom:1rem;font-style:normal;line-height:inherit}ol,ul{padding-left:2rem}dl,ol,ul{margin-top:0;margin-bottom:1rem}ol ol,ol ul,ul ol,ul ul{margin-bottom:0}dt{font-weight:700}dd{margin-bottom:.5rem;margin-left:0}blockquote{margin:0 0 1rem}b,strong{font-weight:bolder}.small,small{font-size:.875em}.mark,mark{padding:.1875em;background-color:var(--bs-highlight-bg)}sub,sup{position:relative;font-size:.75em;line-height:0;vertical-align:baseline}sub{bottom:-.25em}sup{top:-.5em}a{color:var(--bs-link-color);text-decoration:underline}a:hover{color:var(--bs-link-hover-color)}a:not([href]):not([class]),a:not([href]):not([class]):hover{color:inherit;text-decoration:none}code,kbd,pre,samp{font-family:var(--bs-font-monospace);font-size:1em}pre{display:block;margin-top:0;margin-bottom:1rem;overflow:auto;font-size:.875em}pre code{font-size:inherit;color:inherit;word-break:normal}code{font-size:.875em;color:var(--bs-code-color);word-wrap:break-word}a>code{color:inherit}kbd{padding:.1875rem .375rem;font-size:.875em;color:var(--bs-body-bg);background-color:var(--bs-body-color);border-radius:.25rem}kbd kbd{padding:0;font-size:1em}figure{margin:0 0 1rem}img,svg{vertical-align:middle}table{caption-side:bottom;border-collapse:collapse}caption{padding-top:.5rem;padding-bottom:.5rem;color:rgba(var(--bs-body-color-rgb),.75);text-align:left}th{text-align:inherit;text-align:-webkit-match-parent}tbody,td,tfoot,th,thead,tr{border-color:inherit;border-style:solid;border-width:0}label{display:inline-block}button{border-radius:0}button:focus:not(:focus-visible){outline:0}button,input,optgroup,select,textarea{margin:0;font-family:inherit;font-size:inherit;line-height:inherit}button,select{text-transform:none}[role=button]{cursor:pointer}select{word-wrap:normal}select:disabled{opacity:1}[list]:not([type=date]):not([type=datetime-local]):not([type=month]):not([type=week]):not([type=time])::-webkit-calendar-picker-indicator{display:none!important}[type=button],[type=reset],[type=submit],button{-webkit-appearance:button}[type=button]:not(:disabled),[type=reset]:not(:disabled),[type=submit]:not(:disabled),button:not(:disabled){cursor:pointer}::-moz-focus-inner{padding:0;border-style:none}textarea{resize:vertical}fieldset{min-width:0;padding:0;margin:0;border:0}legend{float:left;width:100%;padding:0;margin-bottom:.5rem;font-size:calc(1.275rem + .3vw);line-height:inherit}@media (min-width:1200px){legend{font-size:1.5rem}}legend+*{clear:left}::-webkit-datetime-edit-day-field,::-webkit-datetime-edit-fields-wrapper,::-webkit-datetime-edit-hour-field,::-webkit-datetime-edit-minute,::-webkit-datetime-edit-month-field,::-webkit-datetime-edit-text,::-webkit-datetime-edit-year-field{padding:0}::-webkit-inner-spin-button{height:auto}[type=search]{outline-offset:-2px;-webkit-appearance:textfield}::-webkit-search-decoration{-webkit-appearance:none}::-webkit-color-swatch-wrapper{padding:0}::-webkit-file-upload-button{font:inherit;-webkit-appearance:button}::file-selector-button{font:inherit;-webkit-appearance:button}output{display:inline-block}iframe{border:0}summary{display:list-item;cursor:pointer}progress{vertical-align:baseline}[hidden]{display:none!important}.lead{font-size:1.25rem;font-weight:300}.display-1{font-size:calc(1.625rem + 4.5vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-1{font-size:5rem}}.display-2{font-size:calc(1.575rem + 3.9vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-2{font-size:4.5rem}}.display-3{font-size:calc(1.525rem + 3.3vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-3{font-size:4rem}}.display-4{font-size:calc(1.475rem + 2.7vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-4{font-size:3.5rem}}.display-5{font-size:calc(1.425rem + 2.1vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-5{font-size:3rem}}.display-6{font-size:calc(1.375rem + 1.5vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-6{font-size:2.5rem}}.list-unstyled{padding-left:0;list-style:none}.list-inline{padding-left:0;list-style:none}.list-inline-item{display:inline-block}.list-inline-item:not(:last-child){margin-right:.5rem}.initialism{font-size:.875em;text-transform:uppercase}.blockquote{margin-bottom:1rem;font-size:1.25rem}.blockquote>:last-child{margin-bottom:0}.blockquote-footer{margin-top:-1rem;margin-bottom:1rem;font-size:.875em;color:#6c757d}.blockquote-footer::before{content:"— "}.img-fluid{max-width:100%;height:auto}.img-thumbnail{padding:.25rem;background-color:#fff;border:1px solid var(--bs-border-color);border-radius:.375rem;max-width:100%;height:auto}.figure{display:inline-block}.figure-img{margin-bottom:.5rem;line-height:1}.figure-caption{font-size:.875em;color:#6c757d}.container,.container-fluid,.container-lg,.container-md,.container-sm,.container-xl,.container-xxl{--bs-gutter-x:1.5rem;--bs-gutter-y:0;width:100%;padding-right:calc(var(--bs-gutter-x) * .5);padding-left:calc(var(--bs-gutter-x) * .5);margin-right:auto;margin-left:auto}@media (min-width:576px){.container,.container-sm{max-width:540px}}@media (min-width:768px){.container,.container-md,.container-sm{max-width:720px}}@media (min-width:992px){.container,.container-lg,.container-md,.container-sm{max-width:960px}}@media (min-width:1200px){.container,.container-lg,.container-md,.container-sm,.container-xl{max-width:1140px}}@media (min-width:1400px){.container,.container-lg,.container-md,.container-sm,.container-xl,.container-xxl{max-width:1320px}}.row{--bs-gutter-x:1.5rem;--bs-gutter-y:0;display:flex;flex-wrap:wrap;margin-top:calc(-1 * var(--bs-gutter-y));margin-right:calc(-.5 * var(--bs-gutter-x));margin-left:calc(-.5 * var(--bs-gutter-x))}.row>*{flex-shrink:0;width:100%;max-width:100%;padding-right:calc(var(--bs-gutter-x) * .5);padding-left:calc(var(--bs-gutter-x) * .5);margin-top:var(--bs-gutter-y)}.col{flex:1 0 0%}.row-cols-auto>*{flex:0 0 auto;width:auto}.row-cols-1>*{flex:0 0 auto;width:100%}.row-cols-2>*{flex:0 0 auto;width:50%}.row-cols-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-4>*{flex:0 0 auto;width:25%}.row-cols-5>*{flex:0 0 auto;width:20%}.row-cols-6>*{flex:0 0 auto;width:16.6666666667%}.col-auto{flex:0 0 auto;width:auto}.col-1{flex:0 0 auto;width:8.33333333%}.col-2{flex:0 0 auto;width:16.66666667%}.col-3{flex:0 0 auto;width:25%}.col-4{flex:0 0 auto;width:33.33333333%}.col-5{flex:0 0 auto;width:41.66666667%}.col-6{flex:0 0 auto;width:50%}.col-7{flex:0 0 auto;width:58.33333333%}.col-8{flex:0 0 auto;width:66.66666667%}.col-9{flex:0 0 auto;width:75%}.col-10{flex:0 0 auto;width:83.33333333%}.col-11{flex:0 0 auto;width:91.66666667%}.col-12{flex:0 0 auto;width:100%}.offset-1{margin-left:8.33333333%}.offset-2{margin-left:16.66666667%}.offset-3{margin-left:25%}.offset-4{margin-left:33.33333333%}.offset-5{margin-left:41.66666667%}.offset-6{margin-left:50%}.offset-7{margin-left:58.33333333%}.offset-8{margin-left:66.66666667%}.offset-9{margin-left:75%}.offset-10{margin-left:83.33333333%}.offset-11{margin-left:91.66666667%}.g-0,.gx-0{--bs-gutter-x:0}.g-0,.gy-0{--bs-gutter-y:0}.g-1,.gx-1{--bs-gutter-x:0.25rem}.g-1,.gy-1{--bs-gutter-y:0.25rem}.g-2,.gx-2{--bs-gutter-x:0.5rem}.g-2,.gy-2{--bs-gutter-y:0.5rem}.g-3,.gx-3{--bs-gutter-x:1rem}.g-3,.gy-3{--bs-gutter-y:1rem}.g-4,.gx-4{--bs-gutter-x:1.5rem}.g-4,.gy-4{--bs-gutter-y:1.5rem}.g-5,.gx-5{--bs-gutter-x:3rem}.g-5,.gy-5{--bs-gutter-y:3rem}@media (min-width:576px){.col-sm{flex:1 0 0%}.row-cols-sm-auto>*{flex:0 0 auto;width:auto}.row-cols-sm-1>*{flex:0 0 auto;width:100%}.row-cols-sm-2>*{flex:0 0 auto;width:50%}.row-cols-sm-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-sm-4>*{flex:0 0 auto;width:25%}.row-cols-sm-5>*{flex:0 0 auto;width:20%}.row-cols-sm-6>*{flex:0 0 auto;width:16.6666666667%}.col-sm-auto{flex:0 0 auto;width:auto}.col-sm-1{flex:0 0 auto;width:8.33333333%}.col-sm-2{flex:0 0 auto;width:16.66666667%}.col-sm-3{flex:0 0 auto;width:25%}.col-sm-4{flex:0 0 auto;width:33.33333333%}.col-sm-5{flex:0 0 auto;width:41.66666667%}.col-sm-6{flex:0 0 auto;width:50%}.col-sm-7{flex:0 0 auto;width:58.33333333%}.col-sm-8{flex:0 0 auto;width:66.66666667%}.col-sm-9{flex:0 0 auto;width:75%}.col-sm-10{flex:0 0 auto;width:83.33333333%}.col-sm-11{flex:0 0 auto;width:91.66666667%}.col-sm-12{flex:0 0 auto;width:100%}.offset-sm-0{margin-left:0}.offset-sm-1{margin-left:8.33333333%}.offset-sm-2{margin-left:16.66666667%}.offset-sm-3{margin-left:25%}.offset-sm-4{margin-left:33.33333333%}.offset-sm-5{margin-left:41.66666667%}.offset-sm-6{margin-left:50%}.offset-sm-7{margin-left:58.33333333%}.offset-sm-8{margin-left:66.66666667%}.offset-sm-9{margin-left:75%}.offset-sm-10{margin-left:83.33333333%}.offset-sm-11{margin-left:91.66666667%}.g-sm-0,.gx-sm-0{--bs-gutter-x:0}.g-sm-0,.gy-sm-0{--bs-gutter-y:0}.g-sm-1,.gx-sm-1{--bs-gutter-x:0.25rem}.g-sm-1,.gy-sm-1{--bs-gutter-y:0.25rem}.g-sm-2,.gx-sm-2{--bs-gutter-x:0.5rem}.g-sm-2,.gy-sm-2{--bs-gutter-y:0.5rem}.g-sm-3,.gx-sm-3{--bs-gutter-x:1rem}.g-sm-3,.gy-sm-3{--bs-gutter-y:1rem}.g-sm-4,.gx-sm-4{--bs-gutter-x:1.5rem}.g-sm-4,.gy-sm-4{--bs-gutter-y:1.5rem}.g-sm-5,.gx-sm-5{--bs-gutter-x:3rem}.g-sm-5,.gy-sm-5{--bs-gutter-y:3rem}}@media (min-width:768px){.col-md{flex:1 0 0%}.row-cols-md-auto>*{flex:0 0 auto;width:auto}.row-cols-md-1>*{flex:0 0 auto;width:100%}.row-cols-md-2>*{flex:0 0 auto;width:50%}.row-cols-md-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-md-4>*{flex:0 0 auto;width:25%}.row-cols-md-5>*{flex:0 0 auto;width:20%}.row-cols-md-6>*{flex:0 0 auto;width:16.6666666667%}.col-md-auto{flex:0 0 auto;width:auto}.col-md-1{flex:0 0 auto;width:8.33333333%}.col-md-2{flex:0 0 auto;width:16.66666667%}.col-md-3{flex:0 0 auto;width:25%}.col-md-4{flex:0 0 auto;width:33.33333333%}.col-md-5{flex:0 0 auto;width:41.66666667%}.col-md-6{flex:0 0 auto;width:50%}.col-md-7{flex:0 0 auto;width:58.33333333%}.col-md-8{flex:0 0 auto;width:66.66666667%}.col-md-9{flex:0 0 auto;width:75%}.col-md-10{flex:0 0 auto;width:83.33333333%}.col-md-11{flex:0 0 auto;width:91.66666667%}.col-md-12{flex:0 0 auto;width:100%}.offset-md-0{margin-left:0}.offset-md-1{margin-left:8.33333333%}.offset-md-2{margin-left:16.66666667%}.offset-md-3{margin-left:25%}.offset-md-4{margin-left:33.33333333%}.offset-md-5{margin-left:41.66666667%}.offset-md-6{margin-left:50%}.offset-md-7{margin-left:58.33333333%}.offset-md-8{margin-left:66.66666667%}.offset-md-9{margin-left:75%}.offset-md-10{margin-left:83.33333333%}.offset-md-11{margin-left:91.66666667%}.g-md-0,.gx-md-0{--bs-gutter-x:0}.g-md-0,.gy-md-0{--bs-gutter-y:0}.g-md-1,.gx-md-1{--bs-gutter-x:0.25rem}.g-md-1,.gy-md-1{--bs-gutter-y:0.25rem}.g-md-2,.gx-md-2{--bs-gutter-x:0.5rem}.g-md-2,.gy-md-2{--bs-gutter-y:0.5rem}.g-md-3,.gx-md-3{--bs-gutter-x:1rem}.g-md-3,.gy-md-3{--bs-gutter-y:1rem}.g-md-4,.gx-md-4{--bs-gutter-x:1.5rem}.g-md-4,.gy-md-4{--bs-gutter-y:1.5rem}.g-md-5,.gx-md-5{--bs-gutter-x:3rem}.g-md-5,.gy-md-5{--bs-gutter-y:3rem}}@media (min-width:992px){.col-lg{flex:1 0 0%}.row-cols-lg-auto>*{flex:0 0 auto;width:auto}.row-cols-lg-1>*{flex:0 0 auto;width:100%}.row-cols-lg-2>*{flex:0 0 auto;width:50%}.row-cols-lg-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-lg-4>*{flex:0 0 auto;width:25%}.row-cols-lg-5>*{flex:0 0 auto;width:20%}.row-cols-lg-6>*{flex:0 0 auto;width:16.6666666667%}.col-lg-auto{flex:0 0 auto;width:auto}.col-lg-1{flex:0 0 auto;width:8.33333333%}.col-lg-2{flex:0 0 auto;width:16.66666667%}.col-lg-3{flex:0 0 auto;width:25%}.col-lg-4{flex:0 0 auto;width:33.33333333%}.col-lg-5{flex:0 0 auto;width:41.66666667%}.col-lg-6{flex:0 0 auto;width:50%}.col-lg-7{flex:0 0 auto;width:58.33333333%}.col-lg-8{flex:0 0 auto;width:66.66666667%}.col-lg-9{flex:0 0 auto;width:75%}.col-lg-10{flex:0 0 auto;width:83.33333333%}.col-lg-11{flex:0 0 auto;width:91.66666667%}.col-lg-12{flex:0 0 auto;width:100%}.offset-lg-0{margin-left:0}.offset-lg-1{margin-left:8.33333333%}.offset-lg-2{margin-left:16.66666667%}.offset-lg-3{margin-left:25%}.offset-lg-4{margin-left:33.33333333%}.offset-lg-5{margin-left:41.66666667%}.offset-lg-6{margin-left:50%}.offset-lg-7{margin-left:58.33333333%}.offset-lg-8{margin-left:66.66666667%}.offset-lg-9{margin-left:75%}.offset-lg-10{margin-left:83.33333333%}.offset-lg-11{margin-left:91.66666667%}.g-lg-0,.gx-lg-0{--bs-gutter-x:0}.g-lg-0,.gy-lg-0{--bs-gutter-y:0}.g-lg-1,.gx-lg-1{--bs-gutter-x:0.25rem}.g-lg-1,.gy-lg-1{--bs-gutter-y:0.25rem}.g-lg-2,.gx-lg-2{--bs-gutter-x:0.5rem}.g-lg-2,.gy-lg-2{--bs-gutter-y:0.5rem}.g-lg-3,.gx-lg-3{--bs-gutter-x:1rem}.g-lg-3,.gy-lg-3{--bs-gutter-y:1rem}.g-lg-4,.gx-lg-4{--bs-gutter-x:1.5rem}.g-lg-4,.gy-lg-4{--bs-gutter-y:1.5rem}.g-lg-5,.gx-lg-5{--bs-gutter-x:3rem}.g-lg-5,.gy-lg-5{--bs-gutter-y:3rem}}@media (min-width:1200px){.col-xl{flex:1 0 0%}.row-cols-xl-auto>*{flex:0 0 auto;width:auto}.row-cols-xl-1>*{flex:0 0 auto;width:100%}.row-cols-xl-2>*{flex:0 0 auto;width:50%}.row-cols-xl-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-xl-4>*{flex:0 0 auto;width:25%}.row-cols-xl-5>*{flex:0 0 auto;width:20%}.row-cols-xl-6>*{flex:0 0 auto;width:16.6666666667%}.col-xl-auto{flex:0 0 auto;width:auto}.col-xl-1{flex:0 0 auto;width:8.33333333%}.col-xl-2{flex:0 0 auto;width:16.66666667%}.col-xl-3{flex:0 0 auto;width:25%}.col-xl-4{flex:0 0 auto;width:33.33333333%}.col-xl-5{flex:0 0 auto;width:41.66666667%}.col-xl-6{flex:0 0 auto;width:50%}.col-xl-7{flex:0 0 auto;width:58.33333333%}.col-xl-8{flex:0 0 auto;width:66.66666667%}.col-xl-9{flex:0 0 auto;width:75%}.col-xl-10{flex:0 0 auto;width:83.33333333%}.col-xl-11{flex:0 0 auto;width:91.66666667%}.col-xl-12{flex:0 0 auto;width:100%}.offset-xl-0{margin-left:0}.offset-xl-1{margin-left:8.33333333%}.offset-xl-2{margin-left:16.66666667%}.offset-xl-3{margin-left:25%}.offset-xl-4{margin-left:33.33333333%}.offset-xl-5{margin-left:41.66666667%}.offset-xl-6{margin-left:50%}.offset-xl-7{margin-left:58.33333333%}.offset-xl-8{margin-left:66.66666667%}.offset-xl-9{margin-left:75%}.offset-xl-10{margin-left:83.33333333%}.offset-xl-11{margin-left:91.66666667%}.g-xl-0,.gx-xl-0{--bs-gutter-x:0}.g-xl-0,.gy-xl-0{--bs-gutter-y:0}.g-xl-1,.gx-xl-1{--bs-gutter-x:0.25rem}.g-xl-1,.gy-xl-1{--bs-gutter-y:0.25rem}.g-xl-2,.gx-xl-2{--bs-gutter-x:0.5rem}.g-xl-2,.gy-xl-2{--bs-gutter-y:0.5rem}.g-xl-3,.gx-xl-3{--bs-gutter-x:1rem}.g-xl-3,.gy-xl-3{--bs-gutter-y:1rem}.g-xl-4,.gx-xl-4{--bs-gutter-x:1.5rem}.g-xl-4,.gy-xl-4{--bs-gutter-y:1.5rem}.g-xl-5,.gx-xl-5{--bs-gutter-x:3rem}.g-xl-5,.gy-xl-5{--bs-gutter-y:3rem}}@media (min-width:1400px){.col-xxl{flex:1 0 0%}.row-cols-xxl-auto>*{flex:0 0 auto;width:auto}.row-cols-xxl-1>*{flex:0 0 auto;width:100%}.row-cols-xxl-2>*{flex:0 0 auto;width:50%}.row-cols-xxl-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-xxl-4>*{flex:0 0 auto;width:25%}.row-cols-xxl-5>*{flex:0 0 auto;width:20%}.row-cols-xxl-6>*{flex:0 0 auto;width:16.6666666667%}.col-xxl-auto{flex:0 0 auto;width:auto}.col-xxl-1{flex:0 0 auto;width:8.33333333%}.col-xxl-2{flex:0 0 auto;width:16.66666667%}.col-xxl-3{flex:0 0 auto;width:25%}.col-xxl-4{flex:0 0 auto;width:33.33333333%}.col-xxl-5{flex:0 0 auto;width:41.66666667%}.col-xxl-6{flex:0 0 auto;width:50%}.col-xxl-7{flex:0 0 auto;width:58.33333333%}.col-xxl-8{flex:0 0 auto;width:66.66666667%}.col-xxl-9{flex:0 0 auto;width:75%}.col-xxl-10{flex:0 0 auto;width:83.33333333%}.col-xxl-11{flex:0 0 auto;width:91.66666667%}.col-xxl-12{flex:0 0 auto;width:100%}.offset-xxl-0{margin-left:0}.offset-xxl-1{margin-left:8.33333333%}.offset-xxl-2{margin-left:16.66666667%}.offset-xxl-3{margin-left:25%}.offset-xxl-4{margin-left:33.33333333%}.offset-xxl-5{margin-left:41.66666667%}.offset-xxl-6{margin-left:50%}.offset-xxl-7{margin-left:58.33333333%}.offset-xxl-8{margin-left:66.66666667%}.offset-xxl-9{margin-left:75%}.offset-xxl-10{margin-left:83.33333333%}.offset-xxl-11{margin-left:91.66666667%}.g-xxl-0,.gx-xxl-0{--bs-gutter-x:0}.g-xxl-0,.gy-xxl-0{--bs-gutter-y:0}.g-xxl-1,.gx-xxl-1{--bs-gutter-x:0.25rem}.g-xxl-1,.gy-xxl-1{--bs-gutter-y:0.25rem}.g-xxl-2,.gx-xxl-2{--bs-gutter-x:0.5rem}.g-xxl-2,.gy-xxl-2{--bs-gutter-y:0.5rem}.g-xxl-3,.gx-xxl-3{--bs-gutter-x:1rem}.g-xxl-3,.gy-xxl-3{--bs-gutter-y:1rem}.g-xxl-4,.gx-xxl-4{--bs-gutter-x:1.5rem}.g-xxl-4,.gy-xxl-4{--bs-gutter-y:1.5rem}.g-xxl-5,.gx-xxl-5{--bs-gutter-x:3rem}.g-xxl-5,.gy-xxl-5{--bs-gutter-y:3rem}}.table{--bs-table-color:var(--bs-body-color);--bs-table-bg:transparent;--bs-table-border-color:var(--bs-border-color);--bs-table-accent-bg:transparent;--bs-table-striped-color:var(--bs-body-color);--bs-table-striped-bg:rgba(0, 0, 0, 0.05);--bs-table-active-color:var(--bs-body-color);--bs-table-active-bg:rgba(0, 0, 0, 0.1);--bs-table-hover-color:var(--bs-body-color);--bs-table-hover-bg:rgba(0, 0, 0, 0.075);width:100%;margin-bottom:1rem;color:var(--bs-table-color);vertical-align:top;border-color:var(--bs-table-border-color)}.table>:not(caption)>*>*{padding:.5rem .5rem;background-color:var(--bs-table-bg);border-bottom-width:1px;box-shadow:inset 0 0 0 9999px var(--bs-table-accent-bg)}.table>tbody{vertical-align:inherit}.table>thead{vertical-align:bottom}.table-group-divider{border-top:2px solid currentcolor}.caption-top{caption-side:top}.table-sm>:not(caption)>*>*{padding:.25rem .25rem}.table-bordered>:not(caption)>*{border-width:1px 0}.table-bordered>:not(caption)>*>*{border-width:0 1px}.table-borderless>:not(caption)>*>*{border-bottom-width:0}.table-borderless>:not(:first-child){border-top-width:0}.table-striped>tbody>tr:nth-of-type(odd)>*{--bs-table-accent-bg:var(--bs-table-striped-bg);color:var(--bs-table-striped-color)}.table-striped-columns>:not(caption)>tr>:nth-child(2n){--bs-table-accent-bg:var(--bs-table-striped-bg);color:var(--bs-table-striped-color)}.table-active{--bs-table-accent-bg:var(--bs-table-active-bg);color:var(--bs-table-active-color)}.table-hover>tbody>tr:hover>*{--bs-table-accent-bg:var(--bs-table-hover-bg);color:var(--bs-table-hover-color)}.table-primary{--bs-table-color:#000;--bs-table-bg:#cfe2ff;--bs-table-border-color:#bacbe6;--bs-table-striped-bg:#c5d7f2;--bs-table-striped-color:#000;--bs-table-active-bg:#bacbe6;--bs-table-active-color:#000;--bs-table-hover-bg:#bfd1ec;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-secondary{--bs-table-color:#000;--bs-table-bg:#e2e3e5;--bs-table-border-color:#cbccce;--bs-table-striped-bg:#d7d8da;--bs-table-striped-color:#000;--bs-table-active-bg:#cbccce;--bs-table-active-color:#000;--bs-table-hover-bg:#d1d2d4;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-success{--bs-table-color:#000;--bs-table-bg:#d1e7dd;--bs-table-border-color:#bcd0c7;--bs-table-striped-bg:#c7dbd2;--bs-table-striped-color:#000;--bs-table-active-bg:#bcd0c7;--bs-table-active-color:#000;--bs-table-hover-bg:#c1d6cc;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-info{--bs-table-color:#000;--bs-table-bg:#cff4fc;--bs-table-border-color:#badce3;--bs-table-striped-bg:#c5e8ef;--bs-table-striped-color:#000;--bs-table-active-bg:#badce3;--bs-table-active-color:#000;--bs-table-hover-bg:#bfe2e9;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-warning{--bs-table-color:#000;--bs-table-bg:#fff3cd;--bs-table-border-color:#e6dbb9;--bs-table-striped-bg:#f2e7c3;--bs-table-striped-color:#000;--bs-table-active-bg:#e6dbb9;--bs-table-active-color:#000;--bs-table-hover-bg:#ece1be;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-danger{--bs-table-color:#000;--bs-table-bg:#f8d7da;--bs-table-border-color:#dfc2c4;--bs-table-striped-bg:#eccccf;--bs-table-striped-color:#000;--bs-table-active-bg:#dfc2c4;--bs-table-active-color:#000;--bs-table-hover-bg:#e5c7ca;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-light{--bs-table-color:#000;--bs-table-bg:#f8f9fa;--bs-table-border-color:#dfe0e1;--bs-table-striped-bg:#ecedee;--bs-table-striped-color:#000;--bs-table-active-bg:#dfe0e1;--bs-table-active-color:#000;--bs-table-hover-bg:#e5e6e7;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-dark{--bs-table-color:#fff;--bs-table-bg:#212529;--bs-table-border-color:#373b3e;--bs-table-striped-bg:#2c3034;--bs-table-striped-color:#fff;--bs-table-active-bg:#373b3e;--bs-table-active-color:#fff;--bs-table-hover-bg:#323539;--bs-table-hover-color:#fff;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-responsive{overflow-x:auto;-webkit-overflow-scrolling:touch}@media (max-width:575.98px){.table-responsive-sm{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:767.98px){.table-responsive-md{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:991.98px){.table-responsive-lg{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:1199.98px){.table-responsive-xl{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:1399.98px){.table-responsive-xxl{overflow-x:auto;-webkit-overflow-scrolling:touch}}.form-label{margin-bottom:.5rem}.col-form-label{padding-top:calc(.375rem + 1px);padding-bottom:calc(.375rem + 1px);margin-bottom:0;font-size:inherit;line-height:1.5}.col-form-label-lg{padding-top:calc(.5rem + 1px);padding-bottom:calc(.5rem + 1px);font-size:1.25rem}.col-form-label-sm{padding-top:calc(.25rem + 1px);padding-bottom:calc(.25rem + 1px);font-size:.875rem}.form-text{margin-top:.25rem;font-size:.875em;color:rgba(var(--bs-body-color-rgb),.75)}.form-control{display:block;width:100%;padding:.375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:#212529;background-color:#fff;background-clip:padding-box;border:1px solid #ced4da;-webkit-appearance:none;-moz-appearance:none;appearance:none;border-radius:.375rem;transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-control{transition:none}}.form-control[type=file]{overflow:hidden}.form-control[type=file]:not(:disabled):not([readonly]){cursor:pointer}.form-control:focus{color:#212529;background-color:#fff;border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-control::-webkit-date-and-time-value{height:1.5em}.form-control::-moz-placeholder{color:#6c757d;opacity:1}.form-control::placeholder{color:#6c757d;opacity:1}.form-control:disabled,.form-control[readonly]{background-color:#e9ecef;opacity:1}.form-control::-webkit-file-upload-button{padding:.375rem .75rem;margin:-.375rem -.75rem;-webkit-margin-end:.75rem;margin-inline-end:.75rem;color:#212529;background-color:#e9ecef;pointer-events:none;border-color:inherit;border-style:solid;border-width:0;border-inline-end-width:1px;border-radius:0;-webkit-transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}.form-control::file-selector-button{padding:.375rem .75rem;margin:-.375rem -.75rem;-webkit-margin-end:.75rem;margin-inline-end:.75rem;color:#212529;background-color:#e9ecef;pointer-events:none;border-color:inherit;border-style:solid;border-width:0;border-inline-end-width:1px;border-radius:0;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-control::-webkit-file-upload-button{-webkit-transition:none;transition:none}.form-control::file-selector-button{transition:none}}.form-control:hover:not(:disabled):not([readonly])::-webkit-file-upload-button{background-color:#dde0e3}.form-control:hover:not(:disabled):not([readonly])::file-selector-button{background-color:#dde0e3}.form-control-plaintext{display:block;width:100%;padding:.375rem 0;margin-bottom:0;line-height:1.5;color:#212529;background-color:transparent;border:solid transparent;border-width:1px 0}.form-control-plaintext.form-control-lg,.form-control-plaintext.form-control-sm{padding-right:0;padding-left:0}.form-control-sm{min-height:calc(1.5em + .5rem + 2px);padding:.25rem .5rem;font-size:.875rem;border-radius:.25rem}.form-control-sm::-webkit-file-upload-button{padding:.25rem .5rem;margin:-.25rem -.5rem;-webkit-margin-end:.5rem;margin-inline-end:.5rem}.form-control-sm::file-selector-button{padding:.25rem .5rem;margin:-.25rem -.5rem;-webkit-margin-end:.5rem;margin-inline-end:.5rem}.form-control-lg{min-height:calc(1.5em + 1rem + 2px);padding:.5rem 1rem;font-size:1.25rem;border-radius:.5rem}.form-control-lg::-webkit-file-upload-button{padding:.5rem 1rem;margin:-.5rem -1rem;-webkit-margin-end:1rem;margin-inline-end:1rem}.form-control-lg::file-selector-button{padding:.5rem 1rem;margin:-.5rem -1rem;-webkit-margin-end:1rem;margin-inline-end:1rem}textarea.form-control{min-height:calc(1.5em + .75rem + 2px)}textarea.form-control-sm{min-height:calc(1.5em + .5rem + 2px)}textarea.form-control-lg{min-height:calc(1.5em + 1rem + 2px)}.form-control-color{width:3rem;height:auto;padding:.375rem}.form-control-color:not(:disabled):not([readonly]){cursor:pointer}.form-control-color::-moz-color-swatch{height:1.5em;border-radius:.375rem}.form-control-color::-webkit-color-swatch{height:1.5em;border-radius:.375rem}.form-select{display:block;width:100%;padding:.375rem 2.25rem .375rem .75rem;-moz-padding-start:calc(0.75rem - 3px);font-size:1rem;font-weight:400;line-height:1.5;color:#212529;background-color:#fff;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:right .75rem center;background-size:16px 12px;border:1px solid #ced4da;border-radius:.375rem;transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out;-webkit-appearance:none;-moz-appearance:none;appearance:none}@media (prefers-reduced-motion:reduce){.form-select{transition:none}}.form-select:focus{border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-select[multiple],.form-select[size]:not([size="1"]){padding-right:.75rem;background-image:none}.form-select:disabled{background-color:#e9ecef}.form-select:-moz-focusring{color:transparent;text-shadow:0 0 0 #212529}.form-select-sm{padding-top:.25rem;padding-bottom:.25rem;padding-left:.5rem;font-size:.875rem;border-radius:.25rem}.form-select-lg{padding-top:.5rem;padding-bottom:.5rem;padding-left:1rem;font-size:1.25rem;border-radius:.5rem}.form-check{display:block;min-height:1.5rem;padding-left:1.5em;margin-bottom:.125rem}.form-check .form-check-input{float:left;margin-left:-1.5em}.form-check-reverse{padding-right:1.5em;padding-left:0;text-align:right}.form-check-reverse .form-check-input{float:right;margin-right:-1.5em;margin-left:0}.form-check-input{width:1em;height:1em;margin-top:.25em;vertical-align:top;background-color:#fff;background-repeat:no-repeat;background-position:center;background-size:contain;border:1px solid rgba(0,0,0,.25);-webkit-appearance:none;-moz-appearance:none;appearance:none;-webkit-print-color-adjust:exact;color-adjust:exact;print-color-adjust:exact}.form-check-input[type=checkbox]{border-radius:.25em}.form-check-input[type=radio]{border-radius:50%}.form-check-input:active{filter:brightness(90%)}.form-check-input:focus{border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-check-input:checked{background-color:#0d6efd;border-color:#0d6efd}.form-check-input:checked[type=checkbox]{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='m6 10 3 3 6-6'/%3e%3c/svg%3e")}.form-check-input:checked[type=radio]{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='2' fill='%23fff'/%3e%3c/svg%3e")}.form-check-input[type=checkbox]:indeterminate{background-color:#0d6efd;border-color:#0d6efd;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='M6 10h8'/%3e%3c/svg%3e")}.form-check-input:disabled{pointer-events:none;filter:none;opacity:.5}.form-check-input:disabled~.form-check-label,.form-check-input[disabled]~.form-check-label{cursor:default;opacity:.5}.form-switch{padding-left:2.5em}.form-switch .form-check-input{width:2em;margin-left:-2.5em;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='rgba%280, 0, 0, 0.25%29'/%3e%3c/svg%3e");background-position:left center;border-radius:2em;transition:background-position .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-switch .form-check-input{transition:none}}.form-switch .form-check-input:focus{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%2386b7fe'/%3e%3c/svg%3e")}.form-switch .form-check-input:checked{background-position:right center;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%23fff'/%3e%3c/svg%3e")}.form-switch.form-check-reverse{padding-right:2.5em;padding-left:0}.form-switch.form-check-reverse .form-check-input{margin-right:-2.5em;margin-left:0}.form-check-inline{display:inline-block;margin-right:1rem}.btn-check{position:absolute;clip:rect(0,0,0,0);pointer-events:none}.btn-check:disabled+.btn,.btn-check[disabled]+.btn{pointer-events:none;filter:none;opacity:.65}.form-range{width:100%;height:1.5rem;padding:0;background-color:transparent;-webkit-appearance:none;-moz-appearance:none;appearance:none}.form-range:focus{outline:0}.form-range:focus::-webkit-slider-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .25rem rgba(13,110,253,.25)}.form-range:focus::-moz-range-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .25rem rgba(13,110,253,.25)}.form-range::-moz-focus-outer{border:0}.form-range::-webkit-slider-thumb{width:1rem;height:1rem;margin-top:-.25rem;background-color:#0d6efd;border:0;border-radius:1rem;-webkit-transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;-webkit-appearance:none;appearance:none}@media (prefers-reduced-motion:reduce){.form-range::-webkit-slider-thumb{-webkit-transition:none;transition:none}}.form-range::-webkit-slider-thumb:active{background-color:#b6d4fe}.form-range::-webkit-slider-runnable-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:#dee2e6;border-color:transparent;border-radius:1rem}.form-range::-moz-range-thumb{width:1rem;height:1rem;background-color:#0d6efd;border:0;border-radius:1rem;-moz-transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;-moz-appearance:none;appearance:none}@media (prefers-reduced-motion:reduce){.form-range::-moz-range-thumb{-moz-transition:none;transition:none}}.form-range::-moz-range-thumb:active{background-color:#b6d4fe}.form-range::-moz-range-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:#dee2e6;border-color:transparent;border-radius:1rem}.form-range:disabled{pointer-events:none}.form-range:disabled::-webkit-slider-thumb{background-color:#adb5bd}.form-range:disabled::-moz-range-thumb{background-color:#adb5bd}.form-floating{position:relative}.form-floating>.form-control,.form-floating>.form-control-plaintext,.form-floating>.form-select{height:calc(3.5rem + 2px);line-height:1.25}.form-floating>label{position:absolute;top:0;left:0;height:100%;padding:1rem .75rem;pointer-events:none;border:1px solid transparent;transform-origin:0 0;transition:opacity .1s ease-in-out,transform .1s ease-in-out}@media (prefers-reduced-motion:reduce){.form-floating>label{transition:none}}.form-floating>.form-control,.form-floating>.form-control-plaintext{padding:1rem .75rem}.form-floating>.form-control-plaintext::-moz-placeholder,.form-floating>.form-control::-moz-placeholder{color:transparent}.form-floating>.form-control-plaintext::placeholder,.form-floating>.form-control::placeholder{color:transparent}.form-floating>.form-control-plaintext:not(:-moz-placeholder-shown),.form-floating>.form-control:not(:-moz-placeholder-shown){padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control-plaintext:focus,.form-floating>.form-control-plaintext:not(:placeholder-shown),.form-floating>.form-control:focus,.form-floating>.form-control:not(:placeholder-shown){padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control-plaintext:-webkit-autofill,.form-floating>.form-control:-webkit-autofill{padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-select{padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control:not(:-moz-placeholder-shown)~label{opacity:.65;transform:scale(.85) translateY(-.5rem) translateX(.15rem)}.form-floating>.form-control-plaintext~label,.form-floating>.form-control:focus~label,.form-floating>.form-control:not(:placeholder-shown)~label,.form-floating>.form-select~label{opacity:.65;transform:scale(.85) translateY(-.5rem) translateX(.15rem)}.form-floating>.form-control:-webkit-autofill~label{opacity:.65;transform:scale(.85) translateY(-.5rem) translateX(.15rem)}.form-floating>.form-control-plaintext~label{border-width:1px 0}.input-group{position:relative;display:flex;flex-wrap:wrap;align-items:stretch;width:100%}.input-group>.form-control,.input-group>.form-select{position:relative;flex:1 1 auto;width:1%;min-width:0}.input-group>.form-control:focus,.input-group>.form-select:focus{z-index:3}.input-group .btn{position:relative;z-index:2}.input-group .btn:focus{z-index:3}.input-group-text{display:flex;align-items:center;padding:.375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:#212529;text-align:center;white-space:nowrap;background-color:#e9ecef;border:1px solid #ced4da;border-radius:.375rem}.input-group-lg>.btn,.input-group-lg>.form-control,.input-group-lg>.form-select,.input-group-lg>.input-group-text{padding:.5rem 1rem;font-size:1.25rem;border-radius:.5rem}.input-group-sm>.btn,.input-group-sm>.form-control,.input-group-sm>.form-select,.input-group-sm>.input-group-text{padding:.25rem .5rem;font-size:.875rem;border-radius:.25rem}.input-group-lg>.form-select,.input-group-sm>.form-select{padding-right:3rem}.input-group:not(.has-validation)>.dropdown-toggle:nth-last-child(n+3),.input-group:not(.has-validation)>:not(:last-child):not(.dropdown-toggle):not(.dropdown-menu){border-top-right-radius:0;border-bottom-right-radius:0}.input-group.has-validation>.dropdown-toggle:nth-last-child(n+4),.input-group.has-validation>:nth-last-child(n+3):not(.dropdown-toggle):not(.dropdown-menu){border-top-right-radius:0;border-bottom-right-radius:0}.input-group>:not(:first-child):not(.dropdown-menu):not(.valid-tooltip):not(.valid-feedback):not(.invalid-tooltip):not(.invalid-feedback){margin-left:-1px;border-top-left-radius:0;border-bottom-left-radius:0}.valid-feedback{display:none;width:100%;margin-top:.25rem;font-size:.875em;color:#198754}.valid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:.875rem;color:#fff;background-color:rgba(25,135,84,.9);border-radius:.375rem}.is-valid~.valid-feedback,.is-valid~.valid-tooltip,.was-validated :valid~.valid-feedback,.was-validated :valid~.valid-tooltip{display:block}.form-control.is-valid,.was-validated .form-control:valid{border-color:#198754;padding-right:calc(1.5em + .75rem);background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:right calc(.375em + .1875rem) center;background-size:calc(.75em + .375rem) calc(.75em + .375rem)}.form-control.is-valid:focus,.was-validated .form-control:valid:focus{border-color:#198754;box-shadow:0 0 0 .25rem rgba(25,135,84,.25)}.was-validated textarea.form-control:valid,textarea.form-control.is-valid{padding-right:calc(1.5em + .75rem);background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem)}.form-select.is-valid,.was-validated .form-select:valid{border-color:#198754}.form-select.is-valid:not([multiple]):not([size]),.form-select.is-valid:not([multiple])[size="1"],.was-validated .form-select:valid:not([multiple]):not([size]),.was-validated .form-select:valid:not([multiple])[size="1"]{padding-right:4.125rem;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e"),url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");background-position:right .75rem center,center right 2.25rem;background-size:16px 12px,calc(.75em + .375rem) calc(.75em + .375rem)}.form-select.is-valid:focus,.was-validated .form-select:valid:focus{border-color:#198754;box-shadow:0 0 0 .25rem rgba(25,135,84,.25)}.form-control-color.is-valid,.was-validated .form-control-color:valid{width:calc(3rem + calc(1.5em + .75rem))}.form-check-input.is-valid,.was-validated .form-check-input:valid{border-color:#198754}.form-check-input.is-valid:checked,.was-validated .form-check-input:valid:checked{background-color:#198754}.form-check-input.is-valid:focus,.was-validated .form-check-input:valid:focus{box-shadow:0 0 0 .25rem rgba(25,135,84,.25)}.form-check-input.is-valid~.form-check-label,.was-validated .form-check-input:valid~.form-check-label{color:#198754}.form-check-inline .form-check-input~.valid-feedback{margin-left:.5em}.input-group .form-control.is-valid,.input-group .form-select.is-valid,.was-validated .input-group .form-control:valid,.was-validated .input-group .form-select:valid{z-index:1}.input-group .form-control.is-valid:focus,.input-group .form-select.is-valid:focus,.was-validated .input-group .form-control:valid:focus,.was-validated .input-group .form-select:valid:focus{z-index:3}.invalid-feedback{display:none;width:100%;margin-top:.25rem;font-size:.875em;color:#dc3545}.invalid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:.875rem;color:#fff;background-color:rgba(220,53,69,.9);border-radius:.375rem}.is-invalid~.invalid-feedback,.is-invalid~.invalid-tooltip,.was-validated :invalid~.invalid-feedback,.was-validated :invalid~.invalid-tooltip{display:block}.form-control.is-invalid,.was-validated .form-control:invalid{border-color:#dc3545;padding-right:calc(1.5em + .75rem);background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:right calc(.375em + .1875rem) center;background-size:calc(.75em + .375rem) calc(.75em + .375rem)}.form-control.is-invalid:focus,.was-validated .form-control:invalid:focus{border-color:#dc3545;box-shadow:0 0 0 .25rem rgba(220,53,69,.25)}.was-validated textarea.form-control:invalid,textarea.form-control.is-invalid{padding-right:calc(1.5em + .75rem);background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem)}.form-select.is-invalid,.was-validated .form-select:invalid{border-color:#dc3545}.form-select.is-invalid:not([multiple]):not([size]),.form-select.is-invalid:not([multiple])[size="1"],.was-validated .form-select:invalid:not([multiple]):not([size]),.was-validated .form-select:invalid:not([multiple])[size="1"]{padding-right:4.125rem;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e"),url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e");background-position:right .75rem center,center right 2.25rem;background-size:16px 12px,calc(.75em + .375rem) calc(.75em + .375rem)}.form-select.is-invalid:focus,.was-validated .form-select:invalid:focus{border-color:#dc3545;box-shadow:0 0 0 .25rem rgba(220,53,69,.25)}.form-control-color.is-invalid,.was-validated .form-control-color:invalid{width:calc(3rem + calc(1.5em + .75rem))}.form-check-input.is-invalid,.was-validated .form-check-input:invalid{border-color:#dc3545}.form-check-input.is-invalid:checked,.was-validated .form-check-input:invalid:checked{background-color:#dc3545}.form-check-input.is-invalid:focus,.was-validated .form-check-input:invalid:focus{box-shadow:0 0 0 .25rem rgba(220,53,69,.25)}.form-check-input.is-invalid~.form-check-label,.was-validated .form-check-input:invalid~.form-check-label{color:#dc3545}.form-check-inline .form-check-input~.invalid-feedback{margin-left:.5em}.input-group .form-control.is-invalid,.input-group .form-select.is-invalid,.was-validated .input-group .form-control:invalid,.was-validated .input-group .form-select:invalid{z-index:2}.input-group .form-control.is-invalid:focus,.input-group .form-select.is-invalid:focus,.was-validated .input-group .form-control:invalid:focus,.was-validated .input-group .form-select:invalid:focus{z-index:3}.btn{--bs-btn-padding-x:0.75rem;--bs-btn-padding-y:0.375rem;--bs-btn-font-family: ;--bs-btn-font-size:1rem;--bs-btn-font-weight:400;--bs-btn-line-height:1.5;--bs-btn-color:#212529;--bs-btn-bg:transparent;--bs-btn-border-width:1px;--bs-btn-border-color:transparent;--bs-btn-border-radius:0.375rem;--bs-btn-box-shadow:inset 0 1px 0 rgba(255, 255, 255, 0.15),0 1px 1px rgba(0, 0, 0, 0.075);--bs-btn-disabled-opacity:0.65;--bs-btn-focus-box-shadow:0 0 0 0.25rem rgba(var(--bs-btn-focus-shadow-rgb), .5);display:inline-block;padding:var(--bs-btn-padding-y) var(--bs-btn-padding-x);font-family:var(--bs-btn-font-family);font-size:var(--bs-btn-font-size);font-weight:var(--bs-btn-font-weight);line-height:var(--bs-btn-line-height);color:var(--bs-btn-color);text-align:center;text-decoration:none;vertical-align:middle;cursor:pointer;-webkit-user-select:none;-moz-user-select:none;user-select:none;border:var(--bs-btn-border-width) solid var(--bs-btn-border-color);border-radius:var(--bs-btn-border-radius);background-color:var(--bs-btn-bg);transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.btn{transition:none}}.btn:hover{color:var(--bs-btn-hover-color);background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color)}.btn-check:focus+.btn,.btn:focus{color:var(--bs-btn-hover-color);background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color);outline:0;box-shadow:var(--bs-btn-focus-box-shadow)}.btn-check:active+.btn,.btn-check:checked+.btn,.btn.active,.btn.show,.btn:active{color:var(--bs-btn-active-color);background-color:var(--bs-btn-active-bg);border-color:var(--bs-btn-active-border-color)}.btn-check:active+.btn:focus,.btn-check:checked+.btn:focus,.btn.active:focus,.btn.show:focus,.btn:active:focus{box-shadow:var(--bs-btn-focus-box-shadow)}.btn.disabled,.btn:disabled,fieldset:disabled .btn{color:var(--bs-btn-disabled-color);pointer-events:none;background-color:var(--bs-btn-disabled-bg);border-color:var(--bs-btn-disabled-border-color);opacity:var(--bs-btn-disabled-opacity)}.btn-primary{--bs-btn-color:#fff;--bs-btn-bg:#0d6efd;--bs-btn-border-color:#0d6efd;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#0b5ed7;--bs-btn-hover-border-color:#0a58ca;--bs-btn-focus-shadow-rgb:49,132,253;--bs-btn-active-color:#fff;--bs-btn-active-bg:#0a58ca;--bs-btn-active-border-color:#0a53be;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#0d6efd;--bs-btn-disabled-border-color:#0d6efd}.btn-secondary{--bs-btn-color:#fff;--bs-btn-bg:#6c757d;--bs-btn-border-color:#6c757d;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#5c636a;--bs-btn-hover-border-color:#565e64;--bs-btn-focus-shadow-rgb:130,138,145;--bs-btn-active-color:#fff;--bs-btn-active-bg:#565e64;--bs-btn-active-border-color:#51585e;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#6c757d;--bs-btn-disabled-border-color:#6c757d}.btn-success{--bs-btn-color:#fff;--bs-btn-bg:#198754;--bs-btn-border-color:#198754;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#157347;--bs-btn-hover-border-color:#146c43;--bs-btn-focus-shadow-rgb:60,153,110;--bs-btn-active-color:#fff;--bs-btn-active-bg:#146c43;--bs-btn-active-border-color:#13653f;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#198754;--bs-btn-disabled-border-color:#198754}.btn-info{--bs-btn-color:#000;--bs-btn-bg:#0dcaf0;--bs-btn-border-color:#0dcaf0;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#31d2f2;--bs-btn-hover-border-color:#25cff2;--bs-btn-focus-shadow-rgb:11,172,204;--bs-btn-active-color:#000;--bs-btn-active-bg:#3dd5f3;--bs-btn-active-border-color:#25cff2;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#000;--bs-btn-disabled-bg:#0dcaf0;--bs-btn-disabled-border-color:#0dcaf0}.btn-warning{--bs-btn-color:#000;--bs-btn-bg:#ffc107;--bs-btn-border-color:#ffc107;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#ffca2c;--bs-btn-hover-border-color:#ffc720;--bs-btn-focus-shadow-rgb:217,164,6;--bs-btn-active-color:#000;--bs-btn-active-bg:#ffcd39;--bs-btn-active-border-color:#ffc720;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#000;--bs-btn-disabled-bg:#ffc107;--bs-btn-disabled-border-color:#ffc107}.btn-danger{--bs-btn-color:#fff;--bs-btn-bg:#dc3545;--bs-btn-border-color:#dc3545;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#bb2d3b;--bs-btn-hover-border-color:#b02a37;--bs-btn-focus-shadow-rgb:225,83,97;--bs-btn-active-color:#fff;--bs-btn-active-bg:#b02a37;--bs-btn-active-border-color:#a52834;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#dc3545;--bs-btn-disabled-border-color:#dc3545}.btn-light{--bs-btn-color:#000;--bs-btn-bg:#f8f9fa;--bs-btn-border-color:#f8f9fa;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#f9fafb;--bs-btn-hover-border-color:#f9fafb;--bs-btn-focus-shadow-rgb:211,212,213;--bs-btn-active-color:#000;--bs-btn-active-bg:#f9fafb;--bs-btn-active-border-color:#f9fafb;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#000;--bs-btn-disabled-bg:#f8f9fa;--bs-btn-disabled-border-color:#f8f9fa}.btn-dark{--bs-btn-color:#fff;--bs-btn-bg:#212529;--bs-btn-border-color:#212529;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#1c1f23;--bs-btn-hover-border-color:#1a1e21;--bs-btn-focus-shadow-rgb:66,70,73;--bs-btn-active-color:#fff;--bs-btn-active-bg:#1a1e21;--bs-btn-active-border-color:#191c1f;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#212529;--bs-btn-disabled-border-color:#212529}.btn-outline-primary{--bs-btn-color:#0d6efd;--bs-btn-border-color:#0d6efd;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#0d6efd;--bs-btn-hover-border-color:#0d6efd;--bs-btn-focus-shadow-rgb:13,110,253;--bs-btn-active-color:#fff;--bs-btn-active-bg:#0d6efd;--bs-btn-active-border-color:#0d6efd;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#0d6efd;--bs-btn-disabled-bg:transparent;--bs-gradient:none}.btn-outline-secondary{--bs-btn-color:#6c757d;--bs-btn-border-color:#6c757d;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#6c757d;--bs-btn-hover-border-color:#6c757d;--bs-btn-focus-shadow-rgb:108,117,125;--bs-btn-active-color:#fff;--bs-btn-active-bg:#6c757d;--bs-btn-active-border-color:#6c757d;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#6c757d;--bs-btn-disabled-bg:transparent;--bs-gradient:none}.btn-outline-success{--bs-btn-color:#198754;--bs-btn-border-color:#198754;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#198754;--bs-btn-hover-border-color:#198754;--bs-btn-focus-shadow-rgb:25,135,84;--bs-btn-active-color:#fff;--bs-btn-active-bg:#198754;--bs-btn-active-border-color:#198754;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#198754;--bs-btn-disabled-bg:transparent;--bs-gradient:none}.btn-outline-info{--bs-btn-color:#0dcaf0;--bs-btn-border-color:#0dcaf0;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#0dcaf0;--bs-btn-hover-border-color:#0dcaf0;--bs-btn-focus-shadow-rgb:13,202,240;--bs-btn-active-color:#000;--bs-btn-active-bg:#0dcaf0;--bs-btn-active-border-color:#0dcaf0;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#0dcaf0;--bs-btn-disabled-bg:transparent;--bs-gradient:none}.btn-outline-warning{--bs-btn-color:#ffc107;--bs-btn-border-color:#ffc107;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#ffc107;--bs-btn-hover-border-color:#ffc107;--bs-btn-focus-shadow-rgb:255,193,7;--bs-btn-active-color:#000;--bs-btn-active-bg:#ffc107;--bs-btn-active-border-color:#ffc107;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#ffc107;--bs-btn-disabled-bg:transparent;--bs-gradient:none}.btn-outline-danger{--bs-btn-color:#dc3545;--bs-btn-border-color:#dc3545;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#dc3545;--bs-btn-hover-border-color:#dc3545;--bs-btn-focus-shadow-rgb:220,53,69;--bs-btn-active-color:#fff;--bs-btn-active-bg:#dc3545;--bs-btn-active-border-color:#dc3545;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#dc3545;--bs-btn-disabled-bg:transparent;--bs-gradient:none}.btn-outline-light{--bs-btn-color:#f8f9fa;--bs-btn-border-color:#f8f9fa;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#f8f9fa;--bs-btn-hover-border-color:#f8f9fa;--bs-btn-focus-shadow-rgb:248,249,250;--bs-btn-active-color:#000;--bs-btn-active-bg:#f8f9fa;--bs-btn-active-border-color:#f8f9fa;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#f8f9fa;--bs-btn-disabled-bg:transparent;--bs-gradient:none}.btn-outline-dark{--bs-btn-color:#212529;--bs-btn-border-color:#212529;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#212529;--bs-btn-hover-border-color:#212529;--bs-btn-focus-shadow-rgb:33,37,41;--bs-btn-active-color:#fff;--bs-btn-active-bg:#212529;--bs-btn-active-border-color:#212529;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#212529;--bs-btn-disabled-bg:transparent;--bs-gradient:none}.btn-link{--bs-btn-font-weight:400;--bs-btn-color:var(--bs-link-color);--bs-btn-bg:transparent;--bs-btn-border-color:transparent;--bs-btn-hover-color:var(--bs-link-hover-color);--bs-btn-hover-border-color:transparent;--bs-btn-active-border-color:transparent;--bs-btn-disabled-color:#6c757d;--bs-btn-disabled-border-color:transparent;--bs-btn-box-shadow:none;text-decoration:underline}.btn-group-lg>.btn,.btn-lg{--bs-btn-padding-y:0.5rem;--bs-btn-padding-x:1rem;--bs-btn-font-size:1.25rem;--bs-btn-border-radius:0.5rem}.btn-group-sm>.btn,.btn-sm{--bs-btn-padding-y:0.25rem;--bs-btn-padding-x:0.5rem;--bs-btn-font-size:0.875rem;--bs-btn-border-radius:0.25rem}.fade{transition:opacity .15s linear}@media (prefers-reduced-motion:reduce){.fade{transition:none}}.fade:not(.show){opacity:0}.collapse:not(.show){display:none}.collapsing{height:0;overflow:hidden;transition:height .35s ease}@media (prefers-reduced-motion:reduce){.collapsing{transition:none}}.collapsing.collapse-horizontal{width:0;height:auto;transition:width .35s ease}@media (prefers-reduced-motion:reduce){.collapsing.collapse-horizontal{transition:none}}.dropdown,.dropdown-center,.dropend,.dropstart,.dropup,.dropup-center{position:relative}.dropdown-toggle{white-space:nowrap}.dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid;border-right:.3em solid transparent;border-bottom:0;border-left:.3em solid transparent}.dropdown-toggle:empty::after{margin-left:0}.dropdown-menu{--bs-dropdown-min-width:10rem;--bs-dropdown-padding-x:0;--bs-dropdown-padding-y:0.5rem;--bs-dropdown-spacer:0.125rem;--bs-dropdown-font-size:1rem;--bs-dropdown-color:#212529;--bs-dropdown-bg:#fff;--bs-dropdown-border-color:var(--bs-border-color-translucent);--bs-dropdown-border-radius:0.375rem;--bs-dropdown-border-width:1px;--bs-dropdown-inner-border-radius:calc(0.375rem - 1px);--bs-dropdown-divider-bg:var(--bs-border-color-translucent);--bs-dropdown-divider-margin-y:0.5rem;--bs-dropdown-box-shadow:0 0.5rem 1rem rgba(0, 0, 0, 0.15);--bs-dropdown-link-color:#212529;--bs-dropdown-link-hover-color:#1e2125;--bs-dropdown-link-hover-bg:#e9ecef;--bs-dropdown-link-active-color:#fff;--bs-dropdown-link-active-bg:#0d6efd;--bs-dropdown-link-disabled-color:#adb5bd;--bs-dropdown-item-padding-x:1rem;--bs-dropdown-item-padding-y:0.25rem;--bs-dropdown-header-color:#6c757d;--bs-dropdown-header-padding-x:1rem;--bs-dropdown-header-padding-y:0.5rem;position:absolute;z-index:1000;display:none;min-width:var(--bs-dropdown-min-width);padding:var(--bs-dropdown-padding-y) var(--bs-dropdown-padding-x);margin:0;font-size:var(--bs-dropdown-font-size);color:var(--bs-dropdown-color);text-align:left;list-style:none;background-color:var(--bs-dropdown-bg);background-clip:padding-box;border:var(--bs-dropdown-border-width) solid var(--bs-dropdown-border-color);border-radius:var(--bs-dropdown-border-radius)}.dropdown-menu[data-bs-popper]{top:100%;left:0;margin-top:var(--bs-dropdown-spacer)}.dropdown-menu-start{--bs-position:start}.dropdown-menu-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-end{--bs-position:end}.dropdown-menu-end[data-bs-popper]{right:0;left:auto}@media (min-width:576px){.dropdown-menu-sm-start{--bs-position:start}.dropdown-menu-sm-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-sm-end{--bs-position:end}.dropdown-menu-sm-end[data-bs-popper]{right:0;left:auto}}@media (min-width:768px){.dropdown-menu-md-start{--bs-position:start}.dropdown-menu-md-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-md-end{--bs-position:end}.dropdown-menu-md-end[data-bs-popper]{right:0;left:auto}}@media (min-width:992px){.dropdown-menu-lg-start{--bs-position:start}.dropdown-menu-lg-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-lg-end{--bs-position:end}.dropdown-menu-lg-end[data-bs-popper]{right:0;left:auto}}@media (min-width:1200px){.dropdown-menu-xl-start{--bs-position:start}.dropdown-menu-xl-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-xl-end{--bs-position:end}.dropdown-menu-xl-end[data-bs-popper]{right:0;left:auto}}@media (min-width:1400px){.dropdown-menu-xxl-start{--bs-position:start}.dropdown-menu-xxl-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-xxl-end{--bs-position:end}.dropdown-menu-xxl-end[data-bs-popper]{right:0;left:auto}}.dropup .dropdown-menu[data-bs-popper]{top:auto;bottom:100%;margin-top:0;margin-bottom:var(--bs-dropdown-spacer)}.dropup .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:0;border-right:.3em solid transparent;border-bottom:.3em solid;border-left:.3em solid transparent}.dropup .dropdown-toggle:empty::after{margin-left:0}.dropend .dropdown-menu[data-bs-popper]{top:0;right:auto;left:100%;margin-top:0;margin-left:var(--bs-dropdown-spacer)}.dropend .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:0;border-bottom:.3em solid transparent;border-left:.3em solid}.dropend .dropdown-toggle:empty::after{margin-left:0}.dropend .dropdown-toggle::after{vertical-align:0}.dropstart .dropdown-menu[data-bs-popper]{top:0;right:100%;left:auto;margin-top:0;margin-right:var(--bs-dropdown-spacer)}.dropstart .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:""}.dropstart .dropdown-toggle::after{display:none}.dropstart .dropdown-toggle::before{display:inline-block;margin-right:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:.3em solid;border-bottom:.3em solid transparent}.dropstart .dropdown-toggle:empty::after{margin-left:0}.dropstart .dropdown-toggle::before{vertical-align:0}.dropdown-divider{height:0;margin:var(--bs-dropdown-divider-margin-y) 0;overflow:hidden;border-top:1px solid var(--bs-dropdown-divider-bg);opacity:1}.dropdown-item{display:block;width:100%;padding:var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);clear:both;font-weight:400;color:var(--bs-dropdown-link-color);text-align:inherit;text-decoration:none;white-space:nowrap;background-color:transparent;border:0}.dropdown-item:focus,.dropdown-item:hover{color:var(--bs-dropdown-link-hover-color);background-color:var(--bs-dropdown-link-hover-bg)}.dropdown-item.active,.dropdown-item:active{color:var(--bs-dropdown-link-active-color);text-decoration:none;background-color:var(--bs-dropdown-link-active-bg)}.dropdown-item.disabled,.dropdown-item:disabled{color:var(--bs-dropdown-link-disabled-color);pointer-events:none;background-color:transparent}.dropdown-menu.show{display:block}.dropdown-header{display:block;padding:var(--bs-dropdown-header-padding-y) var(--bs-dropdown-header-padding-x);margin-bottom:0;font-size:.875rem;color:var(--bs-dropdown-header-color);white-space:nowrap}.dropdown-item-text{display:block;padding:var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);color:var(--bs-dropdown-link-color)}.dropdown-menu-dark{--bs-dropdown-color:#dee2e6;--bs-dropdown-bg:#343a40;--bs-dropdown-border-color:var(--bs-border-color-translucent);--bs-dropdown-box-shadow: ;--bs-dropdown-link-color:#dee2e6;--bs-dropdown-link-hover-color:#fff;--bs-dropdown-divider-bg:var(--bs-border-color-translucent);--bs-dropdown-link-hover-bg:rgba(255, 255, 255, 0.15);--bs-dropdown-link-active-color:#fff;--bs-dropdown-link-active-bg:#0d6efd;--bs-dropdown-link-disabled-color:#adb5bd;--bs-dropdown-header-color:#adb5bd}.btn-group,.btn-group-vertical{position:relative;display:inline-flex;vertical-align:middle}.btn-group-vertical>.btn,.btn-group>.btn{position:relative;flex:1 1 auto}.btn-group-vertical>.btn-check:checked+.btn,.btn-group-vertical>.btn-check:focus+.btn,.btn-group-vertical>.btn.active,.btn-group-vertical>.btn:active,.btn-group-vertical>.btn:focus,.btn-group-vertical>.btn:hover,.btn-group>.btn-check:checked+.btn,.btn-group>.btn-check:focus+.btn,.btn-group>.btn.active,.btn-group>.btn:active,.btn-group>.btn:focus,.btn-group>.btn:hover{z-index:1}.btn-toolbar{display:flex;flex-wrap:wrap;justify-content:flex-start}.btn-toolbar .input-group{width:auto}.btn-group{border-radius:.375rem}.btn-group>.btn-group:not(:first-child),.btn-group>.btn:not(:first-child){margin-left:-1px}.btn-group>.btn-group:not(:last-child)>.btn,.btn-group>.btn.dropdown-toggle-split:first-child,.btn-group>.btn:not(:last-child):not(.dropdown-toggle){border-top-right-radius:0;border-bottom-right-radius:0}.btn-group>.btn-group:not(:first-child)>.btn,.btn-group>.btn:nth-child(n+3),.btn-group>:not(.btn-check)+.btn{border-top-left-radius:0;border-bottom-left-radius:0}.dropdown-toggle-split{padding-right:.5625rem;padding-left:.5625rem}.dropdown-toggle-split::after,.dropend .dropdown-toggle-split::after,.dropup .dropdown-toggle-split::after{margin-left:0}.dropstart .dropdown-toggle-split::before{margin-right:0}.btn-group-sm>.btn+.dropdown-toggle-split,.btn-sm+.dropdown-toggle-split{padding-right:.375rem;padding-left:.375rem}.btn-group-lg>.btn+.dropdown-toggle-split,.btn-lg+.dropdown-toggle-split{padding-right:.75rem;padding-left:.75rem}.btn-group-vertical{flex-direction:column;align-items:flex-start;justify-content:center}.btn-group-vertical>.btn,.btn-group-vertical>.btn-group{width:100%}.btn-group-vertical>.btn-group:not(:first-child),.btn-group-vertical>.btn:not(:first-child){margin-top:-1px}.btn-group-vertical>.btn-group:not(:last-child)>.btn,.btn-group-vertical>.btn:not(:last-child):not(.dropdown-toggle){border-bottom-right-radius:0;border-bottom-left-radius:0}.btn-group-vertical>.btn-group:not(:first-child)>.btn,.btn-group-vertical>.btn~.btn{border-top-left-radius:0;border-top-right-radius:0}.nav{--bs-nav-link-padding-x:1rem;--bs-nav-link-padding-y:0.5rem;--bs-nav-link-font-weight: ;--bs-nav-link-color:var(--bs-link-color);--bs-nav-link-hover-color:var(--bs-link-hover-color);--bs-nav-link-disabled-color:#6c757d;display:flex;flex-wrap:wrap;padding-left:0;margin-bottom:0;list-style:none}.nav-link{display:block;padding:var(--bs-nav-link-padding-y) var(--bs-nav-link-padding-x);font-size:var(--bs-nav-link-font-size);font-weight:var(--bs-nav-link-font-weight);color:var(--bs-nav-link-color);text-decoration:none;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out}@media (prefers-reduced-motion:reduce){.nav-link{transition:none}}.nav-link:focus,.nav-link:hover{color:var(--bs-nav-link-hover-color)}.nav-link.disabled{color:var(--bs-nav-link-disabled-color);pointer-events:none;cursor:default}.nav-tabs{--bs-nav-tabs-border-width:1px;--bs-nav-tabs-border-color:#dee2e6;--bs-nav-tabs-border-radius:0.375rem;--bs-nav-tabs-link-hover-border-color:#e9ecef #e9ecef #dee2e6;--bs-nav-tabs-link-active-color:#495057;--bs-nav-tabs-link-active-bg:#fff;--bs-nav-tabs-link-active-border-color:#dee2e6 #dee2e6 #fff;border-bottom:var(--bs-nav-tabs-border-width) solid var(--bs-nav-tabs-border-color)}.nav-tabs .nav-link{margin-bottom:calc(var(--bs-nav-tabs-border-width) * -1);background:0 0;border:var(--bs-nav-tabs-border-width) solid transparent;border-top-left-radius:var(--bs-nav-tabs-border-radius);border-top-right-radius:var(--bs-nav-tabs-border-radius)}.nav-tabs .nav-link:focus,.nav-tabs .nav-link:hover{isolation:isolate;border-color:var(--bs-nav-tabs-link-hover-border-color)}.nav-tabs .nav-link.disabled,.nav-tabs .nav-link:disabled{color:var(--bs-nav-link-disabled-color);background-color:transparent;border-color:transparent}.nav-tabs .nav-item.show .nav-link,.nav-tabs .nav-link.active{color:var(--bs-nav-tabs-link-active-color);background-color:var(--bs-nav-tabs-link-active-bg);border-color:var(--bs-nav-tabs-link-active-border-color)}.nav-tabs .dropdown-menu{margin-top:calc(var(--bs-nav-tabs-border-width) * -1);border-top-left-radius:0;border-top-right-radius:0}.nav-pills{--bs-nav-pills-border-radius:0.375rem;--bs-nav-pills-link-active-color:#fff;--bs-nav-pills-link-active-bg:#0d6efd}.nav-pills .nav-link{background:0 0;border:0;border-radius:var(--bs-nav-pills-border-radius)}.nav-pills .nav-link:disabled{color:var(--bs-nav-link-disabled-color);background-color:transparent;border-color:transparent}.nav-pills .nav-link.active,.nav-pills .show>.nav-link{color:var(--bs-nav-pills-link-active-color);background-color:var(--bs-nav-pills-link-active-bg)}.nav-fill .nav-item,.nav-fill>.nav-link{flex:1 1 auto;text-align:center}.nav-justified .nav-item,.nav-justified>.nav-link{flex-basis:0;flex-grow:1;text-align:center}.nav-fill .nav-item .nav-link,.nav-justified .nav-item .nav-link{width:100%}.tab-content>.tab-pane{display:none}.tab-content>.active{display:block}.navbar{--bs-navbar-padding-x:0;--bs-navbar-padding-y:0.5rem;--bs-navbar-color:rgba(0, 0, 0, 0.55);--bs-navbar-hover-color:rgba(0, 0, 0, 0.7);--bs-navbar-disabled-color:rgba(0, 0, 0, 0.3);--bs-navbar-active-color:rgba(0, 0, 0, 0.9);--bs-navbar-brand-padding-y:0.3125rem;--bs-navbar-brand-margin-end:1rem;--bs-navbar-brand-font-size:1.25rem;--bs-navbar-brand-color:rgba(0, 0, 0, 0.9);--bs-navbar-brand-hover-color:rgba(0, 0, 0, 0.9);--bs-navbar-nav-link-padding-x:0.5rem;--bs-navbar-toggler-padding-y:0.25rem;--bs-navbar-toggler-padding-x:0.75rem;--bs-navbar-toggler-font-size:1.25rem;--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%280, 0, 0, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e");--bs-navbar-toggler-border-color:rgba(0, 0, 0, 0.1);--bs-navbar-toggler-border-radius:0.375rem;--bs-navbar-toggler-focus-width:0.25rem;--bs-navbar-toggler-transition:box-shadow 0.15s ease-in-out;position:relative;display:flex;flex-wrap:wrap;align-items:center;justify-content:space-between;padding:var(--bs-navbar-padding-y) var(--bs-navbar-padding-x)}.navbar>.container,.navbar>.container-fluid,.navbar>.container-lg,.navbar>.container-md,.navbar>.container-sm,.navbar>.container-xl,.navbar>.container-xxl{display:flex;flex-wrap:inherit;align-items:center;justify-content:space-between}.navbar-brand{padding-top:var(--bs-navbar-brand-padding-y);padding-bottom:var(--bs-navbar-brand-padding-y);margin-right:var(--bs-navbar-brand-margin-end);font-size:var(--bs-navbar-brand-font-size);color:var(--bs-navbar-brand-color);text-decoration:none;white-space:nowrap}.navbar-brand:focus,.navbar-brand:hover{color:var(--bs-navbar-brand-hover-color)}.navbar-nav{--bs-nav-link-padding-x:0;--bs-nav-link-padding-y:0.5rem;--bs-nav-link-color:var(--bs-navbar-color);--bs-nav-link-hover-color:var(--bs-navbar-hover-color);--bs-nav-link-disabled-color:var(--bs-navbar-disabled-color);display:flex;flex-direction:column;padding-left:0;margin-bottom:0;list-style:none}.navbar-nav .nav-link.active,.navbar-nav .show>.nav-link{color:var(--bs-navbar-active-color)}.navbar-nav .dropdown-menu{position:static}.navbar-text{padding-top:.5rem;padding-bottom:.5rem;color:var(--bs-navbar-color)}.navbar-text a,.navbar-text a:focus,.navbar-text a:hover{color:var(--bs-navbar-active-color)}.navbar-collapse{flex-basis:100%;flex-grow:1;align-items:center}.navbar-toggler{padding:var(--bs-navbar-toggler-padding-y) var(--bs-navbar-toggler-padding-x);font-size:var(--bs-navbar-toggler-font-size);line-height:1;color:var(--bs-navbar-color);background-color:transparent;border:var(--bs-border-width) solid var(--bs-navbar-toggler-border-color);border-radius:var(--bs-navbar-toggler-border-radius);transition:var(--bs-navbar-toggler-transition)}@media (prefers-reduced-motion:reduce){.navbar-toggler{transition:none}}.navbar-toggler:hover{text-decoration:none}.navbar-toggler:focus{text-decoration:none;outline:0;box-shadow:0 0 0 var(--bs-navbar-toggler-focus-width)}.navbar-toggler-icon{display:inline-block;width:1.5em;height:1.5em;vertical-align:middle;background-image:var(--bs-navbar-toggler-icon-bg);background-repeat:no-repeat;background-position:center;background-size:100%}.navbar-nav-scroll{max-height:var(--bs-scroll-height,75vh);overflow-y:auto}@media (min-width:576px){.navbar-expand-sm{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-sm .navbar-nav{flex-direction:row}.navbar-expand-sm .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-sm .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-sm .navbar-nav-scroll{overflow:visible}.navbar-expand-sm .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-sm .navbar-toggler{display:none}.navbar-expand-sm .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-sm .offcanvas .offcanvas-header{display:none}.navbar-expand-sm .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:768px){.navbar-expand-md{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-md .navbar-nav{flex-direction:row}.navbar-expand-md .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-md .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-md .navbar-nav-scroll{overflow:visible}.navbar-expand-md .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-md .navbar-toggler{display:none}.navbar-expand-md .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-md .offcanvas .offcanvas-header{display:none}.navbar-expand-md .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:992px){.navbar-expand-lg{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-lg .navbar-nav{flex-direction:row}.navbar-expand-lg .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-lg .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-lg .navbar-nav-scroll{overflow:visible}.navbar-expand-lg .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-lg .navbar-toggler{display:none}.navbar-expand-lg .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-lg .offcanvas .offcanvas-header{display:none}.navbar-expand-lg .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:1200px){.navbar-expand-xl{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-xl .navbar-nav{flex-direction:row}.navbar-expand-xl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xl .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-xl .navbar-nav-scroll{overflow:visible}.navbar-expand-xl .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-xl .navbar-toggler{display:none}.navbar-expand-xl .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-xl .offcanvas .offcanvas-header{display:none}.navbar-expand-xl .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:1400px){.navbar-expand-xxl{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-xxl .navbar-nav{flex-direction:row}.navbar-expand-xxl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xxl .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-xxl .navbar-nav-scroll{overflow:visible}.navbar-expand-xxl .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-xxl .navbar-toggler{display:none}.navbar-expand-xxl .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-xxl .offcanvas .offcanvas-header{display:none}.navbar-expand-xxl .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}.navbar-expand{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand .navbar-nav{flex-direction:row}.navbar-expand .navbar-nav .dropdown-menu{position:absolute}.navbar-expand .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand .navbar-nav-scroll{overflow:visible}.navbar-expand .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand .navbar-toggler{display:none}.navbar-expand .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand .offcanvas .offcanvas-header{display:none}.navbar-expand .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}.navbar-dark{--bs-navbar-color:rgba(255, 255, 255, 0.55);--bs-navbar-hover-color:rgba(255, 255, 255, 0.75);--bs-navbar-disabled-color:rgba(255, 255, 255, 0.25);--bs-navbar-active-color:#fff;--bs-navbar-brand-color:#fff;--bs-navbar-brand-hover-color:#fff;--bs-navbar-toggler-border-color:rgba(255, 255, 255, 0.1);--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%28255, 255, 255, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")}.card{--bs-card-spacer-y:1rem;--bs-card-spacer-x:1rem;--bs-card-title-spacer-y:0.5rem;--bs-card-border-width:1px;--bs-card-border-color:var(--bs-border-color-translucent);--bs-card-border-radius:0.375rem;--bs-card-box-shadow: ;--bs-card-inner-border-radius:calc(0.375rem - 1px);--bs-card-cap-padding-y:0.5rem;--bs-card-cap-padding-x:1rem;--bs-card-cap-bg:rgba(0, 0, 0, 0.03);--bs-card-cap-color: ;--bs-card-height: ;--bs-card-color: ;--bs-card-bg:#fff;--bs-card-img-overlay-padding:1rem;--bs-card-group-margin:0.75rem;position:relative;display:flex;flex-direction:column;min-width:0;height:var(--bs-card-height);word-wrap:break-word;background-color:var(--bs-card-bg);background-clip:border-box;border:var(--bs-card-border-width) solid var(--bs-card-border-color);border-radius:var(--bs-card-border-radius)}.card>hr{margin-right:0;margin-left:0}.card>.list-group{border-top:inherit;border-bottom:inherit}.card>.list-group:first-child{border-top-width:0;border-top-left-radius:var(--bs-card-inner-border-radius);border-top-right-radius:var(--bs-card-inner-border-radius)}.card>.list-group:last-child{border-bottom-width:0;border-bottom-right-radius:var(--bs-card-inner-border-radius);border-bottom-left-radius:var(--bs-card-inner-border-radius)}.card>.card-header+.list-group,.card>.list-group+.card-footer{border-top:0}.card-body{flex:1 1 auto;padding:var(--bs-card-spacer-y) var(--bs-card-spacer-x);color:var(--bs-card-color)}.card-title{margin-bottom:var(--bs-card-title-spacer-y)}.card-subtitle{margin-top:calc(-.5 * var(--bs-card-title-spacer-y));margin-bottom:0}.card-text:last-child{margin-bottom:0}.card-link+.card-link{margin-left:var(--bs-card-spacer-x)}.card-header{padding:var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);margin-bottom:0;color:var(--bs-card-cap-color);background-color:var(--bs-card-cap-bg);border-bottom:var(--bs-card-border-width) solid var(--bs-card-border-color)}.card-header:first-child{border-radius:var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius) 0 0}.card-footer{padding:var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);color:var(--bs-card-cap-color);background-color:var(--bs-card-cap-bg);border-top:var(--bs-card-border-width) solid var(--bs-card-border-color)}.card-footer:last-child{border-radius:0 0 var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius)}.card-header-tabs{margin-right:calc(-.5 * var(--bs-card-cap-padding-x));margin-bottom:calc(-1 * var(--bs-card-cap-padding-y));margin-left:calc(-.5 * var(--bs-card-cap-padding-x));border-bottom:0}.card-header-tabs .nav-link.active{background-color:var(--bs-card-bg);border-bottom-color:var(--bs-card-bg)}.card-header-pills{margin-right:calc(-.5 * var(--bs-card-cap-padding-x));margin-left:calc(-.5 * var(--bs-card-cap-padding-x))}.card-img-overlay{position:absolute;top:0;right:0;bottom:0;left:0;padding:var(--bs-card-img-overlay-padding);border-radius:var(--bs-card-inner-border-radius)}.card-img,.card-img-bottom,.card-img-top{width:100%}.card-img,.card-img-top{border-top-left-radius:var(--bs-card-inner-border-radius);border-top-right-radius:var(--bs-card-inner-border-radius)}.card-img,.card-img-bottom{border-bottom-right-radius:var(--bs-card-inner-border-radius);border-bottom-left-radius:var(--bs-card-inner-border-radius)}.card-group>.card{margin-bottom:var(--bs-card-group-margin)}@media (min-width:576px){.card-group{display:flex;flex-flow:row wrap}.card-group>.card{flex:1 0 0%;margin-bottom:0}.card-group>.card+.card{margin-left:0;border-left:0}.card-group>.card:not(:last-child){border-top-right-radius:0;border-bottom-right-radius:0}.card-group>.card:not(:last-child) .card-header,.card-group>.card:not(:last-child) .card-img-top{border-top-right-radius:0}.card-group>.card:not(:last-child) .card-footer,.card-group>.card:not(:last-child) .card-img-bottom{border-bottom-right-radius:0}.card-group>.card:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.card-group>.card:not(:first-child) .card-header,.card-group>.card:not(:first-child) .card-img-top{border-top-left-radius:0}.card-group>.card:not(:first-child) .card-footer,.card-group>.card:not(:first-child) .card-img-bottom{border-bottom-left-radius:0}}.accordion{--bs-accordion-color:#000;--bs-accordion-bg:#fff;--bs-accordion-transition:color 0.15s ease-in-out,background-color 0.15s ease-in-out,border-color 0.15s ease-in-out,box-shadow 0.15s ease-in-out,border-radius 0.15s ease;--bs-accordion-border-color:var(--bs-border-color);--bs-accordion-border-width:1px;--bs-accordion-border-radius:0.375rem;--bs-accordion-inner-border-radius:calc(0.375rem - 1px);--bs-accordion-btn-padding-x:1.25rem;--bs-accordion-btn-padding-y:1rem;--bs-accordion-btn-color:var(--bs-body-color);--bs-accordion-btn-bg:var(--bs-accordion-bg);--bs-accordion-btn-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='var%28--bs-body-color%29'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");--bs-accordion-btn-icon-width:1.25rem;--bs-accordion-btn-icon-transform:rotate(-180deg);--bs-accordion-btn-icon-transition:transform 0.2s ease-in-out;--bs-accordion-btn-active-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%230c63e4'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");--bs-accordion-btn-focus-border-color:#86b7fe;--bs-accordion-btn-focus-box-shadow:0 0 0 0.25rem rgba(13, 110, 253, 0.25);--bs-accordion-body-padding-x:1.25rem;--bs-accordion-body-padding-y:1rem;--bs-accordion-active-color:#0c63e4;--bs-accordion-active-bg:#e7f1ff}.accordion-button{position:relative;display:flex;align-items:center;width:100%;padding:var(--bs-accordion-btn-padding-y) var(--bs-accordion-btn-padding-x);font-size:1rem;color:var(--bs-accordion-btn-color);text-align:left;background-color:var(--bs-accordion-btn-bg);border:0;border-radius:0;overflow-anchor:none;transition:var(--bs-accordion-transition)}@media (prefers-reduced-motion:reduce){.accordion-button{transition:none}}.accordion-button:not(.collapsed){color:var(--bs-accordion-active-color);background-color:var(--bs-accordion-active-bg);box-shadow:inset 0 calc(var(--bs-accordion-border-width) * -1) 0 var(--bs-accordion-border-color)}.accordion-button:not(.collapsed)::after{background-image:var(--bs-accordion-btn-active-icon);transform:var(--bs-accordion-btn-icon-transform)}.accordion-button::after{flex-shrink:0;width:var(--bs-accordion-btn-icon-width);height:var(--bs-accordion-btn-icon-width);margin-left:auto;content:"";background-image:var(--bs-accordion-btn-icon);background-repeat:no-repeat;background-size:var(--bs-accordion-btn-icon-width);transition:var(--bs-accordion-btn-icon-transition)}@media (prefers-reduced-motion:reduce){.accordion-button::after{transition:none}}.accordion-button:hover{z-index:2}.accordion-button:focus{z-index:3;border-color:var(--bs-accordion-btn-focus-border-color);outline:0;box-shadow:var(--bs-accordion-btn-focus-box-shadow)}.accordion-header{margin-bottom:0}.accordion-item{color:var(--bs-accordion-color);background-color:var(--bs-accordion-bg);border:var(--bs-accordion-border-width) solid var(--bs-accordion-border-color)}.accordion-item:first-of-type{border-top-left-radius:var(--bs-accordion-border-radius);border-top-right-radius:var(--bs-accordion-border-radius)}.accordion-item:first-of-type .accordion-button{border-top-left-radius:var(--bs-accordion-inner-border-radius);border-top-right-radius:var(--bs-accordion-inner-border-radius)}.accordion-item:not(:first-of-type){border-top:0}.accordion-item:last-of-type{border-bottom-right-radius:var(--bs-accordion-border-radius);border-bottom-left-radius:var(--bs-accordion-border-radius)}.accordion-item:last-of-type .accordion-button.collapsed{border-bottom-right-radius:var(--bs-accordion-inner-border-radius);border-bottom-left-radius:var(--bs-accordion-inner-border-radius)}.accordion-item:last-of-type .accordion-collapse{border-bottom-right-radius:var(--bs-accordion-border-radius);border-bottom-left-radius:var(--bs-accordion-border-radius)}.accordion-body{padding:var(--bs-accordion-body-padding-y) var(--bs-accordion-body-padding-x)}.accordion-flush .accordion-collapse{border-width:0}.accordion-flush .accordion-item{border-right:0;border-left:0;border-radius:0}.accordion-flush .accordion-item:first-child{border-top:0}.accordion-flush .accordion-item:last-child{border-bottom:0}.accordion-flush .accordion-item .accordion-button{border-radius:0}.breadcrumb{--bs-breadcrumb-padding-x:0;--bs-breadcrumb-padding-y:0;--bs-breadcrumb-margin-bottom:1rem;--bs-breadcrumb-bg: ;--bs-breadcrumb-border-radius: ;--bs-breadcrumb-divider-color:#6c757d;--bs-breadcrumb-item-padding-x:0.5rem;--bs-breadcrumb-item-active-color:#6c757d;display:flex;flex-wrap:wrap;padding:var(--bs-breadcrumb-padding-y) var(--bs-breadcrumb-padding-x);margin-bottom:var(--bs-breadcrumb-margin-bottom);font-size:var(--bs-breadcrumb-font-size);list-style:none;background-color:var(--bs-breadcrumb-bg);border-radius:var(--bs-breadcrumb-border-radius)}.breadcrumb-item+.breadcrumb-item{padding-left:var(--bs-breadcrumb-item-padding-x)}.breadcrumb-item+.breadcrumb-item::before{float:left;padding-right:var(--bs-breadcrumb-item-padding-x);color:var(--bs-breadcrumb-divider-color);content:var(--bs-breadcrumb-divider, "/")}.breadcrumb-item.active{color:var(--bs-breadcrumb-item-active-color)}.pagination{--bs-pagination-padding-x:0.75rem;--bs-pagination-padding-y:0.375rem;--bs-pagination-font-size:1rem;--bs-pagination-color:var(--bs-link-color);--bs-pagination-bg:#fff;--bs-pagination-border-width:1px;--bs-pagination-border-color:#dee2e6;--bs-pagination-border-radius:0.375rem;--bs-pagination-hover-color:var(--bs-link-hover-color);--bs-pagination-hover-bg:#e9ecef;--bs-pagination-hover-border-color:#dee2e6;--bs-pagination-focus-color:var(--bs-link-hover-color);--bs-pagination-focus-bg:#e9ecef;--bs-pagination-focus-box-shadow:0 0 0 0.25rem rgba(13, 110, 253, 0.25);--bs-pagination-active-color:#fff;--bs-pagination-active-bg:#0d6efd;--bs-pagination-active-border-color:#0d6efd;--bs-pagination-disabled-color:#6c757d;--bs-pagination-disabled-bg:#fff;--bs-pagination-disabled-border-color:#dee2e6;display:flex;padding-left:0;list-style:none}.page-link{position:relative;display:block;padding:var(--bs-pagination-padding-y) var(--bs-pagination-padding-x);font-size:var(--bs-pagination-font-size);color:var(--bs-pagination-color);text-decoration:none;background-color:var(--bs-pagination-bg);border:var(--bs-pagination-border-width) solid var(--bs-pagination-border-color);transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.page-link{transition:none}}.page-link:hover{z-index:2;color:var(--bs-pagination-hover-color);background-color:var(--bs-pagination-hover-bg);border-color:var(--bs-pagination-hover-border-color)}.page-link:focus{z-index:3;color:var(--bs-pagination-focus-color);background-color:var(--bs-pagination-focus-bg);outline:0;box-shadow:var(--bs-pagination-focus-box-shadow)}.active>.page-link,.page-link.active{z-index:3;color:var(--bs-pagination-active-color);background-color:var(--bs-pagination-active-bg);border-color:var(--bs-pagination-active-border-color)}.disabled>.page-link,.page-link.disabled{color:var(--bs-pagination-disabled-color);pointer-events:none;background-color:var(--bs-pagination-disabled-bg);border-color:var(--bs-pagination-disabled-border-color)}.page-item:not(:first-child) .page-link{margin-left:-1px}.page-item:first-child .page-link{border-top-left-radius:var(--bs-pagination-border-radius);border-bottom-left-radius:var(--bs-pagination-border-radius)}.page-item:last-child .page-link{border-top-right-radius:var(--bs-pagination-border-radius);border-bottom-right-radius:var(--bs-pagination-border-radius)}.pagination-lg{--bs-pagination-padding-x:1.5rem;--bs-pagination-padding-y:0.75rem;--bs-pagination-font-size:1.25rem;--bs-pagination-border-radius:0.5rem}.pagination-sm{--bs-pagination-padding-x:0.5rem;--bs-pagination-padding-y:0.25rem;--bs-pagination-font-size:0.875rem;--bs-pagination-border-radius:0.25rem}.badge{--bs-badge-padding-x:0.65em;--bs-badge-padding-y:0.35em;--bs-badge-font-size:0.75em;--bs-badge-font-weight:700;--bs-badge-color:#fff;--bs-badge-border-radius:0.375rem;display:inline-block;padding:var(--bs-badge-padding-y) var(--bs-badge-padding-x);font-size:var(--bs-badge-font-size);font-weight:var(--bs-badge-font-weight);line-height:1;color:var(--bs-badge-color);text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:var(--bs-badge-border-radius,0)}.badge:empty{display:none}.btn .badge{position:relative;top:-1px}.alert{--bs-alert-bg:transparent;--bs-alert-padding-x:1rem;--bs-alert-padding-y:1rem;--bs-alert-margin-bottom:1rem;--bs-alert-color:inherit;--bs-alert-border-color:transparent;--bs-alert-border:1px solid var(--bs-alert-border-color);--bs-alert-border-radius:0.375rem;position:relative;padding:var(--bs-alert-padding-y) var(--bs-alert-padding-x);margin-bottom:var(--bs-alert-margin-bottom);color:var(--bs-alert-color);background-color:var(--bs-alert-bg);border:var(--bs-alert-border);border-radius:var(--bs-alert-border-radius,0)}.alert-heading{color:inherit}.alert-link{font-weight:700}.alert-dismissible{padding-right:3rem}.alert-dismissible .btn-close{position:absolute;top:0;right:0;z-index:2;padding:1.25rem 1rem}.alert-primary{--bs-alert-color:#084298;--bs-alert-bg:#cfe2ff;--bs-alert-border-color:#b6d4fe}.alert-primary .alert-link{color:#06357a}.alert-secondary{--bs-alert-color:#41464b;--bs-alert-bg:#e2e3e5;--bs-alert-border-color:#d3d6d8}.alert-secondary .alert-link{color:#34383c}.alert-success{--bs-alert-color:#0f5132;--bs-alert-bg:#d1e7dd;--bs-alert-border-color:#badbcc}.alert-success .alert-link{color:#0c4128}.alert-info{--bs-alert-color:#055160;--bs-alert-bg:#cff4fc;--bs-alert-border-color:#b6effb}.alert-info .alert-link{color:#04414d}.alert-warning{--bs-alert-color:#664d03;--bs-alert-bg:#fff3cd;--bs-alert-border-color:#ffecb5}.alert-warning .alert-link{color:#523e02}.alert-danger{--bs-alert-color:#842029;--bs-alert-bg:#f8d7da;--bs-alert-border-color:#f5c2c7}.alert-danger .alert-link{color:#6a1a21}.alert-light{--bs-alert-color:#636464;--bs-alert-bg:#fefefe;--bs-alert-border-color:#fdfdfe}.alert-light .alert-link{color:#4f5050}.alert-dark{--bs-alert-color:#141619;--bs-alert-bg:#d3d3d4;--bs-alert-border-color:#bcbebf}.alert-dark .alert-link{color:#101214}@-webkit-keyframes progress-bar-stripes{0%{background-position-x:1rem}}@keyframes progress-bar-stripes{0%{background-position-x:1rem}}.progress{--bs-progress-height:1rem;--bs-progress-font-size:0.75rem;--bs-progress-bg:#e9ecef;--bs-progress-border-radius:0.375rem;--bs-progress-box-shadow:inset 0 1px 2px rgba(0, 0, 0, 0.075);--bs-progress-bar-color:#fff;--bs-progress-bar-bg:#0d6efd;--bs-progress-bar-transition:width 0.6s ease;display:flex;height:var(--bs-progress-height);overflow:hidden;font-size:var(--bs-progress-font-size);background-color:var(--bs-progress-bg);border-radius:var(--bs-progress-border-radius)}.progress-bar{display:flex;flex-direction:column;justify-content:center;overflow:hidden;color:var(--bs-progress-bar-color);text-align:center;white-space:nowrap;background-color:var(--bs-progress-bar-bg);transition:var(--bs-progress-bar-transition)}@media (prefers-reduced-motion:reduce){.progress-bar{transition:none}}.progress-bar-striped{background-image:linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-size:var(--bs-progress-height) var(--bs-progress-height)}.progress-bar-animated{-webkit-animation:1s linear infinite progress-bar-stripes;animation:1s linear infinite progress-bar-stripes}@media (prefers-reduced-motion:reduce){.progress-bar-animated{-webkit-animation:none;animation:none}}.list-group{--bs-list-group-color:#212529;--bs-list-group-bg:#fff;--bs-list-group-border-color:rgba(0, 0, 0, 0.125);--bs-list-group-border-width:1px;--bs-list-group-border-radius:0.375rem;--bs-list-group-item-padding-x:1rem;--bs-list-group-item-padding-y:0.5rem;--bs-list-group-action-color:#495057;--bs-list-group-action-hover-color:#495057;--bs-list-group-action-hover-bg:#f8f9fa;--bs-list-group-action-active-color:#212529;--bs-list-group-action-active-bg:#e9ecef;--bs-list-group-disabled-color:#6c757d;--bs-list-group-disabled-bg:#fff;--bs-list-group-active-color:#fff;--bs-list-group-active-bg:#0d6efd;--bs-list-group-active-border-color:#0d6efd;display:flex;flex-direction:column;padding-left:0;margin-bottom:0;border-radius:var(--bs-list-group-border-radius)}.list-group-numbered{list-style-type:none;counter-reset:section}.list-group-numbered>.list-group-item::before{content:counters(section, ".") ". ";counter-increment:section}.list-group-item-action{width:100%;color:var(--bs-list-group-action-color);text-align:inherit}.list-group-item-action:focus,.list-group-item-action:hover{z-index:1;color:var(--bs-list-group-action-hover-color);text-decoration:none;background-color:var(--bs-list-group-action-hover-bg)}.list-group-item-action:active{color:var(--bs-list-group-action-active-color);background-color:var(--bs-list-group-action-active-bg)}.list-group-item{position:relative;display:block;padding:var(--bs-list-group-item-padding-y) var(--bs-list-group-item-padding-x);color:var(--bs-list-group-color);text-decoration:none;background-color:var(--bs-list-group-bg);border:var(--bs-list-group-border-width) solid var(--bs-list-group-border-color)}.list-group-item:first-child{border-top-left-radius:inherit;border-top-right-radius:inherit}.list-group-item:last-child{border-bottom-right-radius:inherit;border-bottom-left-radius:inherit}.list-group-item.disabled,.list-group-item:disabled{color:var(--bs-list-group-disabled-color);pointer-events:none;background-color:var(--bs-list-group-disabled-bg)}.list-group-item.active{z-index:2;color:var(--bs-list-group-active-color);background-color:var(--bs-list-group-active-bg);border-color:var(--bs-list-group-active-border-color)}.list-group-item+.list-group-item{border-top-width:0}.list-group-item+.list-group-item.active{margin-top:calc(var(--bs-list-group-border-width) * -1);border-top-width:var(--bs-list-group-border-width)}.list-group-horizontal{flex-direction:row}.list-group-horizontal>.list-group-item:first-child{border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal>.list-group-item:last-child{border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal>.list-group-item.active{margin-top:0}.list-group-horizontal>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal>.list-group-item+.list-group-item.active{margin-left:calc(var(--bs-list-group-border-width) * -1);border-left-width:var(--bs-list-group-border-width)}@media (min-width:576px){.list-group-horizontal-sm{flex-direction:row}.list-group-horizontal-sm>.list-group-item:first-child{border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-sm>.list-group-item:last-child{border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-sm>.list-group-item.active{margin-top:0}.list-group-horizontal-sm>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-sm>.list-group-item+.list-group-item.active{margin-left:calc(var(--bs-list-group-border-width) * -1);border-left-width:var(--bs-list-group-border-width)}}@media (min-width:768px){.list-group-horizontal-md{flex-direction:row}.list-group-horizontal-md>.list-group-item:first-child{border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-md>.list-group-item:last-child{border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-md>.list-group-item.active{margin-top:0}.list-group-horizontal-md>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-md>.list-group-item+.list-group-item.active{margin-left:calc(var(--bs-list-group-border-width) * -1);border-left-width:var(--bs-list-group-border-width)}}@media (min-width:992px){.list-group-horizontal-lg{flex-direction:row}.list-group-horizontal-lg>.list-group-item:first-child{border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-lg>.list-group-item:last-child{border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-lg>.list-group-item.active{margin-top:0}.list-group-horizontal-lg>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-lg>.list-group-item+.list-group-item.active{margin-left:calc(var(--bs-list-group-border-width) * -1);border-left-width:var(--bs-list-group-border-width)}}@media (min-width:1200px){.list-group-horizontal-xl{flex-direction:row}.list-group-horizontal-xl>.list-group-item:first-child{border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-xl>.list-group-item:last-child{border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-xl>.list-group-item.active{margin-top:0}.list-group-horizontal-xl>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-xl>.list-group-item+.list-group-item.active{margin-left:calc(var(--bs-list-group-border-width) * -1);border-left-width:var(--bs-list-group-border-width)}}@media (min-width:1400px){.list-group-horizontal-xxl{flex-direction:row}.list-group-horizontal-xxl>.list-group-item:first-child{border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-xxl>.list-group-item:last-child{border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-xxl>.list-group-item.active{margin-top:0}.list-group-horizontal-xxl>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-xxl>.list-group-item+.list-group-item.active{margin-left:calc(var(--bs-list-group-border-width) * -1);border-left-width:var(--bs-list-group-border-width)}}.list-group-flush{border-radius:0}.list-group-flush>.list-group-item{border-width:0 0 var(--bs-list-group-border-width)}.list-group-flush>.list-group-item:last-child{border-bottom-width:0}.list-group-item-primary{color:#084298;background-color:#cfe2ff}.list-group-item-primary.list-group-item-action:focus,.list-group-item-primary.list-group-item-action:hover{color:#084298;background-color:#bacbe6}.list-group-item-primary.list-group-item-action.active{color:#fff;background-color:#084298;border-color:#084298}.list-group-item-secondary{color:#41464b;background-color:#e2e3e5}.list-group-item-secondary.list-group-item-action:focus,.list-group-item-secondary.list-group-item-action:hover{color:#41464b;background-color:#cbccce}.list-group-item-secondary.list-group-item-action.active{color:#fff;background-color:#41464b;border-color:#41464b}.list-group-item-success{color:#0f5132;background-color:#d1e7dd}.list-group-item-success.list-group-item-action:focus,.list-group-item-success.list-group-item-action:hover{color:#0f5132;background-color:#bcd0c7}.list-group-item-success.list-group-item-action.active{color:#fff;background-color:#0f5132;border-color:#0f5132}.list-group-item-info{color:#055160;background-color:#cff4fc}.list-group-item-info.list-group-item-action:focus,.list-group-item-info.list-group-item-action:hover{color:#055160;background-color:#badce3}.list-group-item-info.list-group-item-action.active{color:#fff;background-color:#055160;border-color:#055160}.list-group-item-warning{color:#664d03;background-color:#fff3cd}.list-group-item-warning.list-group-item-action:focus,.list-group-item-warning.list-group-item-action:hover{color:#664d03;background-color:#e6dbb9}.list-group-item-warning.list-group-item-action.active{color:#fff;background-color:#664d03;border-color:#664d03}.list-group-item-danger{color:#842029;background-color:#f8d7da}.list-group-item-danger.list-group-item-action:focus,.list-group-item-danger.list-group-item-action:hover{color:#842029;background-color:#dfc2c4}.list-group-item-danger.list-group-item-action.active{color:#fff;background-color:#842029;border-color:#842029}.list-group-item-light{color:#636464;background-color:#fefefe}.list-group-item-light.list-group-item-action:focus,.list-group-item-light.list-group-item-action:hover{color:#636464;background-color:#e5e5e5}.list-group-item-light.list-group-item-action.active{color:#fff;background-color:#636464;border-color:#636464}.list-group-item-dark{color:#141619;background-color:#d3d3d4}.list-group-item-dark.list-group-item-action:focus,.list-group-item-dark.list-group-item-action:hover{color:#141619;background-color:#bebebf}.list-group-item-dark.list-group-item-action.active{color:#fff;background-color:#141619;border-color:#141619}.btn-close{box-sizing:content-box;width:1em;height:1em;padding:.25em .25em;color:#000;background:transparent url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23000'%3e%3cpath d='M.293.293a1 1 0 0 1 1.414 0L8 6.586 14.293.293a1 1 0 1 1 1.414 1.414L9.414 8l6.293 6.293a1 1 0 0 1-1.414 1.414L8 9.414l-6.293 6.293a1 1 0 0 1-1.414-1.414L6.586 8 .293 1.707a1 1 0 0 1 0-1.414z'/%3e%3c/svg%3e") center/1em auto no-repeat;border:0;border-radius:.375rem;opacity:.5}.btn-close:hover{color:#000;text-decoration:none;opacity:.75}.btn-close:focus{outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25);opacity:1}.btn-close.disabled,.btn-close:disabled{pointer-events:none;-webkit-user-select:none;-moz-user-select:none;user-select:none;opacity:.25}.btn-close-white{filter:invert(1) grayscale(100%) brightness(200%)}.toast{--bs-toast-padding-x:0.75rem;--bs-toast-padding-y:0.5rem;--bs-toast-spacing:1.5rem;--bs-toast-max-width:350px;--bs-toast-font-size:0.875rem;--bs-toast-color: ;--bs-toast-bg:rgba(255, 255, 255, 0.85);--bs-toast-border-width:1px;--bs-toast-border-color:var(--bs-border-color-translucent);--bs-toast-border-radius:0.375rem;--bs-toast-box-shadow:0 0.5rem 1rem rgba(0, 0, 0, 0.15);--bs-toast-header-color:#6c757d;--bs-toast-header-bg:rgba(255, 255, 255, 0.85);--bs-toast-header-border-color:rgba(0, 0, 0, 0.05);width:var(--bs-toast-max-width);max-width:100%;font-size:var(--bs-toast-font-size);color:var(--bs-toast-color);pointer-events:auto;background-color:var(--bs-toast-bg);background-clip:padding-box;border:var(--bs-toast-border-width) solid var(--bs-toast-border-color);box-shadow:var(--bs-toast-box-shadow);border-radius:var(--bs-toast-border-radius)}.toast.showing{opacity:0}.toast:not(.show){display:none}.toast-container{position:absolute;z-index:1090;width:-webkit-max-content;width:-moz-max-content;width:max-content;max-width:100%;pointer-events:none}.toast-container>:not(:last-child){margin-bottom:var(--bs-toast-spacing)}.toast-header{display:flex;align-items:center;padding:var(--bs-toast-padding-y) var(--bs-toast-padding-x);color:var(--bs-toast-header-color);background-color:var(--bs-toast-header-bg);background-clip:padding-box;border-bottom:var(--bs-toast-border-width) solid var(--bs-toast-header-border-color);border-top-left-radius:calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width));border-top-right-radius:calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width))}.toast-header .btn-close{margin-right:calc(var(--bs-toast-padding-x) * -.5);margin-left:var(--bs-toast-padding-x)}.toast-body{padding:var(--bs-toast-padding-x);word-wrap:break-word}.modal{--bs-modal-zindex:1055;--bs-modal-width:500px;--bs-modal-padding:1rem;--bs-modal-margin:0.5rem;--bs-modal-color: ;--bs-modal-bg:#fff;--bs-modal-border-color:var(--bs-border-color-translucent);--bs-modal-border-width:1px;--bs-modal-border-radius:0.5rem;--bs-modal-box-shadow:0 0.125rem 0.25rem rgba(0, 0, 0, 0.075);--bs-modal-inner-border-radius:calc(0.5rem - 1px);--bs-modal-header-padding-x:1rem;--bs-modal-header-padding-y:1rem;--bs-modal-header-padding:1rem 1rem;--bs-modal-header-border-color:var(--bs-border-color);--bs-modal-header-border-width:1px;--bs-modal-title-line-height:1.5;--bs-modal-footer-gap:0.5rem;--bs-modal-footer-bg: ;--bs-modal-footer-border-color:var(--bs-border-color);--bs-modal-footer-border-width:1px;position:fixed;top:0;left:0;z-index:var(--bs-modal-zindex);display:none;width:100%;height:100%;overflow-x:hidden;overflow-y:auto;outline:0}.modal-dialog{position:relative;width:auto;margin:var(--bs-modal-margin);pointer-events:none}.modal.fade .modal-dialog{transition:transform .3s ease-out;transform:translate(0,-50px)}@media (prefers-reduced-motion:reduce){.modal.fade .modal-dialog{transition:none}}.modal.show .modal-dialog{transform:none}.modal.modal-static .modal-dialog{transform:scale(1.02)}.modal-dialog-scrollable{height:calc(100% - var(--bs-modal-margin) * 2)}.modal-dialog-scrollable .modal-content{max-height:100%;overflow:hidden}.modal-dialog-scrollable .modal-body{overflow-y:auto}.modal-dialog-centered{display:flex;align-items:center;min-height:calc(100% - var(--bs-modal-margin) * 2)}.modal-content{position:relative;display:flex;flex-direction:column;width:100%;color:var(--bs-modal-color);pointer-events:auto;background-color:var(--bs-modal-bg);background-clip:padding-box;border:var(--bs-modal-border-width) solid var(--bs-modal-border-color);border-radius:var(--bs-modal-border-radius);outline:0}.modal-backdrop{--bs-backdrop-zindex:1050;--bs-backdrop-bg:#000;--bs-backdrop-opacity:0.5;position:fixed;top:0;left:0;z-index:var(--bs-backdrop-zindex);width:100vw;height:100vh;background-color:var(--bs-backdrop-bg)}.modal-backdrop.fade{opacity:0}.modal-backdrop.show{opacity:var(--bs-backdrop-opacity)}.modal-header{display:flex;flex-shrink:0;align-items:center;justify-content:space-between;padding:var(--bs-modal-header-padding);border-bottom:var(--bs-modal-header-border-width) solid var(--bs-modal-header-border-color);border-top-left-radius:var(--bs-modal-inner-border-radius);border-top-right-radius:var(--bs-modal-inner-border-radius)}.modal-header .btn-close{padding:calc(var(--bs-modal-header-padding-y) * .5) calc(var(--bs-modal-header-padding-x) * .5);margin:calc(var(--bs-modal-header-padding-y) * -.5) calc(var(--bs-modal-header-padding-x) * -.5) calc(var(--bs-modal-header-padding-y) * -.5) auto}.modal-title{margin-bottom:0;line-height:var(--bs-modal-title-line-height)}.modal-body{position:relative;flex:1 1 auto;padding:var(--bs-modal-padding)}.modal-footer{display:flex;flex-shrink:0;flex-wrap:wrap;align-items:center;justify-content:flex-end;padding:calc(var(--bs-modal-padding) - var(--bs-modal-footer-gap) * .5);background-color:var(--bs-modal-footer-bg);border-top:var(--bs-modal-footer-border-width) solid var(--bs-modal-footer-border-color);border-bottom-right-radius:var(--bs-modal-inner-border-radius);border-bottom-left-radius:var(--bs-modal-inner-border-radius)}.modal-footer>*{margin:calc(var(--bs-modal-footer-gap) * .5)}@media (min-width:576px){.modal{--bs-modal-margin:1.75rem;--bs-modal-box-shadow:0 0.5rem 1rem rgba(0, 0, 0, 0.15)}.modal-dialog{max-width:var(--bs-modal-width);margin-right:auto;margin-left:auto}.modal-sm{--bs-modal-width:300px}}@media (min-width:992px){.modal-lg,.modal-xl{--bs-modal-width:800px}}@media (min-width:1200px){.modal-xl{--bs-modal-width:1140px}}.modal-fullscreen{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen .modal-footer,.modal-fullscreen .modal-header{border-radius:0}.modal-fullscreen .modal-body{overflow-y:auto}@media (max-width:575.98px){.modal-fullscreen-sm-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-sm-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-sm-down .modal-footer,.modal-fullscreen-sm-down .modal-header{border-radius:0}.modal-fullscreen-sm-down .modal-body{overflow-y:auto}}@media (max-width:767.98px){.modal-fullscreen-md-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-md-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-md-down .modal-footer,.modal-fullscreen-md-down .modal-header{border-radius:0}.modal-fullscreen-md-down .modal-body{overflow-y:auto}}@media (max-width:991.98px){.modal-fullscreen-lg-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-lg-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-lg-down .modal-footer,.modal-fullscreen-lg-down .modal-header{border-radius:0}.modal-fullscreen-lg-down .modal-body{overflow-y:auto}}@media (max-width:1199.98px){.modal-fullscreen-xl-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-xl-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-xl-down .modal-footer,.modal-fullscreen-xl-down .modal-header{border-radius:0}.modal-fullscreen-xl-down .modal-body{overflow-y:auto}}@media (max-width:1399.98px){.modal-fullscreen-xxl-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-xxl-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-xxl-down .modal-footer,.modal-fullscreen-xxl-down .modal-header{border-radius:0}.modal-fullscreen-xxl-down .modal-body{overflow-y:auto}}.tooltip{--bs-tooltip-zindex:1080;--bs-tooltip-max-width:200px;--bs-tooltip-padding-x:0.5rem;--bs-tooltip-padding-y:0.25rem;--bs-tooltip-margin: ;--bs-tooltip-font-size:0.875rem;--bs-tooltip-color:#fff;--bs-tooltip-bg:#000;--bs-tooltip-border-radius:0.375rem;--bs-tooltip-opacity:0.9;--bs-tooltip-arrow-width:0.8rem;--bs-tooltip-arrow-height:0.4rem;z-index:var(--bs-tooltip-zindex);display:block;padding:var(--bs-tooltip-arrow-height);margin:var(--bs-tooltip-margin);font-family:var(--bs-font-sans-serif);font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;white-space:normal;word-spacing:normal;line-break:auto;font-size:var(--bs-tooltip-font-size);word-wrap:break-word;opacity:0}.tooltip.show{opacity:var(--bs-tooltip-opacity)}.tooltip .tooltip-arrow{display:block;width:var(--bs-tooltip-arrow-width);height:var(--bs-tooltip-arrow-height)}.tooltip .tooltip-arrow::before{position:absolute;content:"";border-color:transparent;border-style:solid}.bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow,.bs-tooltip-top .tooltip-arrow{bottom:0}.bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow::before,.bs-tooltip-top .tooltip-arrow::before{top:-1px;border-width:var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0;border-top-color:var(--bs-tooltip-bg)}.bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow,.bs-tooltip-end .tooltip-arrow{left:0;width:var(--bs-tooltip-arrow-height);height:var(--bs-tooltip-arrow-width)}.bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow::before,.bs-tooltip-end .tooltip-arrow::before{right:-1px;border-width:calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0;border-right-color:var(--bs-tooltip-bg)}.bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow,.bs-tooltip-bottom .tooltip-arrow{top:0}.bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow::before,.bs-tooltip-bottom .tooltip-arrow::before{bottom:-1px;border-width:0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height);border-bottom-color:var(--bs-tooltip-bg)}.bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow,.bs-tooltip-start .tooltip-arrow{right:0;width:var(--bs-tooltip-arrow-height);height:var(--bs-tooltip-arrow-width)}.bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow::before,.bs-tooltip-start .tooltip-arrow::before{left:-1px;border-width:calc(var(--bs-tooltip-arrow-width) * .5) 0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height);border-left-color:var(--bs-tooltip-bg)}.tooltip-inner{max-width:var(--bs-tooltip-max-width);padding:var(--bs-tooltip-padding-y) var(--bs-tooltip-padding-x);color:var(--bs-tooltip-color);text-align:center;background-color:var(--bs-tooltip-bg);border-radius:var(--bs-tooltip-border-radius,0)}.popover{--bs-popover-zindex:1070;--bs-popover-max-width:276px;--bs-popover-font-size:0.875rem;--bs-popover-bg:#fff;--bs-popover-border-width:1px;--bs-popover-border-color:var(--bs-border-color-translucent);--bs-popover-border-radius:0.5rem;--bs-popover-inner-border-radius:calc(0.5rem - 1px);--bs-popover-box-shadow:0 0.5rem 1rem rgba(0, 0, 0, 0.15);--bs-popover-header-padding-x:1rem;--bs-popover-header-padding-y:0.5rem;--bs-popover-header-font-size:1rem;--bs-popover-header-color:var(--bs-heading-color);--bs-popover-header-bg:#f0f0f0;--bs-popover-body-padding-x:1rem;--bs-popover-body-padding-y:1rem;--bs-popover-body-color:#212529;--bs-popover-arrow-width:1rem;--bs-popover-arrow-height:0.5rem;--bs-popover-arrow-border:var(--bs-popover-border-color);z-index:var(--bs-popover-zindex);display:block;max-width:var(--bs-popover-max-width);font-family:var(--bs-font-sans-serif);font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;white-space:normal;word-spacing:normal;line-break:auto;font-size:var(--bs-popover-font-size);word-wrap:break-word;background-color:var(--bs-popover-bg);background-clip:padding-box;border:var(--bs-popover-border-width) solid var(--bs-popover-border-color);border-radius:var(--bs-popover-border-radius)}.popover .popover-arrow{display:block;width:var(--bs-popover-arrow-width);height:var(--bs-popover-arrow-height)}.popover .popover-arrow::after,.popover .popover-arrow::before{position:absolute;display:block;content:"";border-color:transparent;border-style:solid;border-width:0}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow,.bs-popover-top>.popover-arrow{bottom:calc(var(--bs-popover-arrow-height) * -1 - var(--bs-popover-border-width))}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::before,.bs-popover-top>.popover-arrow::after,.bs-popover-top>.popover-arrow::before{border-width:var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::before,.bs-popover-top>.popover-arrow::before{bottom:0;border-top-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::after,.bs-popover-top>.popover-arrow::after{bottom:var(--bs-popover-border-width);border-top-color:var(--bs-popover-bg)}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow,.bs-popover-end>.popover-arrow{left:calc(var(--bs-popover-arrow-height) * -1 - var(--bs-popover-border-width));width:var(--bs-popover-arrow-height);height:var(--bs-popover-arrow-width)}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::before,.bs-popover-end>.popover-arrow::after,.bs-popover-end>.popover-arrow::before{border-width:calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::before,.bs-popover-end>.popover-arrow::before{left:0;border-right-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::after,.bs-popover-end>.popover-arrow::after{left:var(--bs-popover-border-width);border-right-color:var(--bs-popover-bg)}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow,.bs-popover-bottom>.popover-arrow{top:calc(var(--bs-popover-arrow-height) * -1 - var(--bs-popover-border-width))}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::before,.bs-popover-bottom>.popover-arrow::after,.bs-popover-bottom>.popover-arrow::before{border-width:0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height)}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::before,.bs-popover-bottom>.popover-arrow::before{top:0;border-bottom-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::after,.bs-popover-bottom>.popover-arrow::after{top:var(--bs-popover-border-width);border-bottom-color:var(--bs-popover-bg)}.bs-popover-auto[data-popper-placement^=bottom] .popover-header::before,.bs-popover-bottom .popover-header::before{position:absolute;top:0;left:50%;display:block;width:var(--bs-popover-arrow-width);margin-left:calc(var(--bs-popover-arrow-width) * -.5);content:"";border-bottom:var(--bs-popover-border-width) solid var(--bs-popover-header-bg)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow,.bs-popover-start>.popover-arrow{right:calc(var(--bs-popover-arrow-height) * -1 - var(--bs-popover-border-width));width:var(--bs-popover-arrow-height);height:var(--bs-popover-arrow-width)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::before,.bs-popover-start>.popover-arrow::after,.bs-popover-start>.popover-arrow::before{border-width:calc(var(--bs-popover-arrow-width) * .5) 0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::before,.bs-popover-start>.popover-arrow::before{right:0;border-left-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::after,.bs-popover-start>.popover-arrow::after{right:var(--bs-popover-border-width);border-left-color:var(--bs-popover-bg)}.popover-header{padding:var(--bs-popover-header-padding-y) var(--bs-popover-header-padding-x);margin-bottom:0;font-size:var(--bs-popover-header-font-size);color:var(--bs-popover-header-color);background-color:var(--bs-popover-header-bg);border-bottom:var(--bs-popover-border-width) solid var(--bs-popover-border-color);border-top-left-radius:var(--bs-popover-inner-border-radius);border-top-right-radius:var(--bs-popover-inner-border-radius)}.popover-header:empty{display:none}.popover-body{padding:var(--bs-popover-body-padding-y) var(--bs-popover-body-padding-x);color:var(--bs-popover-body-color)}.carousel{position:relative}.carousel.pointer-event{touch-action:pan-y}.carousel-inner{position:relative;width:100%;overflow:hidden}.carousel-inner::after{display:block;clear:both;content:""}.carousel-item{position:relative;display:none;float:left;width:100%;margin-right:-100%;-webkit-backface-visibility:hidden;backface-visibility:hidden;transition:transform .6s ease-in-out}@media (prefers-reduced-motion:reduce){.carousel-item{transition:none}}.carousel-item-next,.carousel-item-prev,.carousel-item.active{display:block}.active.carousel-item-end,.carousel-item-next:not(.carousel-item-start){transform:translateX(100%)}.active.carousel-item-start,.carousel-item-prev:not(.carousel-item-end){transform:translateX(-100%)}.carousel-fade .carousel-item{opacity:0;transition-property:opacity;transform:none}.carousel-fade .carousel-item-next.carousel-item-start,.carousel-fade .carousel-item-prev.carousel-item-end,.carousel-fade .carousel-item.active{z-index:1;opacity:1}.carousel-fade .active.carousel-item-end,.carousel-fade .active.carousel-item-start{z-index:0;opacity:0;transition:opacity 0s .6s}@media (prefers-reduced-motion:reduce){.carousel-fade .active.carousel-item-end,.carousel-fade .active.carousel-item-start{transition:none}}.carousel-control-next,.carousel-control-prev{position:absolute;top:0;bottom:0;z-index:1;display:flex;align-items:center;justify-content:center;width:15%;padding:0;color:#fff;text-align:center;background:0 0;border:0;opacity:.5;transition:opacity .15s ease}@media (prefers-reduced-motion:reduce){.carousel-control-next,.carousel-control-prev{transition:none}}.carousel-control-next:focus,.carousel-control-next:hover,.carousel-control-prev:focus,.carousel-control-prev:hover{color:#fff;text-decoration:none;outline:0;opacity:.9}.carousel-control-prev{left:0}.carousel-control-next{right:0}.carousel-control-next-icon,.carousel-control-prev-icon{display:inline-block;width:2rem;height:2rem;background-repeat:no-repeat;background-position:50%;background-size:100% 100%}.carousel-control-prev-icon{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M11.354 1.646a.5.5 0 0 1 0 .708L5.707 8l5.647 5.646a.5.5 0 0 1-.708.708l-6-6a.5.5 0 0 1 0-.708l6-6a.5.5 0 0 1 .708 0z'/%3e%3c/svg%3e")}.carousel-control-next-icon{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M4.646 1.646a.5.5 0 0 1 .708 0l6 6a.5.5 0 0 1 0 .708l-6 6a.5.5 0 0 1-.708-.708L10.293 8 4.646 2.354a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e")}.carousel-indicators{position:absolute;right:0;bottom:0;left:0;z-index:2;display:flex;justify-content:center;padding:0;margin-right:15%;margin-bottom:1rem;margin-left:15%;list-style:none}.carousel-indicators [data-bs-target]{box-sizing:content-box;flex:0 1 auto;width:30px;height:3px;padding:0;margin-right:3px;margin-left:3px;text-indent:-999px;cursor:pointer;background-color:#fff;background-clip:padding-box;border:0;border-top:10px solid transparent;border-bottom:10px solid transparent;opacity:.5;transition:opacity .6s ease}@media (prefers-reduced-motion:reduce){.carousel-indicators [data-bs-target]{transition:none}}.carousel-indicators .active{opacity:1}.carousel-caption{position:absolute;right:15%;bottom:1.25rem;left:15%;padding-top:1.25rem;padding-bottom:1.25rem;color:#fff;text-align:center}.carousel-dark .carousel-control-next-icon,.carousel-dark .carousel-control-prev-icon{filter:invert(1) grayscale(100)}.carousel-dark .carousel-indicators [data-bs-target]{background-color:#000}.carousel-dark .carousel-caption{color:#000}.spinner-border,.spinner-grow{display:inline-block;width:var(--bs-spinner-width);height:var(--bs-spinner-height);vertical-align:var(--bs-spinner-vertical-align);border-radius:50%;-webkit-animation:var(--bs-spinner-animation-speed) linear infinite var(--bs-spinner-animation-name);animation:var(--bs-spinner-animation-speed) linear infinite var(--bs-spinner-animation-name)}@-webkit-keyframes spinner-border{to{transform:rotate(360deg)}}@keyframes spinner-border{to{transform:rotate(360deg)}}.spinner-border{--bs-spinner-width:2rem;--bs-spinner-height:2rem;--bs-spinner-vertical-align:-0.125em;--bs-spinner-border-width:0.25em;--bs-spinner-animation-speed:0.75s;--bs-spinner-animation-name:spinner-border;border:var(--bs-spinner-border-width) solid currentcolor;border-right-color:transparent}.spinner-border-sm{--bs-spinner-width:1rem;--bs-spinner-height:1rem;--bs-spinner-border-width:0.2em}@-webkit-keyframes spinner-grow{0%{transform:scale(0)}50%{opacity:1;transform:none}}@keyframes spinner-grow{0%{transform:scale(0)}50%{opacity:1;transform:none}}.spinner-grow{--bs-spinner-width:2rem;--bs-spinner-height:2rem;--bs-spinner-vertical-align:-0.125em;--bs-spinner-animation-speed:0.75s;--bs-spinner-animation-name:spinner-grow;background-color:currentcolor;opacity:0}.spinner-grow-sm{--bs-spinner-width:1rem;--bs-spinner-height:1rem}@media (prefers-reduced-motion:reduce){.spinner-border,.spinner-grow{--bs-spinner-animation-speed:1.5s}}.offcanvas,.offcanvas-lg,.offcanvas-md,.offcanvas-sm,.offcanvas-xl,.offcanvas-xxl{--bs-offcanvas-width:400px;--bs-offcanvas-height:30vh;--bs-offcanvas-padding-x:1rem;--bs-offcanvas-padding-y:1rem;--bs-offcanvas-color: ;--bs-offcanvas-bg:#fff;--bs-offcanvas-border-width:1px;--bs-offcanvas-border-color:var(--bs-border-color-translucent);--bs-offcanvas-box-shadow:0 0.125rem 0.25rem rgba(0, 0, 0, 0.075)}@media (max-width:575.98px){.offcanvas-sm{position:fixed;bottom:0;z-index:1045;display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}}@media (max-width:575.98px) and (prefers-reduced-motion:reduce){.offcanvas-sm{transition:none}}@media (max-width:575.98px){.offcanvas-sm.show:not(.hiding),.offcanvas-sm.showing{transform:none}}@media (max-width:575.98px){.offcanvas-sm.hiding,.offcanvas-sm.show,.offcanvas-sm.showing{visibility:visible}}@media (max-width:575.98px){.offcanvas-sm.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}}@media (max-width:575.98px){.offcanvas-sm.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}}@media (max-width:575.98px){.offcanvas-sm.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}}@media (max-width:575.98px){.offcanvas-sm.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}}@media (min-width:576px){.offcanvas-sm{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-sm .offcanvas-header{display:none}.offcanvas-sm .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:767.98px){.offcanvas-md{position:fixed;bottom:0;z-index:1045;display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}}@media (max-width:767.98px) and (prefers-reduced-motion:reduce){.offcanvas-md{transition:none}}@media (max-width:767.98px){.offcanvas-md.show:not(.hiding),.offcanvas-md.showing{transform:none}}@media (max-width:767.98px){.offcanvas-md.hiding,.offcanvas-md.show,.offcanvas-md.showing{visibility:visible}}@media (max-width:767.98px){.offcanvas-md.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}}@media (max-width:767.98px){.offcanvas-md.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}}@media (max-width:767.98px){.offcanvas-md.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}}@media (max-width:767.98px){.offcanvas-md.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}}@media (min-width:768px){.offcanvas-md{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-md .offcanvas-header{display:none}.offcanvas-md .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:991.98px){.offcanvas-lg{position:fixed;bottom:0;z-index:1045;display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}}@media (max-width:991.98px) and (prefers-reduced-motion:reduce){.offcanvas-lg{transition:none}}@media (max-width:991.98px){.offcanvas-lg.show:not(.hiding),.offcanvas-lg.showing{transform:none}}@media (max-width:991.98px){.offcanvas-lg.hiding,.offcanvas-lg.show,.offcanvas-lg.showing{visibility:visible}}@media (max-width:991.98px){.offcanvas-lg.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}}@media (max-width:991.98px){.offcanvas-lg.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}}@media (max-width:991.98px){.offcanvas-lg.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}}@media (max-width:991.98px){.offcanvas-lg.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}}@media (min-width:992px){.offcanvas-lg{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-lg .offcanvas-header{display:none}.offcanvas-lg .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:1199.98px){.offcanvas-xl{position:fixed;bottom:0;z-index:1045;display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}}@media (max-width:1199.98px) and (prefers-reduced-motion:reduce){.offcanvas-xl{transition:none}}@media (max-width:1199.98px){.offcanvas-xl.show:not(.hiding),.offcanvas-xl.showing{transform:none}}@media (max-width:1199.98px){.offcanvas-xl.hiding,.offcanvas-xl.show,.offcanvas-xl.showing{visibility:visible}}@media (max-width:1199.98px){.offcanvas-xl.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}}@media (max-width:1199.98px){.offcanvas-xl.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}}@media (max-width:1199.98px){.offcanvas-xl.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}}@media (max-width:1199.98px){.offcanvas-xl.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}}@media (min-width:1200px){.offcanvas-xl{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-xl .offcanvas-header{display:none}.offcanvas-xl .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:1399.98px){.offcanvas-xxl{position:fixed;bottom:0;z-index:1045;display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}}@media (max-width:1399.98px) and (prefers-reduced-motion:reduce){.offcanvas-xxl{transition:none}}@media (max-width:1399.98px){.offcanvas-xxl.show:not(.hiding),.offcanvas-xxl.showing{transform:none}}@media (max-width:1399.98px){.offcanvas-xxl.hiding,.offcanvas-xxl.show,.offcanvas-xxl.showing{visibility:visible}}@media (max-width:1399.98px){.offcanvas-xxl.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}}@media (max-width:1399.98px){.offcanvas-xxl.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}}@media (max-width:1399.98px){.offcanvas-xxl.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}}@media (max-width:1399.98px){.offcanvas-xxl.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}}@media (min-width:1400px){.offcanvas-xxl{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-xxl .offcanvas-header{display:none}.offcanvas-xxl .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}.offcanvas{position:fixed;bottom:0;z-index:1045;display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}@media (prefers-reduced-motion:reduce){.offcanvas{transition:none}}.offcanvas.show:not(.hiding),.offcanvas.showing{transform:none}.offcanvas.hiding,.offcanvas.show,.offcanvas.showing{visibility:visible}.offcanvas.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-backdrop{position:fixed;top:0;left:0;z-index:1040;width:100vw;height:100vh;background-color:#000}.offcanvas-backdrop.fade{opacity:0}.offcanvas-backdrop.show{opacity:.5}.offcanvas-header{display:flex;align-items:center;justify-content:space-between;padding:var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x)}.offcanvas-header .btn-close{padding:calc(var(--bs-offcanvas-padding-y) * .5) calc(var(--bs-offcanvas-padding-x) * .5);margin-top:calc(var(--bs-offcanvas-padding-y) * -.5);margin-right:calc(var(--bs-offcanvas-padding-x) * -.5);margin-bottom:calc(var(--bs-offcanvas-padding-y) * -.5)}.offcanvas-title{margin-bottom:0;line-height:1.5}.offcanvas-body{flex-grow:1;padding:var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x);overflow-y:auto}.placeholder{display:inline-block;min-height:1em;vertical-align:middle;cursor:wait;background-color:currentcolor;opacity:.5}.placeholder.btn::before{display:inline-block;content:""}.placeholder-xs{min-height:.6em}.placeholder-sm{min-height:.8em}.placeholder-lg{min-height:1.2em}.placeholder-glow .placeholder{-webkit-animation:placeholder-glow 2s ease-in-out infinite;animation:placeholder-glow 2s ease-in-out infinite}@-webkit-keyframes placeholder-glow{50%{opacity:.2}}@keyframes placeholder-glow{50%{opacity:.2}}.placeholder-wave{-webkit-mask-image:linear-gradient(130deg,#000 55%,rgba(0,0,0,0.8) 75%,#000 95%);mask-image:linear-gradient(130deg,#000 55%,rgba(0,0,0,0.8) 75%,#000 95%);-webkit-mask-size:200% 100%;mask-size:200% 100%;-webkit-animation:placeholder-wave 2s linear infinite;animation:placeholder-wave 2s linear infinite}@-webkit-keyframes placeholder-wave{100%{-webkit-mask-position:-200% 0%;mask-position:-200% 0%}}@keyframes placeholder-wave{100%{-webkit-mask-position:-200% 0%;mask-position:-200% 0%}}.clearfix::after{display:block;clear:both;content:""}.text-bg-primary{color:#fff!important;background-color:RGBA(13,110,253,var(--bs-bg-opacity,1))!important}.text-bg-secondary{color:#fff!important;background-color:RGBA(108,117,125,var(--bs-bg-opacity,1))!important}.text-bg-success{color:#fff!important;background-color:RGBA(25,135,84,var(--bs-bg-opacity,1))!important}.text-bg-info{color:#000!important;background-color:RGBA(13,202,240,var(--bs-bg-opacity,1))!important}.text-bg-warning{color:#000!important;background-color:RGBA(255,193,7,var(--bs-bg-opacity,1))!important}.text-bg-danger{color:#fff!important;background-color:RGBA(220,53,69,var(--bs-bg-opacity,1))!important}.text-bg-light{color:#000!important;background-color:RGBA(248,249,250,var(--bs-bg-opacity,1))!important}.text-bg-dark{color:#fff!important;background-color:RGBA(33,37,41,var(--bs-bg-opacity,1))!important}.link-primary{color:#0d6efd!important}.link-primary:focus,.link-primary:hover{color:#0a58ca!important}.link-secondary{color:#6c757d!important}.link-secondary:focus,.link-secondary:hover{color:#565e64!important}.link-success{color:#198754!important}.link-success:focus,.link-success:hover{color:#146c43!important}.link-info{color:#0dcaf0!important}.link-info:focus,.link-info:hover{color:#3dd5f3!important}.link-warning{color:#ffc107!important}.link-warning:focus,.link-warning:hover{color:#ffcd39!important}.link-danger{color:#dc3545!important}.link-danger:focus,.link-danger:hover{color:#b02a37!important}.link-light{color:#f8f9fa!important}.link-light:focus,.link-light:hover{color:#f9fafb!important}.link-dark{color:#212529!important}.link-dark:focus,.link-dark:hover{color:#1a1e21!important}.ratio{position:relative;width:100%}.ratio::before{display:block;padding-top:var(--bs-aspect-ratio);content:""}.ratio>*{position:absolute;top:0;left:0;width:100%;height:100%}.ratio-1x1{--bs-aspect-ratio:100%}.ratio-4x3{--bs-aspect-ratio:75%}.ratio-16x9{--bs-aspect-ratio:56.25%}.ratio-21x9{--bs-aspect-ratio:42.8571428571%}.fixed-top{position:fixed;top:0;right:0;left:0;z-index:1030}.fixed-bottom{position:fixed;right:0;bottom:0;left:0;z-index:1030}.sticky-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}@media (min-width:576px){.sticky-sm-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-sm-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:768px){.sticky-md-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-md-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:992px){.sticky-lg-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-lg-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:1200px){.sticky-xl-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-xl-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:1400px){.sticky-xxl-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-xxl-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}.hstack{display:flex;flex-direction:row;align-items:center;align-self:stretch}.vstack{display:flex;flex:1 1 auto;flex-direction:column;align-self:stretch}.visually-hidden,.visually-hidden-focusable:not(:focus):not(:focus-within){position:absolute!important;width:1px!important;height:1px!important;padding:0!important;margin:-1px!important;overflow:hidden!important;clip:rect(0,0,0,0)!important;white-space:nowrap!important;border:0!important}.stretched-link::after{position:absolute;top:0;right:0;bottom:0;left:0;z-index:1;content:""}.text-truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.vr{display:inline-block;align-self:stretch;width:1px;min-height:1em;background-color:currentcolor;opacity:.25}.align-baseline{vertical-align:baseline!important}.align-top{vertical-align:top!important}.align-middle{vertical-align:middle!important}.align-bottom{vertical-align:bottom!important}.align-text-bottom{vertical-align:text-bottom!important}.align-text-top{vertical-align:text-top!important}.float-start{float:left!important}.float-end{float:right!important}.float-none{float:none!important}.opacity-0{opacity:0!important}.opacity-25{opacity:.25!important}.opacity-50{opacity:.5!important}.opacity-75{opacity:.75!important}.opacity-100{opacity:1!important}.overflow-auto{overflow:auto!important}.overflow-hidden{overflow:hidden!important}.overflow-visible{overflow:visible!important}.overflow-scroll{overflow:scroll!important}.d-inline{display:inline!important}.d-inline-block{display:inline-block!important}.d-block{display:block!important}.d-grid{display:grid!important}.d-table{display:table!important}.d-table-row{display:table-row!important}.d-table-cell{display:table-cell!important}.d-flex{display:flex!important}.d-inline-flex{display:inline-flex!important}.d-none{display:none!important}.shadow{box-shadow:0 .5rem 1rem rgba(0,0,0,.15)!important}.shadow-sm{box-shadow:0 .125rem .25rem rgba(0,0,0,.075)!important}.shadow-lg{box-shadow:0 1rem 3rem rgba(0,0,0,.175)!important}.shadow-none{box-shadow:none!important}.position-static{position:static!important}.position-relative{position:relative!important}.position-absolute{position:absolute!important}.position-fixed{position:fixed!important}.position-sticky{position:-webkit-sticky!important;position:sticky!important}.top-0{top:0!important}.top-50{top:50%!important}.top-100{top:100%!important}.bottom-0{bottom:0!important}.bottom-50{bottom:50%!important}.bottom-100{bottom:100%!important}.start-0{left:0!important}.start-50{left:50%!important}.start-100{left:100%!important}.end-0{right:0!important}.end-50{right:50%!important}.end-100{right:100%!important}.translate-middle{transform:translate(-50%,-50%)!important}.translate-middle-x{transform:translateX(-50%)!important}.translate-middle-y{transform:translateY(-50%)!important}.border{border:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-0{border:0!important}.border-top{border-top:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-top-0{border-top:0!important}.border-end{border-right:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-end-0{border-right:0!important}.border-bottom{border-bottom:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-bottom-0{border-bottom:0!important}.border-start{border-left:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-start-0{border-left:0!important}.border-primary{--bs-border-opacity:1;border-color:rgba(var(--bs-primary-rgb),var(--bs-border-opacity))!important}.border-secondary{--bs-border-opacity:1;border-color:rgba(var(--bs-secondary-rgb),var(--bs-border-opacity))!important}.border-success{--bs-border-opacity:1;border-color:rgba(var(--bs-success-rgb),var(--bs-border-opacity))!important}.border-info{--bs-border-opacity:1;border-color:rgba(var(--bs-info-rgb),var(--bs-border-opacity))!important}.border-warning{--bs-border-opacity:1;border-color:rgba(var(--bs-warning-rgb),var(--bs-border-opacity))!important}.border-danger{--bs-border-opacity:1;border-color:rgba(var(--bs-danger-rgb),var(--bs-border-opacity))!important}.border-light{--bs-border-opacity:1;border-color:rgba(var(--bs-light-rgb),var(--bs-border-opacity))!important}.border-dark{--bs-border-opacity:1;border-color:rgba(var(--bs-dark-rgb),var(--bs-border-opacity))!important}.border-white{--bs-border-opacity:1;border-color:rgba(var(--bs-white-rgb),var(--bs-border-opacity))!important}.border-1{--bs-border-width:1px}.border-2{--bs-border-width:2px}.border-3{--bs-border-width:3px}.border-4{--bs-border-width:4px}.border-5{--bs-border-width:5px}.border-opacity-10{--bs-border-opacity:0.1}.border-opacity-25{--bs-border-opacity:0.25}.border-opacity-50{--bs-border-opacity:0.5}.border-opacity-75{--bs-border-opacity:0.75}.border-opacity-100{--bs-border-opacity:1}.w-25{width:25%!important}.w-50{width:50%!important}.w-75{width:75%!important}.w-100{width:100%!important}.w-auto{width:auto!important}.mw-100{max-width:100%!important}.vw-100{width:100vw!important}.min-vw-100{min-width:100vw!important}.h-25{height:25%!important}.h-50{height:50%!important}.h-75{height:75%!important}.h-100{height:100%!important}.h-auto{height:auto!important}.mh-100{max-height:100%!important}.vh-100{height:100vh!important}.min-vh-100{min-height:100vh!important}.flex-fill{flex:1 1 auto!important}.flex-row{flex-direction:row!important}.flex-column{flex-direction:column!important}.flex-row-reverse{flex-direction:row-reverse!important}.flex-column-reverse{flex-direction:column-reverse!important}.flex-grow-0{flex-grow:0!important}.flex-grow-1{flex-grow:1!important}.flex-shrink-0{flex-shrink:0!important}.flex-shrink-1{flex-shrink:1!important}.flex-wrap{flex-wrap:wrap!important}.flex-nowrap{flex-wrap:nowrap!important}.flex-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-start{justify-content:flex-start!important}.justify-content-end{justify-content:flex-end!important}.justify-content-center{justify-content:center!important}.justify-content-between{justify-content:space-between!important}.justify-content-around{justify-content:space-around!important}.justify-content-evenly{justify-content:space-evenly!important}.align-items-start{align-items:flex-start!important}.align-items-end{align-items:flex-end!important}.align-items-center{align-items:center!important}.align-items-baseline{align-items:baseline!important}.align-items-stretch{align-items:stretch!important}.align-content-start{align-content:flex-start!important}.align-content-end{align-content:flex-end!important}.align-content-center{align-content:center!important}.align-content-between{align-content:space-between!important}.align-content-around{align-content:space-around!important}.align-content-stretch{align-content:stretch!important}.align-self-auto{align-self:auto!important}.align-self-start{align-self:flex-start!important}.align-self-end{align-self:flex-end!important}.align-self-center{align-self:center!important}.align-self-baseline{align-self:baseline!important}.align-self-stretch{align-self:stretch!important}.order-first{order:-1!important}.order-0{order:0!important}.order-1{order:1!important}.order-2{order:2!important}.order-3{order:3!important}.order-4{order:4!important}.order-5{order:5!important}.order-last{order:6!important}.m-0{margin:0!important}.m-1{margin:.25rem!important}.m-2{margin:.5rem!important}.m-3{margin:1rem!important}.m-4{margin:1.5rem!important}.m-5{margin:3rem!important}.m-auto{margin:auto!important}.mx-0{margin-right:0!important;margin-left:0!important}.mx-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-3{margin-right:1rem!important;margin-left:1rem!important}.mx-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-5{margin-right:3rem!important;margin-left:3rem!important}.mx-auto{margin-right:auto!important;margin-left:auto!important}.my-0{margin-top:0!important;margin-bottom:0!important}.my-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-0{margin-top:0!important}.mt-1{margin-top:.25rem!important}.mt-2{margin-top:.5rem!important}.mt-3{margin-top:1rem!important}.mt-4{margin-top:1.5rem!important}.mt-5{margin-top:3rem!important}.mt-auto{margin-top:auto!important}.me-0{margin-right:0!important}.me-1{margin-right:.25rem!important}.me-2{margin-right:.5rem!important}.me-3{margin-right:1rem!important}.me-4{margin-right:1.5rem!important}.me-5{margin-right:3rem!important}.me-auto{margin-right:auto!important}.mb-0{margin-bottom:0!important}.mb-1{margin-bottom:.25rem!important}.mb-2{margin-bottom:.5rem!important}.mb-3{margin-bottom:1rem!important}.mb-4{margin-bottom:1.5rem!important}.mb-5{margin-bottom:3rem!important}.mb-auto{margin-bottom:auto!important}.ms-0{margin-left:0!important}.ms-1{margin-left:.25rem!important}.ms-2{margin-left:.5rem!important}.ms-3{margin-left:1rem!important}.ms-4{margin-left:1.5rem!important}.ms-5{margin-left:3rem!important}.ms-auto{margin-left:auto!important}.p-0{padding:0!important}.p-1{padding:.25rem!important}.p-2{padding:.5rem!important}.p-3{padding:1rem!important}.p-4{padding:1.5rem!important}.p-5{padding:3rem!important}.px-0{padding-right:0!important;padding-left:0!important}.px-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-3{padding-right:1rem!important;padding-left:1rem!important}.px-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-5{padding-right:3rem!important;padding-left:3rem!important}.py-0{padding-top:0!important;padding-bottom:0!important}.py-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-0{padding-top:0!important}.pt-1{padding-top:.25rem!important}.pt-2{padding-top:.5rem!important}.pt-3{padding-top:1rem!important}.pt-4{padding-top:1.5rem!important}.pt-5{padding-top:3rem!important}.pe-0{padding-right:0!important}.pe-1{padding-right:.25rem!important}.pe-2{padding-right:.5rem!important}.pe-3{padding-right:1rem!important}.pe-4{padding-right:1.5rem!important}.pe-5{padding-right:3rem!important}.pb-0{padding-bottom:0!important}.pb-1{padding-bottom:.25rem!important}.pb-2{padding-bottom:.5rem!important}.pb-3{padding-bottom:1rem!important}.pb-4{padding-bottom:1.5rem!important}.pb-5{padding-bottom:3rem!important}.ps-0{padding-left:0!important}.ps-1{padding-left:.25rem!important}.ps-2{padding-left:.5rem!important}.ps-3{padding-left:1rem!important}.ps-4{padding-left:1.5rem!important}.ps-5{padding-left:3rem!important}.gap-0{gap:0!important}.gap-1{gap:.25rem!important}.gap-2{gap:.5rem!important}.gap-3{gap:1rem!important}.gap-4{gap:1.5rem!important}.gap-5{gap:3rem!important}.font-monospace{font-family:var(--bs-font-monospace)!important}.fs-1{font-size:calc(1.375rem + 1.5vw)!important}.fs-2{font-size:calc(1.325rem + .9vw)!important}.fs-3{font-size:calc(1.3rem + .6vw)!important}.fs-4{font-size:calc(1.275rem + .3vw)!important}.fs-5{font-size:1.25rem!important}.fs-6{font-size:1rem!important}.fst-italic{font-style:italic!important}.fst-normal{font-style:normal!important}.fw-light{font-weight:300!important}.fw-lighter{font-weight:lighter!important}.fw-normal{font-weight:400!important}.fw-bold{font-weight:700!important}.fw-semibold{font-weight:600!important}.fw-bolder{font-weight:bolder!important}.lh-1{line-height:1!important}.lh-sm{line-height:1.25!important}.lh-base{line-height:1.5!important}.lh-lg{line-height:2!important}.text-start{text-align:left!important}.text-end{text-align:right!important}.text-center{text-align:center!important}.text-decoration-none{text-decoration:none!important}.text-decoration-underline{text-decoration:underline!important}.text-decoration-line-through{text-decoration:line-through!important}.text-lowercase{text-transform:lowercase!important}.text-uppercase{text-transform:uppercase!important}.text-capitalize{text-transform:capitalize!important}.text-wrap{white-space:normal!important}.text-nowrap{white-space:nowrap!important}.text-break{word-wrap:break-word!important;word-break:break-word!important}.text-primary{--bs-text-opacity:1;color:rgba(var(--bs-primary-rgb),var(--bs-text-opacity))!important}.text-secondary{--bs-text-opacity:1;color:rgba(var(--bs-secondary-rgb),var(--bs-text-opacity))!important}.text-success{--bs-text-opacity:1;color:rgba(var(--bs-success-rgb),var(--bs-text-opacity))!important}.text-info{--bs-text-opacity:1;color:rgba(var(--bs-info-rgb),var(--bs-text-opacity))!important}.text-warning{--bs-text-opacity:1;color:rgba(var(--bs-warning-rgb),var(--bs-text-opacity))!important}.text-danger{--bs-text-opacity:1;color:rgba(var(--bs-danger-rgb),var(--bs-text-opacity))!important}.text-light{--bs-text-opacity:1;color:rgba(var(--bs-light-rgb),var(--bs-text-opacity))!important}.text-dark{--bs-text-opacity:1;color:rgba(var(--bs-dark-rgb),var(--bs-text-opacity))!important}.text-black{--bs-text-opacity:1;color:rgba(var(--bs-black-rgb),var(--bs-text-opacity))!important}.text-white{--bs-text-opacity:1;color:rgba(var(--bs-white-rgb),var(--bs-text-opacity))!important}.text-body{--bs-text-opacity:1;color:rgba(var(--bs-body-color-rgb),var(--bs-text-opacity))!important}.text-muted{--bs-text-opacity:1;color:rgba(var(--bs-body-color-rgb),.75)!important}.text-black-50{--bs-text-opacity:1;color:rgba(0,0,0,.5)!important}.text-white-50{--bs-text-opacity:1;color:rgba(255,255,255,.5)!important}.text-reset{--bs-text-opacity:1;color:inherit!important}.text-opacity-25{--bs-text-opacity:0.25}.text-opacity-50{--bs-text-opacity:0.5}.text-opacity-75{--bs-text-opacity:0.75}.text-opacity-100{--bs-text-opacity:1}.bg-primary{--bs-bg-opacity:1;background-color:rgba(var(--bs-primary-rgb),var(--bs-bg-opacity))!important}.bg-secondary{--bs-bg-opacity:1;background-color:rgba(var(--bs-secondary-rgb),var(--bs-bg-opacity))!important}.bg-success{--bs-bg-opacity:1;background-color:rgba(var(--bs-success-rgb),var(--bs-bg-opacity))!important}.bg-info{--bs-bg-opacity:1;background-color:rgba(var(--bs-info-rgb),var(--bs-bg-opacity))!important}.bg-warning{--bs-bg-opacity:1;background-color:rgba(var(--bs-warning-rgb),var(--bs-bg-opacity))!important}.bg-danger{--bs-bg-opacity:1;background-color:rgba(var(--bs-danger-rgb),var(--bs-bg-opacity))!important}.bg-light{--bs-bg-opacity:1;background-color:rgba(var(--bs-light-rgb),var(--bs-bg-opacity))!important}.bg-dark{--bs-bg-opacity:1;background-color:rgba(var(--bs-dark-rgb),var(--bs-bg-opacity))!important}.bg-black{--bs-bg-opacity:1;background-color:rgba(var(--bs-black-rgb),var(--bs-bg-opacity))!important}.bg-white{--bs-bg-opacity:1;background-color:rgba(var(--bs-white-rgb),var(--bs-bg-opacity))!important}.bg-body{--bs-bg-opacity:1;background-color:rgba(var(--bs-body-bg-rgb),var(--bs-bg-opacity))!important}.bg-transparent{--bs-bg-opacity:1;background-color:transparent!important}.bg-opacity-10{--bs-bg-opacity:0.1}.bg-opacity-25{--bs-bg-opacity:0.25}.bg-opacity-50{--bs-bg-opacity:0.5}.bg-opacity-75{--bs-bg-opacity:0.75}.bg-opacity-100{--bs-bg-opacity:1}.bg-gradient{background-image:var(--bs-gradient)!important}.user-select-all{-webkit-user-select:all!important;-moz-user-select:all!important;user-select:all!important}.user-select-auto{-webkit-user-select:auto!important;-moz-user-select:auto!important;user-select:auto!important}.user-select-none{-webkit-user-select:none!important;-moz-user-select:none!important;user-select:none!important}.pe-none{pointer-events:none!important}.pe-auto{pointer-events:auto!important}.rounded{border-radius:var(--bs-border-radius)!important}.rounded-0{border-radius:0!important}.rounded-1{border-radius:var(--bs-border-radius-sm)!important}.rounded-2{border-radius:var(--bs-border-radius)!important}.rounded-3{border-radius:var(--bs-border-radius-lg)!important}.rounded-4{border-radius:var(--bs-border-radius-xl)!important}.rounded-5{border-radius:var(--bs-border-radius-2xl)!important}.rounded-circle{border-radius:50%!important}.rounded-pill{border-radius:var(--bs-border-radius-pill)!important}.rounded-top{border-top-left-radius:var(--bs-border-radius)!important;border-top-right-radius:var(--bs-border-radius)!important}.rounded-end{border-top-right-radius:var(--bs-border-radius)!important;border-bottom-right-radius:var(--bs-border-radius)!important}.rounded-bottom{border-bottom-right-radius:var(--bs-border-radius)!important;border-bottom-left-radius:var(--bs-border-radius)!important}.rounded-start{border-bottom-left-radius:var(--bs-border-radius)!important;border-top-left-radius:var(--bs-border-radius)!important}.visible{visibility:visible!important}.invisible{visibility:hidden!important}@media (min-width:576px){.float-sm-start{float:left!important}.float-sm-end{float:right!important}.float-sm-none{float:none!important}.d-sm-inline{display:inline!important}.d-sm-inline-block{display:inline-block!important}.d-sm-block{display:block!important}.d-sm-grid{display:grid!important}.d-sm-table{display:table!important}.d-sm-table-row{display:table-row!important}.d-sm-table-cell{display:table-cell!important}.d-sm-flex{display:flex!important}.d-sm-inline-flex{display:inline-flex!important}.d-sm-none{display:none!important}.flex-sm-fill{flex:1 1 auto!important}.flex-sm-row{flex-direction:row!important}.flex-sm-column{flex-direction:column!important}.flex-sm-row-reverse{flex-direction:row-reverse!important}.flex-sm-column-reverse{flex-direction:column-reverse!important}.flex-sm-grow-0{flex-grow:0!important}.flex-sm-grow-1{flex-grow:1!important}.flex-sm-shrink-0{flex-shrink:0!important}.flex-sm-shrink-1{flex-shrink:1!important}.flex-sm-wrap{flex-wrap:wrap!important}.flex-sm-nowrap{flex-wrap:nowrap!important}.flex-sm-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-sm-start{justify-content:flex-start!important}.justify-content-sm-end{justify-content:flex-end!important}.justify-content-sm-center{justify-content:center!important}.justify-content-sm-between{justify-content:space-between!important}.justify-content-sm-around{justify-content:space-around!important}.justify-content-sm-evenly{justify-content:space-evenly!important}.align-items-sm-start{align-items:flex-start!important}.align-items-sm-end{align-items:flex-end!important}.align-items-sm-center{align-items:center!important}.align-items-sm-baseline{align-items:baseline!important}.align-items-sm-stretch{align-items:stretch!important}.align-content-sm-start{align-content:flex-start!important}.align-content-sm-end{align-content:flex-end!important}.align-content-sm-center{align-content:center!important}.align-content-sm-between{align-content:space-between!important}.align-content-sm-around{align-content:space-around!important}.align-content-sm-stretch{align-content:stretch!important}.align-self-sm-auto{align-self:auto!important}.align-self-sm-start{align-self:flex-start!important}.align-self-sm-end{align-self:flex-end!important}.align-self-sm-center{align-self:center!important}.align-self-sm-baseline{align-self:baseline!important}.align-self-sm-stretch{align-self:stretch!important}.order-sm-first{order:-1!important}.order-sm-0{order:0!important}.order-sm-1{order:1!important}.order-sm-2{order:2!important}.order-sm-3{order:3!important}.order-sm-4{order:4!important}.order-sm-5{order:5!important}.order-sm-last{order:6!important}.m-sm-0{margin:0!important}.m-sm-1{margin:.25rem!important}.m-sm-2{margin:.5rem!important}.m-sm-3{margin:1rem!important}.m-sm-4{margin:1.5rem!important}.m-sm-5{margin:3rem!important}.m-sm-auto{margin:auto!important}.mx-sm-0{margin-right:0!important;margin-left:0!important}.mx-sm-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-sm-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-sm-3{margin-right:1rem!important;margin-left:1rem!important}.mx-sm-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-sm-5{margin-right:3rem!important;margin-left:3rem!important}.mx-sm-auto{margin-right:auto!important;margin-left:auto!important}.my-sm-0{margin-top:0!important;margin-bottom:0!important}.my-sm-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-sm-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-sm-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-sm-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-sm-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-sm-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-sm-0{margin-top:0!important}.mt-sm-1{margin-top:.25rem!important}.mt-sm-2{margin-top:.5rem!important}.mt-sm-3{margin-top:1rem!important}.mt-sm-4{margin-top:1.5rem!important}.mt-sm-5{margin-top:3rem!important}.mt-sm-auto{margin-top:auto!important}.me-sm-0{margin-right:0!important}.me-sm-1{margin-right:.25rem!important}.me-sm-2{margin-right:.5rem!important}.me-sm-3{margin-right:1rem!important}.me-sm-4{margin-right:1.5rem!important}.me-sm-5{margin-right:3rem!important}.me-sm-auto{margin-right:auto!important}.mb-sm-0{margin-bottom:0!important}.mb-sm-1{margin-bottom:.25rem!important}.mb-sm-2{margin-bottom:.5rem!important}.mb-sm-3{margin-bottom:1rem!important}.mb-sm-4{margin-bottom:1.5rem!important}.mb-sm-5{margin-bottom:3rem!important}.mb-sm-auto{margin-bottom:auto!important}.ms-sm-0{margin-left:0!important}.ms-sm-1{margin-left:.25rem!important}.ms-sm-2{margin-left:.5rem!important}.ms-sm-3{margin-left:1rem!important}.ms-sm-4{margin-left:1.5rem!important}.ms-sm-5{margin-left:3rem!important}.ms-sm-auto{margin-left:auto!important}.p-sm-0{padding:0!important}.p-sm-1{padding:.25rem!important}.p-sm-2{padding:.5rem!important}.p-sm-3{padding:1rem!important}.p-sm-4{padding:1.5rem!important}.p-sm-5{padding:3rem!important}.px-sm-0{padding-right:0!important;padding-left:0!important}.px-sm-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-sm-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-sm-3{padding-right:1rem!important;padding-left:1rem!important}.px-sm-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-sm-5{padding-right:3rem!important;padding-left:3rem!important}.py-sm-0{padding-top:0!important;padding-bottom:0!important}.py-sm-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-sm-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-sm-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-sm-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-sm-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-sm-0{padding-top:0!important}.pt-sm-1{padding-top:.25rem!important}.pt-sm-2{padding-top:.5rem!important}.pt-sm-3{padding-top:1rem!important}.pt-sm-4{padding-top:1.5rem!important}.pt-sm-5{padding-top:3rem!important}.pe-sm-0{padding-right:0!important}.pe-sm-1{padding-right:.25rem!important}.pe-sm-2{padding-right:.5rem!important}.pe-sm-3{padding-right:1rem!important}.pe-sm-4{padding-right:1.5rem!important}.pe-sm-5{padding-right:3rem!important}.pb-sm-0{padding-bottom:0!important}.pb-sm-1{padding-bottom:.25rem!important}.pb-sm-2{padding-bottom:.5rem!important}.pb-sm-3{padding-bottom:1rem!important}.pb-sm-4{padding-bottom:1.5rem!important}.pb-sm-5{padding-bottom:3rem!important}.ps-sm-0{padding-left:0!important}.ps-sm-1{padding-left:.25rem!important}.ps-sm-2{padding-left:.5rem!important}.ps-sm-3{padding-left:1rem!important}.ps-sm-4{padding-left:1.5rem!important}.ps-sm-5{padding-left:3rem!important}.gap-sm-0{gap:0!important}.gap-sm-1{gap:.25rem!important}.gap-sm-2{gap:.5rem!important}.gap-sm-3{gap:1rem!important}.gap-sm-4{gap:1.5rem!important}.gap-sm-5{gap:3rem!important}.text-sm-start{text-align:left!important}.text-sm-end{text-align:right!important}.text-sm-center{text-align:center!important}}@media (min-width:768px){.float-md-start{float:left!important}.float-md-end{float:right!important}.float-md-none{float:none!important}.d-md-inline{display:inline!important}.d-md-inline-block{display:inline-block!important}.d-md-block{display:block!important}.d-md-grid{display:grid!important}.d-md-table{display:table!important}.d-md-table-row{display:table-row!important}.d-md-table-cell{display:table-cell!important}.d-md-flex{display:flex!important}.d-md-inline-flex{display:inline-flex!important}.d-md-none{display:none!important}.flex-md-fill{flex:1 1 auto!important}.flex-md-row{flex-direction:row!important}.flex-md-column{flex-direction:column!important}.flex-md-row-reverse{flex-direction:row-reverse!important}.flex-md-column-reverse{flex-direction:column-reverse!important}.flex-md-grow-0{flex-grow:0!important}.flex-md-grow-1{flex-grow:1!important}.flex-md-shrink-0{flex-shrink:0!important}.flex-md-shrink-1{flex-shrink:1!important}.flex-md-wrap{flex-wrap:wrap!important}.flex-md-nowrap{flex-wrap:nowrap!important}.flex-md-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-md-start{justify-content:flex-start!important}.justify-content-md-end{justify-content:flex-end!important}.justify-content-md-center{justify-content:center!important}.justify-content-md-between{justify-content:space-between!important}.justify-content-md-around{justify-content:space-around!important}.justify-content-md-evenly{justify-content:space-evenly!important}.align-items-md-start{align-items:flex-start!important}.align-items-md-end{align-items:flex-end!important}.align-items-md-center{align-items:center!important}.align-items-md-baseline{align-items:baseline!important}.align-items-md-stretch{align-items:stretch!important}.align-content-md-start{align-content:flex-start!important}.align-content-md-end{align-content:flex-end!important}.align-content-md-center{align-content:center!important}.align-content-md-between{align-content:space-between!important}.align-content-md-around{align-content:space-around!important}.align-content-md-stretch{align-content:stretch!important}.align-self-md-auto{align-self:auto!important}.align-self-md-start{align-self:flex-start!important}.align-self-md-end{align-self:flex-end!important}.align-self-md-center{align-self:center!important}.align-self-md-baseline{align-self:baseline!important}.align-self-md-stretch{align-self:stretch!important}.order-md-first{order:-1!important}.order-md-0{order:0!important}.order-md-1{order:1!important}.order-md-2{order:2!important}.order-md-3{order:3!important}.order-md-4{order:4!important}.order-md-5{order:5!important}.order-md-last{order:6!important}.m-md-0{margin:0!important}.m-md-1{margin:.25rem!important}.m-md-2{margin:.5rem!important}.m-md-3{margin:1rem!important}.m-md-4{margin:1.5rem!important}.m-md-5{margin:3rem!important}.m-md-auto{margin:auto!important}.mx-md-0{margin-right:0!important;margin-left:0!important}.mx-md-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-md-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-md-3{margin-right:1rem!important;margin-left:1rem!important}.mx-md-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-md-5{margin-right:3rem!important;margin-left:3rem!important}.mx-md-auto{margin-right:auto!important;margin-left:auto!important}.my-md-0{margin-top:0!important;margin-bottom:0!important}.my-md-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-md-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-md-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-md-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-md-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-md-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-md-0{margin-top:0!important}.mt-md-1{margin-top:.25rem!important}.mt-md-2{margin-top:.5rem!important}.mt-md-3{margin-top:1rem!important}.mt-md-4{margin-top:1.5rem!important}.mt-md-5{margin-top:3rem!important}.mt-md-auto{margin-top:auto!important}.me-md-0{margin-right:0!important}.me-md-1{margin-right:.25rem!important}.me-md-2{margin-right:.5rem!important}.me-md-3{margin-right:1rem!important}.me-md-4{margin-right:1.5rem!important}.me-md-5{margin-right:3rem!important}.me-md-auto{margin-right:auto!important}.mb-md-0{margin-bottom:0!important}.mb-md-1{margin-bottom:.25rem!important}.mb-md-2{margin-bottom:.5rem!important}.mb-md-3{margin-bottom:1rem!important}.mb-md-4{margin-bottom:1.5rem!important}.mb-md-5{margin-bottom:3rem!important}.mb-md-auto{margin-bottom:auto!important}.ms-md-0{margin-left:0!important}.ms-md-1{margin-left:.25rem!important}.ms-md-2{margin-left:.5rem!important}.ms-md-3{margin-left:1rem!important}.ms-md-4{margin-left:1.5rem!important}.ms-md-5{margin-left:3rem!important}.ms-md-auto{margin-left:auto!important}.p-md-0{padding:0!important}.p-md-1{padding:.25rem!important}.p-md-2{padding:.5rem!important}.p-md-3{padding:1rem!important}.p-md-4{padding:1.5rem!important}.p-md-5{padding:3rem!important}.px-md-0{padding-right:0!important;padding-left:0!important}.px-md-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-md-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-md-3{padding-right:1rem!important;padding-left:1rem!important}.px-md-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-md-5{padding-right:3rem!important;padding-left:3rem!important}.py-md-0{padding-top:0!important;padding-bottom:0!important}.py-md-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-md-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-md-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-md-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-md-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-md-0{padding-top:0!important}.pt-md-1{padding-top:.25rem!important}.pt-md-2{padding-top:.5rem!important}.pt-md-3{padding-top:1rem!important}.pt-md-4{padding-top:1.5rem!important}.pt-md-5{padding-top:3rem!important}.pe-md-0{padding-right:0!important}.pe-md-1{padding-right:.25rem!important}.pe-md-2{padding-right:.5rem!important}.pe-md-3{padding-right:1rem!important}.pe-md-4{padding-right:1.5rem!important}.pe-md-5{padding-right:3rem!important}.pb-md-0{padding-bottom:0!important}.pb-md-1{padding-bottom:.25rem!important}.pb-md-2{padding-bottom:.5rem!important}.pb-md-3{padding-bottom:1rem!important}.pb-md-4{padding-bottom:1.5rem!important}.pb-md-5{padding-bottom:3rem!important}.ps-md-0{padding-left:0!important}.ps-md-1{padding-left:.25rem!important}.ps-md-2{padding-left:.5rem!important}.ps-md-3{padding-left:1rem!important}.ps-md-4{padding-left:1.5rem!important}.ps-md-5{padding-left:3rem!important}.gap-md-0{gap:0!important}.gap-md-1{gap:.25rem!important}.gap-md-2{gap:.5rem!important}.gap-md-3{gap:1rem!important}.gap-md-4{gap:1.5rem!important}.gap-md-5{gap:3rem!important}.text-md-start{text-align:left!important}.text-md-end{text-align:right!important}.text-md-center{text-align:center!important}}@media (min-width:992px){.float-lg-start{float:left!important}.float-lg-end{float:right!important}.float-lg-none{float:none!important}.d-lg-inline{display:inline!important}.d-lg-inline-block{display:inline-block!important}.d-lg-block{display:block!important}.d-lg-grid{display:grid!important}.d-lg-table{display:table!important}.d-lg-table-row{display:table-row!important}.d-lg-table-cell{display:table-cell!important}.d-lg-flex{display:flex!important}.d-lg-inline-flex{display:inline-flex!important}.d-lg-none{display:none!important}.flex-lg-fill{flex:1 1 auto!important}.flex-lg-row{flex-direction:row!important}.flex-lg-column{flex-direction:column!important}.flex-lg-row-reverse{flex-direction:row-reverse!important}.flex-lg-column-reverse{flex-direction:column-reverse!important}.flex-lg-grow-0{flex-grow:0!important}.flex-lg-grow-1{flex-grow:1!important}.flex-lg-shrink-0{flex-shrink:0!important}.flex-lg-shrink-1{flex-shrink:1!important}.flex-lg-wrap{flex-wrap:wrap!important}.flex-lg-nowrap{flex-wrap:nowrap!important}.flex-lg-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-lg-start{justify-content:flex-start!important}.justify-content-lg-end{justify-content:flex-end!important}.justify-content-lg-center{justify-content:center!important}.justify-content-lg-between{justify-content:space-between!important}.justify-content-lg-around{justify-content:space-around!important}.justify-content-lg-evenly{justify-content:space-evenly!important}.align-items-lg-start{align-items:flex-start!important}.align-items-lg-end{align-items:flex-end!important}.align-items-lg-center{align-items:center!important}.align-items-lg-baseline{align-items:baseline!important}.align-items-lg-stretch{align-items:stretch!important}.align-content-lg-start{align-content:flex-start!important}.align-content-lg-end{align-content:flex-end!important}.align-content-lg-center{align-content:center!important}.align-content-lg-between{align-content:space-between!important}.align-content-lg-around{align-content:space-around!important}.align-content-lg-stretch{align-content:stretch!important}.align-self-lg-auto{align-self:auto!important}.align-self-lg-start{align-self:flex-start!important}.align-self-lg-end{align-self:flex-end!important}.align-self-lg-center{align-self:center!important}.align-self-lg-baseline{align-self:baseline!important}.align-self-lg-stretch{align-self:stretch!important}.order-lg-first{order:-1!important}.order-lg-0{order:0!important}.order-lg-1{order:1!important}.order-lg-2{order:2!important}.order-lg-3{order:3!important}.order-lg-4{order:4!important}.order-lg-5{order:5!important}.order-lg-last{order:6!important}.m-lg-0{margin:0!important}.m-lg-1{margin:.25rem!important}.m-lg-2{margin:.5rem!important}.m-lg-3{margin:1rem!important}.m-lg-4{margin:1.5rem!important}.m-lg-5{margin:3rem!important}.m-lg-auto{margin:auto!important}.mx-lg-0{margin-right:0!important;margin-left:0!important}.mx-lg-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-lg-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-lg-3{margin-right:1rem!important;margin-left:1rem!important}.mx-lg-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-lg-5{margin-right:3rem!important;margin-left:3rem!important}.mx-lg-auto{margin-right:auto!important;margin-left:auto!important}.my-lg-0{margin-top:0!important;margin-bottom:0!important}.my-lg-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-lg-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-lg-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-lg-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-lg-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-lg-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-lg-0{margin-top:0!important}.mt-lg-1{margin-top:.25rem!important}.mt-lg-2{margin-top:.5rem!important}.mt-lg-3{margin-top:1rem!important}.mt-lg-4{margin-top:1.5rem!important}.mt-lg-5{margin-top:3rem!important}.mt-lg-auto{margin-top:auto!important}.me-lg-0{margin-right:0!important}.me-lg-1{margin-right:.25rem!important}.me-lg-2{margin-right:.5rem!important}.me-lg-3{margin-right:1rem!important}.me-lg-4{margin-right:1.5rem!important}.me-lg-5{margin-right:3rem!important}.me-lg-auto{margin-right:auto!important}.mb-lg-0{margin-bottom:0!important}.mb-lg-1{margin-bottom:.25rem!important}.mb-lg-2{margin-bottom:.5rem!important}.mb-lg-3{margin-bottom:1rem!important}.mb-lg-4{margin-bottom:1.5rem!important}.mb-lg-5{margin-bottom:3rem!important}.mb-lg-auto{margin-bottom:auto!important}.ms-lg-0{margin-left:0!important}.ms-lg-1{margin-left:.25rem!important}.ms-lg-2{margin-left:.5rem!important}.ms-lg-3{margin-left:1rem!important}.ms-lg-4{margin-left:1.5rem!important}.ms-lg-5{margin-left:3rem!important}.ms-lg-auto{margin-left:auto!important}.p-lg-0{padding:0!important}.p-lg-1{padding:.25rem!important}.p-lg-2{padding:.5rem!important}.p-lg-3{padding:1rem!important}.p-lg-4{padding:1.5rem!important}.p-lg-5{padding:3rem!important}.px-lg-0{padding-right:0!important;padding-left:0!important}.px-lg-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-lg-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-lg-3{padding-right:1rem!important;padding-left:1rem!important}.px-lg-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-lg-5{padding-right:3rem!important;padding-left:3rem!important}.py-lg-0{padding-top:0!important;padding-bottom:0!important}.py-lg-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-lg-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-lg-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-lg-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-lg-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-lg-0{padding-top:0!important}.pt-lg-1{padding-top:.25rem!important}.pt-lg-2{padding-top:.5rem!important}.pt-lg-3{padding-top:1rem!important}.pt-lg-4{padding-top:1.5rem!important}.pt-lg-5{padding-top:3rem!important}.pe-lg-0{padding-right:0!important}.pe-lg-1{padding-right:.25rem!important}.pe-lg-2{padding-right:.5rem!important}.pe-lg-3{padding-right:1rem!important}.pe-lg-4{padding-right:1.5rem!important}.pe-lg-5{padding-right:3rem!important}.pb-lg-0{padding-bottom:0!important}.pb-lg-1{padding-bottom:.25rem!important}.pb-lg-2{padding-bottom:.5rem!important}.pb-lg-3{padding-bottom:1rem!important}.pb-lg-4{padding-bottom:1.5rem!important}.pb-lg-5{padding-bottom:3rem!important}.ps-lg-0{padding-left:0!important}.ps-lg-1{padding-left:.25rem!important}.ps-lg-2{padding-left:.5rem!important}.ps-lg-3{padding-left:1rem!important}.ps-lg-4{padding-left:1.5rem!important}.ps-lg-5{padding-left:3rem!important}.gap-lg-0{gap:0!important}.gap-lg-1{gap:.25rem!important}.gap-lg-2{gap:.5rem!important}.gap-lg-3{gap:1rem!important}.gap-lg-4{gap:1.5rem!important}.gap-lg-5{gap:3rem!important}.text-lg-start{text-align:left!important}.text-lg-end{text-align:right!important}.text-lg-center{text-align:center!important}}@media (min-width:1200px){.float-xl-start{float:left!important}.float-xl-end{float:right!important}.float-xl-none{float:none!important}.d-xl-inline{display:inline!important}.d-xl-inline-block{display:inline-block!important}.d-xl-block{display:block!important}.d-xl-grid{display:grid!important}.d-xl-table{display:table!important}.d-xl-table-row{display:table-row!important}.d-xl-table-cell{display:table-cell!important}.d-xl-flex{display:flex!important}.d-xl-inline-flex{display:inline-flex!important}.d-xl-none{display:none!important}.flex-xl-fill{flex:1 1 auto!important}.flex-xl-row{flex-direction:row!important}.flex-xl-column{flex-direction:column!important}.flex-xl-row-reverse{flex-direction:row-reverse!important}.flex-xl-column-reverse{flex-direction:column-reverse!important}.flex-xl-grow-0{flex-grow:0!important}.flex-xl-grow-1{flex-grow:1!important}.flex-xl-shrink-0{flex-shrink:0!important}.flex-xl-shrink-1{flex-shrink:1!important}.flex-xl-wrap{flex-wrap:wrap!important}.flex-xl-nowrap{flex-wrap:nowrap!important}.flex-xl-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-xl-start{justify-content:flex-start!important}.justify-content-xl-end{justify-content:flex-end!important}.justify-content-xl-center{justify-content:center!important}.justify-content-xl-between{justify-content:space-between!important}.justify-content-xl-around{justify-content:space-around!important}.justify-content-xl-evenly{justify-content:space-evenly!important}.align-items-xl-start{align-items:flex-start!important}.align-items-xl-end{align-items:flex-end!important}.align-items-xl-center{align-items:center!important}.align-items-xl-baseline{align-items:baseline!important}.align-items-xl-stretch{align-items:stretch!important}.align-content-xl-start{align-content:flex-start!important}.align-content-xl-end{align-content:flex-end!important}.align-content-xl-center{align-content:center!important}.align-content-xl-between{align-content:space-between!important}.align-content-xl-around{align-content:space-around!important}.align-content-xl-stretch{align-content:stretch!important}.align-self-xl-auto{align-self:auto!important}.align-self-xl-start{align-self:flex-start!important}.align-self-xl-end{align-self:flex-end!important}.align-self-xl-center{align-self:center!important}.align-self-xl-baseline{align-self:baseline!important}.align-self-xl-stretch{align-self:stretch!important}.order-xl-first{order:-1!important}.order-xl-0{order:0!important}.order-xl-1{order:1!important}.order-xl-2{order:2!important}.order-xl-3{order:3!important}.order-xl-4{order:4!important}.order-xl-5{order:5!important}.order-xl-last{order:6!important}.m-xl-0{margin:0!important}.m-xl-1{margin:.25rem!important}.m-xl-2{margin:.5rem!important}.m-xl-3{margin:1rem!important}.m-xl-4{margin:1.5rem!important}.m-xl-5{margin:3rem!important}.m-xl-auto{margin:auto!important}.mx-xl-0{margin-right:0!important;margin-left:0!important}.mx-xl-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-xl-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-xl-3{margin-right:1rem!important;margin-left:1rem!important}.mx-xl-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-xl-5{margin-right:3rem!important;margin-left:3rem!important}.mx-xl-auto{margin-right:auto!important;margin-left:auto!important}.my-xl-0{margin-top:0!important;margin-bottom:0!important}.my-xl-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-xl-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-xl-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-xl-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-xl-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-xl-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-xl-0{margin-top:0!important}.mt-xl-1{margin-top:.25rem!important}.mt-xl-2{margin-top:.5rem!important}.mt-xl-3{margin-top:1rem!important}.mt-xl-4{margin-top:1.5rem!important}.mt-xl-5{margin-top:3rem!important}.mt-xl-auto{margin-top:auto!important}.me-xl-0{margin-right:0!important}.me-xl-1{margin-right:.25rem!important}.me-xl-2{margin-right:.5rem!important}.me-xl-3{margin-right:1rem!important}.me-xl-4{margin-right:1.5rem!important}.me-xl-5{margin-right:3rem!important}.me-xl-auto{margin-right:auto!important}.mb-xl-0{margin-bottom:0!important}.mb-xl-1{margin-bottom:.25rem!important}.mb-xl-2{margin-bottom:.5rem!important}.mb-xl-3{margin-bottom:1rem!important}.mb-xl-4{margin-bottom:1.5rem!important}.mb-xl-5{margin-bottom:3rem!important}.mb-xl-auto{margin-bottom:auto!important}.ms-xl-0{margin-left:0!important}.ms-xl-1{margin-left:.25rem!important}.ms-xl-2{margin-left:.5rem!important}.ms-xl-3{margin-left:1rem!important}.ms-xl-4{margin-left:1.5rem!important}.ms-xl-5{margin-left:3rem!important}.ms-xl-auto{margin-left:auto!important}.p-xl-0{padding:0!important}.p-xl-1{padding:.25rem!important}.p-xl-2{padding:.5rem!important}.p-xl-3{padding:1rem!important}.p-xl-4{padding:1.5rem!important}.p-xl-5{padding:3rem!important}.px-xl-0{padding-right:0!important;padding-left:0!important}.px-xl-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-xl-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-xl-3{padding-right:1rem!important;padding-left:1rem!important}.px-xl-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-xl-5{padding-right:3rem!important;padding-left:3rem!important}.py-xl-0{padding-top:0!important;padding-bottom:0!important}.py-xl-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-xl-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-xl-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-xl-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-xl-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-xl-0{padding-top:0!important}.pt-xl-1{padding-top:.25rem!important}.pt-xl-2{padding-top:.5rem!important}.pt-xl-3{padding-top:1rem!important}.pt-xl-4{padding-top:1.5rem!important}.pt-xl-5{padding-top:3rem!important}.pe-xl-0{padding-right:0!important}.pe-xl-1{padding-right:.25rem!important}.pe-xl-2{padding-right:.5rem!important}.pe-xl-3{padding-right:1rem!important}.pe-xl-4{padding-right:1.5rem!important}.pe-xl-5{padding-right:3rem!important}.pb-xl-0{padding-bottom:0!important}.pb-xl-1{padding-bottom:.25rem!important}.pb-xl-2{padding-bottom:.5rem!important}.pb-xl-3{padding-bottom:1rem!important}.pb-xl-4{padding-bottom:1.5rem!important}.pb-xl-5{padding-bottom:3rem!important}.ps-xl-0{padding-left:0!important}.ps-xl-1{padding-left:.25rem!important}.ps-xl-2{padding-left:.5rem!important}.ps-xl-3{padding-left:1rem!important}.ps-xl-4{padding-left:1.5rem!important}.ps-xl-5{padding-left:3rem!important}.gap-xl-0{gap:0!important}.gap-xl-1{gap:.25rem!important}.gap-xl-2{gap:.5rem!important}.gap-xl-3{gap:1rem!important}.gap-xl-4{gap:1.5rem!important}.gap-xl-5{gap:3rem!important}.text-xl-start{text-align:left!important}.text-xl-end{text-align:right!important}.text-xl-center{text-align:center!important}}@media (min-width:1400px){.float-xxl-start{float:left!important}.float-xxl-end{float:right!important}.float-xxl-none{float:none!important}.d-xxl-inline{display:inline!important}.d-xxl-inline-block{display:inline-block!important}.d-xxl-block{display:block!important}.d-xxl-grid{display:grid!important}.d-xxl-table{display:table!important}.d-xxl-table-row{display:table-row!important}.d-xxl-table-cell{display:table-cell!important}.d-xxl-flex{display:flex!important}.d-xxl-inline-flex{display:inline-flex!important}.d-xxl-none{display:none!important}.flex-xxl-fill{flex:1 1 auto!important}.flex-xxl-row{flex-direction:row!important}.flex-xxl-column{flex-direction:column!important}.flex-xxl-row-reverse{flex-direction:row-reverse!important}.flex-xxl-column-reverse{flex-direction:column-reverse!important}.flex-xxl-grow-0{flex-grow:0!important}.flex-xxl-grow-1{flex-grow:1!important}.flex-xxl-shrink-0{flex-shrink:0!important}.flex-xxl-shrink-1{flex-shrink:1!important}.flex-xxl-wrap{flex-wrap:wrap!important}.flex-xxl-nowrap{flex-wrap:nowrap!important}.flex-xxl-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-xxl-start{justify-content:flex-start!important}.justify-content-xxl-end{justify-content:flex-end!important}.justify-content-xxl-center{justify-content:center!important}.justify-content-xxl-between{justify-content:space-between!important}.justify-content-xxl-around{justify-content:space-around!important}.justify-content-xxl-evenly{justify-content:space-evenly!important}.align-items-xxl-start{align-items:flex-start!important}.align-items-xxl-end{align-items:flex-end!important}.align-items-xxl-center{align-items:center!important}.align-items-xxl-baseline{align-items:baseline!important}.align-items-xxl-stretch{align-items:stretch!important}.align-content-xxl-start{align-content:flex-start!important}.align-content-xxl-end{align-content:flex-end!important}.align-content-xxl-center{align-content:center!important}.align-content-xxl-between{align-content:space-between!important}.align-content-xxl-around{align-content:space-around!important}.align-content-xxl-stretch{align-content:stretch!important}.align-self-xxl-auto{align-self:auto!important}.align-self-xxl-start{align-self:flex-start!important}.align-self-xxl-end{align-self:flex-end!important}.align-self-xxl-center{align-self:center!important}.align-self-xxl-baseline{align-self:baseline!important}.align-self-xxl-stretch{align-self:stretch!important}.order-xxl-first{order:-1!important}.order-xxl-0{order:0!important}.order-xxl-1{order:1!important}.order-xxl-2{order:2!important}.order-xxl-3{order:3!important}.order-xxl-4{order:4!important}.order-xxl-5{order:5!important}.order-xxl-last{order:6!important}.m-xxl-0{margin:0!important}.m-xxl-1{margin:.25rem!important}.m-xxl-2{margin:.5rem!important}.m-xxl-3{margin:1rem!important}.m-xxl-4{margin:1.5rem!important}.m-xxl-5{margin:3rem!important}.m-xxl-auto{margin:auto!important}.mx-xxl-0{margin-right:0!important;margin-left:0!important}.mx-xxl-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-xxl-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-xxl-3{margin-right:1rem!important;margin-left:1rem!important}.mx-xxl-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-xxl-5{margin-right:3rem!important;margin-left:3rem!important}.mx-xxl-auto{margin-right:auto!important;margin-left:auto!important}.my-xxl-0{margin-top:0!important;margin-bottom:0!important}.my-xxl-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-xxl-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-xxl-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-xxl-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-xxl-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-xxl-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-xxl-0{margin-top:0!important}.mt-xxl-1{margin-top:.25rem!important}.mt-xxl-2{margin-top:.5rem!important}.mt-xxl-3{margin-top:1rem!important}.mt-xxl-4{margin-top:1.5rem!important}.mt-xxl-5{margin-top:3rem!important}.mt-xxl-auto{margin-top:auto!important}.me-xxl-0{margin-right:0!important}.me-xxl-1{margin-right:.25rem!important}.me-xxl-2{margin-right:.5rem!important}.me-xxl-3{margin-right:1rem!important}.me-xxl-4{margin-right:1.5rem!important}.me-xxl-5{margin-right:3rem!important}.me-xxl-auto{margin-right:auto!important}.mb-xxl-0{margin-bottom:0!important}.mb-xxl-1{margin-bottom:.25rem!important}.mb-xxl-2{margin-bottom:.5rem!important}.mb-xxl-3{margin-bottom:1rem!important}.mb-xxl-4{margin-bottom:1.5rem!important}.mb-xxl-5{margin-bottom:3rem!important}.mb-xxl-auto{margin-bottom:auto!important}.ms-xxl-0{margin-left:0!important}.ms-xxl-1{margin-left:.25rem!important}.ms-xxl-2{margin-left:.5rem!important}.ms-xxl-3{margin-left:1rem!important}.ms-xxl-4{margin-left:1.5rem!important}.ms-xxl-5{margin-left:3rem!important}.ms-xxl-auto{margin-left:auto!important}.p-xxl-0{padding:0!important}.p-xxl-1{padding:.25rem!important}.p-xxl-2{padding:.5rem!important}.p-xxl-3{padding:1rem!important}.p-xxl-4{padding:1.5rem!important}.p-xxl-5{padding:3rem!important}.px-xxl-0{padding-right:0!important;padding-left:0!important}.px-xxl-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-xxl-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-xxl-3{padding-right:1rem!important;padding-left:1rem!important}.px-xxl-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-xxl-5{padding-right:3rem!important;padding-left:3rem!important}.py-xxl-0{padding-top:0!important;padding-bottom:0!important}.py-xxl-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-xxl-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-xxl-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-xxl-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-xxl-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-xxl-0{padding-top:0!important}.pt-xxl-1{padding-top:.25rem!important}.pt-xxl-2{padding-top:.5rem!important}.pt-xxl-3{padding-top:1rem!important}.pt-xxl-4{padding-top:1.5rem!important}.pt-xxl-5{padding-top:3rem!important}.pe-xxl-0{padding-right:0!important}.pe-xxl-1{padding-right:.25rem!important}.pe-xxl-2{padding-right:.5rem!important}.pe-xxl-3{padding-right:1rem!important}.pe-xxl-4{padding-right:1.5rem!important}.pe-xxl-5{padding-right:3rem!important}.pb-xxl-0{padding-bottom:0!important}.pb-xxl-1{padding-bottom:.25rem!important}.pb-xxl-2{padding-bottom:.5rem!important}.pb-xxl-3{padding-bottom:1rem!important}.pb-xxl-4{padding-bottom:1.5rem!important}.pb-xxl-5{padding-bottom:3rem!important}.ps-xxl-0{padding-left:0!important}.ps-xxl-1{padding-left:.25rem!important}.ps-xxl-2{padding-left:.5rem!important}.ps-xxl-3{padding-left:1rem!important}.ps-xxl-4{padding-left:1.5rem!important}.ps-xxl-5{padding-left:3rem!important}.gap-xxl-0{gap:0!important}.gap-xxl-1{gap:.25rem!important}.gap-xxl-2{gap:.5rem!important}.gap-xxl-3{gap:1rem!important}.gap-xxl-4{gap:1.5rem!important}.gap-xxl-5{gap:3rem!important}.text-xxl-start{text-align:left!important}.text-xxl-end{text-align:right!important}.text-xxl-center{text-align:center!important}}@media (min-width:1200px){.fs-1{font-size:2.5rem!important}.fs-2{font-size:2rem!important}.fs-3{font-size:1.75rem!important}.fs-4{font-size:1.5rem!important}}@media print{.d-print-inline{display:inline!important}.d-print-inline-block{display:inline-block!important}.d-print-block{display:block!important}.d-print-grid{display:grid!important}.d-print-table{display:table!important}.d-print-table-row{display:table-row!important}.d-print-table-cell{display:table-cell!important}.d-print-flex{display:flex!important}.d-print-inline-flex{display:inline-flex!important}.d-print-none{display:none!important}} | |
| 21 /*# sourceMappingURL=bootstrap.min.css.map */</style> | |
| 22 <body | |
| 23 class="bg-secondary bg-gradient" | |
| 24 style="--bs-bg-opacity: .1; padding-top: 80px;" | |
| 25 > | |
| 26 <nav | |
| 27 class="navbar justify-content-center navbar-dark navbar-expand" | |
| 28 id="history_metadata_extractor_masthead" | |
| 29 style=" | |
| 30 background-color: #2c3143; | |
| 31 top:0px; | |
| 32 position:fixed; | |
| 33 width: 100%; | |
| 34 z-index: 999 ; | |
| 35 " | |
| 36 > | |
| 37 <a class="navbar-brand"> | |
| 38 <span class="navbar-brand-title"> <h1>Galaxy - 22.01</h1></span> | |
| 39 </a> | |
| 40 | |
| 41 <button id="history_metadata_extractor_top" class="btn btn-outline-light d-block m-2"> | |
| 42 Top | |
| 43 </button> | |
| 44 <button id="history_metadata_extractor_folder" class="btn btn-outline-light d-block m-2"> | |
| 45 Fold/Unfold tables | |
| 46 </button> | |
| 47 <button id="history_metadata_extractor_toggle_deleted" class="btn btn-outline-light d-block m-2"> | |
| 48 Show/Hide deleted | |
| 49 </button> | |
| 50 <button id="history_metadata_extractor_bottom" class="btn btn-outline-light d-block m-2"> | |
| 51 Bottom | |
| 52 </button> | |
| 53 </nav> | |
| 54 <div | |
| 55 id="history_metadata_extractor_content" | |
| 56 class="container pt-2 bg-white" | |
| 57 style="overflow-y: auto ; height: 100%" | |
| 58 > | |
| 59 | |
| 60 <div class="alert alert-success"> | |
| 61 <h2 | |
| 62 class="history_metadata_extractor_h2" | |
| 63 style="cursor: pointer" | |
| 64 title="click to fold/unfold the table" | |
| 65 > | |
| 66 [1] - __DATA_FETCH__ - 0.1.0 | |
| 67 </h2> | |
| 68 <p> | |
| 69 Outputs: | |
| 70 </p> | |
| 71 <p class="history_metadata_extractor_status"> | |
| 72 Status: Ok (0) | |
| 73 </p> | |
| 74 <p class="history_metadata_extractor_glitter"></p> | |
| 75 <table class=" | |
| 76 table | |
| 77 table-bordered | |
| 78 table-dark | |
| 79 table-striped | |
| 80 table-hover | |
| 81 d-block | |
| 82 overflow-auto | |
| 83 history_metadata_extractor_table | |
| 84 "> | |
| 85 <thead> | |
| 86 <tr> | |
| 87 <th scope="col"></th> | |
| 88 <th scope="col">value</th> | |
| 89 <th scope="col">name</th> | |
| 90 <th scope="col">extension</th> | |
| 91 <th scope="col">hid</th> | |
| 92 </tr> | |
| 93 </thead> | |
| 94 <tr class=""> | |
| 95 <th scope="row">file_count</th> | |
| 96 <td>1</td> | |
| 97 <td></td> | |
| 98 <td></td> | |
| 99 <td></td> | |
| 100 </tr><tr class=""> | |
| 101 <th scope="row">files</th> | |
| 102 <td>file_data: /galaxy/data/tmp/c400d309afc6474c8b5d1900ad47051a</td> | |
| 103 <td>test.rdata</td> | |
| 104 <td>auto</td> | |
| 105 <td>232343</td> | |
| 106 </tr><tr class=""> | |
| 107 <th scope="row">paramfile</th> | |
| 108 <td>None</td> | |
| 109 <td></td> | |
| 110 <td></td> | |
| 111 <td></td> | |
| 112 </tr><tr class=""> | |
| 113 <th scope="row">request_version</th> | |
| 114 <td>1</td> | |
| 115 <td></td> | |
| 116 <td></td> | |
| 117 <td></td> | |
| 118 </tr><tr class=""> | |
| 119 <th scope="row">auto_decompress</th> | |
| 120 <td>True</td> | |
| 121 <td></td> | |
| 122 <td></td> | |
| 123 <td></td> | |
| 124 </tr><tr class=""> | |
| 125 <th scope="row">check_content</th> | |
| 126 <td>True</td> | |
| 127 <td></td> | |
| 128 <td></td> | |
| 129 <td></td> | |
| 130 </tr> | |
| 131 </table> | |
| 132 </div> | |
| 133 | |
| 134 | |
| 135 <div class="alert alert-success"> | |
| 136 <h2 | |
| 137 class="history_metadata_extractor_h2" | |
| 138 style="cursor: pointer" | |
| 139 title="click to fold/unfold the table" | |
| 140 > | |
| 141 [42] - __DATA_FETCH__ - 0.1.0 | |
| 142 </h2> | |
| 143 <p> | |
| 144 Outputs: | |
| 145 </p> | |
| 146 <p class="history_metadata_extractor_status"> | |
| 147 Status: Ok (0) | |
| 148 </p> | |
| 149 <p class="history_metadata_extractor_glitter"></p> | |
| 150 <table class=" | |
| 151 table | |
| 152 table-bordered | |
| 153 table-dark | |
| 154 table-striped | |
| 155 table-hover | |
| 156 d-block | |
| 157 overflow-auto | |
| 158 history_metadata_extractor_table | |
| 159 "> | |
| 160 <thead> | |
| 161 <tr> | |
| 162 <th scope="col"></th> | |
| 163 <th scope="col">value</th> | |
| 164 <th scope="col">name</th> | |
| 165 <th scope="col">extension</th> | |
| 166 <th scope="col">hid</th> | |
| 167 </tr> | |
| 168 </thead> | |
| 169 <tr class=""> | |
| 170 <th scope="row">file_count</th> | |
| 171 <td>1</td> | |
| 172 <td></td> | |
| 173 <td></td> | |
| 174 <td></td> | |
| 175 </tr><tr class=""> | |
| 176 <th scope="row">files</th> | |
| 177 <td>file_data: /galaxy/data/tmp/e44f6de2f1fd410ab5ab76d3589ed689</td> | |
| 178 <td>peaklist_fragments.tsv</td> | |
| 179 <td>auto</td> | |
| 180 <td>232384</td> | |
| 181 </tr><tr class=""> | |
| 182 <th scope="row">paramfile</th> | |
| 183 <td>None</td> | |
| 184 <td></td> | |
| 185 <td></td> | |
| 186 <td></td> | |
| 187 </tr><tr class=""> | |
| 188 <th scope="row">request_version</th> | |
| 189 <td>1</td> | |
| 190 <td></td> | |
| 191 <td></td> | |
| 192 <td></td> | |
| 193 </tr><tr class=""> | |
| 194 <th scope="row">auto_decompress</th> | |
| 195 <td>True</td> | |
| 196 <td></td> | |
| 197 <td></td> | |
| 198 <td></td> | |
| 199 </tr><tr class=""> | |
| 200 <th scope="row">check_content</th> | |
| 201 <td>True</td> | |
| 202 <td></td> | |
| 203 <td></td> | |
| 204 <td></td> | |
| 205 </tr> | |
| 206 </table> | |
| 207 </div> | |
| 208 | |
| 209 | |
| 210 <div class="alert alert-success history_metadata_extractor_deleted"> | |
| 211 <h2 | |
| 212 class="history_metadata_extractor_h2" | |
| 213 style="cursor: pointer" | |
| 214 title="click to fold/unfold the table" | |
| 215 > | |
| 216 [DELETED] - csv_to_tabular - 1.0.0 | |
| 217 </h2> | |
| 218 <p> | |
| 219 Outputs: | |
| 220 </p> | |
| 221 <p class="history_metadata_extractor_status"> | |
| 222 Status: Ok (0) | |
| 223 </p> | |
| 224 <p class="history_metadata_extractor_glitter"></p> | |
| 225 <table class=" | |
| 226 table | |
| 227 table-bordered | |
| 228 table-dark | |
| 229 table-striped | |
| 230 table-hover | |
| 231 d-block | |
| 232 overflow-auto | |
| 233 history_metadata_extractor_table | |
| 234 "> | |
| 235 <thead> | |
| 236 <tr> | |
| 237 <th scope="col"></th> | |
| 238 <th scope="col">value</th> | |
| 239 <th scope="col">name</th> | |
| 240 <th scope="col">extension</th> | |
| 241 <th scope="col">hid</th> | |
| 242 </tr> | |
| 243 </thead> | |
| 244 <tr class=""> | |
| 245 <th scope="row">__target_datatype__</th> | |
| 246 <td>tabular</td> | |
| 247 <td></td> | |
| 248 <td></td> | |
| 249 <td></td> | |
| 250 </tr><tr class=""> | |
| 251 <th scope="row">csv</th> | |
| 252 <td>eee378ebc66a66f1</td> | |
| 253 <td>peaklist_precursors.csv</td> | |
| 254 <td>csv</td> | |
| 255 <td>43</td> | |
| 256 </tr> | |
| 257 </table> | |
| 258 </div> | |
| 259 | |
| 260 | |
| 261 <div class="alert alert-success"> | |
| 262 <h2 | |
| 263 class="history_metadata_extractor_h2" | |
| 264 style="cursor: pointer" | |
| 265 title="click to fold/unfold the table" | |
| 266 > | |
| 267 [43] - __DATA_FETCH__ - 0.1.0 | |
| 268 </h2> | |
| 269 <p> | |
| 270 Outputs: | |
| 271 </p> | |
| 272 <p class="history_metadata_extractor_status"> | |
| 273 Status: Ok (0) | |
| 274 </p> | |
| 275 <p class="history_metadata_extractor_glitter"></p> | |
| 276 <table class=" | |
| 277 table | |
| 278 table-bordered | |
| 279 table-dark | |
| 280 table-striped | |
| 281 table-hover | |
| 282 d-block | |
| 283 overflow-auto | |
| 284 history_metadata_extractor_table | |
| 285 "> | |
| 286 <thead> | |
| 287 <tr> | |
| 288 <th scope="col"></th> | |
| 289 <th scope="col">value</th> | |
| 290 <th scope="col">name</th> | |
| 291 <th scope="col">extension</th> | |
| 292 <th scope="col">hid</th> | |
| 293 </tr> | |
| 294 </thead> | |
| 295 <tr class=""> | |
| 296 <th scope="row">file_count</th> | |
| 297 <td>1</td> | |
| 298 <td></td> | |
| 299 <td></td> | |
| 300 <td></td> | |
| 301 </tr><tr class=""> | |
| 302 <th scope="row">files</th> | |
| 303 <td>file_data: /galaxy/data/tmp/7964e374d9fa423cb3438b054c7f91f0</td> | |
| 304 <td>peaklist_precursors.csv</td> | |
| 305 <td>auto</td> | |
| 306 <td>232385</td> | |
| 307 </tr><tr class=""> | |
| 308 <th scope="row">paramfile</th> | |
| 309 <td>None</td> | |
| 310 <td></td> | |
| 311 <td></td> | |
| 312 <td></td> | |
| 313 </tr><tr class=""> | |
| 314 <th scope="row">request_version</th> | |
| 315 <td>1</td> | |
| 316 <td></td> | |
| 317 <td></td> | |
| 318 <td></td> | |
| 319 </tr><tr class=""> | |
| 320 <th scope="row">auto_decompress</th> | |
| 321 <td>True</td> | |
| 322 <td></td> | |
| 323 <td></td> | |
| 324 <td></td> | |
| 325 </tr><tr class=""> | |
| 326 <th scope="row">check_content</th> | |
| 327 <td>True</td> | |
| 328 <td></td> | |
| 329 <td></td> | |
| 330 <td></td> | |
| 331 </tr> | |
| 332 </table> | |
| 333 </div> | |
| 334 | |
| 335 | |
| 336 <div class="alert alert-success"> | |
| 337 <h2 | |
| 338 class="history_metadata_extractor_h2" | |
| 339 style="cursor: pointer" | |
| 340 title="click to fold/unfold the table" | |
| 341 > | |
| 342 [44] - __DATA_FETCH__ - 0.1.0 | |
| 343 </h2> | |
| 344 <p> | |
| 345 Outputs: | |
| 346 </p> | |
| 347 <p class="history_metadata_extractor_status"> | |
| 348 Status: Ok (0) | |
| 349 </p> | |
| 350 <p class="history_metadata_extractor_glitter"></p> | |
| 351 <table class=" | |
| 352 table | |
| 353 table-bordered | |
| 354 table-dark | |
| 355 table-striped | |
| 356 table-hover | |
| 357 d-block | |
| 358 overflow-auto | |
| 359 history_metadata_extractor_table | |
| 360 "> | |
| 361 <thead> | |
| 362 <tr> | |
| 363 <th scope="col"></th> | |
| 364 <th scope="col">value</th> | |
| 365 <th scope="col">name</th> | |
| 366 <th scope="col">extension</th> | |
| 367 <th scope="col">hid</th> | |
| 368 </tr> | |
| 369 </thead> | |
| 370 <tr class=""> | |
| 371 <th scope="row">file_count</th> | |
| 372 <td>1</td> | |
| 373 <td></td> | |
| 374 <td></td> | |
| 375 <td></td> | |
| 376 </tr><tr class=""> | |
| 377 <th scope="row">files</th> | |
| 378 <td>file_data: /galaxy/data/tmp/2e503324d9d54059953fac2d6151c762</td> | |
| 379 <td>compounds_pos.txt</td> | |
| 380 <td>auto</td> | |
| 381 <td>232386</td> | |
| 382 </tr><tr class=""> | |
| 383 <th scope="row">paramfile</th> | |
| 384 <td>None</td> | |
| 385 <td></td> | |
| 386 <td></td> | |
| 387 <td></td> | |
| 388 </tr><tr class=""> | |
| 389 <th scope="row">request_version</th> | |
| 390 <td>1</td> | |
| 391 <td></td> | |
| 392 <td></td> | |
| 393 <td></td> | |
| 394 </tr><tr class=""> | |
| 395 <th scope="row">auto_decompress</th> | |
| 396 <td>True</td> | |
| 397 <td></td> | |
| 398 <td></td> | |
| 399 <td></td> | |
| 400 </tr><tr class=""> | |
| 401 <th scope="row">check_content</th> | |
| 402 <td>True</td> | |
| 403 <td></td> | |
| 404 <td></td> | |
| 405 <td></td> | |
| 406 </tr> | |
| 407 </table> | |
| 408 </div> | |
| 409 | |
| 410 | |
| 411 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 412 <h2 | |
| 413 class="history_metadata_extractor_h2" | |
| 414 style="cursor: pointer" | |
| 415 title="click to fold/unfold the table" | |
| 416 > | |
| 417 [DELETED] - Batch_correction - 3.0.0 | |
| 418 </h2> | |
| 419 <p> | |
| 420 Outputs: | |
| 421 </p> | |
| 422 <p class="history_metadata_extractor_status"> | |
| 423 Status: Failed (1) | |
| 424 </p> | |
| 425 <p class="history_metadata_extractor_glitter"></p> | |
| 426 <table class=" | |
| 427 table | |
| 428 table-bordered | |
| 429 table-dark | |
| 430 table-striped | |
| 431 table-hover | |
| 432 d-block | |
| 433 overflow-auto | |
| 434 history_metadata_extractor_table | |
| 435 "> | |
| 436 <thead> | |
| 437 <tr> | |
| 438 <th scope="col"></th> | |
| 439 <th scope="col">value</th> | |
| 440 <th scope="col">name</th> | |
| 441 <th scope="col">extension</th> | |
| 442 <th scope="col">hid</th> | |
| 443 </tr> | |
| 444 </thead> | |
| 445 <tr class=""> | |
| 446 <th scope="row">dataMatrix</th> | |
| 447 <td>9a0ce47bd1734ae7</td> | |
| 448 <td>peaklist_fragments.tsv</td> | |
| 449 <td>tabular</td> | |
| 450 <td>42</td> | |
| 451 </tr><tr class=""> | |
| 452 <th scope="row">sampleMetadata</th> | |
| 453 <td></td> | |
| 454 <td></td> | |
| 455 <td></td> | |
| 456 <td></td> | |
| 457 </tr><tr class=""> | |
| 458 <th scope="row">batch_col_name</th> | |
| 459 <td>batch</td> | |
| 460 <td></td> | |
| 461 <td></td> | |
| 462 <td></td> | |
| 463 </tr><tr class=""> | |
| 464 <th scope="row">injection_order_col_name</th> | |
| 465 <td>injectionOrder</td> | |
| 466 <td></td> | |
| 467 <td></td> | |
| 468 <td></td> | |
| 469 </tr><tr class=""> | |
| 470 <th scope="row">sampleTypeTagBlank</th> | |
| 471 <td>blank</td> | |
| 472 <td></td> | |
| 473 <td></td> | |
| 474 <td></td> | |
| 475 </tr><tr class=""> | |
| 476 <th scope="row">sampleTypeTagPool</th> | |
| 477 <td>pool</td> | |
| 478 <td></td> | |
| 479 <td></td> | |
| 480 <td></td> | |
| 481 </tr><tr class=""> | |
| 482 <th scope="row">sampleTypeTagSample</th> | |
| 483 <td>sample</td> | |
| 484 <td></td> | |
| 485 <td></td> | |
| 486 <td></td> | |
| 487 </tr><tr class=""> | |
| 488 <th scope="row">sample_type_col_name</th> | |
| 489 <td>sampleType</td> | |
| 490 <td></td> | |
| 491 <td></td> | |
| 492 <td></td> | |
| 493 </tr><tr class=""> | |
| 494 <th scope="row">detail</th> | |
| 495 <td>no</td> | |
| 496 <td></td> | |
| 497 <td></td> | |
| 498 <td></td> | |
| 499 </tr><tr class=""> | |
| 500 <th scope="row">method</th> | |
| 501 <td>linear</td> | |
| 502 <td></td> | |
| 503 <td></td> | |
| 504 <td></td> | |
| 505 </tr><tr class=""> | |
| 506 <th scope="row">ref_factor</th> | |
| 507 <td>batch</td> | |
| 508 <td></td> | |
| 509 <td></td> | |
| 510 <td></td> | |
| 511 </tr><tr class=""> | |
| 512 <th scope="row">valnull</th> | |
| 513 <td>none</td> | |
| 514 <td></td> | |
| 515 <td></td> | |
| 516 <td></td> | |
| 517 </tr><tr class=""> | |
| 518 <th scope="row">variableMetadata</th> | |
| 519 <td>9a0ce47bd1734ae7</td> | |
| 520 <td>peaklist_fragments.tsv</td> | |
| 521 <td>tabular</td> | |
| 522 <td>42</td> | |
| 523 </tr> | |
| 524 </table> | |
| 525 </div> | |
| 526 | |
| 527 | |
| 528 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 529 <h2 | |
| 530 class="history_metadata_extractor_h2" | |
| 531 style="cursor: pointer" | |
| 532 title="click to fold/unfold the table" | |
| 533 > | |
| 534 [DELETED] - Batch_correction - 3.0.0 | |
| 535 </h2> | |
| 536 <p> | |
| 537 Outputs: | |
| 538 </p> | |
| 539 <p class="history_metadata_extractor_status"> | |
| 540 Status: Failed (1) | |
| 541 </p> | |
| 542 <p class="history_metadata_extractor_glitter"></p> | |
| 543 <table class=" | |
| 544 table | |
| 545 table-bordered | |
| 546 table-dark | |
| 547 table-striped | |
| 548 table-hover | |
| 549 d-block | |
| 550 overflow-auto | |
| 551 history_metadata_extractor_table | |
| 552 "> | |
| 553 <thead> | |
| 554 <tr> | |
| 555 <th scope="col"></th> | |
| 556 <th scope="col">value</th> | |
| 557 <th scope="col">name</th> | |
| 558 <th scope="col">extension</th> | |
| 559 <th scope="col">hid</th> | |
| 560 </tr> | |
| 561 </thead> | |
| 562 <tr class=""> | |
| 563 <th scope="row">dataMatrix</th> | |
| 564 <td>9a0ce47bd1734ae7</td> | |
| 565 <td>peaklist_fragments.tsv</td> | |
| 566 <td>tabular</td> | |
| 567 <td>42</td> | |
| 568 </tr><tr class=""> | |
| 569 <th scope="row">sampleMetadata</th> | |
| 570 <td></td> | |
| 571 <td></td> | |
| 572 <td></td> | |
| 573 <td></td> | |
| 574 </tr><tr class=""> | |
| 575 <th scope="row">batch_col_name</th> | |
| 576 <td>batch</td> | |
| 577 <td></td> | |
| 578 <td></td> | |
| 579 <td></td> | |
| 580 </tr><tr class=""> | |
| 581 <th scope="row">injection_order_col_name</th> | |
| 582 <td>injectionOrder</td> | |
| 583 <td></td> | |
| 584 <td></td> | |
| 585 <td></td> | |
| 586 </tr><tr class=""> | |
| 587 <th scope="row">sampleTypeTagBlank</th> | |
| 588 <td>blank</td> | |
| 589 <td></td> | |
| 590 <td></td> | |
| 591 <td></td> | |
| 592 </tr><tr class=""> | |
| 593 <th scope="row">sampleTypeTagPool</th> | |
| 594 <td>pool</td> | |
| 595 <td></td> | |
| 596 <td></td> | |
| 597 <td></td> | |
| 598 </tr><tr class=""> | |
| 599 <th scope="row">sampleTypeTagSample</th> | |
| 600 <td>sample</td> | |
| 601 <td></td> | |
| 602 <td></td> | |
| 603 <td></td> | |
| 604 </tr><tr class=""> | |
| 605 <th scope="row">sample_type_col_name</th> | |
| 606 <td>sampleType</td> | |
| 607 <td></td> | |
| 608 <td></td> | |
| 609 <td></td> | |
| 610 </tr><tr class=""> | |
| 611 <th scope="row">detail</th> | |
| 612 <td>no</td> | |
| 613 <td></td> | |
| 614 <td></td> | |
| 615 <td></td> | |
| 616 </tr><tr class=""> | |
| 617 <th scope="row">method</th> | |
| 618 <td>linear</td> | |
| 619 <td></td> | |
| 620 <td></td> | |
| 621 <td></td> | |
| 622 </tr><tr class=""> | |
| 623 <th scope="row">ref_factor</th> | |
| 624 <td>batch</td> | |
| 625 <td></td> | |
| 626 <td></td> | |
| 627 <td></td> | |
| 628 </tr><tr class=""> | |
| 629 <th scope="row">valnull</th> | |
| 630 <td>none</td> | |
| 631 <td></td> | |
| 632 <td></td> | |
| 633 <td></td> | |
| 634 </tr><tr class=""> | |
| 635 <th scope="row">variableMetadata</th> | |
| 636 <td>9a0ce47bd1734ae7</td> | |
| 637 <td>peaklist_fragments.tsv</td> | |
| 638 <td>tabular</td> | |
| 639 <td>42</td> | |
| 640 </tr> | |
| 641 </table> | |
| 642 </div> | |
| 643 | |
| 644 | |
| 645 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 646 <h2 | |
| 647 class="history_metadata_extractor_h2" | |
| 648 style="cursor: pointer" | |
| 649 title="click to fold/unfold the table" | |
| 650 > | |
| 651 [DELETED] - Batch_correction - 3.0.0 | |
| 652 </h2> | |
| 653 <p> | |
| 654 Outputs: | |
| 655 </p> | |
| 656 <p class="history_metadata_extractor_status"> | |
| 657 Status: Failed (1) | |
| 658 </p> | |
| 659 <p class="history_metadata_extractor_glitter"></p> | |
| 660 <table class=" | |
| 661 table | |
| 662 table-bordered | |
| 663 table-dark | |
| 664 table-striped | |
| 665 table-hover | |
| 666 d-block | |
| 667 overflow-auto | |
| 668 history_metadata_extractor_table | |
| 669 "> | |
| 670 <thead> | |
| 671 <tr> | |
| 672 <th scope="col"></th> | |
| 673 <th scope="col">value</th> | |
| 674 <th scope="col">name</th> | |
| 675 <th scope="col">extension</th> | |
| 676 <th scope="col">hid</th> | |
| 677 </tr> | |
| 678 </thead> | |
| 679 <tr class=""> | |
| 680 <th scope="row">dataMatrix</th> | |
| 681 <td>9a0ce47bd1734ae7</td> | |
| 682 <td>peaklist_fragments.tsv</td> | |
| 683 <td>tabular</td> | |
| 684 <td>42</td> | |
| 685 </tr><tr class=""> | |
| 686 <th scope="row">sampleMetadata</th> | |
| 687 <td></td> | |
| 688 <td></td> | |
| 689 <td></td> | |
| 690 <td></td> | |
| 691 </tr><tr class=""> | |
| 692 <th scope="row">batch_col_name</th> | |
| 693 <td>batch</td> | |
| 694 <td></td> | |
| 695 <td></td> | |
| 696 <td></td> | |
| 697 </tr><tr class=""> | |
| 698 <th scope="row">injection_order_col_name</th> | |
| 699 <td>injectionOrder</td> | |
| 700 <td></td> | |
| 701 <td></td> | |
| 702 <td></td> | |
| 703 </tr><tr class=""> | |
| 704 <th scope="row">sampleTypeTagBlank</th> | |
| 705 <td>blank</td> | |
| 706 <td></td> | |
| 707 <td></td> | |
| 708 <td></td> | |
| 709 </tr><tr class=""> | |
| 710 <th scope="row">sampleTypeTagPool</th> | |
| 711 <td>pool</td> | |
| 712 <td></td> | |
| 713 <td></td> | |
| 714 <td></td> | |
| 715 </tr><tr class=""> | |
| 716 <th scope="row">sampleTypeTagSample</th> | |
| 717 <td>sample</td> | |
| 718 <td></td> | |
| 719 <td></td> | |
| 720 <td></td> | |
| 721 </tr><tr class=""> | |
| 722 <th scope="row">sample_type_col_name</th> | |
| 723 <td>sampleType</td> | |
| 724 <td></td> | |
| 725 <td></td> | |
| 726 <td></td> | |
| 727 </tr><tr class=""> | |
| 728 <th scope="row">detail</th> | |
| 729 <td>no</td> | |
| 730 <td></td> | |
| 731 <td></td> | |
| 732 <td></td> | |
| 733 </tr><tr class=""> | |
| 734 <th scope="row">method</th> | |
| 735 <td>linear</td> | |
| 736 <td></td> | |
| 737 <td></td> | |
| 738 <td></td> | |
| 739 </tr><tr class=""> | |
| 740 <th scope="row">ref_factor</th> | |
| 741 <td>batch</td> | |
| 742 <td></td> | |
| 743 <td></td> | |
| 744 <td></td> | |
| 745 </tr><tr class=""> | |
| 746 <th scope="row">valnull</th> | |
| 747 <td>none</td> | |
| 748 <td></td> | |
| 749 <td></td> | |
| 750 <td></td> | |
| 751 </tr><tr class=""> | |
| 752 <th scope="row">variableMetadata</th> | |
| 753 <td>9a0ce47bd1734ae7</td> | |
| 754 <td>peaklist_fragments.tsv</td> | |
| 755 <td>tabular</td> | |
| 756 <td>42</td> | |
| 757 </tr> | |
| 758 </table> | |
| 759 </div> | |
| 760 | |
| 761 | |
| 762 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 763 <h2 | |
| 764 class="history_metadata_extractor_h2" | |
| 765 style="cursor: pointer" | |
| 766 title="click to fold/unfold the table" | |
| 767 > | |
| 768 [DELETED] - quality_metrics - 2.2.8 | |
| 769 </h2> | |
| 770 <p> | |
| 771 Outputs: | |
| 772 </p> | |
| 773 <p class="history_metadata_extractor_status"> | |
| 774 Status: Failed (1) | |
| 775 </p> | |
| 776 <p class="history_metadata_extractor_glitter"></p> | |
| 777 <table class=" | |
| 778 table | |
| 779 table-bordered | |
| 780 table-dark | |
| 781 table-striped | |
| 782 table-hover | |
| 783 d-block | |
| 784 overflow-auto | |
| 785 history_metadata_extractor_table | |
| 786 "> | |
| 787 <thead> | |
| 788 <tr> | |
| 789 <th scope="col"></th> | |
| 790 <th scope="col">value</th> | |
| 791 <th scope="col">name</th> | |
| 792 <th scope="col">extension</th> | |
| 793 <th scope="col">hid</th> | |
| 794 </tr> | |
| 795 </thead> | |
| 796 <tr class=""> | |
| 797 <th scope="row">CV</th> | |
| 798 <td>FALSE</td> | |
| 799 <td></td> | |
| 800 <td></td> | |
| 801 <td></td> | |
| 802 </tr><tr class=""> | |
| 803 <th scope="row">Compa</th> | |
| 804 <td>TRUE</td> | |
| 805 <td></td> | |
| 806 <td></td> | |
| 807 <td></td> | |
| 808 </tr><tr class=""> | |
| 809 <th scope="row">seuil</th> | |
| 810 <td>1</td> | |
| 811 <td></td> | |
| 812 <td></td> | |
| 813 <td></td> | |
| 814 </tr><tr class=""> | |
| 815 <th scope="row">optC</th> | |
| 816 <td>default</td> | |
| 817 <td></td> | |
| 818 <td></td> | |
| 819 <td></td> | |
| 820 </tr><tr class=""> | |
| 821 <th scope="row">poolAsPool1L</th> | |
| 822 <td>TRUE</td> | |
| 823 <td></td> | |
| 824 <td></td> | |
| 825 <td></td> | |
| 826 </tr><tr class=""> | |
| 827 <th scope="row">dataMatrix_in</th> | |
| 828 <td>9a0ce47bd1734ae7</td> | |
| 829 <td>peaklist_fragments.tsv</td> | |
| 830 <td>tabular</td> | |
| 831 <td>42</td> | |
| 832 </tr><tr class=""> | |
| 833 <th scope="row">sampleMetadata_in</th> | |
| 834 <td>9a0ce47bd1734ae7</td> | |
| 835 <td>peaklist_fragments.tsv</td> | |
| 836 <td>tabular</td> | |
| 837 <td>42</td> | |
| 838 </tr><tr class=""> | |
| 839 <th scope="row">variableMetadata_in</th> | |
| 840 <td>9a0ce47bd1734ae7</td> | |
| 841 <td>peaklist_fragments.tsv</td> | |
| 842 <td>tabular</td> | |
| 843 <td>42</td> | |
| 844 </tr> | |
| 845 </table> | |
| 846 </div> | |
| 847 | |
| 848 | |
| 849 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 850 <h2 | |
| 851 class="history_metadata_extractor_h2" | |
| 852 style="cursor: pointer" | |
| 853 title="click to fold/unfold the table" | |
| 854 > | |
| 855 [DELETED] - quality_metrics - 2.2.8 | |
| 856 </h2> | |
| 857 <p> | |
| 858 Outputs: | |
| 859 </p> | |
| 860 <p class="history_metadata_extractor_status"> | |
| 861 Status: Failed (1) | |
| 862 </p> | |
| 863 <p class="history_metadata_extractor_glitter"></p> | |
| 864 <table class=" | |
| 865 table | |
| 866 table-bordered | |
| 867 table-dark | |
| 868 table-striped | |
| 869 table-hover | |
| 870 d-block | |
| 871 overflow-auto | |
| 872 history_metadata_extractor_table | |
| 873 "> | |
| 874 <thead> | |
| 875 <tr> | |
| 876 <th scope="col"></th> | |
| 877 <th scope="col">value</th> | |
| 878 <th scope="col">name</th> | |
| 879 <th scope="col">extension</th> | |
| 880 <th scope="col">hid</th> | |
| 881 </tr> | |
| 882 </thead> | |
| 883 <tr class=""> | |
| 884 <th scope="row">CV</th> | |
| 885 <td>FALSE</td> | |
| 886 <td></td> | |
| 887 <td></td> | |
| 888 <td></td> | |
| 889 </tr><tr class=""> | |
| 890 <th scope="row">Compa</th> | |
| 891 <td>TRUE</td> | |
| 892 <td></td> | |
| 893 <td></td> | |
| 894 <td></td> | |
| 895 </tr><tr class=""> | |
| 896 <th scope="row">seuil</th> | |
| 897 <td>1</td> | |
| 898 <td></td> | |
| 899 <td></td> | |
| 900 <td></td> | |
| 901 </tr><tr class=""> | |
| 902 <th scope="row">optC</th> | |
| 903 <td>default</td> | |
| 904 <td></td> | |
| 905 <td></td> | |
| 906 <td></td> | |
| 907 </tr><tr class=""> | |
| 908 <th scope="row">poolAsPool1L</th> | |
| 909 <td>TRUE</td> | |
| 910 <td></td> | |
| 911 <td></td> | |
| 912 <td></td> | |
| 913 </tr><tr class=""> | |
| 914 <th scope="row">dataMatrix_in</th> | |
| 915 <td>9a0ce47bd1734ae7</td> | |
| 916 <td>peaklist_fragments.tsv</td> | |
| 917 <td>tabular</td> | |
| 918 <td>42</td> | |
| 919 </tr><tr class=""> | |
| 920 <th scope="row">sampleMetadata_in</th> | |
| 921 <td>9a0ce47bd1734ae7</td> | |
| 922 <td>peaklist_fragments.tsv</td> | |
| 923 <td>tabular</td> | |
| 924 <td>42</td> | |
| 925 </tr><tr class=""> | |
| 926 <th scope="row">variableMetadata_in</th> | |
| 927 <td>9a0ce47bd1734ae7</td> | |
| 928 <td>peaklist_fragments.tsv</td> | |
| 929 <td>tabular</td> | |
| 930 <td>42</td> | |
| 931 </tr> | |
| 932 </table> | |
| 933 </div> | |
| 934 | |
| 935 | |
| 936 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 937 <h2 | |
| 938 class="history_metadata_extractor_h2" | |
| 939 style="cursor: pointer" | |
| 940 title="click to fold/unfold the table" | |
| 941 > | |
| 942 [DELETED] - quality_metrics - 2.2.8 | |
| 943 </h2> | |
| 944 <p> | |
| 945 Outputs: | |
| 946 </p> | |
| 947 <p class="history_metadata_extractor_status"> | |
| 948 Status: Failed (1) | |
| 949 </p> | |
| 950 <p class="history_metadata_extractor_glitter"></p> | |
| 951 <table class=" | |
| 952 table | |
| 953 table-bordered | |
| 954 table-dark | |
| 955 table-striped | |
| 956 table-hover | |
| 957 d-block | |
| 958 overflow-auto | |
| 959 history_metadata_extractor_table | |
| 960 "> | |
| 961 <thead> | |
| 962 <tr> | |
| 963 <th scope="col"></th> | |
| 964 <th scope="col">value</th> | |
| 965 <th scope="col">name</th> | |
| 966 <th scope="col">extension</th> | |
| 967 <th scope="col">hid</th> | |
| 968 </tr> | |
| 969 </thead> | |
| 970 <tr class=""> | |
| 971 <th scope="row">CV</th> | |
| 972 <td>FALSE</td> | |
| 973 <td></td> | |
| 974 <td></td> | |
| 975 <td></td> | |
| 976 </tr><tr class=""> | |
| 977 <th scope="row">Compa</th> | |
| 978 <td>TRUE</td> | |
| 979 <td></td> | |
| 980 <td></td> | |
| 981 <td></td> | |
| 982 </tr><tr class=""> | |
| 983 <th scope="row">seuil</th> | |
| 984 <td>1</td> | |
| 985 <td></td> | |
| 986 <td></td> | |
| 987 <td></td> | |
| 988 </tr><tr class=""> | |
| 989 <th scope="row">optC</th> | |
| 990 <td>default</td> | |
| 991 <td></td> | |
| 992 <td></td> | |
| 993 <td></td> | |
| 994 </tr><tr class=""> | |
| 995 <th scope="row">poolAsPool1L</th> | |
| 996 <td>TRUE</td> | |
| 997 <td></td> | |
| 998 <td></td> | |
| 999 <td></td> | |
| 1000 </tr><tr class=""> | |
| 1001 <th scope="row">dataMatrix_in</th> | |
| 1002 <td>9a0ce47bd1734ae7</td> | |
| 1003 <td>peaklist_fragments.tsv</td> | |
| 1004 <td>tabular</td> | |
| 1005 <td>42</td> | |
| 1006 </tr><tr class=""> | |
| 1007 <th scope="row">sampleMetadata_in</th> | |
| 1008 <td>9a0ce47bd1734ae7</td> | |
| 1009 <td>peaklist_fragments.tsv</td> | |
| 1010 <td>tabular</td> | |
| 1011 <td>42</td> | |
| 1012 </tr><tr class=""> | |
| 1013 <th scope="row">variableMetadata_in</th> | |
| 1014 <td>9a0ce47bd1734ae7</td> | |
| 1015 <td>peaklist_fragments.tsv</td> | |
| 1016 <td>tabular</td> | |
| 1017 <td>42</td> | |
| 1018 </tr> | |
| 1019 </table> | |
| 1020 </div> | |
| 1021 | |
| 1022 | |
| 1023 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 1024 <h2 | |
| 1025 class="history_metadata_extractor_h2" | |
| 1026 style="cursor: pointer" | |
| 1027 title="click to fold/unfold the table" | |
| 1028 > | |
| 1029 [DELETED] - quality_metrics - 2.2.8 | |
| 1030 </h2> | |
| 1031 <p> | |
| 1032 Outputs: | |
| 1033 </p> | |
| 1034 <p class="history_metadata_extractor_status"> | |
| 1035 Status: Failed (1) | |
| 1036 </p> | |
| 1037 <p class="history_metadata_extractor_glitter"></p> | |
| 1038 <table class=" | |
| 1039 table | |
| 1040 table-bordered | |
| 1041 table-dark | |
| 1042 table-striped | |
| 1043 table-hover | |
| 1044 d-block | |
| 1045 overflow-auto | |
| 1046 history_metadata_extractor_table | |
| 1047 "> | |
| 1048 <thead> | |
| 1049 <tr> | |
| 1050 <th scope="col"></th> | |
| 1051 <th scope="col">value</th> | |
| 1052 <th scope="col">name</th> | |
| 1053 <th scope="col">extension</th> | |
| 1054 <th scope="col">hid</th> | |
| 1055 </tr> | |
| 1056 </thead> | |
| 1057 <tr class=""> | |
| 1058 <th scope="row">CV</th> | |
| 1059 <td>FALSE</td> | |
| 1060 <td></td> | |
| 1061 <td></td> | |
| 1062 <td></td> | |
| 1063 </tr><tr class=""> | |
| 1064 <th scope="row">Compa</th> | |
| 1065 <td>TRUE</td> | |
| 1066 <td></td> | |
| 1067 <td></td> | |
| 1068 <td></td> | |
| 1069 </tr><tr class=""> | |
| 1070 <th scope="row">seuil</th> | |
| 1071 <td>1</td> | |
| 1072 <td></td> | |
| 1073 <td></td> | |
| 1074 <td></td> | |
| 1075 </tr><tr class=""> | |
| 1076 <th scope="row">optC</th> | |
| 1077 <td>default</td> | |
| 1078 <td></td> | |
| 1079 <td></td> | |
| 1080 <td></td> | |
| 1081 </tr><tr class=""> | |
| 1082 <th scope="row">poolAsPool1L</th> | |
| 1083 <td>TRUE</td> | |
| 1084 <td></td> | |
| 1085 <td></td> | |
| 1086 <td></td> | |
| 1087 </tr><tr class=""> | |
| 1088 <th scope="row">dataMatrix_in</th> | |
| 1089 <td>9a0ce47bd1734ae7</td> | |
| 1090 <td>peaklist_fragments.tsv</td> | |
| 1091 <td>tabular</td> | |
| 1092 <td>42</td> | |
| 1093 </tr><tr class=""> | |
| 1094 <th scope="row">sampleMetadata_in</th> | |
| 1095 <td>9a0ce47bd1734ae7</td> | |
| 1096 <td>peaklist_fragments.tsv</td> | |
| 1097 <td>tabular</td> | |
| 1098 <td>42</td> | |
| 1099 </tr><tr class=""> | |
| 1100 <th scope="row">variableMetadata_in</th> | |
| 1101 <td>9a0ce47bd1734ae7</td> | |
| 1102 <td>peaklist_fragments.tsv</td> | |
| 1103 <td>tabular</td> | |
| 1104 <td>42</td> | |
| 1105 </tr> | |
| 1106 </table> | |
| 1107 </div> | |
| 1108 | |
| 1109 | |
| 1110 <div class="alert alert-success history_metadata_extractor_deleted"> | |
| 1111 <h2 | |
| 1112 class="history_metadata_extractor_h2" | |
| 1113 style="cursor: pointer" | |
| 1114 title="click to fold/unfold the table" | |
| 1115 > | |
| 1116 [DELETED] - __DATA_FETCH__ - 0.1.0 | |
| 1117 </h2> | |
| 1118 <p> | |
| 1119 Outputs: | |
| 1120 </p> | |
| 1121 <p class="history_metadata_extractor_status"> | |
| 1122 Status: Ok (0) | |
| 1123 </p> | |
| 1124 <p class="history_metadata_extractor_glitter"></p> | |
| 1125 <table class=" | |
| 1126 table | |
| 1127 table-bordered | |
| 1128 table-dark | |
| 1129 table-striped | |
| 1130 table-hover | |
| 1131 d-block | |
| 1132 overflow-auto | |
| 1133 history_metadata_extractor_table | |
| 1134 "> | |
| 1135 <thead> | |
| 1136 <tr> | |
| 1137 <th scope="col"></th> | |
| 1138 <th scope="col">value</th> | |
| 1139 <th scope="col">name</th> | |
| 1140 <th scope="col">extension</th> | |
| 1141 <th scope="col">hid</th> | |
| 1142 </tr> | |
| 1143 </thead> | |
| 1144 <tr class=""> | |
| 1145 <th scope="row">file_count</th> | |
| 1146 <td>1</td> | |
| 1147 <td></td> | |
| 1148 <td></td> | |
| 1149 <td></td> | |
| 1150 </tr><tr class=""> | |
| 1151 <th scope="row">files</th> | |
| 1152 <td>file_data: /galaxy/data/tmp/88d2ff5c70f646e182b4b058607d486d</td> | |
| 1153 <td>image.png</td> | |
| 1154 <td>auto</td> | |
| 1155 <td>232870</td> | |
| 1156 </tr><tr class=""> | |
| 1157 <th scope="row">paramfile</th> | |
| 1158 <td>None</td> | |
| 1159 <td></td> | |
| 1160 <td></td> | |
| 1161 <td></td> | |
| 1162 </tr><tr class=""> | |
| 1163 <th scope="row">request_version</th> | |
| 1164 <td>1</td> | |
| 1165 <td></td> | |
| 1166 <td></td> | |
| 1167 <td></td> | |
| 1168 </tr><tr class=""> | |
| 1169 <th scope="row">auto_decompress</th> | |
| 1170 <td>True</td> | |
| 1171 <td></td> | |
| 1172 <td></td> | |
| 1173 <td></td> | |
| 1174 </tr><tr class=""> | |
| 1175 <th scope="row">check_content</th> | |
| 1176 <td>True</td> | |
| 1177 <td></td> | |
| 1178 <td></td> | |
| 1179 <td></td> | |
| 1180 </tr> | |
| 1181 </table> | |
| 1182 </div> | |
| 1183 | |
| 1184 | |
| 1185 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 1186 <h2 | |
| 1187 class="history_metadata_extractor_h2" | |
| 1188 style="cursor: pointer" | |
| 1189 title="click to fold/unfold the table" | |
| 1190 > | |
| 1191 [DELETED] - abims_CAMERA_annotateDiffreport - 2.2.6+camera1.48.0-galaxy0 | |
| 1192 </h2> | |
| 1193 <p> | |
| 1194 Outputs: | |
| 1195 </p> | |
| 1196 <p class="history_metadata_extractor_status"> | |
| 1197 Status: Failed (None) | |
| 1198 </p> | |
| 1199 <p class="history_metadata_extractor_glitter"></p> | |
| 1200 <table class=" | |
| 1201 table | |
| 1202 table-bordered | |
| 1203 table-dark | |
| 1204 table-striped | |
| 1205 table-hover | |
| 1206 d-block | |
| 1207 overflow-auto | |
| 1208 history_metadata_extractor_table | |
| 1209 "> | |
| 1210 <thead> | |
| 1211 <tr> | |
| 1212 <th scope="col"></th> | |
| 1213 <th scope="col">value</th> | |
| 1214 <th scope="col">name</th> | |
| 1215 <th scope="col">extension</th> | |
| 1216 <th scope="col">hid</th> | |
| 1217 </tr> | |
| 1218 </thead> | |
| 1219 <tr class=""> | |
| 1220 <th scope="row">option</th> | |
| 1221 <td>hide</td> | |
| 1222 <td></td> | |
| 1223 <td></td> | |
| 1224 <td></td> | |
| 1225 </tr><tr class=""> | |
| 1226 <th scope="row">convertRTMinute</th> | |
| 1227 <td>false</td> | |
| 1228 <td></td> | |
| 1229 <td></td> | |
| 1230 <td></td> | |
| 1231 </tr><tr class=""> | |
| 1232 <th scope="row">intval</th> | |
| 1233 <td>into</td> | |
| 1234 <td></td> | |
| 1235 <td></td> | |
| 1236 <td></td> | |
| 1237 </tr><tr class=""> | |
| 1238 <th scope="row">numDigitsMZ</th> | |
| 1239 <td>4</td> | |
| 1240 <td></td> | |
| 1241 <td></td> | |
| 1242 <td></td> | |
| 1243 </tr><tr class=""> | |
| 1244 <th scope="row">numDigitsRT</th> | |
| 1245 <td>0</td> | |
| 1246 <td></td> | |
| 1247 <td></td> | |
| 1248 <td></td> | |
| 1249 </tr><tr class=""> | |
| 1250 <th scope="row">file_load_select</th> | |
| 1251 <td>no</td> | |
| 1252 <td></td> | |
| 1253 <td></td> | |
| 1254 <td></td> | |
| 1255 </tr><tr class=""> | |
| 1256 <th scope="row">mzabs</th> | |
| 1257 <td>0.015</td> | |
| 1258 <td></td> | |
| 1259 <td></td> | |
| 1260 <td></td> | |
| 1261 </tr><tr class=""> | |
| 1262 <th scope="row">ppm</th> | |
| 1263 <td>5</td> | |
| 1264 <td></td> | |
| 1265 <td></td> | |
| 1266 <td></td> | |
| 1267 </tr><tr class=""> | |
| 1268 <th scope="row">maxcharge</th> | |
| 1269 <td>3</td> | |
| 1270 <td></td> | |
| 1271 <td></td> | |
| 1272 <td></td> | |
| 1273 </tr><tr class=""> | |
| 1274 <th scope="row">maxiso</th> | |
| 1275 <td>4</td> | |
| 1276 <td></td> | |
| 1277 <td></td> | |
| 1278 <td></td> | |
| 1279 </tr><tr class=""> | |
| 1280 <th scope="row">minfrac</th> | |
| 1281 <td>0.5</td> | |
| 1282 <td></td> | |
| 1283 <td></td> | |
| 1284 <td></td> | |
| 1285 </tr><tr class=""> | |
| 1286 <th scope="row">perfwhm</th> | |
| 1287 <td>0.6</td> | |
| 1288 <td></td> | |
| 1289 <td></td> | |
| 1290 <td></td> | |
| 1291 </tr><tr class=""> | |
| 1292 <th scope="row">sigma</th> | |
| 1293 <td>6</td> | |
| 1294 <td></td> | |
| 1295 <td></td> | |
| 1296 <td></td> | |
| 1297 </tr><tr class=""> | |
| 1298 <th scope="row">image</th> | |
| 1299 <td>9e77b3d7d0887128</td> | |
| 1300 <td>test.rdata</td> | |
| 1301 <td>rdata</td> | |
| 1302 <td>1</td> | |
| 1303 </tr><tr class=""> | |
| 1304 <th scope="row">max_peaks</th> | |
| 1305 <td>100</td> | |
| 1306 <td></td> | |
| 1307 <td></td> | |
| 1308 <td></td> | |
| 1309 </tr><tr class=""> | |
| 1310 <th scope="row">polarity</th> | |
| 1311 <td>negative</td> | |
| 1312 <td></td> | |
| 1313 <td></td> | |
| 1314 <td></td> | |
| 1315 </tr><tr class=""> | |
| 1316 <th scope="row">multiplier</th> | |
| 1317 <td>3</td> | |
| 1318 <td></td> | |
| 1319 <td></td> | |
| 1320 <td></td> | |
| 1321 </tr><tr class=""> | |
| 1322 <th scope="row">rules_select</th> | |
| 1323 <td>FALSE</td> | |
| 1324 <td></td> | |
| 1325 <td></td> | |
| 1326 <td></td> | |
| 1327 </tr><tr class=""> | |
| 1328 <th scope="row">calcCaS</th> | |
| 1329 <td>false</td> | |
| 1330 <td></td> | |
| 1331 <td></td> | |
| 1332 <td></td> | |
| 1333 </tr><tr class=""> | |
| 1334 <th scope="row">calcCiS</th> | |
| 1335 <td>true</td> | |
| 1336 <td></td> | |
| 1337 <td></td> | |
| 1338 <td></td> | |
| 1339 </tr><tr class=""> | |
| 1340 <th scope="row">calcIso</th> | |
| 1341 <td>false</td> | |
| 1342 <td></td> | |
| 1343 <td></td> | |
| 1344 <td></td> | |
| 1345 </tr><tr class=""> | |
| 1346 <th scope="row">cor_eic_th</th> | |
| 1347 <td>0.75</td> | |
| 1348 <td></td> | |
| 1349 <td></td> | |
| 1350 <td></td> | |
| 1351 </tr><tr class=""> | |
| 1352 <th scope="row">graphMethod</th> | |
| 1353 <td>hcs</td> | |
| 1354 <td></td> | |
| 1355 <td></td> | |
| 1356 <td></td> | |
| 1357 </tr><tr class=""> | |
| 1358 <th scope="row">pval</th> | |
| 1359 <td>0.05</td> | |
| 1360 <td></td> | |
| 1361 <td></td> | |
| 1362 <td></td> | |
| 1363 </tr><tr class=""> | |
| 1364 <th scope="row">quick</th> | |
| 1365 <td>FALSE</td> | |
| 1366 <td></td> | |
| 1367 <td></td> | |
| 1368 <td></td> | |
| 1369 </tr> | |
| 1370 </table> | |
| 1371 </div> | |
| 1372 | |
| 1373 | |
| 1374 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 1375 <h2 | |
| 1376 class="history_metadata_extractor_h2" | |
| 1377 style="cursor: pointer" | |
| 1378 title="click to fold/unfold the table" | |
| 1379 > | |
| 1380 [DELETED] - abims_CAMERA_annotateDiffreport - 2.2.6+camera1.48.0-galaxy0 | |
| 1381 </h2> | |
| 1382 <p> | |
| 1383 Outputs: | |
| 1384 </p> | |
| 1385 <p class="history_metadata_extractor_status"> | |
| 1386 Status: Failed (None) | |
| 1387 </p> | |
| 1388 <p class="history_metadata_extractor_glitter"></p> | |
| 1389 <table class=" | |
| 1390 table | |
| 1391 table-bordered | |
| 1392 table-dark | |
| 1393 table-striped | |
| 1394 table-hover | |
| 1395 d-block | |
| 1396 overflow-auto | |
| 1397 history_metadata_extractor_table | |
| 1398 "> | |
| 1399 <thead> | |
| 1400 <tr> | |
| 1401 <th scope="col"></th> | |
| 1402 <th scope="col">value</th> | |
| 1403 <th scope="col">name</th> | |
| 1404 <th scope="col">extension</th> | |
| 1405 <th scope="col">hid</th> | |
| 1406 </tr> | |
| 1407 </thead> | |
| 1408 <tr class=""> | |
| 1409 <th scope="row">option</th> | |
| 1410 <td>hide</td> | |
| 1411 <td></td> | |
| 1412 <td></td> | |
| 1413 <td></td> | |
| 1414 </tr><tr class=""> | |
| 1415 <th scope="row">convertRTMinute</th> | |
| 1416 <td>false</td> | |
| 1417 <td></td> | |
| 1418 <td></td> | |
| 1419 <td></td> | |
| 1420 </tr><tr class=""> | |
| 1421 <th scope="row">intval</th> | |
| 1422 <td>into</td> | |
| 1423 <td></td> | |
| 1424 <td></td> | |
| 1425 <td></td> | |
| 1426 </tr><tr class=""> | |
| 1427 <th scope="row">numDigitsMZ</th> | |
| 1428 <td>4</td> | |
| 1429 <td></td> | |
| 1430 <td></td> | |
| 1431 <td></td> | |
| 1432 </tr><tr class=""> | |
| 1433 <th scope="row">numDigitsRT</th> | |
| 1434 <td>0</td> | |
| 1435 <td></td> | |
| 1436 <td></td> | |
| 1437 <td></td> | |
| 1438 </tr><tr class=""> | |
| 1439 <th scope="row">file_load_select</th> | |
| 1440 <td>no</td> | |
| 1441 <td></td> | |
| 1442 <td></td> | |
| 1443 <td></td> | |
| 1444 </tr><tr class=""> | |
| 1445 <th scope="row">mzabs</th> | |
| 1446 <td>0.015</td> | |
| 1447 <td></td> | |
| 1448 <td></td> | |
| 1449 <td></td> | |
| 1450 </tr><tr class=""> | |
| 1451 <th scope="row">ppm</th> | |
| 1452 <td>5</td> | |
| 1453 <td></td> | |
| 1454 <td></td> | |
| 1455 <td></td> | |
| 1456 </tr><tr class=""> | |
| 1457 <th scope="row">maxcharge</th> | |
| 1458 <td>3</td> | |
| 1459 <td></td> | |
| 1460 <td></td> | |
| 1461 <td></td> | |
| 1462 </tr><tr class=""> | |
| 1463 <th scope="row">maxiso</th> | |
| 1464 <td>4</td> | |
| 1465 <td></td> | |
| 1466 <td></td> | |
| 1467 <td></td> | |
| 1468 </tr><tr class=""> | |
| 1469 <th scope="row">minfrac</th> | |
| 1470 <td>0.5</td> | |
| 1471 <td></td> | |
| 1472 <td></td> | |
| 1473 <td></td> | |
| 1474 </tr><tr class=""> | |
| 1475 <th scope="row">perfwhm</th> | |
| 1476 <td>0.6</td> | |
| 1477 <td></td> | |
| 1478 <td></td> | |
| 1479 <td></td> | |
| 1480 </tr><tr class=""> | |
| 1481 <th scope="row">sigma</th> | |
| 1482 <td>6</td> | |
| 1483 <td></td> | |
| 1484 <td></td> | |
| 1485 <td></td> | |
| 1486 </tr><tr class=""> | |
| 1487 <th scope="row">image</th> | |
| 1488 <td>9e77b3d7d0887128</td> | |
| 1489 <td>test.rdata</td> | |
| 1490 <td>rdata</td> | |
| 1491 <td>1</td> | |
| 1492 </tr><tr class=""> | |
| 1493 <th scope="row">max_peaks</th> | |
| 1494 <td>100</td> | |
| 1495 <td></td> | |
| 1496 <td></td> | |
| 1497 <td></td> | |
| 1498 </tr><tr class=""> | |
| 1499 <th scope="row">polarity</th> | |
| 1500 <td>negative</td> | |
| 1501 <td></td> | |
| 1502 <td></td> | |
| 1503 <td></td> | |
| 1504 </tr><tr class=""> | |
| 1505 <th scope="row">multiplier</th> | |
| 1506 <td>3</td> | |
| 1507 <td></td> | |
| 1508 <td></td> | |
| 1509 <td></td> | |
| 1510 </tr><tr class=""> | |
| 1511 <th scope="row">rules_select</th> | |
| 1512 <td>FALSE</td> | |
| 1513 <td></td> | |
| 1514 <td></td> | |
| 1515 <td></td> | |
| 1516 </tr><tr class=""> | |
| 1517 <th scope="row">calcCaS</th> | |
| 1518 <td>false</td> | |
| 1519 <td></td> | |
| 1520 <td></td> | |
| 1521 <td></td> | |
| 1522 </tr><tr class=""> | |
| 1523 <th scope="row">calcCiS</th> | |
| 1524 <td>true</td> | |
| 1525 <td></td> | |
| 1526 <td></td> | |
| 1527 <td></td> | |
| 1528 </tr><tr class=""> | |
| 1529 <th scope="row">calcIso</th> | |
| 1530 <td>false</td> | |
| 1531 <td></td> | |
| 1532 <td></td> | |
| 1533 <td></td> | |
| 1534 </tr><tr class=""> | |
| 1535 <th scope="row">cor_eic_th</th> | |
| 1536 <td>0.75</td> | |
| 1537 <td></td> | |
| 1538 <td></td> | |
| 1539 <td></td> | |
| 1540 </tr><tr class=""> | |
| 1541 <th scope="row">graphMethod</th> | |
| 1542 <td>hcs</td> | |
| 1543 <td></td> | |
| 1544 <td></td> | |
| 1545 <td></td> | |
| 1546 </tr><tr class=""> | |
| 1547 <th scope="row">pval</th> | |
| 1548 <td>0.05</td> | |
| 1549 <td></td> | |
| 1550 <td></td> | |
| 1551 <td></td> | |
| 1552 </tr><tr class=""> | |
| 1553 <th scope="row">quick</th> | |
| 1554 <td>FALSE</td> | |
| 1555 <td></td> | |
| 1556 <td></td> | |
| 1557 <td></td> | |
| 1558 </tr> | |
| 1559 </table> | |
| 1560 </div> | |
| 1561 | |
| 1562 | |
| 1563 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 1564 <h2 | |
| 1565 class="history_metadata_extractor_h2" | |
| 1566 style="cursor: pointer" | |
| 1567 title="click to fold/unfold the table" | |
| 1568 > | |
| 1569 [DELETED] - corrtable - 1.0.0 | |
| 1570 </h2> | |
| 1571 <p> | |
| 1572 Outputs: | |
| 1573 </p> | |
| 1574 <p class="history_metadata_extractor_status"> | |
| 1575 Status: Failed (127) | |
| 1576 </p> | |
| 1577 <p class="history_metadata_extractor_glitter"></p> | |
| 1578 <table class=" | |
| 1579 table | |
| 1580 table-bordered | |
| 1581 table-dark | |
| 1582 table-striped | |
| 1583 table-hover | |
| 1584 d-block | |
| 1585 overflow-auto | |
| 1586 history_metadata_extractor_table | |
| 1587 "> | |
| 1588 <thead> | |
| 1589 <tr> | |
| 1590 <th scope="col"></th> | |
| 1591 <th scope="col">value</th> | |
| 1592 <th scope="col">name</th> | |
| 1593 <th scope="col">extension</th> | |
| 1594 <th scope="col">hid</th> | |
| 1595 </tr> | |
| 1596 </thead> | |
| 1597 <tr class=""> | |
| 1598 <th scope="row">corr_method</th> | |
| 1599 <td>pearson</td> | |
| 1600 <td></td> | |
| 1601 <td></td> | |
| 1602 <td></td> | |
| 1603 </tr><tr class=""> | |
| 1604 <th scope="row">filter</th> | |
| 1605 <td>no</td> | |
| 1606 <td></td> | |
| 1607 <td></td> | |
| 1608 <td></td> | |
| 1609 </tr><tr class=""> | |
| 1610 <th scope="row">test_corr</th> | |
| 1611 <td>no</td> | |
| 1612 <td></td> | |
| 1613 <td></td> | |
| 1614 <td></td> | |
| 1615 </tr><tr class=""> | |
| 1616 <th scope="row">color_heatmap</th> | |
| 1617 <td>no</td> | |
| 1618 <td></td> | |
| 1619 <td></td> | |
| 1620 <td></td> | |
| 1621 </tr><tr class=""> | |
| 1622 <th scope="row">plot_choice</th> | |
| 1623 <td>auto</td> | |
| 1624 <td></td> | |
| 1625 <td></td> | |
| 1626 <td></td> | |
| 1627 </tr><tr class=""> | |
| 1628 <th scope="row">reorder_var</th> | |
| 1629 <td>no</td> | |
| 1630 <td></td> | |
| 1631 <td></td> | |
| 1632 <td></td> | |
| 1633 </tr><tr class=""> | |
| 1634 <th scope="row">tab1_in</th> | |
| 1635 <td>7cf499d16bd542b2</td> | |
| 1636 <td>compounds_pos.txt</td> | |
| 1637 <td>tabular</td> | |
| 1638 <td>44</td> | |
| 1639 </tr><tr class=""> | |
| 1640 <th scope="row">tab1_samples</th> | |
| 1641 <td>row</td> | |
| 1642 <td></td> | |
| 1643 <td></td> | |
| 1644 <td></td> | |
| 1645 </tr><tr class=""> | |
| 1646 <th scope="row">tab2_in</th> | |
| 1647 <td>7cf499d16bd542b2</td> | |
| 1648 <td>compounds_pos.txt</td> | |
| 1649 <td>tabular</td> | |
| 1650 <td>44</td> | |
| 1651 </tr><tr class=""> | |
| 1652 <th scope="row">tab2_samples</th> | |
| 1653 <td>row</td> | |
| 1654 <td></td> | |
| 1655 <td></td> | |
| 1656 <td></td> | |
| 1657 </tr> | |
| 1658 </table> | |
| 1659 </div> | |
| 1660 | |
| 1661 | |
| 1662 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 1663 <h2 | |
| 1664 class="history_metadata_extractor_h2" | |
| 1665 style="cursor: pointer" | |
| 1666 title="click to fold/unfold the table" | |
| 1667 > | |
| 1668 [DELETED] - corrtable - 1.0.0 | |
| 1669 </h2> | |
| 1670 <p> | |
| 1671 Outputs: | |
| 1672 </p> | |
| 1673 <p class="history_metadata_extractor_status"> | |
| 1674 Status: Failed (127) | |
| 1675 </p> | |
| 1676 <p class="history_metadata_extractor_glitter"></p> | |
| 1677 <table class=" | |
| 1678 table | |
| 1679 table-bordered | |
| 1680 table-dark | |
| 1681 table-striped | |
| 1682 table-hover | |
| 1683 d-block | |
| 1684 overflow-auto | |
| 1685 history_metadata_extractor_table | |
| 1686 "> | |
| 1687 <thead> | |
| 1688 <tr> | |
| 1689 <th scope="col"></th> | |
| 1690 <th scope="col">value</th> | |
| 1691 <th scope="col">name</th> | |
| 1692 <th scope="col">extension</th> | |
| 1693 <th scope="col">hid</th> | |
| 1694 </tr> | |
| 1695 </thead> | |
| 1696 <tr class=""> | |
| 1697 <th scope="row">corr_method</th> | |
| 1698 <td>pearson</td> | |
| 1699 <td></td> | |
| 1700 <td></td> | |
| 1701 <td></td> | |
| 1702 </tr><tr class=""> | |
| 1703 <th scope="row">filter</th> | |
| 1704 <td>no</td> | |
| 1705 <td></td> | |
| 1706 <td></td> | |
| 1707 <td></td> | |
| 1708 </tr><tr class=""> | |
| 1709 <th scope="row">test_corr</th> | |
| 1710 <td>no</td> | |
| 1711 <td></td> | |
| 1712 <td></td> | |
| 1713 <td></td> | |
| 1714 </tr><tr class=""> | |
| 1715 <th scope="row">color_heatmap</th> | |
| 1716 <td>no</td> | |
| 1717 <td></td> | |
| 1718 <td></td> | |
| 1719 <td></td> | |
| 1720 </tr><tr class=""> | |
| 1721 <th scope="row">plot_choice</th> | |
| 1722 <td>auto</td> | |
| 1723 <td></td> | |
| 1724 <td></td> | |
| 1725 <td></td> | |
| 1726 </tr><tr class=""> | |
| 1727 <th scope="row">reorder_var</th> | |
| 1728 <td>no</td> | |
| 1729 <td></td> | |
| 1730 <td></td> | |
| 1731 <td></td> | |
| 1732 </tr><tr class=""> | |
| 1733 <th scope="row">tab1_in</th> | |
| 1734 <td>7cf499d16bd542b2</td> | |
| 1735 <td>compounds_pos.txt</td> | |
| 1736 <td>tabular</td> | |
| 1737 <td>44</td> | |
| 1738 </tr><tr class=""> | |
| 1739 <th scope="row">tab1_samples</th> | |
| 1740 <td>row</td> | |
| 1741 <td></td> | |
| 1742 <td></td> | |
| 1743 <td></td> | |
| 1744 </tr><tr class=""> | |
| 1745 <th scope="row">tab2_in</th> | |
| 1746 <td>7cf499d16bd542b2</td> | |
| 1747 <td>compounds_pos.txt</td> | |
| 1748 <td>tabular</td> | |
| 1749 <td>44</td> | |
| 1750 </tr><tr class=""> | |
| 1751 <th scope="row">tab2_samples</th> | |
| 1752 <td>row</td> | |
| 1753 <td></td> | |
| 1754 <td></td> | |
| 1755 <td></td> | |
| 1756 </tr> | |
| 1757 </table> | |
| 1758 </div> | |
| 1759 | |
| 1760 | |
| 1761 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 1762 <h2 | |
| 1763 class="history_metadata_extractor_h2" | |
| 1764 style="cursor: pointer" | |
| 1765 title="click to fold/unfold the table" | |
| 1766 > | |
| 1767 [DELETED] - corrtable - 1.0.0 | |
| 1768 </h2> | |
| 1769 <p> | |
| 1770 Outputs: | |
| 1771 </p> | |
| 1772 <p class="history_metadata_extractor_status"> | |
| 1773 Status: Failed (127) | |
| 1774 </p> | |
| 1775 <p class="history_metadata_extractor_glitter"></p> | |
| 1776 <table class=" | |
| 1777 table | |
| 1778 table-bordered | |
| 1779 table-dark | |
| 1780 table-striped | |
| 1781 table-hover | |
| 1782 d-block | |
| 1783 overflow-auto | |
| 1784 history_metadata_extractor_table | |
| 1785 "> | |
| 1786 <thead> | |
| 1787 <tr> | |
| 1788 <th scope="col"></th> | |
| 1789 <th scope="col">value</th> | |
| 1790 <th scope="col">name</th> | |
| 1791 <th scope="col">extension</th> | |
| 1792 <th scope="col">hid</th> | |
| 1793 </tr> | |
| 1794 </thead> | |
| 1795 <tr class=""> | |
| 1796 <th scope="row">corr_method</th> | |
| 1797 <td>pearson</td> | |
| 1798 <td></td> | |
| 1799 <td></td> | |
| 1800 <td></td> | |
| 1801 </tr><tr class=""> | |
| 1802 <th scope="row">filter</th> | |
| 1803 <td>no</td> | |
| 1804 <td></td> | |
| 1805 <td></td> | |
| 1806 <td></td> | |
| 1807 </tr><tr class=""> | |
| 1808 <th scope="row">test_corr</th> | |
| 1809 <td>no</td> | |
| 1810 <td></td> | |
| 1811 <td></td> | |
| 1812 <td></td> | |
| 1813 </tr><tr class=""> | |
| 1814 <th scope="row">color_heatmap</th> | |
| 1815 <td>no</td> | |
| 1816 <td></td> | |
| 1817 <td></td> | |
| 1818 <td></td> | |
| 1819 </tr><tr class=""> | |
| 1820 <th scope="row">plot_choice</th> | |
| 1821 <td>auto</td> | |
| 1822 <td></td> | |
| 1823 <td></td> | |
| 1824 <td></td> | |
| 1825 </tr><tr class=""> | |
| 1826 <th scope="row">reorder_var</th> | |
| 1827 <td>no</td> | |
| 1828 <td></td> | |
| 1829 <td></td> | |
| 1830 <td></td> | |
| 1831 </tr><tr class=""> | |
| 1832 <th scope="row">tab1_in</th> | |
| 1833 <td>7cf499d16bd542b2</td> | |
| 1834 <td>compounds_pos.txt</td> | |
| 1835 <td>tabular</td> | |
| 1836 <td>44</td> | |
| 1837 </tr><tr class=""> | |
| 1838 <th scope="row">tab1_samples</th> | |
| 1839 <td>row</td> | |
| 1840 <td></td> | |
| 1841 <td></td> | |
| 1842 <td></td> | |
| 1843 </tr><tr class=""> | |
| 1844 <th scope="row">tab2_in</th> | |
| 1845 <td>7cf499d16bd542b2</td> | |
| 1846 <td>compounds_pos.txt</td> | |
| 1847 <td>tabular</td> | |
| 1848 <td>44</td> | |
| 1849 </tr><tr class=""> | |
| 1850 <th scope="row">tab2_samples</th> | |
| 1851 <td>row</td> | |
| 1852 <td></td> | |
| 1853 <td></td> | |
| 1854 <td></td> | |
| 1855 </tr> | |
| 1856 </table> | |
| 1857 </div> | |
| 1858 | |
| 1859 | |
| 1860 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 1861 <h2 | |
| 1862 class="history_metadata_extractor_h2" | |
| 1863 style="cursor: pointer" | |
| 1864 title="click to fold/unfold the table" | |
| 1865 > | |
| 1866 [DELETED] - corrtable - 1.0.0 | |
| 1867 </h2> | |
| 1868 <p> | |
| 1869 Outputs: | |
| 1870 </p> | |
| 1871 <p class="history_metadata_extractor_status"> | |
| 1872 Status: Failed (127) | |
| 1873 </p> | |
| 1874 <p class="history_metadata_extractor_glitter"></p> | |
| 1875 <table class=" | |
| 1876 table | |
| 1877 table-bordered | |
| 1878 table-dark | |
| 1879 table-striped | |
| 1880 table-hover | |
| 1881 d-block | |
| 1882 overflow-auto | |
| 1883 history_metadata_extractor_table | |
| 1884 "> | |
| 1885 <thead> | |
| 1886 <tr> | |
| 1887 <th scope="col"></th> | |
| 1888 <th scope="col">value</th> | |
| 1889 <th scope="col">name</th> | |
| 1890 <th scope="col">extension</th> | |
| 1891 <th scope="col">hid</th> | |
| 1892 </tr> | |
| 1893 </thead> | |
| 1894 <tr class=""> | |
| 1895 <th scope="row">corr_method</th> | |
| 1896 <td>pearson</td> | |
| 1897 <td></td> | |
| 1898 <td></td> | |
| 1899 <td></td> | |
| 1900 </tr><tr class=""> | |
| 1901 <th scope="row">filter</th> | |
| 1902 <td>no</td> | |
| 1903 <td></td> | |
| 1904 <td></td> | |
| 1905 <td></td> | |
| 1906 </tr><tr class=""> | |
| 1907 <th scope="row">test_corr</th> | |
| 1908 <td>no</td> | |
| 1909 <td></td> | |
| 1910 <td></td> | |
| 1911 <td></td> | |
| 1912 </tr><tr class=""> | |
| 1913 <th scope="row">color_heatmap</th> | |
| 1914 <td>no</td> | |
| 1915 <td></td> | |
| 1916 <td></td> | |
| 1917 <td></td> | |
| 1918 </tr><tr class=""> | |
| 1919 <th scope="row">plot_choice</th> | |
| 1920 <td>auto</td> | |
| 1921 <td></td> | |
| 1922 <td></td> | |
| 1923 <td></td> | |
| 1924 </tr><tr class=""> | |
| 1925 <th scope="row">reorder_var</th> | |
| 1926 <td>no</td> | |
| 1927 <td></td> | |
| 1928 <td></td> | |
| 1929 <td></td> | |
| 1930 </tr><tr class=""> | |
| 1931 <th scope="row">tab1_in</th> | |
| 1932 <td>7cf499d16bd542b2</td> | |
| 1933 <td>compounds_pos.txt</td> | |
| 1934 <td>tabular</td> | |
| 1935 <td>44</td> | |
| 1936 </tr><tr class=""> | |
| 1937 <th scope="row">tab1_samples</th> | |
| 1938 <td>row</td> | |
| 1939 <td></td> | |
| 1940 <td></td> | |
| 1941 <td></td> | |
| 1942 </tr><tr class=""> | |
| 1943 <th scope="row">tab2_in</th> | |
| 1944 <td>7cf499d16bd542b2</td> | |
| 1945 <td>compounds_pos.txt</td> | |
| 1946 <td>tabular</td> | |
| 1947 <td>44</td> | |
| 1948 </tr><tr class=""> | |
| 1949 <th scope="row">tab2_samples</th> | |
| 1950 <td>row</td> | |
| 1951 <td></td> | |
| 1952 <td></td> | |
| 1953 <td></td> | |
| 1954 </tr> | |
| 1955 </table> | |
| 1956 </div> | |
| 1957 | |
| 1958 | |
| 1959 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 1960 <h2 | |
| 1961 class="history_metadata_extractor_h2" | |
| 1962 style="cursor: pointer" | |
| 1963 title="click to fold/unfold the table" | |
| 1964 > | |
| 1965 [DELETED] - intens_check - 1.2.8 | |
| 1966 </h2> | |
| 1967 <p> | |
| 1968 Outputs: | |
| 1969 </p> | |
| 1970 <p class="history_metadata_extractor_status"> | |
| 1971 Status: Failed (1) | |
| 1972 </p> | |
| 1973 <p class="history_metadata_extractor_glitter"></p> | |
| 1974 <table class=" | |
| 1975 table | |
| 1976 table-bordered | |
| 1977 table-dark | |
| 1978 table-striped | |
| 1979 table-hover | |
| 1980 d-block | |
| 1981 overflow-auto | |
| 1982 history_metadata_extractor_table | |
| 1983 "> | |
| 1984 <thead> | |
| 1985 <tr> | |
| 1986 <th scope="col"></th> | |
| 1987 <th scope="col">value</th> | |
| 1988 <th scope="col">name</th> | |
| 1989 <th scope="col">extension</th> | |
| 1990 <th scope="col">hid</th> | |
| 1991 </tr> | |
| 1992 </thead> | |
| 1993 <tr class=""> | |
| 1994 <th scope="row">dataMatrix_in</th> | |
| 1995 <td>7cf499d16bd542b2</td> | |
| 1996 <td>compounds_pos.txt</td> | |
| 1997 <td>tabular</td> | |
| 1998 <td>44</td> | |
| 1999 </tr><tr class=""> | |
| 2000 <th scope="row">chosen_stat</th> | |
| 2001 <td>None</td> | |
| 2002 <td></td> | |
| 2003 <td></td> | |
| 2004 <td></td> | |
| 2005 </tr><tr class=""> | |
| 2006 <th scope="row">method</th> | |
| 2007 <td>no_class</td> | |
| 2008 <td></td> | |
| 2009 <td></td> | |
| 2010 <td></td> | |
| 2011 </tr><tr class=""> | |
| 2012 <th scope="row">sampleMetadata_in</th> | |
| 2013 <td>7cf499d16bd542b2</td> | |
| 2014 <td>compounds_pos.txt</td> | |
| 2015 <td>tabular</td> | |
| 2016 <td>44</td> | |
| 2017 </tr><tr class=""> | |
| 2018 <th scope="row">variableMetadata_in</th> | |
| 2019 <td>7cf499d16bd542b2</td> | |
| 2020 <td>compounds_pos.txt</td> | |
| 2021 <td>tabular</td> | |
| 2022 <td>44</td> | |
| 2023 </tr> | |
| 2024 </table> | |
| 2025 </div> | |
| 2026 | |
| 2027 | |
| 2028 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 2029 <h2 | |
| 2030 class="history_metadata_extractor_h2" | |
| 2031 style="cursor: pointer" | |
| 2032 title="click to fold/unfold the table" | |
| 2033 > | |
| 2034 [DELETED] - intens_check - 1.2.8 | |
| 2035 </h2> | |
| 2036 <p> | |
| 2037 Outputs: | |
| 2038 </p> | |
| 2039 <p class="history_metadata_extractor_status"> | |
| 2040 Status: Failed (1) | |
| 2041 </p> | |
| 2042 <p class="history_metadata_extractor_glitter"></p> | |
| 2043 <table class=" | |
| 2044 table | |
| 2045 table-bordered | |
| 2046 table-dark | |
| 2047 table-striped | |
| 2048 table-hover | |
| 2049 d-block | |
| 2050 overflow-auto | |
| 2051 history_metadata_extractor_table | |
| 2052 "> | |
| 2053 <thead> | |
| 2054 <tr> | |
| 2055 <th scope="col"></th> | |
| 2056 <th scope="col">value</th> | |
| 2057 <th scope="col">name</th> | |
| 2058 <th scope="col">extension</th> | |
| 2059 <th scope="col">hid</th> | |
| 2060 </tr> | |
| 2061 </thead> | |
| 2062 <tr class=""> | |
| 2063 <th scope="row">dataMatrix_in</th> | |
| 2064 <td>7cf499d16bd542b2</td> | |
| 2065 <td>compounds_pos.txt</td> | |
| 2066 <td>tabular</td> | |
| 2067 <td>44</td> | |
| 2068 </tr><tr class=""> | |
| 2069 <th scope="row">chosen_stat</th> | |
| 2070 <td>None</td> | |
| 2071 <td></td> | |
| 2072 <td></td> | |
| 2073 <td></td> | |
| 2074 </tr><tr class=""> | |
| 2075 <th scope="row">method</th> | |
| 2076 <td>no_class</td> | |
| 2077 <td></td> | |
| 2078 <td></td> | |
| 2079 <td></td> | |
| 2080 </tr><tr class=""> | |
| 2081 <th scope="row">sampleMetadata_in</th> | |
| 2082 <td>7cf499d16bd542b2</td> | |
| 2083 <td>compounds_pos.txt</td> | |
| 2084 <td>tabular</td> | |
| 2085 <td>44</td> | |
| 2086 </tr><tr class=""> | |
| 2087 <th scope="row">variableMetadata_in</th> | |
| 2088 <td>7cf499d16bd542b2</td> | |
| 2089 <td>compounds_pos.txt</td> | |
| 2090 <td>tabular</td> | |
| 2091 <td>44</td> | |
| 2092 </tr> | |
| 2093 </table> | |
| 2094 </div> | |
| 2095 | |
| 2096 | |
| 2097 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 2098 <h2 | |
| 2099 class="history_metadata_extractor_h2" | |
| 2100 style="cursor: pointer" | |
| 2101 title="click to fold/unfold the table" | |
| 2102 > | |
| 2103 [DELETED] - wsdl_hmdb - 1.6.1 | |
| 2104 </h2> | |
| 2105 <p> | |
| 2106 Outputs: | |
| 2107 </p> | |
| 2108 <p class="history_metadata_extractor_status"> | |
| 2109 Status: Failed (255) | |
| 2110 </p> | |
| 2111 <p class="history_metadata_extractor_glitter"></p> | |
| 2112 <table class=" | |
| 2113 table | |
| 2114 table-bordered | |
| 2115 table-dark | |
| 2116 table-striped | |
| 2117 table-hover | |
| 2118 d-block | |
| 2119 overflow-auto | |
| 2120 history_metadata_extractor_table | |
| 2121 "> | |
| 2122 <thead> | |
| 2123 <tr> | |
| 2124 <th scope="col"></th> | |
| 2125 <th scope="col">value</th> | |
| 2126 <th scope="col">name</th> | |
| 2127 <th scope="col">extension</th> | |
| 2128 <th scope="col">hid</th> | |
| 2129 </tr> | |
| 2130 </thead> | |
| 2131 <tr class=""> | |
| 2132 <th scope="row">advancedFeatures</th> | |
| 2133 <td>0</td> | |
| 2134 <td></td> | |
| 2135 <td></td> | |
| 2136 <td></td> | |
| 2137 </tr><tr class=""> | |
| 2138 <th scope="row">delta</th> | |
| 2139 <td>0.05</td> | |
| 2140 <td></td> | |
| 2141 <td></td> | |
| 2142 <td></td> | |
| 2143 </tr><tr class=""> | |
| 2144 <th scope="row">choice</th> | |
| 2145 <td>YES</td> | |
| 2146 <td></td> | |
| 2147 <td></td> | |
| 2148 <td></td> | |
| 2149 </tr><tr class=""> | |
| 2150 <th scope="row">colfactor</th> | |
| 2151 <td>1</td> | |
| 2152 <td></td> | |
| 2153 <td></td> | |
| 2154 <td></td> | |
| 2155 </tr><tr class=""> | |
| 2156 <th scope="row">header_choice</th> | |
| 2157 <td>yes</td> | |
| 2158 <td></td> | |
| 2159 <td></td> | |
| 2160 <td></td> | |
| 2161 </tr><tr class=""> | |
| 2162 <th scope="row">nbHeader</th> | |
| 2163 <td>1</td> | |
| 2164 <td></td> | |
| 2165 <td></td> | |
| 2166 <td></td> | |
| 2167 </tr><tr class=""> | |
| 2168 <th scope="row">masses</th> | |
| 2169 <td>7cf499d16bd542b2</td> | |
| 2170 <td>compounds_pos.txt</td> | |
| 2171 <td>tabular</td> | |
| 2172 <td>44</td> | |
| 2173 </tr><tr class=""> | |
| 2174 <th scope="row">maxquery</th> | |
| 2175 <td>10</td> | |
| 2176 <td></td> | |
| 2177 <td></td> | |
| 2178 <td></td> | |
| 2179 </tr><tr class=""> | |
| 2180 <th scope="row">data_neutral_adducts</th> | |
| 2181 <td>M</td> | |
| 2182 <td></td> | |
| 2183 <td></td> | |
| 2184 <td></td> | |
| 2185 </tr><tr class=""> | |
| 2186 <th scope="row">mode</th> | |
| 2187 <td>neutral</td> | |
| 2188 <td></td> | |
| 2189 <td></td> | |
| 2190 <td></td> | |
| 2191 </tr><tr class=""> | |
| 2192 <th scope="row">verbose</th> | |
| 2193 <td>1</td> | |
| 2194 <td></td> | |
| 2195 <td></td> | |
| 2196 <td></td> | |
| 2197 </tr> | |
| 2198 </table> | |
| 2199 </div> | |
| 2200 | |
| 2201 | |
| 2202 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 2203 <h2 | |
| 2204 class="history_metadata_extractor_h2" | |
| 2205 style="cursor: pointer" | |
| 2206 title="click to fold/unfold the table" | |
| 2207 > | |
| 2208 [DELETED] - wsdl_hmdb - 1.6.1 | |
| 2209 </h2> | |
| 2210 <p> | |
| 2211 Outputs: | |
| 2212 </p> | |
| 2213 <p class="history_metadata_extractor_status"> | |
| 2214 Status: Failed (255) | |
| 2215 </p> | |
| 2216 <p class="history_metadata_extractor_glitter"></p> | |
| 2217 <table class=" | |
| 2218 table | |
| 2219 table-bordered | |
| 2220 table-dark | |
| 2221 table-striped | |
| 2222 table-hover | |
| 2223 d-block | |
| 2224 overflow-auto | |
| 2225 history_metadata_extractor_table | |
| 2226 "> | |
| 2227 <thead> | |
| 2228 <tr> | |
| 2229 <th scope="col"></th> | |
| 2230 <th scope="col">value</th> | |
| 2231 <th scope="col">name</th> | |
| 2232 <th scope="col">extension</th> | |
| 2233 <th scope="col">hid</th> | |
| 2234 </tr> | |
| 2235 </thead> | |
| 2236 <tr class=""> | |
| 2237 <th scope="row">advancedFeatures</th> | |
| 2238 <td>0</td> | |
| 2239 <td></td> | |
| 2240 <td></td> | |
| 2241 <td></td> | |
| 2242 </tr><tr class=""> | |
| 2243 <th scope="row">delta</th> | |
| 2244 <td>0.05</td> | |
| 2245 <td></td> | |
| 2246 <td></td> | |
| 2247 <td></td> | |
| 2248 </tr><tr class=""> | |
| 2249 <th scope="row">choice</th> | |
| 2250 <td>YES</td> | |
| 2251 <td></td> | |
| 2252 <td></td> | |
| 2253 <td></td> | |
| 2254 </tr><tr class=""> | |
| 2255 <th scope="row">colfactor</th> | |
| 2256 <td>1</td> | |
| 2257 <td></td> | |
| 2258 <td></td> | |
| 2259 <td></td> | |
| 2260 </tr><tr class=""> | |
| 2261 <th scope="row">header_choice</th> | |
| 2262 <td>yes</td> | |
| 2263 <td></td> | |
| 2264 <td></td> | |
| 2265 <td></td> | |
| 2266 </tr><tr class=""> | |
| 2267 <th scope="row">nbHeader</th> | |
| 2268 <td>1</td> | |
| 2269 <td></td> | |
| 2270 <td></td> | |
| 2271 <td></td> | |
| 2272 </tr><tr class=""> | |
| 2273 <th scope="row">masses</th> | |
| 2274 <td>7cf499d16bd542b2</td> | |
| 2275 <td>compounds_pos.txt</td> | |
| 2276 <td>tabular</td> | |
| 2277 <td>44</td> | |
| 2278 </tr><tr class=""> | |
| 2279 <th scope="row">maxquery</th> | |
| 2280 <td>10</td> | |
| 2281 <td></td> | |
| 2282 <td></td> | |
| 2283 <td></td> | |
| 2284 </tr><tr class=""> | |
| 2285 <th scope="row">data_neutral_adducts</th> | |
| 2286 <td>M</td> | |
| 2287 <td></td> | |
| 2288 <td></td> | |
| 2289 <td></td> | |
| 2290 </tr><tr class=""> | |
| 2291 <th scope="row">mode</th> | |
| 2292 <td>neutral</td> | |
| 2293 <td></td> | |
| 2294 <td></td> | |
| 2295 <td></td> | |
| 2296 </tr><tr class=""> | |
| 2297 <th scope="row">verbose</th> | |
| 2298 <td>1</td> | |
| 2299 <td></td> | |
| 2300 <td></td> | |
| 2301 <td></td> | |
| 2302 </tr> | |
| 2303 </table> | |
| 2304 </div> | |
| 2305 | |
| 2306 | |
| 2307 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 2308 <h2 | |
| 2309 class="history_metadata_extractor_h2" | |
| 2310 style="cursor: pointer" | |
| 2311 title="click to fold/unfold the table" | |
| 2312 > | |
| 2313 [DELETED] - wsdl_hmdb - 1.6.1 | |
| 2314 </h2> | |
| 2315 <p> | |
| 2316 Outputs: | |
| 2317 </p> | |
| 2318 <p class="history_metadata_extractor_status"> | |
| 2319 Status: Failed (255) | |
| 2320 </p> | |
| 2321 <p class="history_metadata_extractor_glitter"></p> | |
| 2322 <table class=" | |
| 2323 table | |
| 2324 table-bordered | |
| 2325 table-dark | |
| 2326 table-striped | |
| 2327 table-hover | |
| 2328 d-block | |
| 2329 overflow-auto | |
| 2330 history_metadata_extractor_table | |
| 2331 "> | |
| 2332 <thead> | |
| 2333 <tr> | |
| 2334 <th scope="col"></th> | |
| 2335 <th scope="col">value</th> | |
| 2336 <th scope="col">name</th> | |
| 2337 <th scope="col">extension</th> | |
| 2338 <th scope="col">hid</th> | |
| 2339 </tr> | |
| 2340 </thead> | |
| 2341 <tr class=""> | |
| 2342 <th scope="row">advancedFeatures</th> | |
| 2343 <td>0</td> | |
| 2344 <td></td> | |
| 2345 <td></td> | |
| 2346 <td></td> | |
| 2347 </tr><tr class=""> | |
| 2348 <th scope="row">delta</th> | |
| 2349 <td>0.05</td> | |
| 2350 <td></td> | |
| 2351 <td></td> | |
| 2352 <td></td> | |
| 2353 </tr><tr class=""> | |
| 2354 <th scope="row">choice</th> | |
| 2355 <td>YES</td> | |
| 2356 <td></td> | |
| 2357 <td></td> | |
| 2358 <td></td> | |
| 2359 </tr><tr class=""> | |
| 2360 <th scope="row">colfactor</th> | |
| 2361 <td>1</td> | |
| 2362 <td></td> | |
| 2363 <td></td> | |
| 2364 <td></td> | |
| 2365 </tr><tr class=""> | |
| 2366 <th scope="row">header_choice</th> | |
| 2367 <td>yes</td> | |
| 2368 <td></td> | |
| 2369 <td></td> | |
| 2370 <td></td> | |
| 2371 </tr><tr class=""> | |
| 2372 <th scope="row">nbHeader</th> | |
| 2373 <td>1</td> | |
| 2374 <td></td> | |
| 2375 <td></td> | |
| 2376 <td></td> | |
| 2377 </tr><tr class=""> | |
| 2378 <th scope="row">masses</th> | |
| 2379 <td>7cf499d16bd542b2</td> | |
| 2380 <td>compounds_pos.txt</td> | |
| 2381 <td>tabular</td> | |
| 2382 <td>44</td> | |
| 2383 </tr><tr class=""> | |
| 2384 <th scope="row">maxquery</th> | |
| 2385 <td>10</td> | |
| 2386 <td></td> | |
| 2387 <td></td> | |
| 2388 <td></td> | |
| 2389 </tr><tr class=""> | |
| 2390 <th scope="row">data_neutral_adducts</th> | |
| 2391 <td>M</td> | |
| 2392 <td></td> | |
| 2393 <td></td> | |
| 2394 <td></td> | |
| 2395 </tr><tr class=""> | |
| 2396 <th scope="row">mode</th> | |
| 2397 <td>neutral</td> | |
| 2398 <td></td> | |
| 2399 <td></td> | |
| 2400 <td></td> | |
| 2401 </tr><tr class=""> | |
| 2402 <th scope="row">verbose</th> | |
| 2403 <td>1</td> | |
| 2404 <td></td> | |
| 2405 <td></td> | |
| 2406 <td></td> | |
| 2407 </tr> | |
| 2408 </table> | |
| 2409 </div> | |
| 2410 | |
| 2411 | |
| 2412 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 2413 <h2 | |
| 2414 class="history_metadata_extractor_h2" | |
| 2415 style="cursor: pointer" | |
| 2416 title="click to fold/unfold the table" | |
| 2417 > | |
| 2418 [DELETED] - idchoice - 19.12 | |
| 2419 </h2> | |
| 2420 <p> | |
| 2421 Outputs: | |
| 2422 </p> | |
| 2423 <p class="history_metadata_extractor_status"> | |
| 2424 Status: Failed (1) | |
| 2425 </p> | |
| 2426 <p class="history_metadata_extractor_glitter"></p> | |
| 2427 <table class=" | |
| 2428 table | |
| 2429 table-bordered | |
| 2430 table-dark | |
| 2431 table-striped | |
| 2432 table-hover | |
| 2433 d-block | |
| 2434 overflow-auto | |
| 2435 history_metadata_extractor_table | |
| 2436 "> | |
| 2437 <thead> | |
| 2438 <tr> | |
| 2439 <th scope="col"></th> | |
| 2440 <th scope="col">value</th> | |
| 2441 <th scope="col">name</th> | |
| 2442 <th scope="col">extension</th> | |
| 2443 <th scope="col">hid</th> | |
| 2444 </tr> | |
| 2445 </thead> | |
| 2446 <tr class=""> | |
| 2447 <th scope="row">Metadata_in</th> | |
| 2448 <td>7cf499d16bd542b2</td> | |
| 2449 <td>compounds_pos.txt</td> | |
| 2450 <td>tabular</td> | |
| 2451 <td>44</td> | |
| 2452 </tr><tr class=""> | |
| 2453 <th scope="row">col_name</th> | |
| 2454 <td></td> | |
| 2455 <td></td> | |
| 2456 <td></td> | |
| 2457 <td></td> | |
| 2458 </tr><tr class=""> | |
| 2459 <th scope="row">dataMatrix_in</th> | |
| 2460 <td>7cf499d16bd542b2</td> | |
| 2461 <td>compounds_pos.txt</td> | |
| 2462 <td>tabular</td> | |
| 2463 <td>44</td> | |
| 2464 </tr><tr class=""> | |
| 2465 <th scope="row">makeunique</th> | |
| 2466 <td>no</td> | |
| 2467 <td></td> | |
| 2468 <td></td> | |
| 2469 <td></td> | |
| 2470 </tr><tr class=""> | |
| 2471 <th scope="row">metatype</th> | |
| 2472 <td>variable</td> | |
| 2473 <td></td> | |
| 2474 <td></td> | |
| 2475 <td></td> | |
| 2476 </tr> | |
| 2477 </table> | |
| 2478 </div> | |
| 2479 | |
| 2480 | |
| 2481 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 2482 <h2 | |
| 2483 class="history_metadata_extractor_h2" | |
| 2484 style="cursor: pointer" | |
| 2485 title="click to fold/unfold the table" | |
| 2486 > | |
| 2487 [DELETED] - idchoice - 19.12 | |
| 2488 </h2> | |
| 2489 <p> | |
| 2490 Outputs: | |
| 2491 </p> | |
| 2492 <p class="history_metadata_extractor_status"> | |
| 2493 Status: Failed (1) | |
| 2494 </p> | |
| 2495 <p class="history_metadata_extractor_glitter"></p> | |
| 2496 <table class=" | |
| 2497 table | |
| 2498 table-bordered | |
| 2499 table-dark | |
| 2500 table-striped | |
| 2501 table-hover | |
| 2502 d-block | |
| 2503 overflow-auto | |
| 2504 history_metadata_extractor_table | |
| 2505 "> | |
| 2506 <thead> | |
| 2507 <tr> | |
| 2508 <th scope="col"></th> | |
| 2509 <th scope="col">value</th> | |
| 2510 <th scope="col">name</th> | |
| 2511 <th scope="col">extension</th> | |
| 2512 <th scope="col">hid</th> | |
| 2513 </tr> | |
| 2514 </thead> | |
| 2515 <tr class=""> | |
| 2516 <th scope="row">Metadata_in</th> | |
| 2517 <td>7cf499d16bd542b2</td> | |
| 2518 <td>compounds_pos.txt</td> | |
| 2519 <td>tabular</td> | |
| 2520 <td>44</td> | |
| 2521 </tr><tr class=""> | |
| 2522 <th scope="row">col_name</th> | |
| 2523 <td></td> | |
| 2524 <td></td> | |
| 2525 <td></td> | |
| 2526 <td></td> | |
| 2527 </tr><tr class=""> | |
| 2528 <th scope="row">dataMatrix_in</th> | |
| 2529 <td>7cf499d16bd542b2</td> | |
| 2530 <td>compounds_pos.txt</td> | |
| 2531 <td>tabular</td> | |
| 2532 <td>44</td> | |
| 2533 </tr><tr class=""> | |
| 2534 <th scope="row">makeunique</th> | |
| 2535 <td>no</td> | |
| 2536 <td></td> | |
| 2537 <td></td> | |
| 2538 <td></td> | |
| 2539 </tr><tr class=""> | |
| 2540 <th scope="row">metatype</th> | |
| 2541 <td>variable</td> | |
| 2542 <td></td> | |
| 2543 <td></td> | |
| 2544 <td></td> | |
| 2545 </tr> | |
| 2546 </table> | |
| 2547 </div> | |
| 2548 | |
| 2549 | |
| 2550 <div class="alert alert-success history_metadata_extractor_deleted"> | |
| 2551 <h2 | |
| 2552 class="history_metadata_extractor_h2" | |
| 2553 style="cursor: pointer" | |
| 2554 title="click to fold/unfold the table" | |
| 2555 > | |
| 2556 [DELETED] - Analytic_correlation_filtration - 2019-06-20 | |
| 2557 </h2> | |
| 2558 <p> | |
| 2559 Outputs: | |
| 2560 </p> | |
| 2561 <p class="history_metadata_extractor_status"> | |
| 2562 Status: Ok (0) | |
| 2563 </p> | |
| 2564 <p class="history_metadata_extractor_glitter"></p> | |
| 2565 <table class=" | |
| 2566 table | |
| 2567 table-bordered | |
| 2568 table-dark | |
| 2569 table-striped | |
| 2570 table-hover | |
| 2571 d-block | |
| 2572 overflow-auto | |
| 2573 history_metadata_extractor_table | |
| 2574 "> | |
| 2575 <thead> | |
| 2576 <tr> | |
| 2577 <th scope="col"></th> | |
| 2578 <th scope="col">value</th> | |
| 2579 <th scope="col">name</th> | |
| 2580 <th scope="col">extension</th> | |
| 2581 <th scope="col">hid</th> | |
| 2582 </tr> | |
| 2583 </thead> | |
| 2584 <tr class=""> | |
| 2585 <th scope="row">correl_threshold</th> | |
| 2586 <td>0.9</td> | |
| 2587 <td></td> | |
| 2588 <td></td> | |
| 2589 <td></td> | |
| 2590 </tr><tr class=""> | |
| 2591 <th scope="row">dataMatrix_in</th> | |
| 2592 <td>7cf499d16bd542b2</td> | |
| 2593 <td>compounds_pos.txt</td> | |
| 2594 <td>tabular</td> | |
| 2595 <td>44</td> | |
| 2596 </tr><tr class=""> | |
| 2597 <th scope="row">file_in</th> | |
| 2598 <td>7cf499d16bd542b2</td> | |
| 2599 <td>compounds_pos.txt</td> | |
| 2600 <td>tabular</td> | |
| 2601 <td>44</td> | |
| 2602 </tr><tr class=""> | |
| 2603 <th scope="row">mass_file_in</th> | |
| 2604 <td>7cf499d16bd542b2</td> | |
| 2605 <td>compounds_pos.txt</td> | |
| 2606 <td>tabular</td> | |
| 2607 <td>44</td> | |
| 2608 </tr><tr class=""> | |
| 2609 <th scope="row">mass_list</th> | |
| 2610 <td>true</td> | |
| 2611 <td></td> | |
| 2612 <td></td> | |
| 2613 <td></td> | |
| 2614 </tr><tr class=""> | |
| 2615 <th scope="row">mass_choice</th> | |
| 2616 <td>true</td> | |
| 2617 <td></td> | |
| 2618 <td></td> | |
| 2619 <td></td> | |
| 2620 </tr><tr class=""> | |
| 2621 <th scope="row">mass_threshold</th> | |
| 2622 <td>0.005</td> | |
| 2623 <td></td> | |
| 2624 <td></td> | |
| 2625 <td></td> | |
| 2626 </tr><tr class=""> | |
| 2627 <th scope="row">repres_opt_selector</th> | |
| 2628 <td>intensity</td> | |
| 2629 <td></td> | |
| 2630 <td></td> | |
| 2631 <td></td> | |
| 2632 </tr><tr class=""> | |
| 2633 <th scope="row">rt_choice</th> | |
| 2634 <td>true</td> | |
| 2635 <td></td> | |
| 2636 <td></td> | |
| 2637 <td></td> | |
| 2638 </tr><tr class=""> | |
| 2639 <th scope="row">rt_threshold</th> | |
| 2640 <td>0.1</td> | |
| 2641 <td></td> | |
| 2642 <td></td> | |
| 2643 <td></td> | |
| 2644 </tr><tr class=""> | |
| 2645 <th scope="row">variableMetadata_in</th> | |
| 2646 <td>7cf499d16bd542b2</td> | |
| 2647 <td>compounds_pos.txt</td> | |
| 2648 <td>tabular</td> | |
| 2649 <td>44</td> | |
| 2650 </tr> | |
| 2651 </table> | |
| 2652 </div> | |
| 2653 | |
| 2654 | |
| 2655 <div class="alert alert-success history_metadata_extractor_deleted"> | |
| 2656 <h2 | |
| 2657 class="history_metadata_extractor_h2" | |
| 2658 style="cursor: pointer" | |
| 2659 title="click to fold/unfold the table" | |
| 2660 > | |
| 2661 [DELETED] - Analytic_correlation_filtration - 2019-06-20 | |
| 2662 </h2> | |
| 2663 <p> | |
| 2664 Outputs: | |
| 2665 </p> | |
| 2666 <p class="history_metadata_extractor_status"> | |
| 2667 Status: Ok (0) | |
| 2668 </p> | |
| 2669 <p class="history_metadata_extractor_glitter"></p> | |
| 2670 <table class=" | |
| 2671 table | |
| 2672 table-bordered | |
| 2673 table-dark | |
| 2674 table-striped | |
| 2675 table-hover | |
| 2676 d-block | |
| 2677 overflow-auto | |
| 2678 history_metadata_extractor_table | |
| 2679 "> | |
| 2680 <thead> | |
| 2681 <tr> | |
| 2682 <th scope="col"></th> | |
| 2683 <th scope="col">value</th> | |
| 2684 <th scope="col">name</th> | |
| 2685 <th scope="col">extension</th> | |
| 2686 <th scope="col">hid</th> | |
| 2687 </tr> | |
| 2688 </thead> | |
| 2689 <tr class=""> | |
| 2690 <th scope="row">correl_threshold</th> | |
| 2691 <td>0.9</td> | |
| 2692 <td></td> | |
| 2693 <td></td> | |
| 2694 <td></td> | |
| 2695 </tr><tr class=""> | |
| 2696 <th scope="row">dataMatrix_in</th> | |
| 2697 <td>7cf499d16bd542b2</td> | |
| 2698 <td>compounds_pos.txt</td> | |
| 2699 <td>tabular</td> | |
| 2700 <td>44</td> | |
| 2701 </tr><tr class=""> | |
| 2702 <th scope="row">file_in</th> | |
| 2703 <td>7cf499d16bd542b2</td> | |
| 2704 <td>compounds_pos.txt</td> | |
| 2705 <td>tabular</td> | |
| 2706 <td>44</td> | |
| 2707 </tr><tr class=""> | |
| 2708 <th scope="row">mass_file_in</th> | |
| 2709 <td>7cf499d16bd542b2</td> | |
| 2710 <td>compounds_pos.txt</td> | |
| 2711 <td>tabular</td> | |
| 2712 <td>44</td> | |
| 2713 </tr><tr class=""> | |
| 2714 <th scope="row">mass_list</th> | |
| 2715 <td>true</td> | |
| 2716 <td></td> | |
| 2717 <td></td> | |
| 2718 <td></td> | |
| 2719 </tr><tr class=""> | |
| 2720 <th scope="row">mass_choice</th> | |
| 2721 <td>true</td> | |
| 2722 <td></td> | |
| 2723 <td></td> | |
| 2724 <td></td> | |
| 2725 </tr><tr class=""> | |
| 2726 <th scope="row">mass_threshold</th> | |
| 2727 <td>0.005</td> | |
| 2728 <td></td> | |
| 2729 <td></td> | |
| 2730 <td></td> | |
| 2731 </tr><tr class=""> | |
| 2732 <th scope="row">repres_opt_selector</th> | |
| 2733 <td>intensity</td> | |
| 2734 <td></td> | |
| 2735 <td></td> | |
| 2736 <td></td> | |
| 2737 </tr><tr class=""> | |
| 2738 <th scope="row">rt_choice</th> | |
| 2739 <td>true</td> | |
| 2740 <td></td> | |
| 2741 <td></td> | |
| 2742 <td></td> | |
| 2743 </tr><tr class=""> | |
| 2744 <th scope="row">rt_threshold</th> | |
| 2745 <td>0.1</td> | |
| 2746 <td></td> | |
| 2747 <td></td> | |
| 2748 <td></td> | |
| 2749 </tr><tr class=""> | |
| 2750 <th scope="row">variableMetadata_in</th> | |
| 2751 <td>7cf499d16bd542b2</td> | |
| 2752 <td>compounds_pos.txt</td> | |
| 2753 <td>tabular</td> | |
| 2754 <td>44</td> | |
| 2755 </tr> | |
| 2756 </table> | |
| 2757 </div> | |
| 2758 | |
| 2759 | |
| 2760 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 2761 <h2 | |
| 2762 class="history_metadata_extractor_h2" | |
| 2763 style="cursor: pointer" | |
| 2764 title="click to fold/unfold the table" | |
| 2765 > | |
| 2766 [DELETED] - correlation_analysis - 1.0.1+galaxy0 | |
| 2767 </h2> | |
| 2768 <p> | |
| 2769 Outputs: | |
| 2770 </p> | |
| 2771 <p class="history_metadata_extractor_status"> | |
| 2772 Status: Failed (1) | |
| 2773 </p> | |
| 2774 <p class="history_metadata_extractor_glitter"></p> | |
| 2775 <table class=" | |
| 2776 table | |
| 2777 table-bordered | |
| 2778 table-dark | |
| 2779 table-striped | |
| 2780 table-hover | |
| 2781 d-block | |
| 2782 overflow-auto | |
| 2783 history_metadata_extractor_table | |
| 2784 "> | |
| 2785 <thead> | |
| 2786 <tr> | |
| 2787 <th scope="col"></th> | |
| 2788 <th scope="col">value</th> | |
| 2789 <th scope="col">name</th> | |
| 2790 <th scope="col">extension</th> | |
| 2791 <th scope="col">hid</th> | |
| 2792 </tr> | |
| 2793 </thead> | |
| 2794 <tr class=""> | |
| 2795 <th scope="row">select_funtion</th> | |
| 2796 <td>sort_only</td> | |
| 2797 <td></td> | |
| 2798 <td></td> | |
| 2799 <td></td> | |
| 2800 </tr><tr class=""> | |
| 2801 <th scope="row">dataMatrix</th> | |
| 2802 <td>7cf499d16bd542b2</td> | |
| 2803 <td>compounds_pos.txt</td> | |
| 2804 <td>tabular</td> | |
| 2805 <td>44</td> | |
| 2806 </tr><tr class=""> | |
| 2807 <th scope="row">sampleMetadata</th> | |
| 2808 <td>7cf499d16bd542b2</td> | |
| 2809 <td>compounds_pos.txt</td> | |
| 2810 <td>tabular</td> | |
| 2811 <td>44</td> | |
| 2812 </tr><tr class=""> | |
| 2813 <th scope="row">select_input_type</th> | |
| 2814 <td>select_input_from_w4m</td> | |
| 2815 <td></td> | |
| 2816 <td></td> | |
| 2817 <td></td> | |
| 2818 </tr><tr class=""> | |
| 2819 <th scope="row">variableMetadata</th> | |
| 2820 <td>7cf499d16bd542b2</td> | |
| 2821 <td>compounds_pos.txt</td> | |
| 2822 <td>tabular</td> | |
| 2823 <td>44</td> | |
| 2824 </tr> | |
| 2825 </table> | |
| 2826 </div> | |
| 2827 | |
| 2828 | |
| 2829 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 2830 <h2 | |
| 2831 class="history_metadata_extractor_h2" | |
| 2832 style="cursor: pointer" | |
| 2833 title="click to fold/unfold the table" | |
| 2834 > | |
| 2835 [DELETED] - Multivariate - 2.4.0 | |
| 2836 </h2> | |
| 2837 <p> | |
| 2838 Outputs: | |
| 2839 </p> | |
| 2840 <p class="history_metadata_extractor_status"> | |
| 2841 Status: Failed (1) | |
| 2842 </p> | |
| 2843 <p class="history_metadata_extractor_glitter"></p> | |
| 2844 <table class=" | |
| 2845 table | |
| 2846 table-bordered | |
| 2847 table-dark | |
| 2848 table-striped | |
| 2849 table-hover | |
| 2850 d-block | |
| 2851 overflow-auto | |
| 2852 history_metadata_extractor_table | |
| 2853 "> | |
| 2854 <thead> | |
| 2855 <tr> | |
| 2856 <th scope="col"></th> | |
| 2857 <th scope="col">value</th> | |
| 2858 <th scope="col">name</th> | |
| 2859 <th scope="col">extension</th> | |
| 2860 <th scope="col">hid</th> | |
| 2861 </tr> | |
| 2862 </thead> | |
| 2863 <tr class=""> | |
| 2864 <th scope="row">algorithm</th> | |
| 2865 <td>default</td> | |
| 2866 <td></td> | |
| 2867 <td></td> | |
| 2868 <td></td> | |
| 2869 </tr><tr class=""> | |
| 2870 <th scope="row">cross_validation_number</th> | |
| 2871 <td>7</td> | |
| 2872 <td></td> | |
| 2873 <td></td> | |
| 2874 <td></td> | |
| 2875 </tr><tr class=""> | |
| 2876 <th scope="row">log10L</th> | |
| 2877 <td>FALSE</td> | |
| 2878 <td></td> | |
| 2879 <td></td> | |
| 2880 <td></td> | |
| 2881 </tr><tr class=""> | |
| 2882 <th scope="row">permutation_number</th> | |
| 2883 <td>20</td> | |
| 2884 <td></td> | |
| 2885 <td></td> | |
| 2886 <td></td> | |
| 2887 </tr><tr class=""> | |
| 2888 <th scope="row">scaling</th> | |
| 2889 <td>standard</td> | |
| 2890 <td></td> | |
| 2891 <td></td> | |
| 2892 <td></td> | |
| 2893 </tr><tr class=""> | |
| 2894 <th scope="row">dataMatrix_in</th> | |
| 2895 <td>7cf499d16bd542b2</td> | |
| 2896 <td>compounds_pos.txt</td> | |
| 2897 <td>tabular</td> | |
| 2898 <td>44</td> | |
| 2899 </tr><tr class=""> | |
| 2900 <th scope="row">abcissa_parameter</th> | |
| 2901 <td>1</td> | |
| 2902 <td></td> | |
| 2903 <td></td> | |
| 2904 <td></td> | |
| 2905 </tr><tr class=""> | |
| 2906 <th scope="row">color_parameter</th> | |
| 2907 <td>None</td> | |
| 2908 <td></td> | |
| 2909 <td></td> | |
| 2910 <td></td> | |
| 2911 </tr><tr class=""> | |
| 2912 <th scope="row">ellipsis_component</th> | |
| 2913 <td>NA</td> | |
| 2914 <td></td> | |
| 2915 <td></td> | |
| 2916 <td></td> | |
| 2917 </tr><tr class=""> | |
| 2918 <th scope="row">graphic_type</th> | |
| 2919 <td>summary</td> | |
| 2920 <td></td> | |
| 2921 <td></td> | |
| 2922 <td></td> | |
| 2923 </tr><tr class=""> | |
| 2924 <th scope="row">labels_parameter</th> | |
| 2925 <td>None</td> | |
| 2926 <td></td> | |
| 2927 <td></td> | |
| 2928 <td></td> | |
| 2929 </tr><tr class=""> | |
| 2930 <th scope="row">magnify_text</th> | |
| 2931 <td>0.8</td> | |
| 2932 <td></td> | |
| 2933 <td></td> | |
| 2934 <td></td> | |
| 2935 </tr><tr class=""> | |
| 2936 <th scope="row">ordinate_parameter</th> | |
| 2937 <td>2</td> | |
| 2938 <td></td> | |
| 2939 <td></td> | |
| 2940 <td></td> | |
| 2941 </tr><tr class=""> | |
| 2942 <th scope="row">orthogonal_component_number</th> | |
| 2943 <td>0</td> | |
| 2944 <td></td> | |
| 2945 <td></td> | |
| 2946 <td></td> | |
| 2947 </tr><tr class=""> | |
| 2948 <th scope="row">predictive_component_number</th> | |
| 2949 <td>NA</td> | |
| 2950 <td></td> | |
| 2951 <td></td> | |
| 2952 <td></td> | |
| 2953 </tr><tr class=""> | |
| 2954 <th scope="row">response_component</th> | |
| 2955 <td>1</td> | |
| 2956 <td></td> | |
| 2957 <td></td> | |
| 2958 <td></td> | |
| 2959 </tr><tr class=""> | |
| 2960 <th scope="row">sampleMetadata_in</th> | |
| 2961 <td>7cf499d16bd542b2</td> | |
| 2962 <td>compounds_pos.txt</td> | |
| 2963 <td>tabular</td> | |
| 2964 <td>44</td> | |
| 2965 </tr><tr class=""> | |
| 2966 <th scope="row">save_rdata</th> | |
| 2967 <td>false</td> | |
| 2968 <td></td> | |
| 2969 <td></td> | |
| 2970 <td></td> | |
| 2971 </tr><tr class=""> | |
| 2972 <th scope="row">test_sample</th> | |
| 2973 <td>FALSE</td> | |
| 2974 <td></td> | |
| 2975 <td></td> | |
| 2976 <td></td> | |
| 2977 </tr><tr class=""> | |
| 2978 <th scope="row">variableMetadata_in</th> | |
| 2979 <td>7cf499d16bd542b2</td> | |
| 2980 <td>compounds_pos.txt</td> | |
| 2981 <td>tabular</td> | |
| 2982 <td>44</td> | |
| 2983 </tr> | |
| 2984 </table> | |
| 2985 </div> | |
| 2986 | |
| 2987 | |
| 2988 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 2989 <h2 | |
| 2990 class="history_metadata_extractor_h2" | |
| 2991 style="cursor: pointer" | |
| 2992 title="click to fold/unfold the table" | |
| 2993 > | |
| 2994 [DELETED] - Multivariate - 2.4.0 | |
| 2995 </h2> | |
| 2996 <p> | |
| 2997 Outputs: | |
| 2998 </p> | |
| 2999 <p class="history_metadata_extractor_status"> | |
| 3000 Status: Failed (1) | |
| 3001 </p> | |
| 3002 <p class="history_metadata_extractor_glitter"></p> | |
| 3003 <table class=" | |
| 3004 table | |
| 3005 table-bordered | |
| 3006 table-dark | |
| 3007 table-striped | |
| 3008 table-hover | |
| 3009 d-block | |
| 3010 overflow-auto | |
| 3011 history_metadata_extractor_table | |
| 3012 "> | |
| 3013 <thead> | |
| 3014 <tr> | |
| 3015 <th scope="col"></th> | |
| 3016 <th scope="col">value</th> | |
| 3017 <th scope="col">name</th> | |
| 3018 <th scope="col">extension</th> | |
| 3019 <th scope="col">hid</th> | |
| 3020 </tr> | |
| 3021 </thead> | |
| 3022 <tr class=""> | |
| 3023 <th scope="row">algorithm</th> | |
| 3024 <td>default</td> | |
| 3025 <td></td> | |
| 3026 <td></td> | |
| 3027 <td></td> | |
| 3028 </tr><tr class=""> | |
| 3029 <th scope="row">cross_validation_number</th> | |
| 3030 <td>7</td> | |
| 3031 <td></td> | |
| 3032 <td></td> | |
| 3033 <td></td> | |
| 3034 </tr><tr class=""> | |
| 3035 <th scope="row">log10L</th> | |
| 3036 <td>FALSE</td> | |
| 3037 <td></td> | |
| 3038 <td></td> | |
| 3039 <td></td> | |
| 3040 </tr><tr class=""> | |
| 3041 <th scope="row">permutation_number</th> | |
| 3042 <td>20</td> | |
| 3043 <td></td> | |
| 3044 <td></td> | |
| 3045 <td></td> | |
| 3046 </tr><tr class=""> | |
| 3047 <th scope="row">scaling</th> | |
| 3048 <td>standard</td> | |
| 3049 <td></td> | |
| 3050 <td></td> | |
| 3051 <td></td> | |
| 3052 </tr><tr class=""> | |
| 3053 <th scope="row">dataMatrix_in</th> | |
| 3054 <td>7cf499d16bd542b2</td> | |
| 3055 <td>compounds_pos.txt</td> | |
| 3056 <td>tabular</td> | |
| 3057 <td>44</td> | |
| 3058 </tr><tr class=""> | |
| 3059 <th scope="row">abcissa_parameter</th> | |
| 3060 <td>1</td> | |
| 3061 <td></td> | |
| 3062 <td></td> | |
| 3063 <td></td> | |
| 3064 </tr><tr class=""> | |
| 3065 <th scope="row">color_parameter</th> | |
| 3066 <td>None</td> | |
| 3067 <td></td> | |
| 3068 <td></td> | |
| 3069 <td></td> | |
| 3070 </tr><tr class=""> | |
| 3071 <th scope="row">ellipsis_component</th> | |
| 3072 <td>NA</td> | |
| 3073 <td></td> | |
| 3074 <td></td> | |
| 3075 <td></td> | |
| 3076 </tr><tr class=""> | |
| 3077 <th scope="row">graphic_type</th> | |
| 3078 <td>summary</td> | |
| 3079 <td></td> | |
| 3080 <td></td> | |
| 3081 <td></td> | |
| 3082 </tr><tr class=""> | |
| 3083 <th scope="row">labels_parameter</th> | |
| 3084 <td>None</td> | |
| 3085 <td></td> | |
| 3086 <td></td> | |
| 3087 <td></td> | |
| 3088 </tr><tr class=""> | |
| 3089 <th scope="row">magnify_text</th> | |
| 3090 <td>0.8</td> | |
| 3091 <td></td> | |
| 3092 <td></td> | |
| 3093 <td></td> | |
| 3094 </tr><tr class=""> | |
| 3095 <th scope="row">ordinate_parameter</th> | |
| 3096 <td>2</td> | |
| 3097 <td></td> | |
| 3098 <td></td> | |
| 3099 <td></td> | |
| 3100 </tr><tr class=""> | |
| 3101 <th scope="row">orthogonal_component_number</th> | |
| 3102 <td>0</td> | |
| 3103 <td></td> | |
| 3104 <td></td> | |
| 3105 <td></td> | |
| 3106 </tr><tr class=""> | |
| 3107 <th scope="row">predictive_component_number</th> | |
| 3108 <td>NA</td> | |
| 3109 <td></td> | |
| 3110 <td></td> | |
| 3111 <td></td> | |
| 3112 </tr><tr class=""> | |
| 3113 <th scope="row">response_component</th> | |
| 3114 <td>1</td> | |
| 3115 <td></td> | |
| 3116 <td></td> | |
| 3117 <td></td> | |
| 3118 </tr><tr class=""> | |
| 3119 <th scope="row">sampleMetadata_in</th> | |
| 3120 <td>7cf499d16bd542b2</td> | |
| 3121 <td>compounds_pos.txt</td> | |
| 3122 <td>tabular</td> | |
| 3123 <td>44</td> | |
| 3124 </tr><tr class=""> | |
| 3125 <th scope="row">save_rdata</th> | |
| 3126 <td>false</td> | |
| 3127 <td></td> | |
| 3128 <td></td> | |
| 3129 <td></td> | |
| 3130 </tr><tr class=""> | |
| 3131 <th scope="row">test_sample</th> | |
| 3132 <td>FALSE</td> | |
| 3133 <td></td> | |
| 3134 <td></td> | |
| 3135 <td></td> | |
| 3136 </tr><tr class=""> | |
| 3137 <th scope="row">variableMetadata_in</th> | |
| 3138 <td>7cf499d16bd542b2</td> | |
| 3139 <td>compounds_pos.txt</td> | |
| 3140 <td>tabular</td> | |
| 3141 <td>44</td> | |
| 3142 </tr> | |
| 3143 </table> | |
| 3144 </div> | |
| 3145 | |
| 3146 | |
| 3147 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 3148 <h2 | |
| 3149 class="history_metadata_extractor_h2" | |
| 3150 style="cursor: pointer" | |
| 3151 title="click to fold/unfold the table" | |
| 3152 > | |
| 3153 [DELETED] - Multivariate - 2.4.0 | |
| 3154 </h2> | |
| 3155 <p> | |
| 3156 Outputs: | |
| 3157 </p> | |
| 3158 <p class="history_metadata_extractor_status"> | |
| 3159 Status: Failed (1) | |
| 3160 </p> | |
| 3161 <p class="history_metadata_extractor_glitter"></p> | |
| 3162 <table class=" | |
| 3163 table | |
| 3164 table-bordered | |
| 3165 table-dark | |
| 3166 table-striped | |
| 3167 table-hover | |
| 3168 d-block | |
| 3169 overflow-auto | |
| 3170 history_metadata_extractor_table | |
| 3171 "> | |
| 3172 <thead> | |
| 3173 <tr> | |
| 3174 <th scope="col"></th> | |
| 3175 <th scope="col">value</th> | |
| 3176 <th scope="col">name</th> | |
| 3177 <th scope="col">extension</th> | |
| 3178 <th scope="col">hid</th> | |
| 3179 </tr> | |
| 3180 </thead> | |
| 3181 <tr class=""> | |
| 3182 <th scope="row">algorithm</th> | |
| 3183 <td>default</td> | |
| 3184 <td></td> | |
| 3185 <td></td> | |
| 3186 <td></td> | |
| 3187 </tr><tr class=""> | |
| 3188 <th scope="row">cross_validation_number</th> | |
| 3189 <td>7</td> | |
| 3190 <td></td> | |
| 3191 <td></td> | |
| 3192 <td></td> | |
| 3193 </tr><tr class=""> | |
| 3194 <th scope="row">log10L</th> | |
| 3195 <td>FALSE</td> | |
| 3196 <td></td> | |
| 3197 <td></td> | |
| 3198 <td></td> | |
| 3199 </tr><tr class=""> | |
| 3200 <th scope="row">permutation_number</th> | |
| 3201 <td>20</td> | |
| 3202 <td></td> | |
| 3203 <td></td> | |
| 3204 <td></td> | |
| 3205 </tr><tr class=""> | |
| 3206 <th scope="row">scaling</th> | |
| 3207 <td>standard</td> | |
| 3208 <td></td> | |
| 3209 <td></td> | |
| 3210 <td></td> | |
| 3211 </tr><tr class=""> | |
| 3212 <th scope="row">dataMatrix_in</th> | |
| 3213 <td>7cf499d16bd542b2</td> | |
| 3214 <td>compounds_pos.txt</td> | |
| 3215 <td>tabular</td> | |
| 3216 <td>44</td> | |
| 3217 </tr><tr class=""> | |
| 3218 <th scope="row">abcissa_parameter</th> | |
| 3219 <td>1</td> | |
| 3220 <td></td> | |
| 3221 <td></td> | |
| 3222 <td></td> | |
| 3223 </tr><tr class=""> | |
| 3224 <th scope="row">color_parameter</th> | |
| 3225 <td>None</td> | |
| 3226 <td></td> | |
| 3227 <td></td> | |
| 3228 <td></td> | |
| 3229 </tr><tr class=""> | |
| 3230 <th scope="row">ellipsis_component</th> | |
| 3231 <td>NA</td> | |
| 3232 <td></td> | |
| 3233 <td></td> | |
| 3234 <td></td> | |
| 3235 </tr><tr class=""> | |
| 3236 <th scope="row">graphic_type</th> | |
| 3237 <td>summary</td> | |
| 3238 <td></td> | |
| 3239 <td></td> | |
| 3240 <td></td> | |
| 3241 </tr><tr class=""> | |
| 3242 <th scope="row">labels_parameter</th> | |
| 3243 <td>None</td> | |
| 3244 <td></td> | |
| 3245 <td></td> | |
| 3246 <td></td> | |
| 3247 </tr><tr class=""> | |
| 3248 <th scope="row">magnify_text</th> | |
| 3249 <td>0.8</td> | |
| 3250 <td></td> | |
| 3251 <td></td> | |
| 3252 <td></td> | |
| 3253 </tr><tr class=""> | |
| 3254 <th scope="row">ordinate_parameter</th> | |
| 3255 <td>2</td> | |
| 3256 <td></td> | |
| 3257 <td></td> | |
| 3258 <td></td> | |
| 3259 </tr><tr class=""> | |
| 3260 <th scope="row">orthogonal_component_number</th> | |
| 3261 <td>0</td> | |
| 3262 <td></td> | |
| 3263 <td></td> | |
| 3264 <td></td> | |
| 3265 </tr><tr class=""> | |
| 3266 <th scope="row">predictive_component_number</th> | |
| 3267 <td>NA</td> | |
| 3268 <td></td> | |
| 3269 <td></td> | |
| 3270 <td></td> | |
| 3271 </tr><tr class=""> | |
| 3272 <th scope="row">response_component</th> | |
| 3273 <td>1</td> | |
| 3274 <td></td> | |
| 3275 <td></td> | |
| 3276 <td></td> | |
| 3277 </tr><tr class=""> | |
| 3278 <th scope="row">sampleMetadata_in</th> | |
| 3279 <td>7cf499d16bd542b2</td> | |
| 3280 <td>compounds_pos.txt</td> | |
| 3281 <td>tabular</td> | |
| 3282 <td>44</td> | |
| 3283 </tr><tr class=""> | |
| 3284 <th scope="row">save_rdata</th> | |
| 3285 <td>false</td> | |
| 3286 <td></td> | |
| 3287 <td></td> | |
| 3288 <td></td> | |
| 3289 </tr><tr class=""> | |
| 3290 <th scope="row">test_sample</th> | |
| 3291 <td>FALSE</td> | |
| 3292 <td></td> | |
| 3293 <td></td> | |
| 3294 <td></td> | |
| 3295 </tr><tr class=""> | |
| 3296 <th scope="row">variableMetadata_in</th> | |
| 3297 <td>7cf499d16bd542b2</td> | |
| 3298 <td>compounds_pos.txt</td> | |
| 3299 <td>tabular</td> | |
| 3300 <td>44</td> | |
| 3301 </tr> | |
| 3302 </table> | |
| 3303 </div> | |
| 3304 | |
| 3305 | |
| 3306 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 3307 <h2 | |
| 3308 class="history_metadata_extractor_h2" | |
| 3309 style="cursor: pointer" | |
| 3310 title="click to fold/unfold the table" | |
| 3311 > | |
| 3312 [DELETED] - Multivariate - 2.4.0 | |
| 3313 </h2> | |
| 3314 <p> | |
| 3315 Outputs: | |
| 3316 </p> | |
| 3317 <p class="history_metadata_extractor_status"> | |
| 3318 Status: Failed (1) | |
| 3319 </p> | |
| 3320 <p class="history_metadata_extractor_glitter"></p> | |
| 3321 <table class=" | |
| 3322 table | |
| 3323 table-bordered | |
| 3324 table-dark | |
| 3325 table-striped | |
| 3326 table-hover | |
| 3327 d-block | |
| 3328 overflow-auto | |
| 3329 history_metadata_extractor_table | |
| 3330 "> | |
| 3331 <thead> | |
| 3332 <tr> | |
| 3333 <th scope="col"></th> | |
| 3334 <th scope="col">value</th> | |
| 3335 <th scope="col">name</th> | |
| 3336 <th scope="col">extension</th> | |
| 3337 <th scope="col">hid</th> | |
| 3338 </tr> | |
| 3339 </thead> | |
| 3340 <tr class=""> | |
| 3341 <th scope="row">algorithm</th> | |
| 3342 <td>default</td> | |
| 3343 <td></td> | |
| 3344 <td></td> | |
| 3345 <td></td> | |
| 3346 </tr><tr class=""> | |
| 3347 <th scope="row">cross_validation_number</th> | |
| 3348 <td>7</td> | |
| 3349 <td></td> | |
| 3350 <td></td> | |
| 3351 <td></td> | |
| 3352 </tr><tr class=""> | |
| 3353 <th scope="row">log10L</th> | |
| 3354 <td>FALSE</td> | |
| 3355 <td></td> | |
| 3356 <td></td> | |
| 3357 <td></td> | |
| 3358 </tr><tr class=""> | |
| 3359 <th scope="row">permutation_number</th> | |
| 3360 <td>20</td> | |
| 3361 <td></td> | |
| 3362 <td></td> | |
| 3363 <td></td> | |
| 3364 </tr><tr class=""> | |
| 3365 <th scope="row">scaling</th> | |
| 3366 <td>standard</td> | |
| 3367 <td></td> | |
| 3368 <td></td> | |
| 3369 <td></td> | |
| 3370 </tr><tr class=""> | |
| 3371 <th scope="row">dataMatrix_in</th> | |
| 3372 <td>7cf499d16bd542b2</td> | |
| 3373 <td>compounds_pos.txt</td> | |
| 3374 <td>tabular</td> | |
| 3375 <td>44</td> | |
| 3376 </tr><tr class=""> | |
| 3377 <th scope="row">abcissa_parameter</th> | |
| 3378 <td>1</td> | |
| 3379 <td></td> | |
| 3380 <td></td> | |
| 3381 <td></td> | |
| 3382 </tr><tr class=""> | |
| 3383 <th scope="row">color_parameter</th> | |
| 3384 <td>None</td> | |
| 3385 <td></td> | |
| 3386 <td></td> | |
| 3387 <td></td> | |
| 3388 </tr><tr class=""> | |
| 3389 <th scope="row">ellipsis_component</th> | |
| 3390 <td>NA</td> | |
| 3391 <td></td> | |
| 3392 <td></td> | |
| 3393 <td></td> | |
| 3394 </tr><tr class=""> | |
| 3395 <th scope="row">graphic_type</th> | |
| 3396 <td>summary</td> | |
| 3397 <td></td> | |
| 3398 <td></td> | |
| 3399 <td></td> | |
| 3400 </tr><tr class=""> | |
| 3401 <th scope="row">labels_parameter</th> | |
| 3402 <td>None</td> | |
| 3403 <td></td> | |
| 3404 <td></td> | |
| 3405 <td></td> | |
| 3406 </tr><tr class=""> | |
| 3407 <th scope="row">magnify_text</th> | |
| 3408 <td>0.8</td> | |
| 3409 <td></td> | |
| 3410 <td></td> | |
| 3411 <td></td> | |
| 3412 </tr><tr class=""> | |
| 3413 <th scope="row">ordinate_parameter</th> | |
| 3414 <td>2</td> | |
| 3415 <td></td> | |
| 3416 <td></td> | |
| 3417 <td></td> | |
| 3418 </tr><tr class=""> | |
| 3419 <th scope="row">orthogonal_component_number</th> | |
| 3420 <td>0</td> | |
| 3421 <td></td> | |
| 3422 <td></td> | |
| 3423 <td></td> | |
| 3424 </tr><tr class=""> | |
| 3425 <th scope="row">predictive_component_number</th> | |
| 3426 <td>NA</td> | |
| 3427 <td></td> | |
| 3428 <td></td> | |
| 3429 <td></td> | |
| 3430 </tr><tr class=""> | |
| 3431 <th scope="row">response_component</th> | |
| 3432 <td>1</td> | |
| 3433 <td></td> | |
| 3434 <td></td> | |
| 3435 <td></td> | |
| 3436 </tr><tr class=""> | |
| 3437 <th scope="row">sampleMetadata_in</th> | |
| 3438 <td>7cf499d16bd542b2</td> | |
| 3439 <td>compounds_pos.txt</td> | |
| 3440 <td>tabular</td> | |
| 3441 <td>44</td> | |
| 3442 </tr><tr class=""> | |
| 3443 <th scope="row">save_rdata</th> | |
| 3444 <td>false</td> | |
| 3445 <td></td> | |
| 3446 <td></td> | |
| 3447 <td></td> | |
| 3448 </tr><tr class=""> | |
| 3449 <th scope="row">test_sample</th> | |
| 3450 <td>FALSE</td> | |
| 3451 <td></td> | |
| 3452 <td></td> | |
| 3453 <td></td> | |
| 3454 </tr><tr class=""> | |
| 3455 <th scope="row">variableMetadata_in</th> | |
| 3456 <td>7cf499d16bd542b2</td> | |
| 3457 <td>compounds_pos.txt</td> | |
| 3458 <td>tabular</td> | |
| 3459 <td>44</td> | |
| 3460 </tr> | |
| 3461 </table> | |
| 3462 </div> | |
| 3463 | |
| 3464 | |
| 3465 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 3466 <h2 | |
| 3467 class="history_metadata_extractor_h2" | |
| 3468 style="cursor: pointer" | |
| 3469 title="click to fold/unfold the table" | |
| 3470 > | |
| 3471 [DELETED] - corrtable - 1.0.0 | |
| 3472 </h2> | |
| 3473 <p> | |
| 3474 Outputs: | |
| 3475 </p> | |
| 3476 <p class="history_metadata_extractor_status"> | |
| 3477 Status: Failed (127) | |
| 3478 </p> | |
| 3479 <p class="history_metadata_extractor_glitter"></p> | |
| 3480 <table class=" | |
| 3481 table | |
| 3482 table-bordered | |
| 3483 table-dark | |
| 3484 table-striped | |
| 3485 table-hover | |
| 3486 d-block | |
| 3487 overflow-auto | |
| 3488 history_metadata_extractor_table | |
| 3489 "> | |
| 3490 <thead> | |
| 3491 <tr> | |
| 3492 <th scope="col"></th> | |
| 3493 <th scope="col">value</th> | |
| 3494 <th scope="col">name</th> | |
| 3495 <th scope="col">extension</th> | |
| 3496 <th scope="col">hid</th> | |
| 3497 </tr> | |
| 3498 </thead> | |
| 3499 <tr class=""> | |
| 3500 <th scope="row">corr_method</th> | |
| 3501 <td>pearson</td> | |
| 3502 <td></td> | |
| 3503 <td></td> | |
| 3504 <td></td> | |
| 3505 </tr><tr class=""> | |
| 3506 <th scope="row">filter</th> | |
| 3507 <td>no</td> | |
| 3508 <td></td> | |
| 3509 <td></td> | |
| 3510 <td></td> | |
| 3511 </tr><tr class=""> | |
| 3512 <th scope="row">test_corr</th> | |
| 3513 <td>no</td> | |
| 3514 <td></td> | |
| 3515 <td></td> | |
| 3516 <td></td> | |
| 3517 </tr><tr class=""> | |
| 3518 <th scope="row">color_heatmap</th> | |
| 3519 <td>no</td> | |
| 3520 <td></td> | |
| 3521 <td></td> | |
| 3522 <td></td> | |
| 3523 </tr><tr class=""> | |
| 3524 <th scope="row">plot_choice</th> | |
| 3525 <td>auto</td> | |
| 3526 <td></td> | |
| 3527 <td></td> | |
| 3528 <td></td> | |
| 3529 </tr><tr class=""> | |
| 3530 <th scope="row">reorder_var</th> | |
| 3531 <td>no</td> | |
| 3532 <td></td> | |
| 3533 <td></td> | |
| 3534 <td></td> | |
| 3535 </tr><tr class=""> | |
| 3536 <th scope="row">tab1_in</th> | |
| 3537 <td>7cf499d16bd542b2</td> | |
| 3538 <td>compounds_pos.txt</td> | |
| 3539 <td>tabular</td> | |
| 3540 <td>44</td> | |
| 3541 </tr><tr class=""> | |
| 3542 <th scope="row">tab1_samples</th> | |
| 3543 <td>row</td> | |
| 3544 <td></td> | |
| 3545 <td></td> | |
| 3546 <td></td> | |
| 3547 </tr><tr class=""> | |
| 3548 <th scope="row">tab2_in</th> | |
| 3549 <td>7cf499d16bd542b2</td> | |
| 3550 <td>compounds_pos.txt</td> | |
| 3551 <td>tabular</td> | |
| 3552 <td>44</td> | |
| 3553 </tr><tr class=""> | |
| 3554 <th scope="row">tab2_samples</th> | |
| 3555 <td>row</td> | |
| 3556 <td></td> | |
| 3557 <td></td> | |
| 3558 <td></td> | |
| 3559 </tr> | |
| 3560 </table> | |
| 3561 </div> | |
| 3562 | |
| 3563 | |
| 3564 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 3565 <h2 | |
| 3566 class="history_metadata_extractor_h2" | |
| 3567 style="cursor: pointer" | |
| 3568 title="click to fold/unfold the table" | |
| 3569 > | |
| 3570 [DELETED] - corrtable - 1.0.0 | |
| 3571 </h2> | |
| 3572 <p> | |
| 3573 Outputs: | |
| 3574 </p> | |
| 3575 <p class="history_metadata_extractor_status"> | |
| 3576 Status: Failed (127) | |
| 3577 </p> | |
| 3578 <p class="history_metadata_extractor_glitter"></p> | |
| 3579 <table class=" | |
| 3580 table | |
| 3581 table-bordered | |
| 3582 table-dark | |
| 3583 table-striped | |
| 3584 table-hover | |
| 3585 d-block | |
| 3586 overflow-auto | |
| 3587 history_metadata_extractor_table | |
| 3588 "> | |
| 3589 <thead> | |
| 3590 <tr> | |
| 3591 <th scope="col"></th> | |
| 3592 <th scope="col">value</th> | |
| 3593 <th scope="col">name</th> | |
| 3594 <th scope="col">extension</th> | |
| 3595 <th scope="col">hid</th> | |
| 3596 </tr> | |
| 3597 </thead> | |
| 3598 <tr class=""> | |
| 3599 <th scope="row">corr_method</th> | |
| 3600 <td>pearson</td> | |
| 3601 <td></td> | |
| 3602 <td></td> | |
| 3603 <td></td> | |
| 3604 </tr><tr class=""> | |
| 3605 <th scope="row">filter</th> | |
| 3606 <td>no</td> | |
| 3607 <td></td> | |
| 3608 <td></td> | |
| 3609 <td></td> | |
| 3610 </tr><tr class=""> | |
| 3611 <th scope="row">test_corr</th> | |
| 3612 <td>no</td> | |
| 3613 <td></td> | |
| 3614 <td></td> | |
| 3615 <td></td> | |
| 3616 </tr><tr class=""> | |
| 3617 <th scope="row">color_heatmap</th> | |
| 3618 <td>no</td> | |
| 3619 <td></td> | |
| 3620 <td></td> | |
| 3621 <td></td> | |
| 3622 </tr><tr class=""> | |
| 3623 <th scope="row">plot_choice</th> | |
| 3624 <td>auto</td> | |
| 3625 <td></td> | |
| 3626 <td></td> | |
| 3627 <td></td> | |
| 3628 </tr><tr class=""> | |
| 3629 <th scope="row">reorder_var</th> | |
| 3630 <td>no</td> | |
| 3631 <td></td> | |
| 3632 <td></td> | |
| 3633 <td></td> | |
| 3634 </tr><tr class=""> | |
| 3635 <th scope="row">tab1_in</th> | |
| 3636 <td>7cf499d16bd542b2</td> | |
| 3637 <td>compounds_pos.txt</td> | |
| 3638 <td>tabular</td> | |
| 3639 <td>44</td> | |
| 3640 </tr><tr class=""> | |
| 3641 <th scope="row">tab1_samples</th> | |
| 3642 <td>row</td> | |
| 3643 <td></td> | |
| 3644 <td></td> | |
| 3645 <td></td> | |
| 3646 </tr><tr class=""> | |
| 3647 <th scope="row">tab2_in</th> | |
| 3648 <td>7cf499d16bd542b2</td> | |
| 3649 <td>compounds_pos.txt</td> | |
| 3650 <td>tabular</td> | |
| 3651 <td>44</td> | |
| 3652 </tr><tr class=""> | |
| 3653 <th scope="row">tab2_samples</th> | |
| 3654 <td>row</td> | |
| 3655 <td></td> | |
| 3656 <td></td> | |
| 3657 <td></td> | |
| 3658 </tr> | |
| 3659 </table> | |
| 3660 </div> | |
| 3661 | |
| 3662 | |
| 3663 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 3664 <h2 | |
| 3665 class="history_metadata_extractor_h2" | |
| 3666 style="cursor: pointer" | |
| 3667 title="click to fold/unfold the table" | |
| 3668 > | |
| 3669 [DELETED] - abims_CAMERA_annotateDiffreport - 2.2.6+camera1.48.0-galaxy0 | |
| 3670 </h2> | |
| 3671 <p> | |
| 3672 Outputs: | |
| 3673 </p> | |
| 3674 <p class="history_metadata_extractor_status"> | |
| 3675 Status: Failed (127) | |
| 3676 </p> | |
| 3677 <p class="history_metadata_extractor_glitter"></p> | |
| 3678 <table class=" | |
| 3679 table | |
| 3680 table-bordered | |
| 3681 table-dark | |
| 3682 table-striped | |
| 3683 table-hover | |
| 3684 d-block | |
| 3685 overflow-auto | |
| 3686 history_metadata_extractor_table | |
| 3687 "> | |
| 3688 <thead> | |
| 3689 <tr> | |
| 3690 <th scope="col"></th> | |
| 3691 <th scope="col">value</th> | |
| 3692 <th scope="col">name</th> | |
| 3693 <th scope="col">extension</th> | |
| 3694 <th scope="col">hid</th> | |
| 3695 </tr> | |
| 3696 </thead> | |
| 3697 <tr class=""> | |
| 3698 <th scope="row">option</th> | |
| 3699 <td>hide</td> | |
| 3700 <td></td> | |
| 3701 <td></td> | |
| 3702 <td></td> | |
| 3703 </tr><tr class=""> | |
| 3704 <th scope="row">convertRTMinute</th> | |
| 3705 <td>false</td> | |
| 3706 <td></td> | |
| 3707 <td></td> | |
| 3708 <td></td> | |
| 3709 </tr><tr class=""> | |
| 3710 <th scope="row">intval</th> | |
| 3711 <td>into</td> | |
| 3712 <td></td> | |
| 3713 <td></td> | |
| 3714 <td></td> | |
| 3715 </tr><tr class=""> | |
| 3716 <th scope="row">numDigitsMZ</th> | |
| 3717 <td>4</td> | |
| 3718 <td></td> | |
| 3719 <td></td> | |
| 3720 <td></td> | |
| 3721 </tr><tr class=""> | |
| 3722 <th scope="row">numDigitsRT</th> | |
| 3723 <td>0</td> | |
| 3724 <td></td> | |
| 3725 <td></td> | |
| 3726 <td></td> | |
| 3727 </tr><tr class=""> | |
| 3728 <th scope="row">file_load_select</th> | |
| 3729 <td>no</td> | |
| 3730 <td></td> | |
| 3731 <td></td> | |
| 3732 <td></td> | |
| 3733 </tr><tr class=""> | |
| 3734 <th scope="row">mzabs</th> | |
| 3735 <td>0.015</td> | |
| 3736 <td></td> | |
| 3737 <td></td> | |
| 3738 <td></td> | |
| 3739 </tr><tr class=""> | |
| 3740 <th scope="row">ppm</th> | |
| 3741 <td>5</td> | |
| 3742 <td></td> | |
| 3743 <td></td> | |
| 3744 <td></td> | |
| 3745 </tr><tr class=""> | |
| 3746 <th scope="row">maxcharge</th> | |
| 3747 <td>3</td> | |
| 3748 <td></td> | |
| 3749 <td></td> | |
| 3750 <td></td> | |
| 3751 </tr><tr class=""> | |
| 3752 <th scope="row">maxiso</th> | |
| 3753 <td>4</td> | |
| 3754 <td></td> | |
| 3755 <td></td> | |
| 3756 <td></td> | |
| 3757 </tr><tr class=""> | |
| 3758 <th scope="row">minfrac</th> | |
| 3759 <td>0.5</td> | |
| 3760 <td></td> | |
| 3761 <td></td> | |
| 3762 <td></td> | |
| 3763 </tr><tr class=""> | |
| 3764 <th scope="row">perfwhm</th> | |
| 3765 <td>0.6</td> | |
| 3766 <td></td> | |
| 3767 <td></td> | |
| 3768 <td></td> | |
| 3769 </tr><tr class=""> | |
| 3770 <th scope="row">sigma</th> | |
| 3771 <td>6</td> | |
| 3772 <td></td> | |
| 3773 <td></td> | |
| 3774 <td></td> | |
| 3775 </tr><tr class=""> | |
| 3776 <th scope="row">image</th> | |
| 3777 <td>9e77b3d7d0887128</td> | |
| 3778 <td>test.rdata</td> | |
| 3779 <td>rdata</td> | |
| 3780 <td>1</td> | |
| 3781 </tr><tr class=""> | |
| 3782 <th scope="row">max_peaks</th> | |
| 3783 <td>100</td> | |
| 3784 <td></td> | |
| 3785 <td></td> | |
| 3786 <td></td> | |
| 3787 </tr><tr class=""> | |
| 3788 <th scope="row">polarity</th> | |
| 3789 <td>negative</td> | |
| 3790 <td></td> | |
| 3791 <td></td> | |
| 3792 <td></td> | |
| 3793 </tr><tr class=""> | |
| 3794 <th scope="row">multiplier</th> | |
| 3795 <td>3</td> | |
| 3796 <td></td> | |
| 3797 <td></td> | |
| 3798 <td></td> | |
| 3799 </tr><tr class=""> | |
| 3800 <th scope="row">rules_select</th> | |
| 3801 <td>FALSE</td> | |
| 3802 <td></td> | |
| 3803 <td></td> | |
| 3804 <td></td> | |
| 3805 </tr><tr class=""> | |
| 3806 <th scope="row">calcCaS</th> | |
| 3807 <td>false</td> | |
| 3808 <td></td> | |
| 3809 <td></td> | |
| 3810 <td></td> | |
| 3811 </tr><tr class=""> | |
| 3812 <th scope="row">calcCiS</th> | |
| 3813 <td>true</td> | |
| 3814 <td></td> | |
| 3815 <td></td> | |
| 3816 <td></td> | |
| 3817 </tr><tr class=""> | |
| 3818 <th scope="row">calcIso</th> | |
| 3819 <td>false</td> | |
| 3820 <td></td> | |
| 3821 <td></td> | |
| 3822 <td></td> | |
| 3823 </tr><tr class=""> | |
| 3824 <th scope="row">cor_eic_th</th> | |
| 3825 <td>0.75</td> | |
| 3826 <td></td> | |
| 3827 <td></td> | |
| 3828 <td></td> | |
| 3829 </tr><tr class=""> | |
| 3830 <th scope="row">graphMethod</th> | |
| 3831 <td>hcs</td> | |
| 3832 <td></td> | |
| 3833 <td></td> | |
| 3834 <td></td> | |
| 3835 </tr><tr class=""> | |
| 3836 <th scope="row">pval</th> | |
| 3837 <td>0.05</td> | |
| 3838 <td></td> | |
| 3839 <td></td> | |
| 3840 <td></td> | |
| 3841 </tr><tr class=""> | |
| 3842 <th scope="row">quick</th> | |
| 3843 <td>FALSE</td> | |
| 3844 <td></td> | |
| 3845 <td></td> | |
| 3846 <td></td> | |
| 3847 </tr> | |
| 3848 </table> | |
| 3849 </div> | |
| 3850 | |
| 3851 | |
| 3852 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 3853 <h2 | |
| 3854 class="history_metadata_extractor_h2" | |
| 3855 style="cursor: pointer" | |
| 3856 title="click to fold/unfold the table" | |
| 3857 > | |
| 3858 [DELETED] - abims_CAMERA_annotateDiffreport - 2.2.6+camera1.48.0-galaxy0 | |
| 3859 </h2> | |
| 3860 <p> | |
| 3861 Outputs: | |
| 3862 </p> | |
| 3863 <p class="history_metadata_extractor_status"> | |
| 3864 Status: Failed (127) | |
| 3865 </p> | |
| 3866 <p class="history_metadata_extractor_glitter"></p> | |
| 3867 <table class=" | |
| 3868 table | |
| 3869 table-bordered | |
| 3870 table-dark | |
| 3871 table-striped | |
| 3872 table-hover | |
| 3873 d-block | |
| 3874 overflow-auto | |
| 3875 history_metadata_extractor_table | |
| 3876 "> | |
| 3877 <thead> | |
| 3878 <tr> | |
| 3879 <th scope="col"></th> | |
| 3880 <th scope="col">value</th> | |
| 3881 <th scope="col">name</th> | |
| 3882 <th scope="col">extension</th> | |
| 3883 <th scope="col">hid</th> | |
| 3884 </tr> | |
| 3885 </thead> | |
| 3886 <tr class=""> | |
| 3887 <th scope="row">option</th> | |
| 3888 <td>hide</td> | |
| 3889 <td></td> | |
| 3890 <td></td> | |
| 3891 <td></td> | |
| 3892 </tr><tr class=""> | |
| 3893 <th scope="row">convertRTMinute</th> | |
| 3894 <td>false</td> | |
| 3895 <td></td> | |
| 3896 <td></td> | |
| 3897 <td></td> | |
| 3898 </tr><tr class=""> | |
| 3899 <th scope="row">intval</th> | |
| 3900 <td>into</td> | |
| 3901 <td></td> | |
| 3902 <td></td> | |
| 3903 <td></td> | |
| 3904 </tr><tr class=""> | |
| 3905 <th scope="row">numDigitsMZ</th> | |
| 3906 <td>4</td> | |
| 3907 <td></td> | |
| 3908 <td></td> | |
| 3909 <td></td> | |
| 3910 </tr><tr class=""> | |
| 3911 <th scope="row">numDigitsRT</th> | |
| 3912 <td>0</td> | |
| 3913 <td></td> | |
| 3914 <td></td> | |
| 3915 <td></td> | |
| 3916 </tr><tr class=""> | |
| 3917 <th scope="row">file_load_select</th> | |
| 3918 <td>no</td> | |
| 3919 <td></td> | |
| 3920 <td></td> | |
| 3921 <td></td> | |
| 3922 </tr><tr class=""> | |
| 3923 <th scope="row">mzabs</th> | |
| 3924 <td>0.015</td> | |
| 3925 <td></td> | |
| 3926 <td></td> | |
| 3927 <td></td> | |
| 3928 </tr><tr class=""> | |
| 3929 <th scope="row">ppm</th> | |
| 3930 <td>5</td> | |
| 3931 <td></td> | |
| 3932 <td></td> | |
| 3933 <td></td> | |
| 3934 </tr><tr class=""> | |
| 3935 <th scope="row">maxcharge</th> | |
| 3936 <td>3</td> | |
| 3937 <td></td> | |
| 3938 <td></td> | |
| 3939 <td></td> | |
| 3940 </tr><tr class=""> | |
| 3941 <th scope="row">maxiso</th> | |
| 3942 <td>4</td> | |
| 3943 <td></td> | |
| 3944 <td></td> | |
| 3945 <td></td> | |
| 3946 </tr><tr class=""> | |
| 3947 <th scope="row">minfrac</th> | |
| 3948 <td>0.5</td> | |
| 3949 <td></td> | |
| 3950 <td></td> | |
| 3951 <td></td> | |
| 3952 </tr><tr class=""> | |
| 3953 <th scope="row">perfwhm</th> | |
| 3954 <td>0.6</td> | |
| 3955 <td></td> | |
| 3956 <td></td> | |
| 3957 <td></td> | |
| 3958 </tr><tr class=""> | |
| 3959 <th scope="row">sigma</th> | |
| 3960 <td>6</td> | |
| 3961 <td></td> | |
| 3962 <td></td> | |
| 3963 <td></td> | |
| 3964 </tr><tr class=""> | |
| 3965 <th scope="row">image</th> | |
| 3966 <td>9e77b3d7d0887128</td> | |
| 3967 <td>test.rdata</td> | |
| 3968 <td>rdata</td> | |
| 3969 <td>1</td> | |
| 3970 </tr><tr class=""> | |
| 3971 <th scope="row">max_peaks</th> | |
| 3972 <td>100</td> | |
| 3973 <td></td> | |
| 3974 <td></td> | |
| 3975 <td></td> | |
| 3976 </tr><tr class=""> | |
| 3977 <th scope="row">polarity</th> | |
| 3978 <td>negative</td> | |
| 3979 <td></td> | |
| 3980 <td></td> | |
| 3981 <td></td> | |
| 3982 </tr><tr class=""> | |
| 3983 <th scope="row">multiplier</th> | |
| 3984 <td>3</td> | |
| 3985 <td></td> | |
| 3986 <td></td> | |
| 3987 <td></td> | |
| 3988 </tr><tr class=""> | |
| 3989 <th scope="row">rules_select</th> | |
| 3990 <td>FALSE</td> | |
| 3991 <td></td> | |
| 3992 <td></td> | |
| 3993 <td></td> | |
| 3994 </tr><tr class=""> | |
| 3995 <th scope="row">calcCaS</th> | |
| 3996 <td>false</td> | |
| 3997 <td></td> | |
| 3998 <td></td> | |
| 3999 <td></td> | |
| 4000 </tr><tr class=""> | |
| 4001 <th scope="row">calcCiS</th> | |
| 4002 <td>true</td> | |
| 4003 <td></td> | |
| 4004 <td></td> | |
| 4005 <td></td> | |
| 4006 </tr><tr class=""> | |
| 4007 <th scope="row">calcIso</th> | |
| 4008 <td>false</td> | |
| 4009 <td></td> | |
| 4010 <td></td> | |
| 4011 <td></td> | |
| 4012 </tr><tr class=""> | |
| 4013 <th scope="row">cor_eic_th</th> | |
| 4014 <td>0.75</td> | |
| 4015 <td></td> | |
| 4016 <td></td> | |
| 4017 <td></td> | |
| 4018 </tr><tr class=""> | |
| 4019 <th scope="row">graphMethod</th> | |
| 4020 <td>hcs</td> | |
| 4021 <td></td> | |
| 4022 <td></td> | |
| 4023 <td></td> | |
| 4024 </tr><tr class=""> | |
| 4025 <th scope="row">pval</th> | |
| 4026 <td>0.05</td> | |
| 4027 <td></td> | |
| 4028 <td></td> | |
| 4029 <td></td> | |
| 4030 </tr><tr class=""> | |
| 4031 <th scope="row">quick</th> | |
| 4032 <td>FALSE</td> | |
| 4033 <td></td> | |
| 4034 <td></td> | |
| 4035 <td></td> | |
| 4036 </tr> | |
| 4037 </table> | |
| 4038 </div> | |
| 4039 | |
| 4040 | |
| 4041 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 4042 <h2 | |
| 4043 class="history_metadata_extractor_h2" | |
| 4044 style="cursor: pointer" | |
| 4045 title="click to fold/unfold the table" | |
| 4046 > | |
| 4047 [DELETED] - abims_xcms_retcor - 3.12.0+galaxy0 | |
| 4048 </h2> | |
| 4049 <p> | |
| 4050 Outputs: | |
| 4051 </p> | |
| 4052 <p class="history_metadata_extractor_status"> | |
| 4053 Status: Failed (1) | |
| 4054 </p> | |
| 4055 <p class="history_metadata_extractor_glitter"></p> | |
| 4056 <table class=" | |
| 4057 table | |
| 4058 table-bordered | |
| 4059 table-dark | |
| 4060 table-striped | |
| 4061 table-hover | |
| 4062 d-block | |
| 4063 overflow-auto | |
| 4064 history_metadata_extractor_table | |
| 4065 "> | |
| 4066 <thead> | |
| 4067 <tr> | |
| 4068 <th scope="col"></th> | |
| 4069 <th scope="col">value</th> | |
| 4070 <th scope="col">name</th> | |
| 4071 <th scope="col">extension</th> | |
| 4072 <th scope="col">hid</th> | |
| 4073 </tr> | |
| 4074 </thead> | |
| 4075 <tr class=""> | |
| 4076 <th scope="row">file_load_select</th> | |
| 4077 <td>no</td> | |
| 4078 <td></td> | |
| 4079 <td></td> | |
| 4080 <td></td> | |
| 4081 </tr><tr class=""> | |
| 4082 <th scope="row">image</th> | |
| 4083 <td>9e77b3d7d0887128</td> | |
| 4084 <td>test.rdata</td> | |
| 4085 <td>rdata</td> | |
| 4086 <td>1</td> | |
| 4087 </tr><tr class=""> | |
| 4088 <th scope="row">extraPeaks</th> | |
| 4089 <td>1</td> | |
| 4090 <td></td> | |
| 4091 <td></td> | |
| 4092 <td></td> | |
| 4093 </tr><tr class=""> | |
| 4094 <th scope="row">method</th> | |
| 4095 <td>PeakGroups</td> | |
| 4096 <td></td> | |
| 4097 <td></td> | |
| 4098 <td></td> | |
| 4099 </tr><tr class=""> | |
| 4100 <th scope="row">minFraction</th> | |
| 4101 <td>0.9</td> | |
| 4102 <td></td> | |
| 4103 <td></td> | |
| 4104 <td></td> | |
| 4105 </tr><tr class=""> | |
| 4106 <th scope="row">family</th> | |
| 4107 <td>gaussian</td> | |
| 4108 <td></td> | |
| 4109 <td></td> | |
| 4110 <td></td> | |
| 4111 </tr><tr class=""> | |
| 4112 <th scope="row">span</th> | |
| 4113 <td>0.2</td> | |
| 4114 <td></td> | |
| 4115 <td></td> | |
| 4116 <td></td> | |
| 4117 </tr><tr class=""> | |
| 4118 <th scope="row">smooth</th> | |
| 4119 <td>loess</td> | |
| 4120 <td></td> | |
| 4121 <td></td> | |
| 4122 <td></td> | |
| 4123 </tr> | |
| 4124 </table> | |
| 4125 </div> | |
| 4126 | |
| 4127 | |
| 4128 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 4129 <h2 | |
| 4130 class="history_metadata_extractor_h2" | |
| 4131 style="cursor: pointer" | |
| 4132 title="click to fold/unfold the table" | |
| 4133 > | |
| 4134 [DELETED] - abims_xcms_retcor - 3.12.0+galaxy0 | |
| 4135 </h2> | |
| 4136 <p> | |
| 4137 Outputs: | |
| 4138 </p> | |
| 4139 <p class="history_metadata_extractor_status"> | |
| 4140 Status: Failed (1) | |
| 4141 </p> | |
| 4142 <p class="history_metadata_extractor_glitter"></p> | |
| 4143 <table class=" | |
| 4144 table | |
| 4145 table-bordered | |
| 4146 table-dark | |
| 4147 table-striped | |
| 4148 table-hover | |
| 4149 d-block | |
| 4150 overflow-auto | |
| 4151 history_metadata_extractor_table | |
| 4152 "> | |
| 4153 <thead> | |
| 4154 <tr> | |
| 4155 <th scope="col"></th> | |
| 4156 <th scope="col">value</th> | |
| 4157 <th scope="col">name</th> | |
| 4158 <th scope="col">extension</th> | |
| 4159 <th scope="col">hid</th> | |
| 4160 </tr> | |
| 4161 </thead> | |
| 4162 <tr class=""> | |
| 4163 <th scope="row">file_load_select</th> | |
| 4164 <td>no</td> | |
| 4165 <td></td> | |
| 4166 <td></td> | |
| 4167 <td></td> | |
| 4168 </tr><tr class=""> | |
| 4169 <th scope="row">image</th> | |
| 4170 <td>9e77b3d7d0887128</td> | |
| 4171 <td>test.rdata</td> | |
| 4172 <td>rdata</td> | |
| 4173 <td>1</td> | |
| 4174 </tr><tr class=""> | |
| 4175 <th scope="row">extraPeaks</th> | |
| 4176 <td>1</td> | |
| 4177 <td></td> | |
| 4178 <td></td> | |
| 4179 <td></td> | |
| 4180 </tr><tr class=""> | |
| 4181 <th scope="row">method</th> | |
| 4182 <td>PeakGroups</td> | |
| 4183 <td></td> | |
| 4184 <td></td> | |
| 4185 <td></td> | |
| 4186 </tr><tr class=""> | |
| 4187 <th scope="row">minFraction</th> | |
| 4188 <td>0.9</td> | |
| 4189 <td></td> | |
| 4190 <td></td> | |
| 4191 <td></td> | |
| 4192 </tr><tr class=""> | |
| 4193 <th scope="row">family</th> | |
| 4194 <td>gaussian</td> | |
| 4195 <td></td> | |
| 4196 <td></td> | |
| 4197 <td></td> | |
| 4198 </tr><tr class=""> | |
| 4199 <th scope="row">span</th> | |
| 4200 <td>0.2</td> | |
| 4201 <td></td> | |
| 4202 <td></td> | |
| 4203 <td></td> | |
| 4204 </tr><tr class=""> | |
| 4205 <th scope="row">smooth</th> | |
| 4206 <td>loess</td> | |
| 4207 <td></td> | |
| 4208 <td></td> | |
| 4209 <td></td> | |
| 4210 </tr> | |
| 4211 </table> | |
| 4212 </div> | |
| 4213 | |
| 4214 | |
| 4215 <div class="alert alert-success history_metadata_extractor_deleted"> | |
| 4216 <h2 | |
| 4217 class="history_metadata_extractor_h2" | |
| 4218 style="cursor: pointer" | |
| 4219 title="click to fold/unfold the table" | |
| 4220 > | |
| 4221 [DELETED] - abims_xcms_summary - 3.12.0+galaxy0 | |
| 4222 </h2> | |
| 4223 <p> | |
| 4224 Outputs: | |
| 4225 </p> | |
| 4226 <p class="history_metadata_extractor_status"> | |
| 4227 Status: Ok (0) | |
| 4228 </p> | |
| 4229 <p class="history_metadata_extractor_glitter"></p> | |
| 4230 <table class=" | |
| 4231 table | |
| 4232 table-bordered | |
| 4233 table-dark | |
| 4234 table-striped | |
| 4235 table-hover | |
| 4236 d-block | |
| 4237 overflow-auto | |
| 4238 history_metadata_extractor_table | |
| 4239 "> | |
| 4240 <thead> | |
| 4241 <tr> | |
| 4242 <th scope="col"></th> | |
| 4243 <th scope="col">value</th> | |
| 4244 <th scope="col">name</th> | |
| 4245 <th scope="col">extension</th> | |
| 4246 <th scope="col">hid</th> | |
| 4247 </tr> | |
| 4248 </thead> | |
| 4249 <tr class=""> | |
| 4250 <th scope="row">image</th> | |
| 4251 <td>9e77b3d7d0887128</td> | |
| 4252 <td>test.rdata</td> | |
| 4253 <td>rdata</td> | |
| 4254 <td>1</td> | |
| 4255 </tr> | |
| 4256 </table> | |
| 4257 </div> | |
| 4258 | |
| 4259 | |
| 4260 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 4261 <h2 | |
| 4262 class="history_metadata_extractor_h2" | |
| 4263 style="cursor: pointer" | |
| 4264 title="click to fold/unfold the table" | |
| 4265 > | |
| 4266 [DELETED] - abims_xcms_group - 3.12.0+galaxy0 | |
| 4267 </h2> | |
| 4268 <p> | |
| 4269 Outputs: | |
| 4270 </p> | |
| 4271 <p class="history_metadata_extractor_status"> | |
| 4272 Status: Failed (1) | |
| 4273 </p> | |
| 4274 <p class="history_metadata_extractor_glitter"></p> | |
| 4275 <table class=" | |
| 4276 table | |
| 4277 table-bordered | |
| 4278 table-dark | |
| 4279 table-striped | |
| 4280 table-hover | |
| 4281 d-block | |
| 4282 overflow-auto | |
| 4283 history_metadata_extractor_table | |
| 4284 "> | |
| 4285 <thead> | |
| 4286 <tr> | |
| 4287 <th scope="col"></th> | |
| 4288 <th scope="col">value</th> | |
| 4289 <th scope="col">name</th> | |
| 4290 <th scope="col">extension</th> | |
| 4291 <th scope="col">hid</th> | |
| 4292 </tr> | |
| 4293 </thead> | |
| 4294 <tr class=""> | |
| 4295 <th scope="row">file_load_select</th> | |
| 4296 <td>no</td> | |
| 4297 <td></td> | |
| 4298 <td></td> | |
| 4299 <td></td> | |
| 4300 </tr><tr class=""> | |
| 4301 <th scope="row">image</th> | |
| 4302 <td>9e77b3d7d0887128</td> | |
| 4303 <td>test.rdata</td> | |
| 4304 <td>rdata</td> | |
| 4305 <td>1</td> | |
| 4306 </tr><tr class=""> | |
| 4307 <th scope="row">maxFeatures</th> | |
| 4308 <td>50</td> | |
| 4309 <td></td> | |
| 4310 <td></td> | |
| 4311 <td></td> | |
| 4312 </tr><tr class=""> | |
| 4313 <th scope="row">binSize</th> | |
| 4314 <td>0.25</td> | |
| 4315 <td></td> | |
| 4316 <td></td> | |
| 4317 <td></td> | |
| 4318 </tr><tr class=""> | |
| 4319 <th scope="row">bw</th> | |
| 4320 <td>30.0</td> | |
| 4321 <td></td> | |
| 4322 <td></td> | |
| 4323 <td></td> | |
| 4324 </tr><tr class=""> | |
| 4325 <th scope="row">method</th> | |
| 4326 <td>PeakDensity</td> | |
| 4327 <td></td> | |
| 4328 <td></td> | |
| 4329 <td></td> | |
| 4330 </tr><tr class=""> | |
| 4331 <th scope="row">minFraction</th> | |
| 4332 <td>0.5</td> | |
| 4333 <td></td> | |
| 4334 <td></td> | |
| 4335 <td></td> | |
| 4336 </tr><tr class=""> | |
| 4337 <th scope="row">minSamples</th> | |
| 4338 <td>1</td> | |
| 4339 <td></td> | |
| 4340 <td></td> | |
| 4341 <td></td> | |
| 4342 </tr><tr class=""> | |
| 4343 <th scope="row">peaklistBool</th> | |
| 4344 <td>false</td> | |
| 4345 <td></td> | |
| 4346 <td></td> | |
| 4347 <td></td> | |
| 4348 </tr> | |
| 4349 </table> | |
| 4350 </div> | |
| 4351 | |
| 4352 | |
| 4353 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 4354 <h2 | |
| 4355 class="history_metadata_extractor_h2" | |
| 4356 style="cursor: pointer" | |
| 4357 title="click to fold/unfold the table" | |
| 4358 > | |
| 4359 [DELETED] - abims_xcms_group - 3.12.0+galaxy0 | |
| 4360 </h2> | |
| 4361 <p> | |
| 4362 Outputs: | |
| 4363 </p> | |
| 4364 <p class="history_metadata_extractor_status"> | |
| 4365 Status: Failed (1) | |
| 4366 </p> | |
| 4367 <p class="history_metadata_extractor_glitter"></p> | |
| 4368 <table class=" | |
| 4369 table | |
| 4370 table-bordered | |
| 4371 table-dark | |
| 4372 table-striped | |
| 4373 table-hover | |
| 4374 d-block | |
| 4375 overflow-auto | |
| 4376 history_metadata_extractor_table | |
| 4377 "> | |
| 4378 <thead> | |
| 4379 <tr> | |
| 4380 <th scope="col"></th> | |
| 4381 <th scope="col">value</th> | |
| 4382 <th scope="col">name</th> | |
| 4383 <th scope="col">extension</th> | |
| 4384 <th scope="col">hid</th> | |
| 4385 </tr> | |
| 4386 </thead> | |
| 4387 <tr class=""> | |
| 4388 <th scope="row">file_load_select</th> | |
| 4389 <td>no</td> | |
| 4390 <td></td> | |
| 4391 <td></td> | |
| 4392 <td></td> | |
| 4393 </tr><tr class=""> | |
| 4394 <th scope="row">image</th> | |
| 4395 <td>9e77b3d7d0887128</td> | |
| 4396 <td>test.rdata</td> | |
| 4397 <td>rdata</td> | |
| 4398 <td>1</td> | |
| 4399 </tr><tr class=""> | |
| 4400 <th scope="row">maxFeatures</th> | |
| 4401 <td>50</td> | |
| 4402 <td></td> | |
| 4403 <td></td> | |
| 4404 <td></td> | |
| 4405 </tr><tr class=""> | |
| 4406 <th scope="row">binSize</th> | |
| 4407 <td>0.25</td> | |
| 4408 <td></td> | |
| 4409 <td></td> | |
| 4410 <td></td> | |
| 4411 </tr><tr class=""> | |
| 4412 <th scope="row">bw</th> | |
| 4413 <td>30.0</td> | |
| 4414 <td></td> | |
| 4415 <td></td> | |
| 4416 <td></td> | |
| 4417 </tr><tr class=""> | |
| 4418 <th scope="row">method</th> | |
| 4419 <td>PeakDensity</td> | |
| 4420 <td></td> | |
| 4421 <td></td> | |
| 4422 <td></td> | |
| 4423 </tr><tr class=""> | |
| 4424 <th scope="row">minFraction</th> | |
| 4425 <td>0.5</td> | |
| 4426 <td></td> | |
| 4427 <td></td> | |
| 4428 <td></td> | |
| 4429 </tr><tr class=""> | |
| 4430 <th scope="row">minSamples</th> | |
| 4431 <td>1</td> | |
| 4432 <td></td> | |
| 4433 <td></td> | |
| 4434 <td></td> | |
| 4435 </tr><tr class=""> | |
| 4436 <th scope="row">peaklistBool</th> | |
| 4437 <td>false</td> | |
| 4438 <td></td> | |
| 4439 <td></td> | |
| 4440 <td></td> | |
| 4441 </tr> | |
| 4442 </table> | |
| 4443 </div> | |
| 4444 | |
| 4445 | |
| 4446 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 4447 <h2 | |
| 4448 class="history_metadata_extractor_h2" | |
| 4449 style="cursor: pointer" | |
| 4450 title="click to fold/unfold the table" | |
| 4451 > | |
| 4452 [DELETED] - xcms_merge - 3.12.0+galaxy0 | |
| 4453 </h2> | |
| 4454 <p> | |
| 4455 Outputs: | |
| 4456 </p> | |
| 4457 <p class="history_metadata_extractor_status"> | |
| 4458 Status: Failed (1) | |
| 4459 </p> | |
| 4460 <p class="history_metadata_extractor_glitter"></p> | |
| 4461 <table class=" | |
| 4462 table | |
| 4463 table-bordered | |
| 4464 table-dark | |
| 4465 table-striped | |
| 4466 table-hover | |
| 4467 d-block | |
| 4468 overflow-auto | |
| 4469 history_metadata_extractor_table | |
| 4470 "> | |
| 4471 <thead> | |
| 4472 <tr> | |
| 4473 <th scope="col"></th> | |
| 4474 <th scope="col">value</th> | |
| 4475 <th scope="col">name</th> | |
| 4476 <th scope="col">extension</th> | |
| 4477 <th scope="col">hid</th> | |
| 4478 </tr> | |
| 4479 </thead> | |
| 4480 <tr class=""> | |
| 4481 <th scope="row">file_load_select</th> | |
| 4482 <td>no</td> | |
| 4483 <td></td> | |
| 4484 <td></td> | |
| 4485 <td></td> | |
| 4486 </tr><tr class=""> | |
| 4487 <th scope="row">images</th> | |
| 4488 <td>9e77b3d7d0887128</td> | |
| 4489 <td>test.rdata</td> | |
| 4490 <td>rdata</td> | |
| 4491 <td>1</td> | |
| 4492 </tr><tr class=""> | |
| 4493 <th scope="row">sampleMetadata</th> | |
| 4494 <td>None</td> | |
| 4495 <td></td> | |
| 4496 <td></td> | |
| 4497 <td></td> | |
| 4498 </tr> | |
| 4499 </table> | |
| 4500 </div> | |
| 4501 | |
| 4502 | |
| 4503 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 4504 <h2 | |
| 4505 class="history_metadata_extractor_h2" | |
| 4506 style="cursor: pointer" | |
| 4507 title="click to fold/unfold the table" | |
| 4508 > | |
| 4509 [DELETED] - xcms_merge - 3.12.0+galaxy0 | |
| 4510 </h2> | |
| 4511 <p> | |
| 4512 Outputs: | |
| 4513 </p> | |
| 4514 <p class="history_metadata_extractor_status"> | |
| 4515 Status: Failed (1) | |
| 4516 </p> | |
| 4517 <p class="history_metadata_extractor_glitter"></p> | |
| 4518 <table class=" | |
| 4519 table | |
| 4520 table-bordered | |
| 4521 table-dark | |
| 4522 table-striped | |
| 4523 table-hover | |
| 4524 d-block | |
| 4525 overflow-auto | |
| 4526 history_metadata_extractor_table | |
| 4527 "> | |
| 4528 <thead> | |
| 4529 <tr> | |
| 4530 <th scope="col"></th> | |
| 4531 <th scope="col">value</th> | |
| 4532 <th scope="col">name</th> | |
| 4533 <th scope="col">extension</th> | |
| 4534 <th scope="col">hid</th> | |
| 4535 </tr> | |
| 4536 </thead> | |
| 4537 <tr class=""> | |
| 4538 <th scope="row">file_load_select</th> | |
| 4539 <td>no</td> | |
| 4540 <td></td> | |
| 4541 <td></td> | |
| 4542 <td></td> | |
| 4543 </tr><tr class=""> | |
| 4544 <th scope="row">images</th> | |
| 4545 <td>9e77b3d7d0887128</td> | |
| 4546 <td>test.rdata</td> | |
| 4547 <td>rdata</td> | |
| 4548 <td>1</td> | |
| 4549 </tr><tr class=""> | |
| 4550 <th scope="row">sampleMetadata</th> | |
| 4551 <td>None</td> | |
| 4552 <td></td> | |
| 4553 <td></td> | |
| 4554 <td></td> | |
| 4555 </tr> | |
| 4556 </table> | |
| 4557 </div> | |
| 4558 | |
| 4559 | |
| 4560 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 4561 <h2 | |
| 4562 class="history_metadata_extractor_h2" | |
| 4563 style="cursor: pointer" | |
| 4564 title="click to fold/unfold the table" | |
| 4565 > | |
| 4566 [DELETED] - abims_xcms_xcmsSet - 3.12.0+galaxy0 | |
| 4567 </h2> | |
| 4568 <p> | |
| 4569 Outputs: | |
| 4570 </p> | |
| 4571 <p class="history_metadata_extractor_status"> | |
| 4572 Status: Failed (1) | |
| 4573 </p> | |
| 4574 <p class="history_metadata_extractor_glitter"></p> | |
| 4575 <table class=" | |
| 4576 table | |
| 4577 table-bordered | |
| 4578 table-dark | |
| 4579 table-striped | |
| 4580 table-hover | |
| 4581 d-block | |
| 4582 overflow-auto | |
| 4583 history_metadata_extractor_table | |
| 4584 "> | |
| 4585 <thead> | |
| 4586 <tr> | |
| 4587 <th scope="col"></th> | |
| 4588 <th scope="col">value</th> | |
| 4589 <th scope="col">name</th> | |
| 4590 <th scope="col">extension</th> | |
| 4591 <th scope="col">hid</th> | |
| 4592 </tr> | |
| 4593 </thead> | |
| 4594 <tr class=""> | |
| 4595 <th scope="row">file_load_select</th> | |
| 4596 <td>no</td> | |
| 4597 <td></td> | |
| 4598 <td></td> | |
| 4599 <td></td> | |
| 4600 </tr><tr class=""> | |
| 4601 <th scope="row">filterAcquisitionNum</th> | |
| 4602 <td></td> | |
| 4603 <td></td> | |
| 4604 <td></td> | |
| 4605 <td></td> | |
| 4606 </tr><tr class=""> | |
| 4607 <th scope="row">filterMz</th> | |
| 4608 <td></td> | |
| 4609 <td></td> | |
| 4610 <td></td> | |
| 4611 <td></td> | |
| 4612 </tr><tr class=""> | |
| 4613 <th scope="row">filterRt</th> | |
| 4614 <td></td> | |
| 4615 <td></td> | |
| 4616 <td></td> | |
| 4617 <td></td> | |
| 4618 </tr><tr class=""> | |
| 4619 <th scope="row">image</th> | |
| 4620 <td>9e77b3d7d0887128</td> | |
| 4621 <td>test.rdata</td> | |
| 4622 <td>rdata</td> | |
| 4623 <td>1</td> | |
| 4624 </tr><tr class=""> | |
| 4625 <th scope="row">impute</th> | |
| 4626 <td>none</td> | |
| 4627 <td></td> | |
| 4628 <td></td> | |
| 4629 <td></td> | |
| 4630 </tr><tr class=""> | |
| 4631 <th scope="row">max</th> | |
| 4632 <td>5</td> | |
| 4633 <td></td> | |
| 4634 <td></td> | |
| 4635 <td></td> | |
| 4636 </tr><tr class=""> | |
| 4637 <th scope="row">mzdiff</th> | |
| 4638 <td>0.6</td> | |
| 4639 <td></td> | |
| 4640 <td></td> | |
| 4641 <td></td> | |
| 4642 </tr><tr class=""> | |
| 4643 <th scope="row">peaklist</th> | |
| 4644 <td>false</td> | |
| 4645 <td></td> | |
| 4646 <td></td> | |
| 4647 <td></td> | |
| 4648 </tr><tr class=""> | |
| 4649 <th scope="row">sigma</th> | |
| 4650 <td></td> | |
| 4651 <td></td> | |
| 4652 <td></td> | |
| 4653 <td></td> | |
| 4654 </tr><tr class=""> | |
| 4655 <th scope="row">snthresh</th> | |
| 4656 <td>10</td> | |
| 4657 <td></td> | |
| 4658 <td></td> | |
| 4659 <td></td> | |
| 4660 </tr><tr class=""> | |
| 4661 <th scope="row">steps</th> | |
| 4662 <td>2</td> | |
| 4663 <td></td> | |
| 4664 <td></td> | |
| 4665 <td></td> | |
| 4666 </tr><tr class=""> | |
| 4667 <th scope="row">binSize</th> | |
| 4668 <td>0.1</td> | |
| 4669 <td></td> | |
| 4670 <td></td> | |
| 4671 <td></td> | |
| 4672 </tr><tr class=""> | |
| 4673 <th scope="row">fwhm</th> | |
| 4674 <td>30</td> | |
| 4675 <td></td> | |
| 4676 <td></td> | |
| 4677 <td></td> | |
| 4678 </tr><tr class=""> | |
| 4679 <th scope="row">method</th> | |
| 4680 <td>MatchedFilter</td> | |
| 4681 <td></td> | |
| 4682 <td></td> | |
| 4683 <td></td> | |
| 4684 </tr> | |
| 4685 </table> | |
| 4686 </div> | |
| 4687 | |
| 4688 | |
| 4689 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 4690 <h2 | |
| 4691 class="history_metadata_extractor_h2" | |
| 4692 style="cursor: pointer" | |
| 4693 title="click to fold/unfold the table" | |
| 4694 > | |
| 4695 [DELETED] - abims_xcms_xcmsSet - 3.12.0+galaxy0 | |
| 4696 </h2> | |
| 4697 <p> | |
| 4698 Outputs: | |
| 4699 </p> | |
| 4700 <p class="history_metadata_extractor_status"> | |
| 4701 Status: Failed (1) | |
| 4702 </p> | |
| 4703 <p class="history_metadata_extractor_glitter"></p> | |
| 4704 <table class=" | |
| 4705 table | |
| 4706 table-bordered | |
| 4707 table-dark | |
| 4708 table-striped | |
| 4709 table-hover | |
| 4710 d-block | |
| 4711 overflow-auto | |
| 4712 history_metadata_extractor_table | |
| 4713 "> | |
| 4714 <thead> | |
| 4715 <tr> | |
| 4716 <th scope="col"></th> | |
| 4717 <th scope="col">value</th> | |
| 4718 <th scope="col">name</th> | |
| 4719 <th scope="col">extension</th> | |
| 4720 <th scope="col">hid</th> | |
| 4721 </tr> | |
| 4722 </thead> | |
| 4723 <tr class=""> | |
| 4724 <th scope="row">file_load_select</th> | |
| 4725 <td>no</td> | |
| 4726 <td></td> | |
| 4727 <td></td> | |
| 4728 <td></td> | |
| 4729 </tr><tr class=""> | |
| 4730 <th scope="row">filterAcquisitionNum</th> | |
| 4731 <td></td> | |
| 4732 <td></td> | |
| 4733 <td></td> | |
| 4734 <td></td> | |
| 4735 </tr><tr class=""> | |
| 4736 <th scope="row">filterMz</th> | |
| 4737 <td></td> | |
| 4738 <td></td> | |
| 4739 <td></td> | |
| 4740 <td></td> | |
| 4741 </tr><tr class=""> | |
| 4742 <th scope="row">filterRt</th> | |
| 4743 <td></td> | |
| 4744 <td></td> | |
| 4745 <td></td> | |
| 4746 <td></td> | |
| 4747 </tr><tr class=""> | |
| 4748 <th scope="row">image</th> | |
| 4749 <td>9e77b3d7d0887128</td> | |
| 4750 <td>test.rdata</td> | |
| 4751 <td>rdata</td> | |
| 4752 <td>1</td> | |
| 4753 </tr><tr class=""> | |
| 4754 <th scope="row">impute</th> | |
| 4755 <td>none</td> | |
| 4756 <td></td> | |
| 4757 <td></td> | |
| 4758 <td></td> | |
| 4759 </tr><tr class=""> | |
| 4760 <th scope="row">max</th> | |
| 4761 <td>5</td> | |
| 4762 <td></td> | |
| 4763 <td></td> | |
| 4764 <td></td> | |
| 4765 </tr><tr class=""> | |
| 4766 <th scope="row">mzdiff</th> | |
| 4767 <td>0.6</td> | |
| 4768 <td></td> | |
| 4769 <td></td> | |
| 4770 <td></td> | |
| 4771 </tr><tr class=""> | |
| 4772 <th scope="row">peaklist</th> | |
| 4773 <td>false</td> | |
| 4774 <td></td> | |
| 4775 <td></td> | |
| 4776 <td></td> | |
| 4777 </tr><tr class=""> | |
| 4778 <th scope="row">sigma</th> | |
| 4779 <td></td> | |
| 4780 <td></td> | |
| 4781 <td></td> | |
| 4782 <td></td> | |
| 4783 </tr><tr class=""> | |
| 4784 <th scope="row">snthresh</th> | |
| 4785 <td>10</td> | |
| 4786 <td></td> | |
| 4787 <td></td> | |
| 4788 <td></td> | |
| 4789 </tr><tr class=""> | |
| 4790 <th scope="row">steps</th> | |
| 4791 <td>2</td> | |
| 4792 <td></td> | |
| 4793 <td></td> | |
| 4794 <td></td> | |
| 4795 </tr><tr class=""> | |
| 4796 <th scope="row">binSize</th> | |
| 4797 <td>0.1</td> | |
| 4798 <td></td> | |
| 4799 <td></td> | |
| 4800 <td></td> | |
| 4801 </tr><tr class=""> | |
| 4802 <th scope="row">fwhm</th> | |
| 4803 <td>30</td> | |
| 4804 <td></td> | |
| 4805 <td></td> | |
| 4806 <td></td> | |
| 4807 </tr><tr class=""> | |
| 4808 <th scope="row">method</th> | |
| 4809 <td>MatchedFilter</td> | |
| 4810 <td></td> | |
| 4811 <td></td> | |
| 4812 <td></td> | |
| 4813 </tr> | |
| 4814 </table> | |
| 4815 </div> | |
| 4816 | |
| 4817 | |
| 4818 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 4819 <h2 | |
| 4820 class="history_metadata_extractor_h2" | |
| 4821 style="cursor: pointer" | |
| 4822 title="click to fold/unfold the table" | |
| 4823 > | |
| 4824 [DELETED] - xcms_export_samplemetadata - 3.12.0+galaxy0 | |
| 4825 </h2> | |
| 4826 <p> | |
| 4827 Outputs: | |
| 4828 </p> | |
| 4829 <p class="history_metadata_extractor_status"> | |
| 4830 Status: Failed (1) | |
| 4831 </p> | |
| 4832 <p class="history_metadata_extractor_glitter"></p> | |
| 4833 <table class=" | |
| 4834 table | |
| 4835 table-bordered | |
| 4836 table-dark | |
| 4837 table-striped | |
| 4838 table-hover | |
| 4839 d-block | |
| 4840 overflow-auto | |
| 4841 history_metadata_extractor_table | |
| 4842 "> | |
| 4843 <thead> | |
| 4844 <tr> | |
| 4845 <th scope="col"></th> | |
| 4846 <th scope="col">value</th> | |
| 4847 <th scope="col">name</th> | |
| 4848 <th scope="col">extension</th> | |
| 4849 <th scope="col">hid</th> | |
| 4850 </tr> | |
| 4851 </thead> | |
| 4852 <tr class=""> | |
| 4853 <th scope="row">images</th> | |
| 4854 <td>9e77b3d7d0887128</td> | |
| 4855 <td>test.rdata</td> | |
| 4856 <td>rdata</td> | |
| 4857 <td>1</td> | |
| 4858 </tr> | |
| 4859 </table> | |
| 4860 </div> | |
| 4861 | |
| 4862 | |
| 4863 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 4864 <h2 | |
| 4865 class="history_metadata_extractor_h2" | |
| 4866 style="cursor: pointer" | |
| 4867 title="click to fold/unfold the table" | |
| 4868 > | |
| 4869 [DELETED] - xcms_plot_chromatogram - 3.12.0+galaxy0 | |
| 4870 </h2> | |
| 4871 <p> | |
| 4872 Outputs: | |
| 4873 </p> | |
| 4874 <p class="history_metadata_extractor_status"> | |
| 4875 Status: Failed (1) | |
| 4876 </p> | |
| 4877 <p class="history_metadata_extractor_glitter"></p> | |
| 4878 <table class=" | |
| 4879 table | |
| 4880 table-bordered | |
| 4881 table-dark | |
| 4882 table-striped | |
| 4883 table-hover | |
| 4884 d-block | |
| 4885 overflow-auto | |
| 4886 history_metadata_extractor_table | |
| 4887 "> | |
| 4888 <thead> | |
| 4889 <tr> | |
| 4890 <th scope="col"></th> | |
| 4891 <th scope="col">value</th> | |
| 4892 <th scope="col">name</th> | |
| 4893 <th scope="col">extension</th> | |
| 4894 <th scope="col">hid</th> | |
| 4895 </tr> | |
| 4896 </thead> | |
| 4897 <tr class=""> | |
| 4898 <th scope="row">file_load_select</th> | |
| 4899 <td>no</td> | |
| 4900 <td></td> | |
| 4901 <td></td> | |
| 4902 <td></td> | |
| 4903 </tr><tr class=""> | |
| 4904 <th scope="row">images</th> | |
| 4905 <td>9e77b3d7d0887128</td> | |
| 4906 <td>test.rdata</td> | |
| 4907 <td>rdata</td> | |
| 4908 <td>1</td> | |
| 4909 </tr><tr class=""> | |
| 4910 <th scope="row">sampleMetadata</th> | |
| 4911 <td>None</td> | |
| 4912 <td></td> | |
| 4913 <td></td> | |
| 4914 <td></td> | |
| 4915 </tr> | |
| 4916 </table> | |
| 4917 </div> | |
| 4918 | |
| 4919 | |
| 4920 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 4921 <h2 | |
| 4922 class="history_metadata_extractor_h2" | |
| 4923 style="cursor: pointer" | |
| 4924 title="click to fold/unfold the table" | |
| 4925 > | |
| 4926 [DELETED] - xcms_plot_chromatogram - 3.12.0+galaxy0 | |
| 4927 </h2> | |
| 4928 <p> | |
| 4929 Outputs: | |
| 4930 </p> | |
| 4931 <p class="history_metadata_extractor_status"> | |
| 4932 Status: Failed (1) | |
| 4933 </p> | |
| 4934 <p class="history_metadata_extractor_glitter"></p> | |
| 4935 <table class=" | |
| 4936 table | |
| 4937 table-bordered | |
| 4938 table-dark | |
| 4939 table-striped | |
| 4940 table-hover | |
| 4941 d-block | |
| 4942 overflow-auto | |
| 4943 history_metadata_extractor_table | |
| 4944 "> | |
| 4945 <thead> | |
| 4946 <tr> | |
| 4947 <th scope="col"></th> | |
| 4948 <th scope="col">value</th> | |
| 4949 <th scope="col">name</th> | |
| 4950 <th scope="col">extension</th> | |
| 4951 <th scope="col">hid</th> | |
| 4952 </tr> | |
| 4953 </thead> | |
| 4954 <tr class=""> | |
| 4955 <th scope="row">file_load_select</th> | |
| 4956 <td>no</td> | |
| 4957 <td></td> | |
| 4958 <td></td> | |
| 4959 <td></td> | |
| 4960 </tr><tr class=""> | |
| 4961 <th scope="row">images</th> | |
| 4962 <td>9e77b3d7d0887128</td> | |
| 4963 <td>test.rdata</td> | |
| 4964 <td>rdata</td> | |
| 4965 <td>1</td> | |
| 4966 </tr><tr class=""> | |
| 4967 <th scope="row">sampleMetadata</th> | |
| 4968 <td>None</td> | |
| 4969 <td></td> | |
| 4970 <td></td> | |
| 4971 <td></td> | |
| 4972 </tr> | |
| 4973 </table> | |
| 4974 </div> | |
| 4975 | |
| 4976 | |
| 4977 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 4978 <h2 | |
| 4979 class="history_metadata_extractor_h2" | |
| 4980 style="cursor: pointer" | |
| 4981 title="click to fold/unfold the table" | |
| 4982 > | |
| 4983 [DELETED] - abims_xcms_fillPeaks - 3.12.0+galaxy0 | |
| 4984 </h2> | |
| 4985 <p> | |
| 4986 Outputs: | |
| 4987 </p> | |
| 4988 <p class="history_metadata_extractor_status"> | |
| 4989 Status: Failed (1) | |
| 4990 </p> | |
| 4991 <p class="history_metadata_extractor_glitter"></p> | |
| 4992 <table class=" | |
| 4993 table | |
| 4994 table-bordered | |
| 4995 table-dark | |
| 4996 table-striped | |
| 4997 table-hover | |
| 4998 d-block | |
| 4999 overflow-auto | |
| 5000 history_metadata_extractor_table | |
| 5001 "> | |
| 5002 <thead> | |
| 5003 <tr> | |
| 5004 <th scope="col"></th> | |
| 5005 <th scope="col">value</th> | |
| 5006 <th scope="col">name</th> | |
| 5007 <th scope="col">extension</th> | |
| 5008 <th scope="col">hid</th> | |
| 5009 </tr> | |
| 5010 </thead> | |
| 5011 <tr class=""> | |
| 5012 <th scope="row">expandMz</th> | |
| 5013 <td>0</td> | |
| 5014 <td></td> | |
| 5015 <td></td> | |
| 5016 <td></td> | |
| 5017 </tr><tr class=""> | |
| 5018 <th scope="row">expandRt</th> | |
| 5019 <td>0</td> | |
| 5020 <td></td> | |
| 5021 <td></td> | |
| 5022 <td></td> | |
| 5023 </tr><tr class=""> | |
| 5024 <th scope="row">ppm</th> | |
| 5025 <td>0</td> | |
| 5026 <td></td> | |
| 5027 <td></td> | |
| 5028 <td></td> | |
| 5029 </tr><tr class=""> | |
| 5030 <th scope="row">file_load_select</th> | |
| 5031 <td>no</td> | |
| 5032 <td></td> | |
| 5033 <td></td> | |
| 5034 <td></td> | |
| 5035 </tr><tr class=""> | |
| 5036 <th scope="row">image</th> | |
| 5037 <td>9e77b3d7d0887128</td> | |
| 5038 <td>test.rdata</td> | |
| 5039 <td>rdata</td> | |
| 5040 <td>1</td> | |
| 5041 </tr><tr class=""> | |
| 5042 <th scope="row">convertRTMinute</th> | |
| 5043 <td>false</td> | |
| 5044 <td></td> | |
| 5045 <td></td> | |
| 5046 <td></td> | |
| 5047 </tr><tr class=""> | |
| 5048 <th scope="row">intval</th> | |
| 5049 <td>into</td> | |
| 5050 <td></td> | |
| 5051 <td></td> | |
| 5052 <td></td> | |
| 5053 </tr><tr class=""> | |
| 5054 <th scope="row">naTOzero</th> | |
| 5055 <td>true</td> | |
| 5056 <td></td> | |
| 5057 <td></td> | |
| 5058 <td></td> | |
| 5059 </tr><tr class=""> | |
| 5060 <th scope="row">numDigitsMZ</th> | |
| 5061 <td>4</td> | |
| 5062 <td></td> | |
| 5063 <td></td> | |
| 5064 <td></td> | |
| 5065 </tr><tr class=""> | |
| 5066 <th scope="row">numDigitsRT</th> | |
| 5067 <td>0</td> | |
| 5068 <td></td> | |
| 5069 <td></td> | |
| 5070 <td></td> | |
| 5071 </tr><tr class=""> | |
| 5072 <th scope="row">peaklistBool</th> | |
| 5073 <td>True</td> | |
| 5074 <td></td> | |
| 5075 <td></td> | |
| 5076 <td></td> | |
| 5077 </tr> | |
| 5078 </table> | |
| 5079 </div> | |
| 5080 | |
| 5081 | |
| 5082 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 5083 <h2 | |
| 5084 class="history_metadata_extractor_h2" | |
| 5085 style="cursor: pointer" | |
| 5086 title="click to fold/unfold the table" | |
| 5087 > | |
| 5088 [DELETED] - abims_xcms_fillPeaks - 3.12.0+galaxy0 | |
| 5089 </h2> | |
| 5090 <p> | |
| 5091 Outputs: | |
| 5092 </p> | |
| 5093 <p class="history_metadata_extractor_status"> | |
| 5094 Status: Failed (1) | |
| 5095 </p> | |
| 5096 <p class="history_metadata_extractor_glitter"></p> | |
| 5097 <table class=" | |
| 5098 table | |
| 5099 table-bordered | |
| 5100 table-dark | |
| 5101 table-striped | |
| 5102 table-hover | |
| 5103 d-block | |
| 5104 overflow-auto | |
| 5105 history_metadata_extractor_table | |
| 5106 "> | |
| 5107 <thead> | |
| 5108 <tr> | |
| 5109 <th scope="col"></th> | |
| 5110 <th scope="col">value</th> | |
| 5111 <th scope="col">name</th> | |
| 5112 <th scope="col">extension</th> | |
| 5113 <th scope="col">hid</th> | |
| 5114 </tr> | |
| 5115 </thead> | |
| 5116 <tr class=""> | |
| 5117 <th scope="row">expandMz</th> | |
| 5118 <td>0</td> | |
| 5119 <td></td> | |
| 5120 <td></td> | |
| 5121 <td></td> | |
| 5122 </tr><tr class=""> | |
| 5123 <th scope="row">expandRt</th> | |
| 5124 <td>0</td> | |
| 5125 <td></td> | |
| 5126 <td></td> | |
| 5127 <td></td> | |
| 5128 </tr><tr class=""> | |
| 5129 <th scope="row">ppm</th> | |
| 5130 <td>0</td> | |
| 5131 <td></td> | |
| 5132 <td></td> | |
| 5133 <td></td> | |
| 5134 </tr><tr class=""> | |
| 5135 <th scope="row">file_load_select</th> | |
| 5136 <td>no</td> | |
| 5137 <td></td> | |
| 5138 <td></td> | |
| 5139 <td></td> | |
| 5140 </tr><tr class=""> | |
| 5141 <th scope="row">image</th> | |
| 5142 <td>9e77b3d7d0887128</td> | |
| 5143 <td>test.rdata</td> | |
| 5144 <td>rdata</td> | |
| 5145 <td>1</td> | |
| 5146 </tr><tr class=""> | |
| 5147 <th scope="row">convertRTMinute</th> | |
| 5148 <td>false</td> | |
| 5149 <td></td> | |
| 5150 <td></td> | |
| 5151 <td></td> | |
| 5152 </tr><tr class=""> | |
| 5153 <th scope="row">intval</th> | |
| 5154 <td>into</td> | |
| 5155 <td></td> | |
| 5156 <td></td> | |
| 5157 <td></td> | |
| 5158 </tr><tr class=""> | |
| 5159 <th scope="row">naTOzero</th> | |
| 5160 <td>true</td> | |
| 5161 <td></td> | |
| 5162 <td></td> | |
| 5163 <td></td> | |
| 5164 </tr><tr class=""> | |
| 5165 <th scope="row">numDigitsMZ</th> | |
| 5166 <td>4</td> | |
| 5167 <td></td> | |
| 5168 <td></td> | |
| 5169 <td></td> | |
| 5170 </tr><tr class=""> | |
| 5171 <th scope="row">numDigitsRT</th> | |
| 5172 <td>0</td> | |
| 5173 <td></td> | |
| 5174 <td></td> | |
| 5175 <td></td> | |
| 5176 </tr><tr class=""> | |
| 5177 <th scope="row">peaklistBool</th> | |
| 5178 <td>True</td> | |
| 5179 <td></td> | |
| 5180 <td></td> | |
| 5181 <td></td> | |
| 5182 </tr> | |
| 5183 </table> | |
| 5184 </div> | |
| 5185 | |
| 5186 | |
| 5187 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 5188 <h2 | |
| 5189 class="history_metadata_extractor_h2" | |
| 5190 style="cursor: pointer" | |
| 5191 title="click to fold/unfold the table" | |
| 5192 > | |
| 5193 [DELETED] - abims_xcms_fillPeaks - 3.12.0+galaxy0 | |
| 5194 </h2> | |
| 5195 <p> | |
| 5196 Outputs: | |
| 5197 </p> | |
| 5198 <p class="history_metadata_extractor_status"> | |
| 5199 Status: Failed (1) | |
| 5200 </p> | |
| 5201 <p class="history_metadata_extractor_glitter"></p> | |
| 5202 <table class=" | |
| 5203 table | |
| 5204 table-bordered | |
| 5205 table-dark | |
| 5206 table-striped | |
| 5207 table-hover | |
| 5208 d-block | |
| 5209 overflow-auto | |
| 5210 history_metadata_extractor_table | |
| 5211 "> | |
| 5212 <thead> | |
| 5213 <tr> | |
| 5214 <th scope="col"></th> | |
| 5215 <th scope="col">value</th> | |
| 5216 <th scope="col">name</th> | |
| 5217 <th scope="col">extension</th> | |
| 5218 <th scope="col">hid</th> | |
| 5219 </tr> | |
| 5220 </thead> | |
| 5221 <tr class=""> | |
| 5222 <th scope="row">expandMz</th> | |
| 5223 <td>0</td> | |
| 5224 <td></td> | |
| 5225 <td></td> | |
| 5226 <td></td> | |
| 5227 </tr><tr class=""> | |
| 5228 <th scope="row">expandRt</th> | |
| 5229 <td>0</td> | |
| 5230 <td></td> | |
| 5231 <td></td> | |
| 5232 <td></td> | |
| 5233 </tr><tr class=""> | |
| 5234 <th scope="row">ppm</th> | |
| 5235 <td>0</td> | |
| 5236 <td></td> | |
| 5237 <td></td> | |
| 5238 <td></td> | |
| 5239 </tr><tr class=""> | |
| 5240 <th scope="row">file_load_select</th> | |
| 5241 <td>no</td> | |
| 5242 <td></td> | |
| 5243 <td></td> | |
| 5244 <td></td> | |
| 5245 </tr><tr class=""> | |
| 5246 <th scope="row">image</th> | |
| 5247 <td>9e77b3d7d0887128</td> | |
| 5248 <td>test.rdata</td> | |
| 5249 <td>rdata</td> | |
| 5250 <td>1</td> | |
| 5251 </tr><tr class=""> | |
| 5252 <th scope="row">convertRTMinute</th> | |
| 5253 <td>false</td> | |
| 5254 <td></td> | |
| 5255 <td></td> | |
| 5256 <td></td> | |
| 5257 </tr><tr class=""> | |
| 5258 <th scope="row">intval</th> | |
| 5259 <td>into</td> | |
| 5260 <td></td> | |
| 5261 <td></td> | |
| 5262 <td></td> | |
| 5263 </tr><tr class=""> | |
| 5264 <th scope="row">naTOzero</th> | |
| 5265 <td>true</td> | |
| 5266 <td></td> | |
| 5267 <td></td> | |
| 5268 <td></td> | |
| 5269 </tr><tr class=""> | |
| 5270 <th scope="row">numDigitsMZ</th> | |
| 5271 <td>4</td> | |
| 5272 <td></td> | |
| 5273 <td></td> | |
| 5274 <td></td> | |
| 5275 </tr><tr class=""> | |
| 5276 <th scope="row">numDigitsRT</th> | |
| 5277 <td>0</td> | |
| 5278 <td></td> | |
| 5279 <td></td> | |
| 5280 <td></td> | |
| 5281 </tr><tr class=""> | |
| 5282 <th scope="row">peaklistBool</th> | |
| 5283 <td>True</td> | |
| 5284 <td></td> | |
| 5285 <td></td> | |
| 5286 <td></td> | |
| 5287 </tr> | |
| 5288 </table> | |
| 5289 </div> | |
| 5290 | |
| 5291 | |
| 5292 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 5293 <h2 | |
| 5294 class="history_metadata_extractor_h2" | |
| 5295 style="cursor: pointer" | |
| 5296 title="click to fold/unfold the table" | |
| 5297 > | |
| 5298 [DELETED] - quality_metrics - 2.2.8 | |
| 5299 </h2> | |
| 5300 <p> | |
| 5301 Outputs: | |
| 5302 </p> | |
| 5303 <p class="history_metadata_extractor_status"> | |
| 5304 Status: Failed (1) | |
| 5305 </p> | |
| 5306 <p class="history_metadata_extractor_glitter"></p> | |
| 5307 <table class=" | |
| 5308 table | |
| 5309 table-bordered | |
| 5310 table-dark | |
| 5311 table-striped | |
| 5312 table-hover | |
| 5313 d-block | |
| 5314 overflow-auto | |
| 5315 history_metadata_extractor_table | |
| 5316 "> | |
| 5317 <thead> | |
| 5318 <tr> | |
| 5319 <th scope="col"></th> | |
| 5320 <th scope="col">value</th> | |
| 5321 <th scope="col">name</th> | |
| 5322 <th scope="col">extension</th> | |
| 5323 <th scope="col">hid</th> | |
| 5324 </tr> | |
| 5325 </thead> | |
| 5326 <tr class=""> | |
| 5327 <th scope="row">CV</th> | |
| 5328 <td>FALSE</td> | |
| 5329 <td></td> | |
| 5330 <td></td> | |
| 5331 <td></td> | |
| 5332 </tr><tr class=""> | |
| 5333 <th scope="row">Compa</th> | |
| 5334 <td>TRUE</td> | |
| 5335 <td></td> | |
| 5336 <td></td> | |
| 5337 <td></td> | |
| 5338 </tr><tr class=""> | |
| 5339 <th scope="row">seuil</th> | |
| 5340 <td>1</td> | |
| 5341 <td></td> | |
| 5342 <td></td> | |
| 5343 <td></td> | |
| 5344 </tr><tr class=""> | |
| 5345 <th scope="row">optC</th> | |
| 5346 <td>default</td> | |
| 5347 <td></td> | |
| 5348 <td></td> | |
| 5349 <td></td> | |
| 5350 </tr><tr class=""> | |
| 5351 <th scope="row">poolAsPool1L</th> | |
| 5352 <td>TRUE</td> | |
| 5353 <td></td> | |
| 5354 <td></td> | |
| 5355 <td></td> | |
| 5356 </tr><tr class=""> | |
| 5357 <th scope="row">dataMatrix_in</th> | |
| 5358 <td>9a0ce47bd1734ae7</td> | |
| 5359 <td>peaklist_fragments.tsv</td> | |
| 5360 <td>tabular</td> | |
| 5361 <td>42</td> | |
| 5362 </tr><tr class=""> | |
| 5363 <th scope="row">sampleMetadata_in</th> | |
| 5364 <td>9a0ce47bd1734ae7</td> | |
| 5365 <td>peaklist_fragments.tsv</td> | |
| 5366 <td>tabular</td> | |
| 5367 <td>42</td> | |
| 5368 </tr><tr class=""> | |
| 5369 <th scope="row">variableMetadata_in</th> | |
| 5370 <td>9a0ce47bd1734ae7</td> | |
| 5371 <td>peaklist_fragments.tsv</td> | |
| 5372 <td>tabular</td> | |
| 5373 <td>42</td> | |
| 5374 </tr> | |
| 5375 </table> | |
| 5376 </div> | |
| 5377 | |
| 5378 | |
| 5379 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 5380 <h2 | |
| 5381 class="history_metadata_extractor_h2" | |
| 5382 style="cursor: pointer" | |
| 5383 title="click to fold/unfold the table" | |
| 5384 > | |
| 5385 [DELETED] - quality_metrics - 2.2.8 | |
| 5386 </h2> | |
| 5387 <p> | |
| 5388 Outputs: | |
| 5389 </p> | |
| 5390 <p class="history_metadata_extractor_status"> | |
| 5391 Status: Failed (1) | |
| 5392 </p> | |
| 5393 <p class="history_metadata_extractor_glitter"></p> | |
| 5394 <table class=" | |
| 5395 table | |
| 5396 table-bordered | |
| 5397 table-dark | |
| 5398 table-striped | |
| 5399 table-hover | |
| 5400 d-block | |
| 5401 overflow-auto | |
| 5402 history_metadata_extractor_table | |
| 5403 "> | |
| 5404 <thead> | |
| 5405 <tr> | |
| 5406 <th scope="col"></th> | |
| 5407 <th scope="col">value</th> | |
| 5408 <th scope="col">name</th> | |
| 5409 <th scope="col">extension</th> | |
| 5410 <th scope="col">hid</th> | |
| 5411 </tr> | |
| 5412 </thead> | |
| 5413 <tr class=""> | |
| 5414 <th scope="row">CV</th> | |
| 5415 <td>FALSE</td> | |
| 5416 <td></td> | |
| 5417 <td></td> | |
| 5418 <td></td> | |
| 5419 </tr><tr class=""> | |
| 5420 <th scope="row">Compa</th> | |
| 5421 <td>TRUE</td> | |
| 5422 <td></td> | |
| 5423 <td></td> | |
| 5424 <td></td> | |
| 5425 </tr><tr class=""> | |
| 5426 <th scope="row">seuil</th> | |
| 5427 <td>1</td> | |
| 5428 <td></td> | |
| 5429 <td></td> | |
| 5430 <td></td> | |
| 5431 </tr><tr class=""> | |
| 5432 <th scope="row">optC</th> | |
| 5433 <td>default</td> | |
| 5434 <td></td> | |
| 5435 <td></td> | |
| 5436 <td></td> | |
| 5437 </tr><tr class=""> | |
| 5438 <th scope="row">poolAsPool1L</th> | |
| 5439 <td>TRUE</td> | |
| 5440 <td></td> | |
| 5441 <td></td> | |
| 5442 <td></td> | |
| 5443 </tr><tr class=""> | |
| 5444 <th scope="row">dataMatrix_in</th> | |
| 5445 <td>9a0ce47bd1734ae7</td> | |
| 5446 <td>peaklist_fragments.tsv</td> | |
| 5447 <td>tabular</td> | |
| 5448 <td>42</td> | |
| 5449 </tr><tr class=""> | |
| 5450 <th scope="row">sampleMetadata_in</th> | |
| 5451 <td>9a0ce47bd1734ae7</td> | |
| 5452 <td>peaklist_fragments.tsv</td> | |
| 5453 <td>tabular</td> | |
| 5454 <td>42</td> | |
| 5455 </tr><tr class=""> | |
| 5456 <th scope="row">variableMetadata_in</th> | |
| 5457 <td>9a0ce47bd1734ae7</td> | |
| 5458 <td>peaklist_fragments.tsv</td> | |
| 5459 <td>tabular</td> | |
| 5460 <td>42</td> | |
| 5461 </tr> | |
| 5462 </table> | |
| 5463 </div> | |
| 5464 | |
| 5465 | |
| 5466 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 5467 <h2 | |
| 5468 class="history_metadata_extractor_h2" | |
| 5469 style="cursor: pointer" | |
| 5470 title="click to fold/unfold the table" | |
| 5471 > | |
| 5472 [DELETED] - quality_metrics - 2.2.8 | |
| 5473 </h2> | |
| 5474 <p> | |
| 5475 Outputs: | |
| 5476 </p> | |
| 5477 <p class="history_metadata_extractor_status"> | |
| 5478 Status: Failed (1) | |
| 5479 </p> | |
| 5480 <p class="history_metadata_extractor_glitter"></p> | |
| 5481 <table class=" | |
| 5482 table | |
| 5483 table-bordered | |
| 5484 table-dark | |
| 5485 table-striped | |
| 5486 table-hover | |
| 5487 d-block | |
| 5488 overflow-auto | |
| 5489 history_metadata_extractor_table | |
| 5490 "> | |
| 5491 <thead> | |
| 5492 <tr> | |
| 5493 <th scope="col"></th> | |
| 5494 <th scope="col">value</th> | |
| 5495 <th scope="col">name</th> | |
| 5496 <th scope="col">extension</th> | |
| 5497 <th scope="col">hid</th> | |
| 5498 </tr> | |
| 5499 </thead> | |
| 5500 <tr class=""> | |
| 5501 <th scope="row">CV</th> | |
| 5502 <td>FALSE</td> | |
| 5503 <td></td> | |
| 5504 <td></td> | |
| 5505 <td></td> | |
| 5506 </tr><tr class=""> | |
| 5507 <th scope="row">Compa</th> | |
| 5508 <td>TRUE</td> | |
| 5509 <td></td> | |
| 5510 <td></td> | |
| 5511 <td></td> | |
| 5512 </tr><tr class=""> | |
| 5513 <th scope="row">seuil</th> | |
| 5514 <td>1</td> | |
| 5515 <td></td> | |
| 5516 <td></td> | |
| 5517 <td></td> | |
| 5518 </tr><tr class=""> | |
| 5519 <th scope="row">optC</th> | |
| 5520 <td>default</td> | |
| 5521 <td></td> | |
| 5522 <td></td> | |
| 5523 <td></td> | |
| 5524 </tr><tr class=""> | |
| 5525 <th scope="row">poolAsPool1L</th> | |
| 5526 <td>TRUE</td> | |
| 5527 <td></td> | |
| 5528 <td></td> | |
| 5529 <td></td> | |
| 5530 </tr><tr class=""> | |
| 5531 <th scope="row">dataMatrix_in</th> | |
| 5532 <td>9a0ce47bd1734ae7</td> | |
| 5533 <td>peaklist_fragments.tsv</td> | |
| 5534 <td>tabular</td> | |
| 5535 <td>42</td> | |
| 5536 </tr><tr class=""> | |
| 5537 <th scope="row">sampleMetadata_in</th> | |
| 5538 <td>9a0ce47bd1734ae7</td> | |
| 5539 <td>peaklist_fragments.tsv</td> | |
| 5540 <td>tabular</td> | |
| 5541 <td>42</td> | |
| 5542 </tr><tr class=""> | |
| 5543 <th scope="row">variableMetadata_in</th> | |
| 5544 <td>9a0ce47bd1734ae7</td> | |
| 5545 <td>peaklist_fragments.tsv</td> | |
| 5546 <td>tabular</td> | |
| 5547 <td>42</td> | |
| 5548 </tr> | |
| 5549 </table> | |
| 5550 </div> | |
| 5551 | |
| 5552 | |
| 5553 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 5554 <h2 | |
| 5555 class="history_metadata_extractor_h2" | |
| 5556 style="cursor: pointer" | |
| 5557 title="click to fold/unfold the table" | |
| 5558 > | |
| 5559 [DELETED] - quality_metrics - 2.2.8 | |
| 5560 </h2> | |
| 5561 <p> | |
| 5562 Outputs: | |
| 5563 </p> | |
| 5564 <p class="history_metadata_extractor_status"> | |
| 5565 Status: Failed (1) | |
| 5566 </p> | |
| 5567 <p class="history_metadata_extractor_glitter"></p> | |
| 5568 <table class=" | |
| 5569 table | |
| 5570 table-bordered | |
| 5571 table-dark | |
| 5572 table-striped | |
| 5573 table-hover | |
| 5574 d-block | |
| 5575 overflow-auto | |
| 5576 history_metadata_extractor_table | |
| 5577 "> | |
| 5578 <thead> | |
| 5579 <tr> | |
| 5580 <th scope="col"></th> | |
| 5581 <th scope="col">value</th> | |
| 5582 <th scope="col">name</th> | |
| 5583 <th scope="col">extension</th> | |
| 5584 <th scope="col">hid</th> | |
| 5585 </tr> | |
| 5586 </thead> | |
| 5587 <tr class=""> | |
| 5588 <th scope="row">CV</th> | |
| 5589 <td>FALSE</td> | |
| 5590 <td></td> | |
| 5591 <td></td> | |
| 5592 <td></td> | |
| 5593 </tr><tr class=""> | |
| 5594 <th scope="row">Compa</th> | |
| 5595 <td>TRUE</td> | |
| 5596 <td></td> | |
| 5597 <td></td> | |
| 5598 <td></td> | |
| 5599 </tr><tr class=""> | |
| 5600 <th scope="row">seuil</th> | |
| 5601 <td>1</td> | |
| 5602 <td></td> | |
| 5603 <td></td> | |
| 5604 <td></td> | |
| 5605 </tr><tr class=""> | |
| 5606 <th scope="row">optC</th> | |
| 5607 <td>default</td> | |
| 5608 <td></td> | |
| 5609 <td></td> | |
| 5610 <td></td> | |
| 5611 </tr><tr class=""> | |
| 5612 <th scope="row">poolAsPool1L</th> | |
| 5613 <td>TRUE</td> | |
| 5614 <td></td> | |
| 5615 <td></td> | |
| 5616 <td></td> | |
| 5617 </tr><tr class=""> | |
| 5618 <th scope="row">dataMatrix_in</th> | |
| 5619 <td>9a0ce47bd1734ae7</td> | |
| 5620 <td>peaklist_fragments.tsv</td> | |
| 5621 <td>tabular</td> | |
| 5622 <td>42</td> | |
| 5623 </tr><tr class=""> | |
| 5624 <th scope="row">sampleMetadata_in</th> | |
| 5625 <td>9a0ce47bd1734ae7</td> | |
| 5626 <td>peaklist_fragments.tsv</td> | |
| 5627 <td>tabular</td> | |
| 5628 <td>42</td> | |
| 5629 </tr><tr class=""> | |
| 5630 <th scope="row">variableMetadata_in</th> | |
| 5631 <td>9a0ce47bd1734ae7</td> | |
| 5632 <td>peaklist_fragments.tsv</td> | |
| 5633 <td>tabular</td> | |
| 5634 <td>42</td> | |
| 5635 </tr> | |
| 5636 </table> | |
| 5637 </div> | |
| 5638 | |
| 5639 | |
| 5640 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 5641 <h2 | |
| 5642 class="history_metadata_extractor_h2" | |
| 5643 style="cursor: pointer" | |
| 5644 title="click to fold/unfold the table" | |
| 5645 > | |
| 5646 [DELETED] - abims_CAMERA_annotateDiffreport - 2.2.6+camera1.48.0-galaxy0 | |
| 5647 </h2> | |
| 5648 <p> | |
| 5649 Outputs: | |
| 5650 </p> | |
| 5651 <p class="history_metadata_extractor_status"> | |
| 5652 Status: Failed (127) | |
| 5653 </p> | |
| 5654 <p class="history_metadata_extractor_glitter"></p> | |
| 5655 <table class=" | |
| 5656 table | |
| 5657 table-bordered | |
| 5658 table-dark | |
| 5659 table-striped | |
| 5660 table-hover | |
| 5661 d-block | |
| 5662 overflow-auto | |
| 5663 history_metadata_extractor_table | |
| 5664 "> | |
| 5665 <thead> | |
| 5666 <tr> | |
| 5667 <th scope="col"></th> | |
| 5668 <th scope="col">value</th> | |
| 5669 <th scope="col">name</th> | |
| 5670 <th scope="col">extension</th> | |
| 5671 <th scope="col">hid</th> | |
| 5672 </tr> | |
| 5673 </thead> | |
| 5674 <tr class=""> | |
| 5675 <th scope="row">option</th> | |
| 5676 <td>hide</td> | |
| 5677 <td></td> | |
| 5678 <td></td> | |
| 5679 <td></td> | |
| 5680 </tr><tr class=""> | |
| 5681 <th scope="row">convertRTMinute</th> | |
| 5682 <td>false</td> | |
| 5683 <td></td> | |
| 5684 <td></td> | |
| 5685 <td></td> | |
| 5686 </tr><tr class=""> | |
| 5687 <th scope="row">intval</th> | |
| 5688 <td>into</td> | |
| 5689 <td></td> | |
| 5690 <td></td> | |
| 5691 <td></td> | |
| 5692 </tr><tr class=""> | |
| 5693 <th scope="row">numDigitsMZ</th> | |
| 5694 <td>4</td> | |
| 5695 <td></td> | |
| 5696 <td></td> | |
| 5697 <td></td> | |
| 5698 </tr><tr class=""> | |
| 5699 <th scope="row">numDigitsRT</th> | |
| 5700 <td>0</td> | |
| 5701 <td></td> | |
| 5702 <td></td> | |
| 5703 <td></td> | |
| 5704 </tr><tr class=""> | |
| 5705 <th scope="row">file_load_select</th> | |
| 5706 <td>no</td> | |
| 5707 <td></td> | |
| 5708 <td></td> | |
| 5709 <td></td> | |
| 5710 </tr><tr class=""> | |
| 5711 <th scope="row">mzabs</th> | |
| 5712 <td>0.015</td> | |
| 5713 <td></td> | |
| 5714 <td></td> | |
| 5715 <td></td> | |
| 5716 </tr><tr class=""> | |
| 5717 <th scope="row">ppm</th> | |
| 5718 <td>5</td> | |
| 5719 <td></td> | |
| 5720 <td></td> | |
| 5721 <td></td> | |
| 5722 </tr><tr class=""> | |
| 5723 <th scope="row">maxcharge</th> | |
| 5724 <td>3</td> | |
| 5725 <td></td> | |
| 5726 <td></td> | |
| 5727 <td></td> | |
| 5728 </tr><tr class=""> | |
| 5729 <th scope="row">maxiso</th> | |
| 5730 <td>4</td> | |
| 5731 <td></td> | |
| 5732 <td></td> | |
| 5733 <td></td> | |
| 5734 </tr><tr class=""> | |
| 5735 <th scope="row">minfrac</th> | |
| 5736 <td>0.5</td> | |
| 5737 <td></td> | |
| 5738 <td></td> | |
| 5739 <td></td> | |
| 5740 </tr><tr class=""> | |
| 5741 <th scope="row">perfwhm</th> | |
| 5742 <td>0.6</td> | |
| 5743 <td></td> | |
| 5744 <td></td> | |
| 5745 <td></td> | |
| 5746 </tr><tr class=""> | |
| 5747 <th scope="row">sigma</th> | |
| 5748 <td>6</td> | |
| 5749 <td></td> | |
| 5750 <td></td> | |
| 5751 <td></td> | |
| 5752 </tr><tr class=""> | |
| 5753 <th scope="row">image</th> | |
| 5754 <td>9e77b3d7d0887128</td> | |
| 5755 <td>test.rdata</td> | |
| 5756 <td>rdata</td> | |
| 5757 <td>1</td> | |
| 5758 </tr><tr class=""> | |
| 5759 <th scope="row">max_peaks</th> | |
| 5760 <td>100</td> | |
| 5761 <td></td> | |
| 5762 <td></td> | |
| 5763 <td></td> | |
| 5764 </tr><tr class=""> | |
| 5765 <th scope="row">polarity</th> | |
| 5766 <td>negative</td> | |
| 5767 <td></td> | |
| 5768 <td></td> | |
| 5769 <td></td> | |
| 5770 </tr><tr class=""> | |
| 5771 <th scope="row">multiplier</th> | |
| 5772 <td>3</td> | |
| 5773 <td></td> | |
| 5774 <td></td> | |
| 5775 <td></td> | |
| 5776 </tr><tr class=""> | |
| 5777 <th scope="row">rules_select</th> | |
| 5778 <td>FALSE</td> | |
| 5779 <td></td> | |
| 5780 <td></td> | |
| 5781 <td></td> | |
| 5782 </tr><tr class=""> | |
| 5783 <th scope="row">calcCaS</th> | |
| 5784 <td>false</td> | |
| 5785 <td></td> | |
| 5786 <td></td> | |
| 5787 <td></td> | |
| 5788 </tr><tr class=""> | |
| 5789 <th scope="row">calcCiS</th> | |
| 5790 <td>true</td> | |
| 5791 <td></td> | |
| 5792 <td></td> | |
| 5793 <td></td> | |
| 5794 </tr><tr class=""> | |
| 5795 <th scope="row">calcIso</th> | |
| 5796 <td>false</td> | |
| 5797 <td></td> | |
| 5798 <td></td> | |
| 5799 <td></td> | |
| 5800 </tr><tr class=""> | |
| 5801 <th scope="row">cor_eic_th</th> | |
| 5802 <td>0.75</td> | |
| 5803 <td></td> | |
| 5804 <td></td> | |
| 5805 <td></td> | |
| 5806 </tr><tr class=""> | |
| 5807 <th scope="row">graphMethod</th> | |
| 5808 <td>hcs</td> | |
| 5809 <td></td> | |
| 5810 <td></td> | |
| 5811 <td></td> | |
| 5812 </tr><tr class=""> | |
| 5813 <th scope="row">pval</th> | |
| 5814 <td>0.05</td> | |
| 5815 <td></td> | |
| 5816 <td></td> | |
| 5817 <td></td> | |
| 5818 </tr><tr class=""> | |
| 5819 <th scope="row">quick</th> | |
| 5820 <td>FALSE</td> | |
| 5821 <td></td> | |
| 5822 <td></td> | |
| 5823 <td></td> | |
| 5824 </tr> | |
| 5825 </table> | |
| 5826 </div> | |
| 5827 | |
| 5828 | |
| 5829 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 5830 <h2 | |
| 5831 class="history_metadata_extractor_h2" | |
| 5832 style="cursor: pointer" | |
| 5833 title="click to fold/unfold the table" | |
| 5834 > | |
| 5835 [DELETED] - abims_CAMERA_annotateDiffreport - 2.2.6+camera1.48.0-galaxy0 | |
| 5836 </h2> | |
| 5837 <p> | |
| 5838 Outputs: | |
| 5839 </p> | |
| 5840 <p class="history_metadata_extractor_status"> | |
| 5841 Status: Failed (127) | |
| 5842 </p> | |
| 5843 <p class="history_metadata_extractor_glitter"></p> | |
| 5844 <table class=" | |
| 5845 table | |
| 5846 table-bordered | |
| 5847 table-dark | |
| 5848 table-striped | |
| 5849 table-hover | |
| 5850 d-block | |
| 5851 overflow-auto | |
| 5852 history_metadata_extractor_table | |
| 5853 "> | |
| 5854 <thead> | |
| 5855 <tr> | |
| 5856 <th scope="col"></th> | |
| 5857 <th scope="col">value</th> | |
| 5858 <th scope="col">name</th> | |
| 5859 <th scope="col">extension</th> | |
| 5860 <th scope="col">hid</th> | |
| 5861 </tr> | |
| 5862 </thead> | |
| 5863 <tr class=""> | |
| 5864 <th scope="row">option</th> | |
| 5865 <td>hide</td> | |
| 5866 <td></td> | |
| 5867 <td></td> | |
| 5868 <td></td> | |
| 5869 </tr><tr class=""> | |
| 5870 <th scope="row">convertRTMinute</th> | |
| 5871 <td>false</td> | |
| 5872 <td></td> | |
| 5873 <td></td> | |
| 5874 <td></td> | |
| 5875 </tr><tr class=""> | |
| 5876 <th scope="row">intval</th> | |
| 5877 <td>into</td> | |
| 5878 <td></td> | |
| 5879 <td></td> | |
| 5880 <td></td> | |
| 5881 </tr><tr class=""> | |
| 5882 <th scope="row">numDigitsMZ</th> | |
| 5883 <td>4</td> | |
| 5884 <td></td> | |
| 5885 <td></td> | |
| 5886 <td></td> | |
| 5887 </tr><tr class=""> | |
| 5888 <th scope="row">numDigitsRT</th> | |
| 5889 <td>0</td> | |
| 5890 <td></td> | |
| 5891 <td></td> | |
| 5892 <td></td> | |
| 5893 </tr><tr class=""> | |
| 5894 <th scope="row">file_load_select</th> | |
| 5895 <td>no</td> | |
| 5896 <td></td> | |
| 5897 <td></td> | |
| 5898 <td></td> | |
| 5899 </tr><tr class=""> | |
| 5900 <th scope="row">mzabs</th> | |
| 5901 <td>0.015</td> | |
| 5902 <td></td> | |
| 5903 <td></td> | |
| 5904 <td></td> | |
| 5905 </tr><tr class=""> | |
| 5906 <th scope="row">ppm</th> | |
| 5907 <td>5</td> | |
| 5908 <td></td> | |
| 5909 <td></td> | |
| 5910 <td></td> | |
| 5911 </tr><tr class=""> | |
| 5912 <th scope="row">maxcharge</th> | |
| 5913 <td>3</td> | |
| 5914 <td></td> | |
| 5915 <td></td> | |
| 5916 <td></td> | |
| 5917 </tr><tr class=""> | |
| 5918 <th scope="row">maxiso</th> | |
| 5919 <td>4</td> | |
| 5920 <td></td> | |
| 5921 <td></td> | |
| 5922 <td></td> | |
| 5923 </tr><tr class=""> | |
| 5924 <th scope="row">minfrac</th> | |
| 5925 <td>0.5</td> | |
| 5926 <td></td> | |
| 5927 <td></td> | |
| 5928 <td></td> | |
| 5929 </tr><tr class=""> | |
| 5930 <th scope="row">perfwhm</th> | |
| 5931 <td>0.6</td> | |
| 5932 <td></td> | |
| 5933 <td></td> | |
| 5934 <td></td> | |
| 5935 </tr><tr class=""> | |
| 5936 <th scope="row">sigma</th> | |
| 5937 <td>6</td> | |
| 5938 <td></td> | |
| 5939 <td></td> | |
| 5940 <td></td> | |
| 5941 </tr><tr class=""> | |
| 5942 <th scope="row">image</th> | |
| 5943 <td>9e77b3d7d0887128</td> | |
| 5944 <td>test.rdata</td> | |
| 5945 <td>rdata</td> | |
| 5946 <td>1</td> | |
| 5947 </tr><tr class=""> | |
| 5948 <th scope="row">max_peaks</th> | |
| 5949 <td>100</td> | |
| 5950 <td></td> | |
| 5951 <td></td> | |
| 5952 <td></td> | |
| 5953 </tr><tr class=""> | |
| 5954 <th scope="row">polarity</th> | |
| 5955 <td>negative</td> | |
| 5956 <td></td> | |
| 5957 <td></td> | |
| 5958 <td></td> | |
| 5959 </tr><tr class=""> | |
| 5960 <th scope="row">multiplier</th> | |
| 5961 <td>3</td> | |
| 5962 <td></td> | |
| 5963 <td></td> | |
| 5964 <td></td> | |
| 5965 </tr><tr class=""> | |
| 5966 <th scope="row">rules_select</th> | |
| 5967 <td>FALSE</td> | |
| 5968 <td></td> | |
| 5969 <td></td> | |
| 5970 <td></td> | |
| 5971 </tr><tr class=""> | |
| 5972 <th scope="row">calcCaS</th> | |
| 5973 <td>false</td> | |
| 5974 <td></td> | |
| 5975 <td></td> | |
| 5976 <td></td> | |
| 5977 </tr><tr class=""> | |
| 5978 <th scope="row">calcCiS</th> | |
| 5979 <td>true</td> | |
| 5980 <td></td> | |
| 5981 <td></td> | |
| 5982 <td></td> | |
| 5983 </tr><tr class=""> | |
| 5984 <th scope="row">calcIso</th> | |
| 5985 <td>false</td> | |
| 5986 <td></td> | |
| 5987 <td></td> | |
| 5988 <td></td> | |
| 5989 </tr><tr class=""> | |
| 5990 <th scope="row">cor_eic_th</th> | |
| 5991 <td>0.75</td> | |
| 5992 <td></td> | |
| 5993 <td></td> | |
| 5994 <td></td> | |
| 5995 </tr><tr class=""> | |
| 5996 <th scope="row">graphMethod</th> | |
| 5997 <td>hcs</td> | |
| 5998 <td></td> | |
| 5999 <td></td> | |
| 6000 <td></td> | |
| 6001 </tr><tr class=""> | |
| 6002 <th scope="row">pval</th> | |
| 6003 <td>0.05</td> | |
| 6004 <td></td> | |
| 6005 <td></td> | |
| 6006 <td></td> | |
| 6007 </tr><tr class=""> | |
| 6008 <th scope="row">quick</th> | |
| 6009 <td>FALSE</td> | |
| 6010 <td></td> | |
| 6011 <td></td> | |
| 6012 <td></td> | |
| 6013 </tr> | |
| 6014 </table> | |
| 6015 </div> | |
| 6016 | |
| 6017 | |
| 6018 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 6019 <h2 | |
| 6020 class="history_metadata_extractor_h2" | |
| 6021 style="cursor: pointer" | |
| 6022 title="click to fold/unfold the table" | |
| 6023 > | |
| 6024 [DELETED] - abims_CAMERA_annotateDiffreport - 2.2.6+camera1.48.0-galaxy0 | |
| 6025 </h2> | |
| 6026 <p> | |
| 6027 Outputs: | |
| 6028 </p> | |
| 6029 <p class="history_metadata_extractor_status"> | |
| 6030 Status: Failed (127) | |
| 6031 </p> | |
| 6032 <p class="history_metadata_extractor_glitter"></p> | |
| 6033 <table class=" | |
| 6034 table | |
| 6035 table-bordered | |
| 6036 table-dark | |
| 6037 table-striped | |
| 6038 table-hover | |
| 6039 d-block | |
| 6040 overflow-auto | |
| 6041 history_metadata_extractor_table | |
| 6042 "> | |
| 6043 <thead> | |
| 6044 <tr> | |
| 6045 <th scope="col"></th> | |
| 6046 <th scope="col">value</th> | |
| 6047 <th scope="col">name</th> | |
| 6048 <th scope="col">extension</th> | |
| 6049 <th scope="col">hid</th> | |
| 6050 </tr> | |
| 6051 </thead> | |
| 6052 <tr class=""> | |
| 6053 <th scope="row">option</th> | |
| 6054 <td>hide</td> | |
| 6055 <td></td> | |
| 6056 <td></td> | |
| 6057 <td></td> | |
| 6058 </tr><tr class=""> | |
| 6059 <th scope="row">convertRTMinute</th> | |
| 6060 <td>false</td> | |
| 6061 <td></td> | |
| 6062 <td></td> | |
| 6063 <td></td> | |
| 6064 </tr><tr class=""> | |
| 6065 <th scope="row">intval</th> | |
| 6066 <td>into</td> | |
| 6067 <td></td> | |
| 6068 <td></td> | |
| 6069 <td></td> | |
| 6070 </tr><tr class=""> | |
| 6071 <th scope="row">numDigitsMZ</th> | |
| 6072 <td>4</td> | |
| 6073 <td></td> | |
| 6074 <td></td> | |
| 6075 <td></td> | |
| 6076 </tr><tr class=""> | |
| 6077 <th scope="row">numDigitsRT</th> | |
| 6078 <td>0</td> | |
| 6079 <td></td> | |
| 6080 <td></td> | |
| 6081 <td></td> | |
| 6082 </tr><tr class=""> | |
| 6083 <th scope="row">file_load_select</th> | |
| 6084 <td>no</td> | |
| 6085 <td></td> | |
| 6086 <td></td> | |
| 6087 <td></td> | |
| 6088 </tr><tr class=""> | |
| 6089 <th scope="row">mzabs</th> | |
| 6090 <td>0.015</td> | |
| 6091 <td></td> | |
| 6092 <td></td> | |
| 6093 <td></td> | |
| 6094 </tr><tr class=""> | |
| 6095 <th scope="row">ppm</th> | |
| 6096 <td>5</td> | |
| 6097 <td></td> | |
| 6098 <td></td> | |
| 6099 <td></td> | |
| 6100 </tr><tr class=""> | |
| 6101 <th scope="row">maxcharge</th> | |
| 6102 <td>3</td> | |
| 6103 <td></td> | |
| 6104 <td></td> | |
| 6105 <td></td> | |
| 6106 </tr><tr class=""> | |
| 6107 <th scope="row">maxiso</th> | |
| 6108 <td>4</td> | |
| 6109 <td></td> | |
| 6110 <td></td> | |
| 6111 <td></td> | |
| 6112 </tr><tr class=""> | |
| 6113 <th scope="row">minfrac</th> | |
| 6114 <td>0.5</td> | |
| 6115 <td></td> | |
| 6116 <td></td> | |
| 6117 <td></td> | |
| 6118 </tr><tr class=""> | |
| 6119 <th scope="row">perfwhm</th> | |
| 6120 <td>0.6</td> | |
| 6121 <td></td> | |
| 6122 <td></td> | |
| 6123 <td></td> | |
| 6124 </tr><tr class=""> | |
| 6125 <th scope="row">sigma</th> | |
| 6126 <td>6</td> | |
| 6127 <td></td> | |
| 6128 <td></td> | |
| 6129 <td></td> | |
| 6130 </tr><tr class=""> | |
| 6131 <th scope="row">image</th> | |
| 6132 <td>9e77b3d7d0887128</td> | |
| 6133 <td>test.rdata</td> | |
| 6134 <td>rdata</td> | |
| 6135 <td>1</td> | |
| 6136 </tr><tr class=""> | |
| 6137 <th scope="row">max_peaks</th> | |
| 6138 <td>100</td> | |
| 6139 <td></td> | |
| 6140 <td></td> | |
| 6141 <td></td> | |
| 6142 </tr><tr class=""> | |
| 6143 <th scope="row">polarity</th> | |
| 6144 <td>negative</td> | |
| 6145 <td></td> | |
| 6146 <td></td> | |
| 6147 <td></td> | |
| 6148 </tr><tr class=""> | |
| 6149 <th scope="row">multiplier</th> | |
| 6150 <td>3</td> | |
| 6151 <td></td> | |
| 6152 <td></td> | |
| 6153 <td></td> | |
| 6154 </tr><tr class=""> | |
| 6155 <th scope="row">rules_select</th> | |
| 6156 <td>FALSE</td> | |
| 6157 <td></td> | |
| 6158 <td></td> | |
| 6159 <td></td> | |
| 6160 </tr><tr class=""> | |
| 6161 <th scope="row">calcCaS</th> | |
| 6162 <td>false</td> | |
| 6163 <td></td> | |
| 6164 <td></td> | |
| 6165 <td></td> | |
| 6166 </tr><tr class=""> | |
| 6167 <th scope="row">calcCiS</th> | |
| 6168 <td>true</td> | |
| 6169 <td></td> | |
| 6170 <td></td> | |
| 6171 <td></td> | |
| 6172 </tr><tr class=""> | |
| 6173 <th scope="row">calcIso</th> | |
| 6174 <td>false</td> | |
| 6175 <td></td> | |
| 6176 <td></td> | |
| 6177 <td></td> | |
| 6178 </tr><tr class=""> | |
| 6179 <th scope="row">cor_eic_th</th> | |
| 6180 <td>0.75</td> | |
| 6181 <td></td> | |
| 6182 <td></td> | |
| 6183 <td></td> | |
| 6184 </tr><tr class=""> | |
| 6185 <th scope="row">graphMethod</th> | |
| 6186 <td>hcs</td> | |
| 6187 <td></td> | |
| 6188 <td></td> | |
| 6189 <td></td> | |
| 6190 </tr><tr class=""> | |
| 6191 <th scope="row">pval</th> | |
| 6192 <td>0.05</td> | |
| 6193 <td></td> | |
| 6194 <td></td> | |
| 6195 <td></td> | |
| 6196 </tr><tr class=""> | |
| 6197 <th scope="row">quick</th> | |
| 6198 <td>FALSE</td> | |
| 6199 <td></td> | |
| 6200 <td></td> | |
| 6201 <td></td> | |
| 6202 </tr> | |
| 6203 </table> | |
| 6204 </div> | |
| 6205 | |
| 6206 | |
| 6207 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 6208 <h2 | |
| 6209 class="history_metadata_extractor_h2" | |
| 6210 style="cursor: pointer" | |
| 6211 title="click to fold/unfold the table" | |
| 6212 > | |
| 6213 [DELETED] - abims_CAMERA_annotateDiffreport - 2.2.6+camera1.48.0-galaxy0 | |
| 6214 </h2> | |
| 6215 <p> | |
| 6216 Outputs: | |
| 6217 </p> | |
| 6218 <p class="history_metadata_extractor_status"> | |
| 6219 Status: Failed (127) | |
| 6220 </p> | |
| 6221 <p class="history_metadata_extractor_glitter"></p> | |
| 6222 <table class=" | |
| 6223 table | |
| 6224 table-bordered | |
| 6225 table-dark | |
| 6226 table-striped | |
| 6227 table-hover | |
| 6228 d-block | |
| 6229 overflow-auto | |
| 6230 history_metadata_extractor_table | |
| 6231 "> | |
| 6232 <thead> | |
| 6233 <tr> | |
| 6234 <th scope="col"></th> | |
| 6235 <th scope="col">value</th> | |
| 6236 <th scope="col">name</th> | |
| 6237 <th scope="col">extension</th> | |
| 6238 <th scope="col">hid</th> | |
| 6239 </tr> | |
| 6240 </thead> | |
| 6241 <tr class=""> | |
| 6242 <th scope="row">option</th> | |
| 6243 <td>hide</td> | |
| 6244 <td></td> | |
| 6245 <td></td> | |
| 6246 <td></td> | |
| 6247 </tr><tr class=""> | |
| 6248 <th scope="row">convertRTMinute</th> | |
| 6249 <td>false</td> | |
| 6250 <td></td> | |
| 6251 <td></td> | |
| 6252 <td></td> | |
| 6253 </tr><tr class=""> | |
| 6254 <th scope="row">intval</th> | |
| 6255 <td>into</td> | |
| 6256 <td></td> | |
| 6257 <td></td> | |
| 6258 <td></td> | |
| 6259 </tr><tr class=""> | |
| 6260 <th scope="row">numDigitsMZ</th> | |
| 6261 <td>4</td> | |
| 6262 <td></td> | |
| 6263 <td></td> | |
| 6264 <td></td> | |
| 6265 </tr><tr class=""> | |
| 6266 <th scope="row">numDigitsRT</th> | |
| 6267 <td>0</td> | |
| 6268 <td></td> | |
| 6269 <td></td> | |
| 6270 <td></td> | |
| 6271 </tr><tr class=""> | |
| 6272 <th scope="row">file_load_select</th> | |
| 6273 <td>no</td> | |
| 6274 <td></td> | |
| 6275 <td></td> | |
| 6276 <td></td> | |
| 6277 </tr><tr class=""> | |
| 6278 <th scope="row">mzabs</th> | |
| 6279 <td>0.015</td> | |
| 6280 <td></td> | |
| 6281 <td></td> | |
| 6282 <td></td> | |
| 6283 </tr><tr class=""> | |
| 6284 <th scope="row">ppm</th> | |
| 6285 <td>5</td> | |
| 6286 <td></td> | |
| 6287 <td></td> | |
| 6288 <td></td> | |
| 6289 </tr><tr class=""> | |
| 6290 <th scope="row">maxcharge</th> | |
| 6291 <td>3</td> | |
| 6292 <td></td> | |
| 6293 <td></td> | |
| 6294 <td></td> | |
| 6295 </tr><tr class=""> | |
| 6296 <th scope="row">maxiso</th> | |
| 6297 <td>4</td> | |
| 6298 <td></td> | |
| 6299 <td></td> | |
| 6300 <td></td> | |
| 6301 </tr><tr class=""> | |
| 6302 <th scope="row">minfrac</th> | |
| 6303 <td>0.5</td> | |
| 6304 <td></td> | |
| 6305 <td></td> | |
| 6306 <td></td> | |
| 6307 </tr><tr class=""> | |
| 6308 <th scope="row">perfwhm</th> | |
| 6309 <td>0.6</td> | |
| 6310 <td></td> | |
| 6311 <td></td> | |
| 6312 <td></td> | |
| 6313 </tr><tr class=""> | |
| 6314 <th scope="row">sigma</th> | |
| 6315 <td>6</td> | |
| 6316 <td></td> | |
| 6317 <td></td> | |
| 6318 <td></td> | |
| 6319 </tr><tr class=""> | |
| 6320 <th scope="row">image</th> | |
| 6321 <td>9e77b3d7d0887128</td> | |
| 6322 <td>test.rdata</td> | |
| 6323 <td>rdata</td> | |
| 6324 <td>1</td> | |
| 6325 </tr><tr class=""> | |
| 6326 <th scope="row">max_peaks</th> | |
| 6327 <td>100</td> | |
| 6328 <td></td> | |
| 6329 <td></td> | |
| 6330 <td></td> | |
| 6331 </tr><tr class=""> | |
| 6332 <th scope="row">polarity</th> | |
| 6333 <td>negative</td> | |
| 6334 <td></td> | |
| 6335 <td></td> | |
| 6336 <td></td> | |
| 6337 </tr><tr class=""> | |
| 6338 <th scope="row">multiplier</th> | |
| 6339 <td>3</td> | |
| 6340 <td></td> | |
| 6341 <td></td> | |
| 6342 <td></td> | |
| 6343 </tr><tr class=""> | |
| 6344 <th scope="row">rules_select</th> | |
| 6345 <td>FALSE</td> | |
| 6346 <td></td> | |
| 6347 <td></td> | |
| 6348 <td></td> | |
| 6349 </tr><tr class=""> | |
| 6350 <th scope="row">calcCaS</th> | |
| 6351 <td>false</td> | |
| 6352 <td></td> | |
| 6353 <td></td> | |
| 6354 <td></td> | |
| 6355 </tr><tr class=""> | |
| 6356 <th scope="row">calcCiS</th> | |
| 6357 <td>true</td> | |
| 6358 <td></td> | |
| 6359 <td></td> | |
| 6360 <td></td> | |
| 6361 </tr><tr class=""> | |
| 6362 <th scope="row">calcIso</th> | |
| 6363 <td>false</td> | |
| 6364 <td></td> | |
| 6365 <td></td> | |
| 6366 <td></td> | |
| 6367 </tr><tr class=""> | |
| 6368 <th scope="row">cor_eic_th</th> | |
| 6369 <td>0.75</td> | |
| 6370 <td></td> | |
| 6371 <td></td> | |
| 6372 <td></td> | |
| 6373 </tr><tr class=""> | |
| 6374 <th scope="row">graphMethod</th> | |
| 6375 <td>hcs</td> | |
| 6376 <td></td> | |
| 6377 <td></td> | |
| 6378 <td></td> | |
| 6379 </tr><tr class=""> | |
| 6380 <th scope="row">pval</th> | |
| 6381 <td>0.05</td> | |
| 6382 <td></td> | |
| 6383 <td></td> | |
| 6384 <td></td> | |
| 6385 </tr><tr class=""> | |
| 6386 <th scope="row">quick</th> | |
| 6387 <td>FALSE</td> | |
| 6388 <td></td> | |
| 6389 <td></td> | |
| 6390 <td></td> | |
| 6391 </tr> | |
| 6392 </table> | |
| 6393 </div> | |
| 6394 | |
| 6395 | |
| 6396 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 6397 <h2 | |
| 6398 class="history_metadata_extractor_h2" | |
| 6399 style="cursor: pointer" | |
| 6400 title="click to fold/unfold the table" | |
| 6401 > | |
| 6402 [DELETED] - abims_CAMERA_annotateDiffreport - 2.2.6+camera1.48.0-galaxy0 | |
| 6403 </h2> | |
| 6404 <p> | |
| 6405 Outputs: | |
| 6406 </p> | |
| 6407 <p class="history_metadata_extractor_status"> | |
| 6408 Status: Failed (1) | |
| 6409 </p> | |
| 6410 <p class="history_metadata_extractor_glitter"></p> | |
| 6411 <table class=" | |
| 6412 table | |
| 6413 table-bordered | |
| 6414 table-dark | |
| 6415 table-striped | |
| 6416 table-hover | |
| 6417 d-block | |
| 6418 overflow-auto | |
| 6419 history_metadata_extractor_table | |
| 6420 "> | |
| 6421 <thead> | |
| 6422 <tr> | |
| 6423 <th scope="col"></th> | |
| 6424 <th scope="col">value</th> | |
| 6425 <th scope="col">name</th> | |
| 6426 <th scope="col">extension</th> | |
| 6427 <th scope="col">hid</th> | |
| 6428 </tr> | |
| 6429 </thead> | |
| 6430 <tr class=""> | |
| 6431 <th scope="row">option</th> | |
| 6432 <td>hide</td> | |
| 6433 <td></td> | |
| 6434 <td></td> | |
| 6435 <td></td> | |
| 6436 </tr><tr class=""> | |
| 6437 <th scope="row">convertRTMinute</th> | |
| 6438 <td>false</td> | |
| 6439 <td></td> | |
| 6440 <td></td> | |
| 6441 <td></td> | |
| 6442 </tr><tr class=""> | |
| 6443 <th scope="row">intval</th> | |
| 6444 <td>into</td> | |
| 6445 <td></td> | |
| 6446 <td></td> | |
| 6447 <td></td> | |
| 6448 </tr><tr class=""> | |
| 6449 <th scope="row">numDigitsMZ</th> | |
| 6450 <td>4</td> | |
| 6451 <td></td> | |
| 6452 <td></td> | |
| 6453 <td></td> | |
| 6454 </tr><tr class=""> | |
| 6455 <th scope="row">numDigitsRT</th> | |
| 6456 <td>0</td> | |
| 6457 <td></td> | |
| 6458 <td></td> | |
| 6459 <td></td> | |
| 6460 </tr><tr class=""> | |
| 6461 <th scope="row">file_load_select</th> | |
| 6462 <td>no</td> | |
| 6463 <td></td> | |
| 6464 <td></td> | |
| 6465 <td></td> | |
| 6466 </tr><tr class=""> | |
| 6467 <th scope="row">mzabs</th> | |
| 6468 <td>0.015</td> | |
| 6469 <td></td> | |
| 6470 <td></td> | |
| 6471 <td></td> | |
| 6472 </tr><tr class=""> | |
| 6473 <th scope="row">ppm</th> | |
| 6474 <td>5</td> | |
| 6475 <td></td> | |
| 6476 <td></td> | |
| 6477 <td></td> | |
| 6478 </tr><tr class=""> | |
| 6479 <th scope="row">maxcharge</th> | |
| 6480 <td>3</td> | |
| 6481 <td></td> | |
| 6482 <td></td> | |
| 6483 <td></td> | |
| 6484 </tr><tr class=""> | |
| 6485 <th scope="row">maxiso</th> | |
| 6486 <td>4</td> | |
| 6487 <td></td> | |
| 6488 <td></td> | |
| 6489 <td></td> | |
| 6490 </tr><tr class=""> | |
| 6491 <th scope="row">minfrac</th> | |
| 6492 <td>0.5</td> | |
| 6493 <td></td> | |
| 6494 <td></td> | |
| 6495 <td></td> | |
| 6496 </tr><tr class=""> | |
| 6497 <th scope="row">perfwhm</th> | |
| 6498 <td>0.6</td> | |
| 6499 <td></td> | |
| 6500 <td></td> | |
| 6501 <td></td> | |
| 6502 </tr><tr class=""> | |
| 6503 <th scope="row">sigma</th> | |
| 6504 <td>6</td> | |
| 6505 <td></td> | |
| 6506 <td></td> | |
| 6507 <td></td> | |
| 6508 </tr><tr class=""> | |
| 6509 <th scope="row">image</th> | |
| 6510 <td>9e77b3d7d0887128</td> | |
| 6511 <td>test.rdata</td> | |
| 6512 <td>rdata</td> | |
| 6513 <td>1</td> | |
| 6514 </tr><tr class=""> | |
| 6515 <th scope="row">max_peaks</th> | |
| 6516 <td>100</td> | |
| 6517 <td></td> | |
| 6518 <td></td> | |
| 6519 <td></td> | |
| 6520 </tr><tr class=""> | |
| 6521 <th scope="row">polarity</th> | |
| 6522 <td>negative</td> | |
| 6523 <td></td> | |
| 6524 <td></td> | |
| 6525 <td></td> | |
| 6526 </tr><tr class=""> | |
| 6527 <th scope="row">multiplier</th> | |
| 6528 <td>3</td> | |
| 6529 <td></td> | |
| 6530 <td></td> | |
| 6531 <td></td> | |
| 6532 </tr><tr class=""> | |
| 6533 <th scope="row">rules_select</th> | |
| 6534 <td>FALSE</td> | |
| 6535 <td></td> | |
| 6536 <td></td> | |
| 6537 <td></td> | |
| 6538 </tr><tr class=""> | |
| 6539 <th scope="row">calcCaS</th> | |
| 6540 <td>false</td> | |
| 6541 <td></td> | |
| 6542 <td></td> | |
| 6543 <td></td> | |
| 6544 </tr><tr class=""> | |
| 6545 <th scope="row">calcCiS</th> | |
| 6546 <td>true</td> | |
| 6547 <td></td> | |
| 6548 <td></td> | |
| 6549 <td></td> | |
| 6550 </tr><tr class=""> | |
| 6551 <th scope="row">calcIso</th> | |
| 6552 <td>false</td> | |
| 6553 <td></td> | |
| 6554 <td></td> | |
| 6555 <td></td> | |
| 6556 </tr><tr class=""> | |
| 6557 <th scope="row">cor_eic_th</th> | |
| 6558 <td>0.75</td> | |
| 6559 <td></td> | |
| 6560 <td></td> | |
| 6561 <td></td> | |
| 6562 </tr><tr class=""> | |
| 6563 <th scope="row">graphMethod</th> | |
| 6564 <td>hcs</td> | |
| 6565 <td></td> | |
| 6566 <td></td> | |
| 6567 <td></td> | |
| 6568 </tr><tr class=""> | |
| 6569 <th scope="row">pval</th> | |
| 6570 <td>0.05</td> | |
| 6571 <td></td> | |
| 6572 <td></td> | |
| 6573 <td></td> | |
| 6574 </tr><tr class=""> | |
| 6575 <th scope="row">quick</th> | |
| 6576 <td>FALSE</td> | |
| 6577 <td></td> | |
| 6578 <td></td> | |
| 6579 <td></td> | |
| 6580 </tr> | |
| 6581 </table> | |
| 6582 </div> | |
| 6583 | |
| 6584 | |
| 6585 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 6586 <h2 | |
| 6587 class="history_metadata_extractor_h2" | |
| 6588 style="cursor: pointer" | |
| 6589 title="click to fold/unfold the table" | |
| 6590 > | |
| 6591 [DELETED] - abims_CAMERA_annotateDiffreport - 2.2.6+camera1.48.0-galaxy0 | |
| 6592 </h2> | |
| 6593 <p> | |
| 6594 Outputs: | |
| 6595 </p> | |
| 6596 <p class="history_metadata_extractor_status"> | |
| 6597 Status: Failed (1) | |
| 6598 </p> | |
| 6599 <p class="history_metadata_extractor_glitter"></p> | |
| 6600 <table class=" | |
| 6601 table | |
| 6602 table-bordered | |
| 6603 table-dark | |
| 6604 table-striped | |
| 6605 table-hover | |
| 6606 d-block | |
| 6607 overflow-auto | |
| 6608 history_metadata_extractor_table | |
| 6609 "> | |
| 6610 <thead> | |
| 6611 <tr> | |
| 6612 <th scope="col"></th> | |
| 6613 <th scope="col">value</th> | |
| 6614 <th scope="col">name</th> | |
| 6615 <th scope="col">extension</th> | |
| 6616 <th scope="col">hid</th> | |
| 6617 </tr> | |
| 6618 </thead> | |
| 6619 <tr class=""> | |
| 6620 <th scope="row">option</th> | |
| 6621 <td>hide</td> | |
| 6622 <td></td> | |
| 6623 <td></td> | |
| 6624 <td></td> | |
| 6625 </tr><tr class=""> | |
| 6626 <th scope="row">convertRTMinute</th> | |
| 6627 <td>false</td> | |
| 6628 <td></td> | |
| 6629 <td></td> | |
| 6630 <td></td> | |
| 6631 </tr><tr class=""> | |
| 6632 <th scope="row">intval</th> | |
| 6633 <td>into</td> | |
| 6634 <td></td> | |
| 6635 <td></td> | |
| 6636 <td></td> | |
| 6637 </tr><tr class=""> | |
| 6638 <th scope="row">numDigitsMZ</th> | |
| 6639 <td>4</td> | |
| 6640 <td></td> | |
| 6641 <td></td> | |
| 6642 <td></td> | |
| 6643 </tr><tr class=""> | |
| 6644 <th scope="row">numDigitsRT</th> | |
| 6645 <td>0</td> | |
| 6646 <td></td> | |
| 6647 <td></td> | |
| 6648 <td></td> | |
| 6649 </tr><tr class=""> | |
| 6650 <th scope="row">file_load_select</th> | |
| 6651 <td>no</td> | |
| 6652 <td></td> | |
| 6653 <td></td> | |
| 6654 <td></td> | |
| 6655 </tr><tr class=""> | |
| 6656 <th scope="row">mzabs</th> | |
| 6657 <td>0.015</td> | |
| 6658 <td></td> | |
| 6659 <td></td> | |
| 6660 <td></td> | |
| 6661 </tr><tr class=""> | |
| 6662 <th scope="row">ppm</th> | |
| 6663 <td>5</td> | |
| 6664 <td></td> | |
| 6665 <td></td> | |
| 6666 <td></td> | |
| 6667 </tr><tr class=""> | |
| 6668 <th scope="row">maxcharge</th> | |
| 6669 <td>3</td> | |
| 6670 <td></td> | |
| 6671 <td></td> | |
| 6672 <td></td> | |
| 6673 </tr><tr class=""> | |
| 6674 <th scope="row">maxiso</th> | |
| 6675 <td>4</td> | |
| 6676 <td></td> | |
| 6677 <td></td> | |
| 6678 <td></td> | |
| 6679 </tr><tr class=""> | |
| 6680 <th scope="row">minfrac</th> | |
| 6681 <td>0.5</td> | |
| 6682 <td></td> | |
| 6683 <td></td> | |
| 6684 <td></td> | |
| 6685 </tr><tr class=""> | |
| 6686 <th scope="row">perfwhm</th> | |
| 6687 <td>0.6</td> | |
| 6688 <td></td> | |
| 6689 <td></td> | |
| 6690 <td></td> | |
| 6691 </tr><tr class=""> | |
| 6692 <th scope="row">sigma</th> | |
| 6693 <td>6</td> | |
| 6694 <td></td> | |
| 6695 <td></td> | |
| 6696 <td></td> | |
| 6697 </tr><tr class=""> | |
| 6698 <th scope="row">image</th> | |
| 6699 <td>9e77b3d7d0887128</td> | |
| 6700 <td>test.rdata</td> | |
| 6701 <td>rdata</td> | |
| 6702 <td>1</td> | |
| 6703 </tr><tr class=""> | |
| 6704 <th scope="row">max_peaks</th> | |
| 6705 <td>100</td> | |
| 6706 <td></td> | |
| 6707 <td></td> | |
| 6708 <td></td> | |
| 6709 </tr><tr class=""> | |
| 6710 <th scope="row">polarity</th> | |
| 6711 <td>negative</td> | |
| 6712 <td></td> | |
| 6713 <td></td> | |
| 6714 <td></td> | |
| 6715 </tr><tr class=""> | |
| 6716 <th scope="row">multiplier</th> | |
| 6717 <td>3</td> | |
| 6718 <td></td> | |
| 6719 <td></td> | |
| 6720 <td></td> | |
| 6721 </tr><tr class=""> | |
| 6722 <th scope="row">rules_select</th> | |
| 6723 <td>FALSE</td> | |
| 6724 <td></td> | |
| 6725 <td></td> | |
| 6726 <td></td> | |
| 6727 </tr><tr class=""> | |
| 6728 <th scope="row">calcCaS</th> | |
| 6729 <td>false</td> | |
| 6730 <td></td> | |
| 6731 <td></td> | |
| 6732 <td></td> | |
| 6733 </tr><tr class=""> | |
| 6734 <th scope="row">calcCiS</th> | |
| 6735 <td>true</td> | |
| 6736 <td></td> | |
| 6737 <td></td> | |
| 6738 <td></td> | |
| 6739 </tr><tr class=""> | |
| 6740 <th scope="row">calcIso</th> | |
| 6741 <td>false</td> | |
| 6742 <td></td> | |
| 6743 <td></td> | |
| 6744 <td></td> | |
| 6745 </tr><tr class=""> | |
| 6746 <th scope="row">cor_eic_th</th> | |
| 6747 <td>0.75</td> | |
| 6748 <td></td> | |
| 6749 <td></td> | |
| 6750 <td></td> | |
| 6751 </tr><tr class=""> | |
| 6752 <th scope="row">graphMethod</th> | |
| 6753 <td>hcs</td> | |
| 6754 <td></td> | |
| 6755 <td></td> | |
| 6756 <td></td> | |
| 6757 </tr><tr class=""> | |
| 6758 <th scope="row">pval</th> | |
| 6759 <td>0.05</td> | |
| 6760 <td></td> | |
| 6761 <td></td> | |
| 6762 <td></td> | |
| 6763 </tr><tr class=""> | |
| 6764 <th scope="row">quick</th> | |
| 6765 <td>FALSE</td> | |
| 6766 <td></td> | |
| 6767 <td></td> | |
| 6768 <td></td> | |
| 6769 </tr> | |
| 6770 </table> | |
| 6771 </div> | |
| 6772 | |
| 6773 | |
| 6774 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 6775 <h2 | |
| 6776 class="history_metadata_extractor_h2" | |
| 6777 style="cursor: pointer" | |
| 6778 title="click to fold/unfold the table" | |
| 6779 > | |
| 6780 [DELETED] - abims_xcms_retcor - 3.12.0+galaxy0 | |
| 6781 </h2> | |
| 6782 <p> | |
| 6783 Outputs: | |
| 6784 </p> | |
| 6785 <p class="history_metadata_extractor_status"> | |
| 6786 Status: Failed (1) | |
| 6787 </p> | |
| 6788 <p class="history_metadata_extractor_glitter"></p> | |
| 6789 <table class=" | |
| 6790 table | |
| 6791 table-bordered | |
| 6792 table-dark | |
| 6793 table-striped | |
| 6794 table-hover | |
| 6795 d-block | |
| 6796 overflow-auto | |
| 6797 history_metadata_extractor_table | |
| 6798 "> | |
| 6799 <thead> | |
| 6800 <tr> | |
| 6801 <th scope="col"></th> | |
| 6802 <th scope="col">value</th> | |
| 6803 <th scope="col">name</th> | |
| 6804 <th scope="col">extension</th> | |
| 6805 <th scope="col">hid</th> | |
| 6806 </tr> | |
| 6807 </thead> | |
| 6808 <tr class=""> | |
| 6809 <th scope="row">file_load_select</th> | |
| 6810 <td>no</td> | |
| 6811 <td></td> | |
| 6812 <td></td> | |
| 6813 <td></td> | |
| 6814 </tr><tr class=""> | |
| 6815 <th scope="row">image</th> | |
| 6816 <td>9e77b3d7d0887128</td> | |
| 6817 <td>test.rdata</td> | |
| 6818 <td>rdata</td> | |
| 6819 <td>1</td> | |
| 6820 </tr><tr class=""> | |
| 6821 <th scope="row">extraPeaks</th> | |
| 6822 <td>1</td> | |
| 6823 <td></td> | |
| 6824 <td></td> | |
| 6825 <td></td> | |
| 6826 </tr><tr class=""> | |
| 6827 <th scope="row">method</th> | |
| 6828 <td>PeakGroups</td> | |
| 6829 <td></td> | |
| 6830 <td></td> | |
| 6831 <td></td> | |
| 6832 </tr><tr class=""> | |
| 6833 <th scope="row">minFraction</th> | |
| 6834 <td>0.9</td> | |
| 6835 <td></td> | |
| 6836 <td></td> | |
| 6837 <td></td> | |
| 6838 </tr><tr class=""> | |
| 6839 <th scope="row">family</th> | |
| 6840 <td>gaussian</td> | |
| 6841 <td></td> | |
| 6842 <td></td> | |
| 6843 <td></td> | |
| 6844 </tr><tr class=""> | |
| 6845 <th scope="row">span</th> | |
| 6846 <td>0.2</td> | |
| 6847 <td></td> | |
| 6848 <td></td> | |
| 6849 <td></td> | |
| 6850 </tr><tr class=""> | |
| 6851 <th scope="row">smooth</th> | |
| 6852 <td>loess</td> | |
| 6853 <td></td> | |
| 6854 <td></td> | |
| 6855 <td></td> | |
| 6856 </tr> | |
| 6857 </table> | |
| 6858 </div> | |
| 6859 | |
| 6860 | |
| 6861 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 6862 <h2 | |
| 6863 class="history_metadata_extractor_h2" | |
| 6864 style="cursor: pointer" | |
| 6865 title="click to fold/unfold the table" | |
| 6866 > | |
| 6867 [DELETED] - abims_xcms_retcor - 3.12.0+galaxy0 | |
| 6868 </h2> | |
| 6869 <p> | |
| 6870 Outputs: | |
| 6871 </p> | |
| 6872 <p class="history_metadata_extractor_status"> | |
| 6873 Status: Failed (1) | |
| 6874 </p> | |
| 6875 <p class="history_metadata_extractor_glitter"></p> | |
| 6876 <table class=" | |
| 6877 table | |
| 6878 table-bordered | |
| 6879 table-dark | |
| 6880 table-striped | |
| 6881 table-hover | |
| 6882 d-block | |
| 6883 overflow-auto | |
| 6884 history_metadata_extractor_table | |
| 6885 "> | |
| 6886 <thead> | |
| 6887 <tr> | |
| 6888 <th scope="col"></th> | |
| 6889 <th scope="col">value</th> | |
| 6890 <th scope="col">name</th> | |
| 6891 <th scope="col">extension</th> | |
| 6892 <th scope="col">hid</th> | |
| 6893 </tr> | |
| 6894 </thead> | |
| 6895 <tr class=""> | |
| 6896 <th scope="row">file_load_select</th> | |
| 6897 <td>no</td> | |
| 6898 <td></td> | |
| 6899 <td></td> | |
| 6900 <td></td> | |
| 6901 </tr><tr class=""> | |
| 6902 <th scope="row">image</th> | |
| 6903 <td>9e77b3d7d0887128</td> | |
| 6904 <td>test.rdata</td> | |
| 6905 <td>rdata</td> | |
| 6906 <td>1</td> | |
| 6907 </tr><tr class=""> | |
| 6908 <th scope="row">extraPeaks</th> | |
| 6909 <td>1</td> | |
| 6910 <td></td> | |
| 6911 <td></td> | |
| 6912 <td></td> | |
| 6913 </tr><tr class=""> | |
| 6914 <th scope="row">method</th> | |
| 6915 <td>PeakGroups</td> | |
| 6916 <td></td> | |
| 6917 <td></td> | |
| 6918 <td></td> | |
| 6919 </tr><tr class=""> | |
| 6920 <th scope="row">minFraction</th> | |
| 6921 <td>0.9</td> | |
| 6922 <td></td> | |
| 6923 <td></td> | |
| 6924 <td></td> | |
| 6925 </tr><tr class=""> | |
| 6926 <th scope="row">family</th> | |
| 6927 <td>gaussian</td> | |
| 6928 <td></td> | |
| 6929 <td></td> | |
| 6930 <td></td> | |
| 6931 </tr><tr class=""> | |
| 6932 <th scope="row">span</th> | |
| 6933 <td>0.2</td> | |
| 6934 <td></td> | |
| 6935 <td></td> | |
| 6936 <td></td> | |
| 6937 </tr><tr class=""> | |
| 6938 <th scope="row">smooth</th> | |
| 6939 <td>loess</td> | |
| 6940 <td></td> | |
| 6941 <td></td> | |
| 6942 <td></td> | |
| 6943 </tr> | |
| 6944 </table> | |
| 6945 </div> | |
| 6946 | |
| 6947 | |
| 6948 <div class="alert alert-success history_metadata_extractor_deleted"> | |
| 6949 <h2 | |
| 6950 class="history_metadata_extractor_h2" | |
| 6951 style="cursor: pointer" | |
| 6952 title="click to fold/unfold the table" | |
| 6953 > | |
| 6954 [DELETED] - abims_xcms_summary - 3.12.0+galaxy0 | |
| 6955 </h2> | |
| 6956 <p> | |
| 6957 Outputs: | |
| 6958 </p> | |
| 6959 <p class="history_metadata_extractor_status"> | |
| 6960 Status: Ok (0) | |
| 6961 </p> | |
| 6962 <p class="history_metadata_extractor_glitter"></p> | |
| 6963 <table class=" | |
| 6964 table | |
| 6965 table-bordered | |
| 6966 table-dark | |
| 6967 table-striped | |
| 6968 table-hover | |
| 6969 d-block | |
| 6970 overflow-auto | |
| 6971 history_metadata_extractor_table | |
| 6972 "> | |
| 6973 <thead> | |
| 6974 <tr> | |
| 6975 <th scope="col"></th> | |
| 6976 <th scope="col">value</th> | |
| 6977 <th scope="col">name</th> | |
| 6978 <th scope="col">extension</th> | |
| 6979 <th scope="col">hid</th> | |
| 6980 </tr> | |
| 6981 </thead> | |
| 6982 <tr class=""> | |
| 6983 <th scope="row">image</th> | |
| 6984 <td>9e77b3d7d0887128</td> | |
| 6985 <td>test.rdata</td> | |
| 6986 <td>rdata</td> | |
| 6987 <td>1</td> | |
| 6988 </tr> | |
| 6989 </table> | |
| 6990 </div> | |
| 6991 | |
| 6992 | |
| 6993 <div class="alert alert-success history_metadata_extractor_deleted"> | |
| 6994 <h2 | |
| 6995 class="history_metadata_extractor_h2" | |
| 6996 style="cursor: pointer" | |
| 6997 title="click to fold/unfold the table" | |
| 6998 > | |
| 6999 [DELETED] - abims_xcms_summary - 3.12.0+galaxy0 | |
| 7000 </h2> | |
| 7001 <p> | |
| 7002 Outputs: | |
| 7003 </p> | |
| 7004 <p class="history_metadata_extractor_status"> | |
| 7005 Status: Ok (0) | |
| 7006 </p> | |
| 7007 <p class="history_metadata_extractor_glitter"></p> | |
| 7008 <table class=" | |
| 7009 table | |
| 7010 table-bordered | |
| 7011 table-dark | |
| 7012 table-striped | |
| 7013 table-hover | |
| 7014 d-block | |
| 7015 overflow-auto | |
| 7016 history_metadata_extractor_table | |
| 7017 "> | |
| 7018 <thead> | |
| 7019 <tr> | |
| 7020 <th scope="col"></th> | |
| 7021 <th scope="col">value</th> | |
| 7022 <th scope="col">name</th> | |
| 7023 <th scope="col">extension</th> | |
| 7024 <th scope="col">hid</th> | |
| 7025 </tr> | |
| 7026 </thead> | |
| 7027 <tr class=""> | |
| 7028 <th scope="row">image</th> | |
| 7029 <td>9e77b3d7d0887128</td> | |
| 7030 <td>test.rdata</td> | |
| 7031 <td>rdata</td> | |
| 7032 <td>1</td> | |
| 7033 </tr> | |
| 7034 </table> | |
| 7035 </div> | |
| 7036 | |
| 7037 | |
| 7038 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 7039 <h2 | |
| 7040 class="history_metadata_extractor_h2" | |
| 7041 style="cursor: pointer" | |
| 7042 title="click to fold/unfold the table" | |
| 7043 > | |
| 7044 [DELETED] - abims_xcms_group - 3.12.0+galaxy0 | |
| 7045 </h2> | |
| 7046 <p> | |
| 7047 Outputs: | |
| 7048 </p> | |
| 7049 <p class="history_metadata_extractor_status"> | |
| 7050 Status: Failed (1) | |
| 7051 </p> | |
| 7052 <p class="history_metadata_extractor_glitter"></p> | |
| 7053 <table class=" | |
| 7054 table | |
| 7055 table-bordered | |
| 7056 table-dark | |
| 7057 table-striped | |
| 7058 table-hover | |
| 7059 d-block | |
| 7060 overflow-auto | |
| 7061 history_metadata_extractor_table | |
| 7062 "> | |
| 7063 <thead> | |
| 7064 <tr> | |
| 7065 <th scope="col"></th> | |
| 7066 <th scope="col">value</th> | |
| 7067 <th scope="col">name</th> | |
| 7068 <th scope="col">extension</th> | |
| 7069 <th scope="col">hid</th> | |
| 7070 </tr> | |
| 7071 </thead> | |
| 7072 <tr class=""> | |
| 7073 <th scope="row">file_load_select</th> | |
| 7074 <td>no</td> | |
| 7075 <td></td> | |
| 7076 <td></td> | |
| 7077 <td></td> | |
| 7078 </tr><tr class=""> | |
| 7079 <th scope="row">image</th> | |
| 7080 <td>9e77b3d7d0887128</td> | |
| 7081 <td>test.rdata</td> | |
| 7082 <td>rdata</td> | |
| 7083 <td>1</td> | |
| 7084 </tr><tr class=""> | |
| 7085 <th scope="row">maxFeatures</th> | |
| 7086 <td>50</td> | |
| 7087 <td></td> | |
| 7088 <td></td> | |
| 7089 <td></td> | |
| 7090 </tr><tr class=""> | |
| 7091 <th scope="row">binSize</th> | |
| 7092 <td>0.25</td> | |
| 7093 <td></td> | |
| 7094 <td></td> | |
| 7095 <td></td> | |
| 7096 </tr><tr class=""> | |
| 7097 <th scope="row">bw</th> | |
| 7098 <td>30.0</td> | |
| 7099 <td></td> | |
| 7100 <td></td> | |
| 7101 <td></td> | |
| 7102 </tr><tr class=""> | |
| 7103 <th scope="row">method</th> | |
| 7104 <td>PeakDensity</td> | |
| 7105 <td></td> | |
| 7106 <td></td> | |
| 7107 <td></td> | |
| 7108 </tr><tr class=""> | |
| 7109 <th scope="row">minFraction</th> | |
| 7110 <td>0.5</td> | |
| 7111 <td></td> | |
| 7112 <td></td> | |
| 7113 <td></td> | |
| 7114 </tr><tr class=""> | |
| 7115 <th scope="row">minSamples</th> | |
| 7116 <td>1</td> | |
| 7117 <td></td> | |
| 7118 <td></td> | |
| 7119 <td></td> | |
| 7120 </tr><tr class=""> | |
| 7121 <th scope="row">peaklistBool</th> | |
| 7122 <td>false</td> | |
| 7123 <td></td> | |
| 7124 <td></td> | |
| 7125 <td></td> | |
| 7126 </tr> | |
| 7127 </table> | |
| 7128 </div> | |
| 7129 | |
| 7130 | |
| 7131 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 7132 <h2 | |
| 7133 class="history_metadata_extractor_h2" | |
| 7134 style="cursor: pointer" | |
| 7135 title="click to fold/unfold the table" | |
| 7136 > | |
| 7137 [DELETED] - abims_xcms_group - 3.12.0+galaxy0 | |
| 7138 </h2> | |
| 7139 <p> | |
| 7140 Outputs: | |
| 7141 </p> | |
| 7142 <p class="history_metadata_extractor_status"> | |
| 7143 Status: Failed (1) | |
| 7144 </p> | |
| 7145 <p class="history_metadata_extractor_glitter"></p> | |
| 7146 <table class=" | |
| 7147 table | |
| 7148 table-bordered | |
| 7149 table-dark | |
| 7150 table-striped | |
| 7151 table-hover | |
| 7152 d-block | |
| 7153 overflow-auto | |
| 7154 history_metadata_extractor_table | |
| 7155 "> | |
| 7156 <thead> | |
| 7157 <tr> | |
| 7158 <th scope="col"></th> | |
| 7159 <th scope="col">value</th> | |
| 7160 <th scope="col">name</th> | |
| 7161 <th scope="col">extension</th> | |
| 7162 <th scope="col">hid</th> | |
| 7163 </tr> | |
| 7164 </thead> | |
| 7165 <tr class=""> | |
| 7166 <th scope="row">file_load_select</th> | |
| 7167 <td>no</td> | |
| 7168 <td></td> | |
| 7169 <td></td> | |
| 7170 <td></td> | |
| 7171 </tr><tr class=""> | |
| 7172 <th scope="row">image</th> | |
| 7173 <td>9e77b3d7d0887128</td> | |
| 7174 <td>test.rdata</td> | |
| 7175 <td>rdata</td> | |
| 7176 <td>1</td> | |
| 7177 </tr><tr class=""> | |
| 7178 <th scope="row">maxFeatures</th> | |
| 7179 <td>50</td> | |
| 7180 <td></td> | |
| 7181 <td></td> | |
| 7182 <td></td> | |
| 7183 </tr><tr class=""> | |
| 7184 <th scope="row">binSize</th> | |
| 7185 <td>0.25</td> | |
| 7186 <td></td> | |
| 7187 <td></td> | |
| 7188 <td></td> | |
| 7189 </tr><tr class=""> | |
| 7190 <th scope="row">bw</th> | |
| 7191 <td>30.0</td> | |
| 7192 <td></td> | |
| 7193 <td></td> | |
| 7194 <td></td> | |
| 7195 </tr><tr class=""> | |
| 7196 <th scope="row">method</th> | |
| 7197 <td>PeakDensity</td> | |
| 7198 <td></td> | |
| 7199 <td></td> | |
| 7200 <td></td> | |
| 7201 </tr><tr class=""> | |
| 7202 <th scope="row">minFraction</th> | |
| 7203 <td>0.5</td> | |
| 7204 <td></td> | |
| 7205 <td></td> | |
| 7206 <td></td> | |
| 7207 </tr><tr class=""> | |
| 7208 <th scope="row">minSamples</th> | |
| 7209 <td>1</td> | |
| 7210 <td></td> | |
| 7211 <td></td> | |
| 7212 <td></td> | |
| 7213 </tr><tr class=""> | |
| 7214 <th scope="row">peaklistBool</th> | |
| 7215 <td>false</td> | |
| 7216 <td></td> | |
| 7217 <td></td> | |
| 7218 <td></td> | |
| 7219 </tr> | |
| 7220 </table> | |
| 7221 </div> | |
| 7222 | |
| 7223 | |
| 7224 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 7225 <h2 | |
| 7226 class="history_metadata_extractor_h2" | |
| 7227 style="cursor: pointer" | |
| 7228 title="click to fold/unfold the table" | |
| 7229 > | |
| 7230 [DELETED] - abims_xcms_group - 3.12.0+galaxy0 | |
| 7231 </h2> | |
| 7232 <p> | |
| 7233 Outputs: | |
| 7234 </p> | |
| 7235 <p class="history_metadata_extractor_status"> | |
| 7236 Status: Failed (1) | |
| 7237 </p> | |
| 7238 <p class="history_metadata_extractor_glitter"></p> | |
| 7239 <table class=" | |
| 7240 table | |
| 7241 table-bordered | |
| 7242 table-dark | |
| 7243 table-striped | |
| 7244 table-hover | |
| 7245 d-block | |
| 7246 overflow-auto | |
| 7247 history_metadata_extractor_table | |
| 7248 "> | |
| 7249 <thead> | |
| 7250 <tr> | |
| 7251 <th scope="col"></th> | |
| 7252 <th scope="col">value</th> | |
| 7253 <th scope="col">name</th> | |
| 7254 <th scope="col">extension</th> | |
| 7255 <th scope="col">hid</th> | |
| 7256 </tr> | |
| 7257 </thead> | |
| 7258 <tr class=""> | |
| 7259 <th scope="row">file_load_select</th> | |
| 7260 <td>no</td> | |
| 7261 <td></td> | |
| 7262 <td></td> | |
| 7263 <td></td> | |
| 7264 </tr><tr class=""> | |
| 7265 <th scope="row">image</th> | |
| 7266 <td>9e77b3d7d0887128</td> | |
| 7267 <td>test.rdata</td> | |
| 7268 <td>rdata</td> | |
| 7269 <td>1</td> | |
| 7270 </tr><tr class=""> | |
| 7271 <th scope="row">maxFeatures</th> | |
| 7272 <td>50</td> | |
| 7273 <td></td> | |
| 7274 <td></td> | |
| 7275 <td></td> | |
| 7276 </tr><tr class=""> | |
| 7277 <th scope="row">binSize</th> | |
| 7278 <td>0.25</td> | |
| 7279 <td></td> | |
| 7280 <td></td> | |
| 7281 <td></td> | |
| 7282 </tr><tr class=""> | |
| 7283 <th scope="row">bw</th> | |
| 7284 <td>30.0</td> | |
| 7285 <td></td> | |
| 7286 <td></td> | |
| 7287 <td></td> | |
| 7288 </tr><tr class=""> | |
| 7289 <th scope="row">method</th> | |
| 7290 <td>PeakDensity</td> | |
| 7291 <td></td> | |
| 7292 <td></td> | |
| 7293 <td></td> | |
| 7294 </tr><tr class=""> | |
| 7295 <th scope="row">minFraction</th> | |
| 7296 <td>0.5</td> | |
| 7297 <td></td> | |
| 7298 <td></td> | |
| 7299 <td></td> | |
| 7300 </tr><tr class=""> | |
| 7301 <th scope="row">minSamples</th> | |
| 7302 <td>1</td> | |
| 7303 <td></td> | |
| 7304 <td></td> | |
| 7305 <td></td> | |
| 7306 </tr><tr class=""> | |
| 7307 <th scope="row">peaklistBool</th> | |
| 7308 <td>false</td> | |
| 7309 <td></td> | |
| 7310 <td></td> | |
| 7311 <td></td> | |
| 7312 </tr> | |
| 7313 </table> | |
| 7314 </div> | |
| 7315 | |
| 7316 | |
| 7317 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 7318 <h2 | |
| 7319 class="history_metadata_extractor_h2" | |
| 7320 style="cursor: pointer" | |
| 7321 title="click to fold/unfold the table" | |
| 7322 > | |
| 7323 [DELETED] - abims_xcms_group - 3.12.0+galaxy0 | |
| 7324 </h2> | |
| 7325 <p> | |
| 7326 Outputs: | |
| 7327 </p> | |
| 7328 <p class="history_metadata_extractor_status"> | |
| 7329 Status: Failed (1) | |
| 7330 </p> | |
| 7331 <p class="history_metadata_extractor_glitter"></p> | |
| 7332 <table class=" | |
| 7333 table | |
| 7334 table-bordered | |
| 7335 table-dark | |
| 7336 table-striped | |
| 7337 table-hover | |
| 7338 d-block | |
| 7339 overflow-auto | |
| 7340 history_metadata_extractor_table | |
| 7341 "> | |
| 7342 <thead> | |
| 7343 <tr> | |
| 7344 <th scope="col"></th> | |
| 7345 <th scope="col">value</th> | |
| 7346 <th scope="col">name</th> | |
| 7347 <th scope="col">extension</th> | |
| 7348 <th scope="col">hid</th> | |
| 7349 </tr> | |
| 7350 </thead> | |
| 7351 <tr class=""> | |
| 7352 <th scope="row">file_load_select</th> | |
| 7353 <td>no</td> | |
| 7354 <td></td> | |
| 7355 <td></td> | |
| 7356 <td></td> | |
| 7357 </tr><tr class=""> | |
| 7358 <th scope="row">image</th> | |
| 7359 <td>9e77b3d7d0887128</td> | |
| 7360 <td>test.rdata</td> | |
| 7361 <td>rdata</td> | |
| 7362 <td>1</td> | |
| 7363 </tr><tr class=""> | |
| 7364 <th scope="row">maxFeatures</th> | |
| 7365 <td>50</td> | |
| 7366 <td></td> | |
| 7367 <td></td> | |
| 7368 <td></td> | |
| 7369 </tr><tr class=""> | |
| 7370 <th scope="row">binSize</th> | |
| 7371 <td>0.25</td> | |
| 7372 <td></td> | |
| 7373 <td></td> | |
| 7374 <td></td> | |
| 7375 </tr><tr class=""> | |
| 7376 <th scope="row">bw</th> | |
| 7377 <td>30.0</td> | |
| 7378 <td></td> | |
| 7379 <td></td> | |
| 7380 <td></td> | |
| 7381 </tr><tr class=""> | |
| 7382 <th scope="row">method</th> | |
| 7383 <td>PeakDensity</td> | |
| 7384 <td></td> | |
| 7385 <td></td> | |
| 7386 <td></td> | |
| 7387 </tr><tr class=""> | |
| 7388 <th scope="row">minFraction</th> | |
| 7389 <td>0.5</td> | |
| 7390 <td></td> | |
| 7391 <td></td> | |
| 7392 <td></td> | |
| 7393 </tr><tr class=""> | |
| 7394 <th scope="row">minSamples</th> | |
| 7395 <td>1</td> | |
| 7396 <td></td> | |
| 7397 <td></td> | |
| 7398 <td></td> | |
| 7399 </tr><tr class=""> | |
| 7400 <th scope="row">peaklistBool</th> | |
| 7401 <td>false</td> | |
| 7402 <td></td> | |
| 7403 <td></td> | |
| 7404 <td></td> | |
| 7405 </tr> | |
| 7406 </table> | |
| 7407 </div> | |
| 7408 | |
| 7409 | |
| 7410 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 7411 <h2 | |
| 7412 class="history_metadata_extractor_h2" | |
| 7413 style="cursor: pointer" | |
| 7414 title="click to fold/unfold the table" | |
| 7415 > | |
| 7416 [DELETED] - xcms_merge - 3.12.0+galaxy0 | |
| 7417 </h2> | |
| 7418 <p> | |
| 7419 Outputs: | |
| 7420 </p> | |
| 7421 <p class="history_metadata_extractor_status"> | |
| 7422 Status: Failed (1) | |
| 7423 </p> | |
| 7424 <p class="history_metadata_extractor_glitter"></p> | |
| 7425 <table class=" | |
| 7426 table | |
| 7427 table-bordered | |
| 7428 table-dark | |
| 7429 table-striped | |
| 7430 table-hover | |
| 7431 d-block | |
| 7432 overflow-auto | |
| 7433 history_metadata_extractor_table | |
| 7434 "> | |
| 7435 <thead> | |
| 7436 <tr> | |
| 7437 <th scope="col"></th> | |
| 7438 <th scope="col">value</th> | |
| 7439 <th scope="col">name</th> | |
| 7440 <th scope="col">extension</th> | |
| 7441 <th scope="col">hid</th> | |
| 7442 </tr> | |
| 7443 </thead> | |
| 7444 <tr class=""> | |
| 7445 <th scope="row">file_load_select</th> | |
| 7446 <td>no</td> | |
| 7447 <td></td> | |
| 7448 <td></td> | |
| 7449 <td></td> | |
| 7450 </tr><tr class=""> | |
| 7451 <th scope="row">images</th> | |
| 7452 <td>9e77b3d7d0887128</td> | |
| 7453 <td>test.rdata</td> | |
| 7454 <td>rdata</td> | |
| 7455 <td>1</td> | |
| 7456 </tr><tr class=""> | |
| 7457 <th scope="row">sampleMetadata</th> | |
| 7458 <td>None</td> | |
| 7459 <td></td> | |
| 7460 <td></td> | |
| 7461 <td></td> | |
| 7462 </tr> | |
| 7463 </table> | |
| 7464 </div> | |
| 7465 | |
| 7466 | |
| 7467 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 7468 <h2 | |
| 7469 class="history_metadata_extractor_h2" | |
| 7470 style="cursor: pointer" | |
| 7471 title="click to fold/unfold the table" | |
| 7472 > | |
| 7473 [DELETED] - xcms_merge - 3.12.0+galaxy0 | |
| 7474 </h2> | |
| 7475 <p> | |
| 7476 Outputs: | |
| 7477 </p> | |
| 7478 <p class="history_metadata_extractor_status"> | |
| 7479 Status: Failed (1) | |
| 7480 </p> | |
| 7481 <p class="history_metadata_extractor_glitter"></p> | |
| 7482 <table class=" | |
| 7483 table | |
| 7484 table-bordered | |
| 7485 table-dark | |
| 7486 table-striped | |
| 7487 table-hover | |
| 7488 d-block | |
| 7489 overflow-auto | |
| 7490 history_metadata_extractor_table | |
| 7491 "> | |
| 7492 <thead> | |
| 7493 <tr> | |
| 7494 <th scope="col"></th> | |
| 7495 <th scope="col">value</th> | |
| 7496 <th scope="col">name</th> | |
| 7497 <th scope="col">extension</th> | |
| 7498 <th scope="col">hid</th> | |
| 7499 </tr> | |
| 7500 </thead> | |
| 7501 <tr class=""> | |
| 7502 <th scope="row">file_load_select</th> | |
| 7503 <td>no</td> | |
| 7504 <td></td> | |
| 7505 <td></td> | |
| 7506 <td></td> | |
| 7507 </tr><tr class=""> | |
| 7508 <th scope="row">images</th> | |
| 7509 <td>9e77b3d7d0887128</td> | |
| 7510 <td>test.rdata</td> | |
| 7511 <td>rdata</td> | |
| 7512 <td>1</td> | |
| 7513 </tr><tr class=""> | |
| 7514 <th scope="row">sampleMetadata</th> | |
| 7515 <td>None</td> | |
| 7516 <td></td> | |
| 7517 <td></td> | |
| 7518 <td></td> | |
| 7519 </tr> | |
| 7520 </table> | |
| 7521 </div> | |
| 7522 | |
| 7523 | |
| 7524 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 7525 <h2 | |
| 7526 class="history_metadata_extractor_h2" | |
| 7527 style="cursor: pointer" | |
| 7528 title="click to fold/unfold the table" | |
| 7529 > | |
| 7530 [DELETED] - xcms_export_samplemetadata - 3.12.0+galaxy0 | |
| 7531 </h2> | |
| 7532 <p> | |
| 7533 Outputs: | |
| 7534 </p> | |
| 7535 <p class="history_metadata_extractor_status"> | |
| 7536 Status: Failed (1) | |
| 7537 </p> | |
| 7538 <p class="history_metadata_extractor_glitter"></p> | |
| 7539 <table class=" | |
| 7540 table | |
| 7541 table-bordered | |
| 7542 table-dark | |
| 7543 table-striped | |
| 7544 table-hover | |
| 7545 d-block | |
| 7546 overflow-auto | |
| 7547 history_metadata_extractor_table | |
| 7548 "> | |
| 7549 <thead> | |
| 7550 <tr> | |
| 7551 <th scope="col"></th> | |
| 7552 <th scope="col">value</th> | |
| 7553 <th scope="col">name</th> | |
| 7554 <th scope="col">extension</th> | |
| 7555 <th scope="col">hid</th> | |
| 7556 </tr> | |
| 7557 </thead> | |
| 7558 <tr class=""> | |
| 7559 <th scope="row">images</th> | |
| 7560 <td>9e77b3d7d0887128</td> | |
| 7561 <td>test.rdata</td> | |
| 7562 <td>rdata</td> | |
| 7563 <td>1</td> | |
| 7564 </tr> | |
| 7565 </table> | |
| 7566 </div> | |
| 7567 | |
| 7568 | |
| 7569 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 7570 <h2 | |
| 7571 class="history_metadata_extractor_h2" | |
| 7572 style="cursor: pointer" | |
| 7573 title="click to fold/unfold the table" | |
| 7574 > | |
| 7575 [DELETED] - xcms_plot_chromatogram - 3.12.0+galaxy0 | |
| 7576 </h2> | |
| 7577 <p> | |
| 7578 Outputs: | |
| 7579 </p> | |
| 7580 <p class="history_metadata_extractor_status"> | |
| 7581 Status: Failed (1) | |
| 7582 </p> | |
| 7583 <p class="history_metadata_extractor_glitter"></p> | |
| 7584 <table class=" | |
| 7585 table | |
| 7586 table-bordered | |
| 7587 table-dark | |
| 7588 table-striped | |
| 7589 table-hover | |
| 7590 d-block | |
| 7591 overflow-auto | |
| 7592 history_metadata_extractor_table | |
| 7593 "> | |
| 7594 <thead> | |
| 7595 <tr> | |
| 7596 <th scope="col"></th> | |
| 7597 <th scope="col">value</th> | |
| 7598 <th scope="col">name</th> | |
| 7599 <th scope="col">extension</th> | |
| 7600 <th scope="col">hid</th> | |
| 7601 </tr> | |
| 7602 </thead> | |
| 7603 <tr class=""> | |
| 7604 <th scope="row">file_load_select</th> | |
| 7605 <td>no</td> | |
| 7606 <td></td> | |
| 7607 <td></td> | |
| 7608 <td></td> | |
| 7609 </tr><tr class=""> | |
| 7610 <th scope="row">images</th> | |
| 7611 <td>9e77b3d7d0887128</td> | |
| 7612 <td>test.rdata</td> | |
| 7613 <td>rdata</td> | |
| 7614 <td>1</td> | |
| 7615 </tr><tr class=""> | |
| 7616 <th scope="row">sampleMetadata</th> | |
| 7617 <td>None</td> | |
| 7618 <td></td> | |
| 7619 <td></td> | |
| 7620 <td></td> | |
| 7621 </tr> | |
| 7622 </table> | |
| 7623 </div> | |
| 7624 | |
| 7625 | |
| 7626 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 7627 <h2 | |
| 7628 class="history_metadata_extractor_h2" | |
| 7629 style="cursor: pointer" | |
| 7630 title="click to fold/unfold the table" | |
| 7631 > | |
| 7632 [DELETED] - xcms_plot_chromatogram - 3.12.0+galaxy0 | |
| 7633 </h2> | |
| 7634 <p> | |
| 7635 Outputs: | |
| 7636 </p> | |
| 7637 <p class="history_metadata_extractor_status"> | |
| 7638 Status: Failed (1) | |
| 7639 </p> | |
| 7640 <p class="history_metadata_extractor_glitter"></p> | |
| 7641 <table class=" | |
| 7642 table | |
| 7643 table-bordered | |
| 7644 table-dark | |
| 7645 table-striped | |
| 7646 table-hover | |
| 7647 d-block | |
| 7648 overflow-auto | |
| 7649 history_metadata_extractor_table | |
| 7650 "> | |
| 7651 <thead> | |
| 7652 <tr> | |
| 7653 <th scope="col"></th> | |
| 7654 <th scope="col">value</th> | |
| 7655 <th scope="col">name</th> | |
| 7656 <th scope="col">extension</th> | |
| 7657 <th scope="col">hid</th> | |
| 7658 </tr> | |
| 7659 </thead> | |
| 7660 <tr class=""> | |
| 7661 <th scope="row">file_load_select</th> | |
| 7662 <td>no</td> | |
| 7663 <td></td> | |
| 7664 <td></td> | |
| 7665 <td></td> | |
| 7666 </tr><tr class=""> | |
| 7667 <th scope="row">images</th> | |
| 7668 <td>9e77b3d7d0887128</td> | |
| 7669 <td>test.rdata</td> | |
| 7670 <td>rdata</td> | |
| 7671 <td>1</td> | |
| 7672 </tr><tr class=""> | |
| 7673 <th scope="row">sampleMetadata</th> | |
| 7674 <td>None</td> | |
| 7675 <td></td> | |
| 7676 <td></td> | |
| 7677 <td></td> | |
| 7678 </tr> | |
| 7679 </table> | |
| 7680 </div> | |
| 7681 | |
| 7682 | |
| 7683 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 7684 <h2 | |
| 7685 class="history_metadata_extractor_h2" | |
| 7686 style="cursor: pointer" | |
| 7687 title="click to fold/unfold the table" | |
| 7688 > | |
| 7689 [DELETED] - abims_xcms_fillPeaks - 3.12.0+galaxy0 | |
| 7690 </h2> | |
| 7691 <p> | |
| 7692 Outputs: | |
| 7693 </p> | |
| 7694 <p class="history_metadata_extractor_status"> | |
| 7695 Status: Failed (1) | |
| 7696 </p> | |
| 7697 <p class="history_metadata_extractor_glitter"></p> | |
| 7698 <table class=" | |
| 7699 table | |
| 7700 table-bordered | |
| 7701 table-dark | |
| 7702 table-striped | |
| 7703 table-hover | |
| 7704 d-block | |
| 7705 overflow-auto | |
| 7706 history_metadata_extractor_table | |
| 7707 "> | |
| 7708 <thead> | |
| 7709 <tr> | |
| 7710 <th scope="col"></th> | |
| 7711 <th scope="col">value</th> | |
| 7712 <th scope="col">name</th> | |
| 7713 <th scope="col">extension</th> | |
| 7714 <th scope="col">hid</th> | |
| 7715 </tr> | |
| 7716 </thead> | |
| 7717 <tr class=""> | |
| 7718 <th scope="row">expandMz</th> | |
| 7719 <td>0</td> | |
| 7720 <td></td> | |
| 7721 <td></td> | |
| 7722 <td></td> | |
| 7723 </tr><tr class=""> | |
| 7724 <th scope="row">expandRt</th> | |
| 7725 <td>0</td> | |
| 7726 <td></td> | |
| 7727 <td></td> | |
| 7728 <td></td> | |
| 7729 </tr><tr class=""> | |
| 7730 <th scope="row">ppm</th> | |
| 7731 <td>0</td> | |
| 7732 <td></td> | |
| 7733 <td></td> | |
| 7734 <td></td> | |
| 7735 </tr><tr class=""> | |
| 7736 <th scope="row">file_load_select</th> | |
| 7737 <td>no</td> | |
| 7738 <td></td> | |
| 7739 <td></td> | |
| 7740 <td></td> | |
| 7741 </tr><tr class=""> | |
| 7742 <th scope="row">image</th> | |
| 7743 <td>9e77b3d7d0887128</td> | |
| 7744 <td>test.rdata</td> | |
| 7745 <td>rdata</td> | |
| 7746 <td>1</td> | |
| 7747 </tr><tr class=""> | |
| 7748 <th scope="row">convertRTMinute</th> | |
| 7749 <td>false</td> | |
| 7750 <td></td> | |
| 7751 <td></td> | |
| 7752 <td></td> | |
| 7753 </tr><tr class=""> | |
| 7754 <th scope="row">intval</th> | |
| 7755 <td>into</td> | |
| 7756 <td></td> | |
| 7757 <td></td> | |
| 7758 <td></td> | |
| 7759 </tr><tr class=""> | |
| 7760 <th scope="row">naTOzero</th> | |
| 7761 <td>true</td> | |
| 7762 <td></td> | |
| 7763 <td></td> | |
| 7764 <td></td> | |
| 7765 </tr><tr class=""> | |
| 7766 <th scope="row">numDigitsMZ</th> | |
| 7767 <td>4</td> | |
| 7768 <td></td> | |
| 7769 <td></td> | |
| 7770 <td></td> | |
| 7771 </tr><tr class=""> | |
| 7772 <th scope="row">numDigitsRT</th> | |
| 7773 <td>0</td> | |
| 7774 <td></td> | |
| 7775 <td></td> | |
| 7776 <td></td> | |
| 7777 </tr><tr class=""> | |
| 7778 <th scope="row">peaklistBool</th> | |
| 7779 <td>True</td> | |
| 7780 <td></td> | |
| 7781 <td></td> | |
| 7782 <td></td> | |
| 7783 </tr> | |
| 7784 </table> | |
| 7785 </div> | |
| 7786 | |
| 7787 | |
| 7788 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 7789 <h2 | |
| 7790 class="history_metadata_extractor_h2" | |
| 7791 style="cursor: pointer" | |
| 7792 title="click to fold/unfold the table" | |
| 7793 > | |
| 7794 [DELETED] - abims_xcms_fillPeaks - 3.12.0+galaxy0 | |
| 7795 </h2> | |
| 7796 <p> | |
| 7797 Outputs: | |
| 7798 </p> | |
| 7799 <p class="history_metadata_extractor_status"> | |
| 7800 Status: Failed (1) | |
| 7801 </p> | |
| 7802 <p class="history_metadata_extractor_glitter"></p> | |
| 7803 <table class=" | |
| 7804 table | |
| 7805 table-bordered | |
| 7806 table-dark | |
| 7807 table-striped | |
| 7808 table-hover | |
| 7809 d-block | |
| 7810 overflow-auto | |
| 7811 history_metadata_extractor_table | |
| 7812 "> | |
| 7813 <thead> | |
| 7814 <tr> | |
| 7815 <th scope="col"></th> | |
| 7816 <th scope="col">value</th> | |
| 7817 <th scope="col">name</th> | |
| 7818 <th scope="col">extension</th> | |
| 7819 <th scope="col">hid</th> | |
| 7820 </tr> | |
| 7821 </thead> | |
| 7822 <tr class=""> | |
| 7823 <th scope="row">expandMz</th> | |
| 7824 <td>0</td> | |
| 7825 <td></td> | |
| 7826 <td></td> | |
| 7827 <td></td> | |
| 7828 </tr><tr class=""> | |
| 7829 <th scope="row">expandRt</th> | |
| 7830 <td>0</td> | |
| 7831 <td></td> | |
| 7832 <td></td> | |
| 7833 <td></td> | |
| 7834 </tr><tr class=""> | |
| 7835 <th scope="row">ppm</th> | |
| 7836 <td>0</td> | |
| 7837 <td></td> | |
| 7838 <td></td> | |
| 7839 <td></td> | |
| 7840 </tr><tr class=""> | |
| 7841 <th scope="row">file_load_select</th> | |
| 7842 <td>no</td> | |
| 7843 <td></td> | |
| 7844 <td></td> | |
| 7845 <td></td> | |
| 7846 </tr><tr class=""> | |
| 7847 <th scope="row">image</th> | |
| 7848 <td>9e77b3d7d0887128</td> | |
| 7849 <td>test.rdata</td> | |
| 7850 <td>rdata</td> | |
| 7851 <td>1</td> | |
| 7852 </tr><tr class=""> | |
| 7853 <th scope="row">convertRTMinute</th> | |
| 7854 <td>false</td> | |
| 7855 <td></td> | |
| 7856 <td></td> | |
| 7857 <td></td> | |
| 7858 </tr><tr class=""> | |
| 7859 <th scope="row">intval</th> | |
| 7860 <td>into</td> | |
| 7861 <td></td> | |
| 7862 <td></td> | |
| 7863 <td></td> | |
| 7864 </tr><tr class=""> | |
| 7865 <th scope="row">naTOzero</th> | |
| 7866 <td>true</td> | |
| 7867 <td></td> | |
| 7868 <td></td> | |
| 7869 <td></td> | |
| 7870 </tr><tr class=""> | |
| 7871 <th scope="row">numDigitsMZ</th> | |
| 7872 <td>4</td> | |
| 7873 <td></td> | |
| 7874 <td></td> | |
| 7875 <td></td> | |
| 7876 </tr><tr class=""> | |
| 7877 <th scope="row">numDigitsRT</th> | |
| 7878 <td>0</td> | |
| 7879 <td></td> | |
| 7880 <td></td> | |
| 7881 <td></td> | |
| 7882 </tr><tr class=""> | |
| 7883 <th scope="row">peaklistBool</th> | |
| 7884 <td>True</td> | |
| 7885 <td></td> | |
| 7886 <td></td> | |
| 7887 <td></td> | |
| 7888 </tr> | |
| 7889 </table> | |
| 7890 </div> | |
| 7891 | |
| 7892 | |
| 7893 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 7894 <h2 | |
| 7895 class="history_metadata_extractor_h2" | |
| 7896 style="cursor: pointer" | |
| 7897 title="click to fold/unfold the table" | |
| 7898 > | |
| 7899 [DELETED] - abims_xcms_fillPeaks - 3.12.0+galaxy0 | |
| 7900 </h2> | |
| 7901 <p> | |
| 7902 Outputs: | |
| 7903 </p> | |
| 7904 <p class="history_metadata_extractor_status"> | |
| 7905 Status: Failed (1) | |
| 7906 </p> | |
| 7907 <p class="history_metadata_extractor_glitter"></p> | |
| 7908 <table class=" | |
| 7909 table | |
| 7910 table-bordered | |
| 7911 table-dark | |
| 7912 table-striped | |
| 7913 table-hover | |
| 7914 d-block | |
| 7915 overflow-auto | |
| 7916 history_metadata_extractor_table | |
| 7917 "> | |
| 7918 <thead> | |
| 7919 <tr> | |
| 7920 <th scope="col"></th> | |
| 7921 <th scope="col">value</th> | |
| 7922 <th scope="col">name</th> | |
| 7923 <th scope="col">extension</th> | |
| 7924 <th scope="col">hid</th> | |
| 7925 </tr> | |
| 7926 </thead> | |
| 7927 <tr class=""> | |
| 7928 <th scope="row">expandMz</th> | |
| 7929 <td>0</td> | |
| 7930 <td></td> | |
| 7931 <td></td> | |
| 7932 <td></td> | |
| 7933 </tr><tr class=""> | |
| 7934 <th scope="row">expandRt</th> | |
| 7935 <td>0</td> | |
| 7936 <td></td> | |
| 7937 <td></td> | |
| 7938 <td></td> | |
| 7939 </tr><tr class=""> | |
| 7940 <th scope="row">ppm</th> | |
| 7941 <td>0</td> | |
| 7942 <td></td> | |
| 7943 <td></td> | |
| 7944 <td></td> | |
| 7945 </tr><tr class=""> | |
| 7946 <th scope="row">file_load_select</th> | |
| 7947 <td>no</td> | |
| 7948 <td></td> | |
| 7949 <td></td> | |
| 7950 <td></td> | |
| 7951 </tr><tr class=""> | |
| 7952 <th scope="row">image</th> | |
| 7953 <td>9e77b3d7d0887128</td> | |
| 7954 <td>test.rdata</td> | |
| 7955 <td>rdata</td> | |
| 7956 <td>1</td> | |
| 7957 </tr><tr class=""> | |
| 7958 <th scope="row">convertRTMinute</th> | |
| 7959 <td>false</td> | |
| 7960 <td></td> | |
| 7961 <td></td> | |
| 7962 <td></td> | |
| 7963 </tr><tr class=""> | |
| 7964 <th scope="row">intval</th> | |
| 7965 <td>into</td> | |
| 7966 <td></td> | |
| 7967 <td></td> | |
| 7968 <td></td> | |
| 7969 </tr><tr class=""> | |
| 7970 <th scope="row">naTOzero</th> | |
| 7971 <td>true</td> | |
| 7972 <td></td> | |
| 7973 <td></td> | |
| 7974 <td></td> | |
| 7975 </tr><tr class=""> | |
| 7976 <th scope="row">numDigitsMZ</th> | |
| 7977 <td>4</td> | |
| 7978 <td></td> | |
| 7979 <td></td> | |
| 7980 <td></td> | |
| 7981 </tr><tr class=""> | |
| 7982 <th scope="row">numDigitsRT</th> | |
| 7983 <td>0</td> | |
| 7984 <td></td> | |
| 7985 <td></td> | |
| 7986 <td></td> | |
| 7987 </tr><tr class=""> | |
| 7988 <th scope="row">peaklistBool</th> | |
| 7989 <td>True</td> | |
| 7990 <td></td> | |
| 7991 <td></td> | |
| 7992 <td></td> | |
| 7993 </tr> | |
| 7994 </table> | |
| 7995 </div> | |
| 7996 | |
| 7997 | |
| 7998 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 7999 <h2 | |
| 8000 class="history_metadata_extractor_h2" | |
| 8001 style="cursor: pointer" | |
| 8002 title="click to fold/unfold the table" | |
| 8003 > | |
| 8004 [DELETED] - quality_metrics - 2.2.8 | |
| 8005 </h2> | |
| 8006 <p> | |
| 8007 Outputs: | |
| 8008 </p> | |
| 8009 <p class="history_metadata_extractor_status"> | |
| 8010 Status: Failed (1) | |
| 8011 </p> | |
| 8012 <p class="history_metadata_extractor_glitter"></p> | |
| 8013 <table class=" | |
| 8014 table | |
| 8015 table-bordered | |
| 8016 table-dark | |
| 8017 table-striped | |
| 8018 table-hover | |
| 8019 d-block | |
| 8020 overflow-auto | |
| 8021 history_metadata_extractor_table | |
| 8022 "> | |
| 8023 <thead> | |
| 8024 <tr> | |
| 8025 <th scope="col"></th> | |
| 8026 <th scope="col">value</th> | |
| 8027 <th scope="col">name</th> | |
| 8028 <th scope="col">extension</th> | |
| 8029 <th scope="col">hid</th> | |
| 8030 </tr> | |
| 8031 </thead> | |
| 8032 <tr class=""> | |
| 8033 <th scope="row">CV</th> | |
| 8034 <td>FALSE</td> | |
| 8035 <td></td> | |
| 8036 <td></td> | |
| 8037 <td></td> | |
| 8038 </tr><tr class=""> | |
| 8039 <th scope="row">Compa</th> | |
| 8040 <td>TRUE</td> | |
| 8041 <td></td> | |
| 8042 <td></td> | |
| 8043 <td></td> | |
| 8044 </tr><tr class=""> | |
| 8045 <th scope="row">seuil</th> | |
| 8046 <td>1</td> | |
| 8047 <td></td> | |
| 8048 <td></td> | |
| 8049 <td></td> | |
| 8050 </tr><tr class=""> | |
| 8051 <th scope="row">optC</th> | |
| 8052 <td>default</td> | |
| 8053 <td></td> | |
| 8054 <td></td> | |
| 8055 <td></td> | |
| 8056 </tr><tr class=""> | |
| 8057 <th scope="row">poolAsPool1L</th> | |
| 8058 <td>TRUE</td> | |
| 8059 <td></td> | |
| 8060 <td></td> | |
| 8061 <td></td> | |
| 8062 </tr><tr class=""> | |
| 8063 <th scope="row">dataMatrix_in</th> | |
| 8064 <td>7cf499d16bd542b2</td> | |
| 8065 <td>compounds_pos.txt</td> | |
| 8066 <td>tabular</td> | |
| 8067 <td>44</td> | |
| 8068 </tr><tr class=""> | |
| 8069 <th scope="row">sampleMetadata_in</th> | |
| 8070 <td>7cf499d16bd542b2</td> | |
| 8071 <td>compounds_pos.txt</td> | |
| 8072 <td>tabular</td> | |
| 8073 <td>44</td> | |
| 8074 </tr><tr class=""> | |
| 8075 <th scope="row">variableMetadata_in</th> | |
| 8076 <td>7cf499d16bd542b2</td> | |
| 8077 <td>compounds_pos.txt</td> | |
| 8078 <td>tabular</td> | |
| 8079 <td>44</td> | |
| 8080 </tr> | |
| 8081 </table> | |
| 8082 </div> | |
| 8083 | |
| 8084 | |
| 8085 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 8086 <h2 | |
| 8087 class="history_metadata_extractor_h2" | |
| 8088 style="cursor: pointer" | |
| 8089 title="click to fold/unfold the table" | |
| 8090 > | |
| 8091 [DELETED] - quality_metrics - 2.2.8 | |
| 8092 </h2> | |
| 8093 <p> | |
| 8094 Outputs: | |
| 8095 </p> | |
| 8096 <p class="history_metadata_extractor_status"> | |
| 8097 Status: Failed (1) | |
| 8098 </p> | |
| 8099 <p class="history_metadata_extractor_glitter"></p> | |
| 8100 <table class=" | |
| 8101 table | |
| 8102 table-bordered | |
| 8103 table-dark | |
| 8104 table-striped | |
| 8105 table-hover | |
| 8106 d-block | |
| 8107 overflow-auto | |
| 8108 history_metadata_extractor_table | |
| 8109 "> | |
| 8110 <thead> | |
| 8111 <tr> | |
| 8112 <th scope="col"></th> | |
| 8113 <th scope="col">value</th> | |
| 8114 <th scope="col">name</th> | |
| 8115 <th scope="col">extension</th> | |
| 8116 <th scope="col">hid</th> | |
| 8117 </tr> | |
| 8118 </thead> | |
| 8119 <tr class=""> | |
| 8120 <th scope="row">CV</th> | |
| 8121 <td>FALSE</td> | |
| 8122 <td></td> | |
| 8123 <td></td> | |
| 8124 <td></td> | |
| 8125 </tr><tr class=""> | |
| 8126 <th scope="row">Compa</th> | |
| 8127 <td>TRUE</td> | |
| 8128 <td></td> | |
| 8129 <td></td> | |
| 8130 <td></td> | |
| 8131 </tr><tr class=""> | |
| 8132 <th scope="row">seuil</th> | |
| 8133 <td>1</td> | |
| 8134 <td></td> | |
| 8135 <td></td> | |
| 8136 <td></td> | |
| 8137 </tr><tr class=""> | |
| 8138 <th scope="row">optC</th> | |
| 8139 <td>default</td> | |
| 8140 <td></td> | |
| 8141 <td></td> | |
| 8142 <td></td> | |
| 8143 </tr><tr class=""> | |
| 8144 <th scope="row">poolAsPool1L</th> | |
| 8145 <td>TRUE</td> | |
| 8146 <td></td> | |
| 8147 <td></td> | |
| 8148 <td></td> | |
| 8149 </tr><tr class=""> | |
| 8150 <th scope="row">dataMatrix_in</th> | |
| 8151 <td>7cf499d16bd542b2</td> | |
| 8152 <td>compounds_pos.txt</td> | |
| 8153 <td>tabular</td> | |
| 8154 <td>44</td> | |
| 8155 </tr><tr class=""> | |
| 8156 <th scope="row">sampleMetadata_in</th> | |
| 8157 <td>7cf499d16bd542b2</td> | |
| 8158 <td>compounds_pos.txt</td> | |
| 8159 <td>tabular</td> | |
| 8160 <td>44</td> | |
| 8161 </tr><tr class=""> | |
| 8162 <th scope="row">variableMetadata_in</th> | |
| 8163 <td>7cf499d16bd542b2</td> | |
| 8164 <td>compounds_pos.txt</td> | |
| 8165 <td>tabular</td> | |
| 8166 <td>44</td> | |
| 8167 </tr> | |
| 8168 </table> | |
| 8169 </div> | |
| 8170 | |
| 8171 | |
| 8172 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 8173 <h2 | |
| 8174 class="history_metadata_extractor_h2" | |
| 8175 style="cursor: pointer" | |
| 8176 title="click to fold/unfold the table" | |
| 8177 > | |
| 8178 [DELETED] - quality_metrics - 2.2.8 | |
| 8179 </h2> | |
| 8180 <p> | |
| 8181 Outputs: | |
| 8182 </p> | |
| 8183 <p class="history_metadata_extractor_status"> | |
| 8184 Status: Failed (1) | |
| 8185 </p> | |
| 8186 <p class="history_metadata_extractor_glitter"></p> | |
| 8187 <table class=" | |
| 8188 table | |
| 8189 table-bordered | |
| 8190 table-dark | |
| 8191 table-striped | |
| 8192 table-hover | |
| 8193 d-block | |
| 8194 overflow-auto | |
| 8195 history_metadata_extractor_table | |
| 8196 "> | |
| 8197 <thead> | |
| 8198 <tr> | |
| 8199 <th scope="col"></th> | |
| 8200 <th scope="col">value</th> | |
| 8201 <th scope="col">name</th> | |
| 8202 <th scope="col">extension</th> | |
| 8203 <th scope="col">hid</th> | |
| 8204 </tr> | |
| 8205 </thead> | |
| 8206 <tr class=""> | |
| 8207 <th scope="row">CV</th> | |
| 8208 <td>FALSE</td> | |
| 8209 <td></td> | |
| 8210 <td></td> | |
| 8211 <td></td> | |
| 8212 </tr><tr class=""> | |
| 8213 <th scope="row">Compa</th> | |
| 8214 <td>TRUE</td> | |
| 8215 <td></td> | |
| 8216 <td></td> | |
| 8217 <td></td> | |
| 8218 </tr><tr class=""> | |
| 8219 <th scope="row">seuil</th> | |
| 8220 <td>1</td> | |
| 8221 <td></td> | |
| 8222 <td></td> | |
| 8223 <td></td> | |
| 8224 </tr><tr class=""> | |
| 8225 <th scope="row">optC</th> | |
| 8226 <td>default</td> | |
| 8227 <td></td> | |
| 8228 <td></td> | |
| 8229 <td></td> | |
| 8230 </tr><tr class=""> | |
| 8231 <th scope="row">poolAsPool1L</th> | |
| 8232 <td>TRUE</td> | |
| 8233 <td></td> | |
| 8234 <td></td> | |
| 8235 <td></td> | |
| 8236 </tr><tr class=""> | |
| 8237 <th scope="row">dataMatrix_in</th> | |
| 8238 <td>7cf499d16bd542b2</td> | |
| 8239 <td>compounds_pos.txt</td> | |
| 8240 <td>tabular</td> | |
| 8241 <td>44</td> | |
| 8242 </tr><tr class=""> | |
| 8243 <th scope="row">sampleMetadata_in</th> | |
| 8244 <td>7cf499d16bd542b2</td> | |
| 8245 <td>compounds_pos.txt</td> | |
| 8246 <td>tabular</td> | |
| 8247 <td>44</td> | |
| 8248 </tr><tr class=""> | |
| 8249 <th scope="row">variableMetadata_in</th> | |
| 8250 <td>7cf499d16bd542b2</td> | |
| 8251 <td>compounds_pos.txt</td> | |
| 8252 <td>tabular</td> | |
| 8253 <td>44</td> | |
| 8254 </tr> | |
| 8255 </table> | |
| 8256 </div> | |
| 8257 | |
| 8258 | |
| 8259 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 8260 <h2 | |
| 8261 class="history_metadata_extractor_h2" | |
| 8262 style="cursor: pointer" | |
| 8263 title="click to fold/unfold the table" | |
| 8264 > | |
| 8265 [DELETED] - quality_metrics - 2.2.8 | |
| 8266 </h2> | |
| 8267 <p> | |
| 8268 Outputs: | |
| 8269 </p> | |
| 8270 <p class="history_metadata_extractor_status"> | |
| 8271 Status: Failed (1) | |
| 8272 </p> | |
| 8273 <p class="history_metadata_extractor_glitter"></p> | |
| 8274 <table class=" | |
| 8275 table | |
| 8276 table-bordered | |
| 8277 table-dark | |
| 8278 table-striped | |
| 8279 table-hover | |
| 8280 d-block | |
| 8281 overflow-auto | |
| 8282 history_metadata_extractor_table | |
| 8283 "> | |
| 8284 <thead> | |
| 8285 <tr> | |
| 8286 <th scope="col"></th> | |
| 8287 <th scope="col">value</th> | |
| 8288 <th scope="col">name</th> | |
| 8289 <th scope="col">extension</th> | |
| 8290 <th scope="col">hid</th> | |
| 8291 </tr> | |
| 8292 </thead> | |
| 8293 <tr class=""> | |
| 8294 <th scope="row">CV</th> | |
| 8295 <td>FALSE</td> | |
| 8296 <td></td> | |
| 8297 <td></td> | |
| 8298 <td></td> | |
| 8299 </tr><tr class=""> | |
| 8300 <th scope="row">Compa</th> | |
| 8301 <td>TRUE</td> | |
| 8302 <td></td> | |
| 8303 <td></td> | |
| 8304 <td></td> | |
| 8305 </tr><tr class=""> | |
| 8306 <th scope="row">seuil</th> | |
| 8307 <td>1</td> | |
| 8308 <td></td> | |
| 8309 <td></td> | |
| 8310 <td></td> | |
| 8311 </tr><tr class=""> | |
| 8312 <th scope="row">optC</th> | |
| 8313 <td>default</td> | |
| 8314 <td></td> | |
| 8315 <td></td> | |
| 8316 <td></td> | |
| 8317 </tr><tr class=""> | |
| 8318 <th scope="row">poolAsPool1L</th> | |
| 8319 <td>TRUE</td> | |
| 8320 <td></td> | |
| 8321 <td></td> | |
| 8322 <td></td> | |
| 8323 </tr><tr class=""> | |
| 8324 <th scope="row">dataMatrix_in</th> | |
| 8325 <td>7cf499d16bd542b2</td> | |
| 8326 <td>compounds_pos.txt</td> | |
| 8327 <td>tabular</td> | |
| 8328 <td>44</td> | |
| 8329 </tr><tr class=""> | |
| 8330 <th scope="row">sampleMetadata_in</th> | |
| 8331 <td>7cf499d16bd542b2</td> | |
| 8332 <td>compounds_pos.txt</td> | |
| 8333 <td>tabular</td> | |
| 8334 <td>44</td> | |
| 8335 </tr><tr class=""> | |
| 8336 <th scope="row">variableMetadata_in</th> | |
| 8337 <td>7cf499d16bd542b2</td> | |
| 8338 <td>compounds_pos.txt</td> | |
| 8339 <td>tabular</td> | |
| 8340 <td>44</td> | |
| 8341 </tr> | |
| 8342 </table> | |
| 8343 </div> | |
| 8344 | |
| 8345 | |
| 8346 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 8347 <h2 | |
| 8348 class="history_metadata_extractor_h2" | |
| 8349 style="cursor: pointer" | |
| 8350 title="click to fold/unfold the table" | |
| 8351 > | |
| 8352 [DELETED] - intens_check - 1.2.8 | |
| 8353 </h2> | |
| 8354 <p> | |
| 8355 Outputs: | |
| 8356 </p> | |
| 8357 <p class="history_metadata_extractor_status"> | |
| 8358 Status: Failed (1) | |
| 8359 </p> | |
| 8360 <p class="history_metadata_extractor_glitter"></p> | |
| 8361 <table class=" | |
| 8362 table | |
| 8363 table-bordered | |
| 8364 table-dark | |
| 8365 table-striped | |
| 8366 table-hover | |
| 8367 d-block | |
| 8368 overflow-auto | |
| 8369 history_metadata_extractor_table | |
| 8370 "> | |
| 8371 <thead> | |
| 8372 <tr> | |
| 8373 <th scope="col"></th> | |
| 8374 <th scope="col">value</th> | |
| 8375 <th scope="col">name</th> | |
| 8376 <th scope="col">extension</th> | |
| 8377 <th scope="col">hid</th> | |
| 8378 </tr> | |
| 8379 </thead> | |
| 8380 <tr class=""> | |
| 8381 <th scope="row">dataMatrix_in</th> | |
| 8382 <td>9a0ce47bd1734ae7</td> | |
| 8383 <td>peaklist_fragments.tsv</td> | |
| 8384 <td>tabular</td> | |
| 8385 <td>42</td> | |
| 8386 </tr><tr class=""> | |
| 8387 <th scope="row">chosen_stat</th> | |
| 8388 <td>None</td> | |
| 8389 <td></td> | |
| 8390 <td></td> | |
| 8391 <td></td> | |
| 8392 </tr><tr class=""> | |
| 8393 <th scope="row">method</th> | |
| 8394 <td>no_class</td> | |
| 8395 <td></td> | |
| 8396 <td></td> | |
| 8397 <td></td> | |
| 8398 </tr><tr class=""> | |
| 8399 <th scope="row">sampleMetadata_in</th> | |
| 8400 <td>9a0ce47bd1734ae7</td> | |
| 8401 <td>peaklist_fragments.tsv</td> | |
| 8402 <td>tabular</td> | |
| 8403 <td>42</td> | |
| 8404 </tr><tr class=""> | |
| 8405 <th scope="row">variableMetadata_in</th> | |
| 8406 <td>9a0ce47bd1734ae7</td> | |
| 8407 <td>peaklist_fragments.tsv</td> | |
| 8408 <td>tabular</td> | |
| 8409 <td>42</td> | |
| 8410 </tr> | |
| 8411 </table> | |
| 8412 </div> | |
| 8413 | |
| 8414 | |
| 8415 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 8416 <h2 | |
| 8417 class="history_metadata_extractor_h2" | |
| 8418 style="cursor: pointer" | |
| 8419 title="click to fold/unfold the table" | |
| 8420 > | |
| 8421 [DELETED] - intens_check - 1.2.8 | |
| 8422 </h2> | |
| 8423 <p> | |
| 8424 Outputs: | |
| 8425 </p> | |
| 8426 <p class="history_metadata_extractor_status"> | |
| 8427 Status: Failed (1) | |
| 8428 </p> | |
| 8429 <p class="history_metadata_extractor_glitter"></p> | |
| 8430 <table class=" | |
| 8431 table | |
| 8432 table-bordered | |
| 8433 table-dark | |
| 8434 table-striped | |
| 8435 table-hover | |
| 8436 d-block | |
| 8437 overflow-auto | |
| 8438 history_metadata_extractor_table | |
| 8439 "> | |
| 8440 <thead> | |
| 8441 <tr> | |
| 8442 <th scope="col"></th> | |
| 8443 <th scope="col">value</th> | |
| 8444 <th scope="col">name</th> | |
| 8445 <th scope="col">extension</th> | |
| 8446 <th scope="col">hid</th> | |
| 8447 </tr> | |
| 8448 </thead> | |
| 8449 <tr class=""> | |
| 8450 <th scope="row">dataMatrix_in</th> | |
| 8451 <td>9a0ce47bd1734ae7</td> | |
| 8452 <td>peaklist_fragments.tsv</td> | |
| 8453 <td>tabular</td> | |
| 8454 <td>42</td> | |
| 8455 </tr><tr class=""> | |
| 8456 <th scope="row">chosen_stat</th> | |
| 8457 <td>None</td> | |
| 8458 <td></td> | |
| 8459 <td></td> | |
| 8460 <td></td> | |
| 8461 </tr><tr class=""> | |
| 8462 <th scope="row">method</th> | |
| 8463 <td>no_class</td> | |
| 8464 <td></td> | |
| 8465 <td></td> | |
| 8466 <td></td> | |
| 8467 </tr><tr class=""> | |
| 8468 <th scope="row">sampleMetadata_in</th> | |
| 8469 <td>9a0ce47bd1734ae7</td> | |
| 8470 <td>peaklist_fragments.tsv</td> | |
| 8471 <td>tabular</td> | |
| 8472 <td>42</td> | |
| 8473 </tr><tr class=""> | |
| 8474 <th scope="row">variableMetadata_in</th> | |
| 8475 <td>9a0ce47bd1734ae7</td> | |
| 8476 <td>peaklist_fragments.tsv</td> | |
| 8477 <td>tabular</td> | |
| 8478 <td>42</td> | |
| 8479 </tr> | |
| 8480 </table> | |
| 8481 </div> | |
| 8482 | |
| 8483 | |
| 8484 <div class="alert alert-success history_metadata_extractor_deleted"> | |
| 8485 <h2 | |
| 8486 class="history_metadata_extractor_h2" | |
| 8487 style="cursor: pointer" | |
| 8488 title="click to fold/unfold the table" | |
| 8489 > | |
| 8490 [DELETED] - Analytic_correlation_filtration - 2019-06-20 | |
| 8491 </h2> | |
| 8492 <p> | |
| 8493 Outputs: | |
| 8494 </p> | |
| 8495 <p class="history_metadata_extractor_status"> | |
| 8496 Status: Ok (0) | |
| 8497 </p> | |
| 8498 <p class="history_metadata_extractor_glitter"></p> | |
| 8499 <table class=" | |
| 8500 table | |
| 8501 table-bordered | |
| 8502 table-dark | |
| 8503 table-striped | |
| 8504 table-hover | |
| 8505 d-block | |
| 8506 overflow-auto | |
| 8507 history_metadata_extractor_table | |
| 8508 "> | |
| 8509 <thead> | |
| 8510 <tr> | |
| 8511 <th scope="col"></th> | |
| 8512 <th scope="col">value</th> | |
| 8513 <th scope="col">name</th> | |
| 8514 <th scope="col">extension</th> | |
| 8515 <th scope="col">hid</th> | |
| 8516 </tr> | |
| 8517 </thead> | |
| 8518 <tr class=""> | |
| 8519 <th scope="row">correl_threshold</th> | |
| 8520 <td>0.9</td> | |
| 8521 <td></td> | |
| 8522 <td></td> | |
| 8523 <td></td> | |
| 8524 </tr><tr class=""> | |
| 8525 <th scope="row">dataMatrix_in</th> | |
| 8526 <td>9a0ce47bd1734ae7</td> | |
| 8527 <td>peaklist_fragments.tsv</td> | |
| 8528 <td>tabular</td> | |
| 8529 <td>42</td> | |
| 8530 </tr><tr class=""> | |
| 8531 <th scope="row">file_in</th> | |
| 8532 <td>9a0ce47bd1734ae7</td> | |
| 8533 <td>peaklist_fragments.tsv</td> | |
| 8534 <td>tabular</td> | |
| 8535 <td>42</td> | |
| 8536 </tr><tr class=""> | |
| 8537 <th scope="row">mass_file_in</th> | |
| 8538 <td>9a0ce47bd1734ae7</td> | |
| 8539 <td>peaklist_fragments.tsv</td> | |
| 8540 <td>tabular</td> | |
| 8541 <td>42</td> | |
| 8542 </tr><tr class=""> | |
| 8543 <th scope="row">mass_list</th> | |
| 8544 <td>true</td> | |
| 8545 <td></td> | |
| 8546 <td></td> | |
| 8547 <td></td> | |
| 8548 </tr><tr class=""> | |
| 8549 <th scope="row">mass_choice</th> | |
| 8550 <td>true</td> | |
| 8551 <td></td> | |
| 8552 <td></td> | |
| 8553 <td></td> | |
| 8554 </tr><tr class=""> | |
| 8555 <th scope="row">mass_threshold</th> | |
| 8556 <td>0.005</td> | |
| 8557 <td></td> | |
| 8558 <td></td> | |
| 8559 <td></td> | |
| 8560 </tr><tr class=""> | |
| 8561 <th scope="row">repres_opt_selector</th> | |
| 8562 <td>intensity</td> | |
| 8563 <td></td> | |
| 8564 <td></td> | |
| 8565 <td></td> | |
| 8566 </tr><tr class=""> | |
| 8567 <th scope="row">rt_choice</th> | |
| 8568 <td>true</td> | |
| 8569 <td></td> | |
| 8570 <td></td> | |
| 8571 <td></td> | |
| 8572 </tr><tr class=""> | |
| 8573 <th scope="row">rt_threshold</th> | |
| 8574 <td>0.1</td> | |
| 8575 <td></td> | |
| 8576 <td></td> | |
| 8577 <td></td> | |
| 8578 </tr><tr class=""> | |
| 8579 <th scope="row">variableMetadata_in</th> | |
| 8580 <td>9a0ce47bd1734ae7</td> | |
| 8581 <td>peaklist_fragments.tsv</td> | |
| 8582 <td>tabular</td> | |
| 8583 <td>42</td> | |
| 8584 </tr> | |
| 8585 </table> | |
| 8586 </div> | |
| 8587 | |
| 8588 | |
| 8589 <div class="alert alert-success history_metadata_extractor_deleted"> | |
| 8590 <h2 | |
| 8591 class="history_metadata_extractor_h2" | |
| 8592 style="cursor: pointer" | |
| 8593 title="click to fold/unfold the table" | |
| 8594 > | |
| 8595 [DELETED] - Analytic_correlation_filtration - 2019-06-20 | |
| 8596 </h2> | |
| 8597 <p> | |
| 8598 Outputs: | |
| 8599 </p> | |
| 8600 <p class="history_metadata_extractor_status"> | |
| 8601 Status: Ok (0) | |
| 8602 </p> | |
| 8603 <p class="history_metadata_extractor_glitter"></p> | |
| 8604 <table class=" | |
| 8605 table | |
| 8606 table-bordered | |
| 8607 table-dark | |
| 8608 table-striped | |
| 8609 table-hover | |
| 8610 d-block | |
| 8611 overflow-auto | |
| 8612 history_metadata_extractor_table | |
| 8613 "> | |
| 8614 <thead> | |
| 8615 <tr> | |
| 8616 <th scope="col"></th> | |
| 8617 <th scope="col">value</th> | |
| 8618 <th scope="col">name</th> | |
| 8619 <th scope="col">extension</th> | |
| 8620 <th scope="col">hid</th> | |
| 8621 </tr> | |
| 8622 </thead> | |
| 8623 <tr class=""> | |
| 8624 <th scope="row">correl_threshold</th> | |
| 8625 <td>0.9</td> | |
| 8626 <td></td> | |
| 8627 <td></td> | |
| 8628 <td></td> | |
| 8629 </tr><tr class=""> | |
| 8630 <th scope="row">dataMatrix_in</th> | |
| 8631 <td>9a0ce47bd1734ae7</td> | |
| 8632 <td>peaklist_fragments.tsv</td> | |
| 8633 <td>tabular</td> | |
| 8634 <td>42</td> | |
| 8635 </tr><tr class=""> | |
| 8636 <th scope="row">file_in</th> | |
| 8637 <td>9a0ce47bd1734ae7</td> | |
| 8638 <td>peaklist_fragments.tsv</td> | |
| 8639 <td>tabular</td> | |
| 8640 <td>42</td> | |
| 8641 </tr><tr class=""> | |
| 8642 <th scope="row">mass_file_in</th> | |
| 8643 <td>9a0ce47bd1734ae7</td> | |
| 8644 <td>peaklist_fragments.tsv</td> | |
| 8645 <td>tabular</td> | |
| 8646 <td>42</td> | |
| 8647 </tr><tr class=""> | |
| 8648 <th scope="row">mass_list</th> | |
| 8649 <td>true</td> | |
| 8650 <td></td> | |
| 8651 <td></td> | |
| 8652 <td></td> | |
| 8653 </tr><tr class=""> | |
| 8654 <th scope="row">mass_choice</th> | |
| 8655 <td>true</td> | |
| 8656 <td></td> | |
| 8657 <td></td> | |
| 8658 <td></td> | |
| 8659 </tr><tr class=""> | |
| 8660 <th scope="row">mass_threshold</th> | |
| 8661 <td>0.005</td> | |
| 8662 <td></td> | |
| 8663 <td></td> | |
| 8664 <td></td> | |
| 8665 </tr><tr class=""> | |
| 8666 <th scope="row">repres_opt_selector</th> | |
| 8667 <td>intensity</td> | |
| 8668 <td></td> | |
| 8669 <td></td> | |
| 8670 <td></td> | |
| 8671 </tr><tr class=""> | |
| 8672 <th scope="row">rt_choice</th> | |
| 8673 <td>true</td> | |
| 8674 <td></td> | |
| 8675 <td></td> | |
| 8676 <td></td> | |
| 8677 </tr><tr class=""> | |
| 8678 <th scope="row">rt_threshold</th> | |
| 8679 <td>0.1</td> | |
| 8680 <td></td> | |
| 8681 <td></td> | |
| 8682 <td></td> | |
| 8683 </tr><tr class=""> | |
| 8684 <th scope="row">variableMetadata_in</th> | |
| 8685 <td>9a0ce47bd1734ae7</td> | |
| 8686 <td>peaklist_fragments.tsv</td> | |
| 8687 <td>tabular</td> | |
| 8688 <td>42</td> | |
| 8689 </tr> | |
| 8690 </table> | |
| 8691 </div> | |
| 8692 | |
| 8693 | |
| 8694 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 8695 <h2 | |
| 8696 class="history_metadata_extractor_h2" | |
| 8697 style="cursor: pointer" | |
| 8698 title="click to fold/unfold the table" | |
| 8699 > | |
| 8700 [DELETED] - correlation_analysis - 1.0.1+galaxy0 | |
| 8701 </h2> | |
| 8702 <p> | |
| 8703 Outputs: | |
| 8704 </p> | |
| 8705 <p class="history_metadata_extractor_status"> | |
| 8706 Status: Failed (1) | |
| 8707 </p> | |
| 8708 <p class="history_metadata_extractor_glitter"></p> | |
| 8709 <table class=" | |
| 8710 table | |
| 8711 table-bordered | |
| 8712 table-dark | |
| 8713 table-striped | |
| 8714 table-hover | |
| 8715 d-block | |
| 8716 overflow-auto | |
| 8717 history_metadata_extractor_table | |
| 8718 "> | |
| 8719 <thead> | |
| 8720 <tr> | |
| 8721 <th scope="col"></th> | |
| 8722 <th scope="col">value</th> | |
| 8723 <th scope="col">name</th> | |
| 8724 <th scope="col">extension</th> | |
| 8725 <th scope="col">hid</th> | |
| 8726 </tr> | |
| 8727 </thead> | |
| 8728 <tr class=""> | |
| 8729 <th scope="row">select_funtion</th> | |
| 8730 <td>sort_only</td> | |
| 8731 <td></td> | |
| 8732 <td></td> | |
| 8733 <td></td> | |
| 8734 </tr><tr class=""> | |
| 8735 <th scope="row">dataMatrix</th> | |
| 8736 <td>7cf499d16bd542b2</td> | |
| 8737 <td>compounds_pos.txt</td> | |
| 8738 <td>tabular</td> | |
| 8739 <td>44</td> | |
| 8740 </tr><tr class=""> | |
| 8741 <th scope="row">sampleMetadata</th> | |
| 8742 <td>7cf499d16bd542b2</td> | |
| 8743 <td>compounds_pos.txt</td> | |
| 8744 <td>tabular</td> | |
| 8745 <td>44</td> | |
| 8746 </tr><tr class=""> | |
| 8747 <th scope="row">select_input_type</th> | |
| 8748 <td>select_input_from_w4m</td> | |
| 8749 <td></td> | |
| 8750 <td></td> | |
| 8751 <td></td> | |
| 8752 </tr><tr class=""> | |
| 8753 <th scope="row">variableMetadata</th> | |
| 8754 <td>7cf499d16bd542b2</td> | |
| 8755 <td>compounds_pos.txt</td> | |
| 8756 <td>tabular</td> | |
| 8757 <td>44</td> | |
| 8758 </tr> | |
| 8759 </table> | |
| 8760 </div> | |
| 8761 | |
| 8762 | |
| 8763 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 8764 <h2 | |
| 8765 class="history_metadata_extractor_h2" | |
| 8766 style="cursor: pointer" | |
| 8767 title="click to fold/unfold the table" | |
| 8768 > | |
| 8769 [DELETED] - Transformation - 2.2.0 | |
| 8770 </h2> | |
| 8771 <p> | |
| 8772 Outputs: | |
| 8773 </p> | |
| 8774 <p class="history_metadata_extractor_status"> | |
| 8775 Status: Failed (1) | |
| 8776 </p> | |
| 8777 <p class="history_metadata_extractor_glitter"></p> | |
| 8778 <table class=" | |
| 8779 table | |
| 8780 table-bordered | |
| 8781 table-dark | |
| 8782 table-striped | |
| 8783 table-hover | |
| 8784 d-block | |
| 8785 overflow-auto | |
| 8786 history_metadata_extractor_table | |
| 8787 "> | |
| 8788 <thead> | |
| 8789 <tr> | |
| 8790 <th scope="col"></th> | |
| 8791 <th scope="col">value</th> | |
| 8792 <th scope="col">name</th> | |
| 8793 <th scope="col">extension</th> | |
| 8794 <th scope="col">hid</th> | |
| 8795 </tr> | |
| 8796 </thead> | |
| 8797 <tr class=""> | |
| 8798 <th scope="row">dataMatrix_in</th> | |
| 8799 <td>9a0ce47bd1734ae7</td> | |
| 8800 <td>peaklist_fragments.tsv</td> | |
| 8801 <td>tabular</td> | |
| 8802 <td>42</td> | |
| 8803 </tr><tr class=""> | |
| 8804 <th scope="row">method</th> | |
| 8805 <td>log2</td> | |
| 8806 <td></td> | |
| 8807 <td></td> | |
| 8808 <td></td> | |
| 8809 </tr> | |
| 8810 </table> | |
| 8811 </div> | |
| 8812 | |
| 8813 | |
| 8814 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 8815 <h2 | |
| 8816 class="history_metadata_extractor_h2" | |
| 8817 style="cursor: pointer" | |
| 8818 title="click to fold/unfold the table" | |
| 8819 > | |
| 8820 [DELETED] - Transformation - 2.2.0 | |
| 8821 </h2> | |
| 8822 <p> | |
| 8823 Outputs: | |
| 8824 </p> | |
| 8825 <p class="history_metadata_extractor_status"> | |
| 8826 Status: Failed (1) | |
| 8827 </p> | |
| 8828 <p class="history_metadata_extractor_glitter"></p> | |
| 8829 <table class=" | |
| 8830 table | |
| 8831 table-bordered | |
| 8832 table-dark | |
| 8833 table-striped | |
| 8834 table-hover | |
| 8835 d-block | |
| 8836 overflow-auto | |
| 8837 history_metadata_extractor_table | |
| 8838 "> | |
| 8839 <thead> | |
| 8840 <tr> | |
| 8841 <th scope="col"></th> | |
| 8842 <th scope="col">value</th> | |
| 8843 <th scope="col">name</th> | |
| 8844 <th scope="col">extension</th> | |
| 8845 <th scope="col">hid</th> | |
| 8846 </tr> | |
| 8847 </thead> | |
| 8848 <tr class=""> | |
| 8849 <th scope="row">dataMatrix_in</th> | |
| 8850 <td>9a0ce47bd1734ae7</td> | |
| 8851 <td>peaklist_fragments.tsv</td> | |
| 8852 <td>tabular</td> | |
| 8853 <td>42</td> | |
| 8854 </tr><tr class=""> | |
| 8855 <th scope="row">method</th> | |
| 8856 <td>log2</td> | |
| 8857 <td></td> | |
| 8858 <td></td> | |
| 8859 <td></td> | |
| 8860 </tr> | |
| 8861 </table> | |
| 8862 </div> | |
| 8863 | |
| 8864 | |
| 8865 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 8866 <h2 | |
| 8867 class="history_metadata_extractor_h2" | |
| 8868 style="cursor: pointer" | |
| 8869 title="click to fold/unfold the table" | |
| 8870 > | |
| 8871 [DELETED] - normalization - 1.0.7 | |
| 8872 </h2> | |
| 8873 <p> | |
| 8874 Outputs: | |
| 8875 </p> | |
| 8876 <p class="history_metadata_extractor_status"> | |
| 8877 Status: Failed (1) | |
| 8878 </p> | |
| 8879 <p class="history_metadata_extractor_glitter"></p> | |
| 8880 <table class=" | |
| 8881 table | |
| 8882 table-bordered | |
| 8883 table-dark | |
| 8884 table-striped | |
| 8885 table-hover | |
| 8886 d-block | |
| 8887 overflow-auto | |
| 8888 history_metadata_extractor_table | |
| 8889 "> | |
| 8890 <thead> | |
| 8891 <tr> | |
| 8892 <th scope="col"></th> | |
| 8893 <th scope="col">value</th> | |
| 8894 <th scope="col">name</th> | |
| 8895 <th scope="col">extension</th> | |
| 8896 <th scope="col">hid</th> | |
| 8897 </tr> | |
| 8898 </thead> | |
| 8899 <tr class=""> | |
| 8900 <th scope="row">dataMatrix</th> | |
| 8901 <td>9a0ce47bd1734ae7</td> | |
| 8902 <td>peaklist_fragments.tsv</td> | |
| 8903 <td>tabular</td> | |
| 8904 <td>42</td> | |
| 8905 </tr><tr class=""> | |
| 8906 <th scope="row">graphType</th> | |
| 8907 <td>None</td> | |
| 8908 <td></td> | |
| 8909 <td></td> | |
| 8910 <td></td> | |
| 8911 </tr><tr class=""> | |
| 8912 <th scope="row">method</th> | |
| 8913 <td>None</td> | |
| 8914 <td></td> | |
| 8915 <td></td> | |
| 8916 <td></td> | |
| 8917 </tr> | |
| 8918 </table> | |
| 8919 </div> | |
| 8920 | |
| 8921 | |
| 8922 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 8923 <h2 | |
| 8924 class="history_metadata_extractor_h2" | |
| 8925 style="cursor: pointer" | |
| 8926 title="click to fold/unfold the table" | |
| 8927 > | |
| 8928 [DELETED] - normalization - 1.0.7 | |
| 8929 </h2> | |
| 8930 <p> | |
| 8931 Outputs: | |
| 8932 </p> | |
| 8933 <p class="history_metadata_extractor_status"> | |
| 8934 Status: Failed (1) | |
| 8935 </p> | |
| 8936 <p class="history_metadata_extractor_glitter"></p> | |
| 8937 <table class=" | |
| 8938 table | |
| 8939 table-bordered | |
| 8940 table-dark | |
| 8941 table-striped | |
| 8942 table-hover | |
| 8943 d-block | |
| 8944 overflow-auto | |
| 8945 history_metadata_extractor_table | |
| 8946 "> | |
| 8947 <thead> | |
| 8948 <tr> | |
| 8949 <th scope="col"></th> | |
| 8950 <th scope="col">value</th> | |
| 8951 <th scope="col">name</th> | |
| 8952 <th scope="col">extension</th> | |
| 8953 <th scope="col">hid</th> | |
| 8954 </tr> | |
| 8955 </thead> | |
| 8956 <tr class=""> | |
| 8957 <th scope="row">dataMatrix</th> | |
| 8958 <td>9a0ce47bd1734ae7</td> | |
| 8959 <td>peaklist_fragments.tsv</td> | |
| 8960 <td>tabular</td> | |
| 8961 <td>42</td> | |
| 8962 </tr><tr class=""> | |
| 8963 <th scope="row">graphType</th> | |
| 8964 <td>None</td> | |
| 8965 <td></td> | |
| 8966 <td></td> | |
| 8967 <td></td> | |
| 8968 </tr><tr class=""> | |
| 8969 <th scope="row">method</th> | |
| 8970 <td>None</td> | |
| 8971 <td></td> | |
| 8972 <td></td> | |
| 8973 <td></td> | |
| 8974 </tr> | |
| 8975 </table> | |
| 8976 </div> | |
| 8977 | |
| 8978 | |
| 8979 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 8980 <h2 | |
| 8981 class="history_metadata_extractor_h2" | |
| 8982 style="cursor: pointer" | |
| 8983 title="click to fold/unfold the table" | |
| 8984 > | |
| 8985 [DELETED] - Determine_BC - 3.0.0 | |
| 8986 </h2> | |
| 8987 <p> | |
| 8988 Outputs: | |
| 8989 </p> | |
| 8990 <p class="history_metadata_extractor_status"> | |
| 8991 Status: Failed (1) | |
| 8992 </p> | |
| 8993 <p class="history_metadata_extractor_glitter"></p> | |
| 8994 <table class=" | |
| 8995 table | |
| 8996 table-bordered | |
| 8997 table-dark | |
| 8998 table-striped | |
| 8999 table-hover | |
| 9000 d-block | |
| 9001 overflow-auto | |
| 9002 history_metadata_extractor_table | |
| 9003 "> | |
| 9004 <thead> | |
| 9005 <tr> | |
| 9006 <th scope="col"></th> | |
| 9007 <th scope="col">value</th> | |
| 9008 <th scope="col">name</th> | |
| 9009 <th scope="col">extension</th> | |
| 9010 <th scope="col">hid</th> | |
| 9011 </tr> | |
| 9012 </thead> | |
| 9013 <tr class=""> | |
| 9014 <th scope="row">option</th> | |
| 9015 <td>hide</td> | |
| 9016 <td></td> | |
| 9017 <td></td> | |
| 9018 <td></td> | |
| 9019 </tr><tr class=""> | |
| 9020 <th scope="row">dataMatrix</th> | |
| 9021 <td>9a0ce47bd1734ae7</td> | |
| 9022 <td>peaklist_fragments.tsv</td> | |
| 9023 <td>tabular</td> | |
| 9024 <td>42</td> | |
| 9025 </tr><tr class=""> | |
| 9026 <th scope="row">ref_factor</th> | |
| 9027 <td>batch</td> | |
| 9028 <td></td> | |
| 9029 <td></td> | |
| 9030 <td></td> | |
| 9031 </tr><tr class=""> | |
| 9032 <th scope="row">sampleMetadata</th> | |
| 9033 <td>9a0ce47bd1734ae7</td> | |
| 9034 <td>peaklist_fragments.tsv</td> | |
| 9035 <td>tabular</td> | |
| 9036 <td>42</td> | |
| 9037 </tr><tr class=""> | |
| 9038 <th scope="row">batch_col_name</th> | |
| 9039 <td>batch</td> | |
| 9040 <td></td> | |
| 9041 <td></td> | |
| 9042 <td></td> | |
| 9043 </tr><tr class=""> | |
| 9044 <th scope="row">injection_order_col_name</th> | |
| 9045 <td>injectionOrder</td> | |
| 9046 <td></td> | |
| 9047 <td></td> | |
| 9048 <td></td> | |
| 9049 </tr><tr class=""> | |
| 9050 <th scope="row">sampleTypeTagBlank</th> | |
| 9051 <td>blank</td> | |
| 9052 <td></td> | |
| 9053 <td></td> | |
| 9054 <td></td> | |
| 9055 </tr><tr class=""> | |
| 9056 <th scope="row">sampleTypeTagPool</th> | |
| 9057 <td>pool</td> | |
| 9058 <td></td> | |
| 9059 <td></td> | |
| 9060 <td></td> | |
| 9061 </tr><tr class=""> | |
| 9062 <th scope="row">sampleTypeTagSample</th> | |
| 9063 <td>sample</td> | |
| 9064 <td></td> | |
| 9065 <td></td> | |
| 9066 <td></td> | |
| 9067 </tr><tr class=""> | |
| 9068 <th scope="row">sample_type_col_name</th> | |
| 9069 <td>sampleType</td> | |
| 9070 <td></td> | |
| 9071 <td></td> | |
| 9072 <td></td> | |
| 9073 </tr> | |
| 9074 </table> | |
| 9075 </div> | |
| 9076 | |
| 9077 | |
| 9078 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 9079 <h2 | |
| 9080 class="history_metadata_extractor_h2" | |
| 9081 style="cursor: pointer" | |
| 9082 title="click to fold/unfold the table" | |
| 9083 > | |
| 9084 [DELETED] - Determine_BC - 3.0.0 | |
| 9085 </h2> | |
| 9086 <p> | |
| 9087 Outputs: | |
| 9088 </p> | |
| 9089 <p class="history_metadata_extractor_status"> | |
| 9090 Status: Failed (1) | |
| 9091 </p> | |
| 9092 <p class="history_metadata_extractor_glitter"></p> | |
| 9093 <table class=" | |
| 9094 table | |
| 9095 table-bordered | |
| 9096 table-dark | |
| 9097 table-striped | |
| 9098 table-hover | |
| 9099 d-block | |
| 9100 overflow-auto | |
| 9101 history_metadata_extractor_table | |
| 9102 "> | |
| 9103 <thead> | |
| 9104 <tr> | |
| 9105 <th scope="col"></th> | |
| 9106 <th scope="col">value</th> | |
| 9107 <th scope="col">name</th> | |
| 9108 <th scope="col">extension</th> | |
| 9109 <th scope="col">hid</th> | |
| 9110 </tr> | |
| 9111 </thead> | |
| 9112 <tr class=""> | |
| 9113 <th scope="row">option</th> | |
| 9114 <td>hide</td> | |
| 9115 <td></td> | |
| 9116 <td></td> | |
| 9117 <td></td> | |
| 9118 </tr><tr class=""> | |
| 9119 <th scope="row">dataMatrix</th> | |
| 9120 <td>9a0ce47bd1734ae7</td> | |
| 9121 <td>peaklist_fragments.tsv</td> | |
| 9122 <td>tabular</td> | |
| 9123 <td>42</td> | |
| 9124 </tr><tr class=""> | |
| 9125 <th scope="row">ref_factor</th> | |
| 9126 <td>batch</td> | |
| 9127 <td></td> | |
| 9128 <td></td> | |
| 9129 <td></td> | |
| 9130 </tr><tr class=""> | |
| 9131 <th scope="row">sampleMetadata</th> | |
| 9132 <td>9a0ce47bd1734ae7</td> | |
| 9133 <td>peaklist_fragments.tsv</td> | |
| 9134 <td>tabular</td> | |
| 9135 <td>42</td> | |
| 9136 </tr><tr class=""> | |
| 9137 <th scope="row">batch_col_name</th> | |
| 9138 <td>batch</td> | |
| 9139 <td></td> | |
| 9140 <td></td> | |
| 9141 <td></td> | |
| 9142 </tr><tr class=""> | |
| 9143 <th scope="row">injection_order_col_name</th> | |
| 9144 <td>injectionOrder</td> | |
| 9145 <td></td> | |
| 9146 <td></td> | |
| 9147 <td></td> | |
| 9148 </tr><tr class=""> | |
| 9149 <th scope="row">sampleTypeTagBlank</th> | |
| 9150 <td>blank</td> | |
| 9151 <td></td> | |
| 9152 <td></td> | |
| 9153 <td></td> | |
| 9154 </tr><tr class=""> | |
| 9155 <th scope="row">sampleTypeTagPool</th> | |
| 9156 <td>pool</td> | |
| 9157 <td></td> | |
| 9158 <td></td> | |
| 9159 <td></td> | |
| 9160 </tr><tr class=""> | |
| 9161 <th scope="row">sampleTypeTagSample</th> | |
| 9162 <td>sample</td> | |
| 9163 <td></td> | |
| 9164 <td></td> | |
| 9165 <td></td> | |
| 9166 </tr><tr class=""> | |
| 9167 <th scope="row">sample_type_col_name</th> | |
| 9168 <td>sampleType</td> | |
| 9169 <td></td> | |
| 9170 <td></td> | |
| 9171 <td></td> | |
| 9172 </tr> | |
| 9173 </table> | |
| 9174 </div> | |
| 9175 | |
| 9176 | |
| 9177 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 9178 <h2 | |
| 9179 class="history_metadata_extractor_h2" | |
| 9180 style="cursor: pointer" | |
| 9181 title="click to fold/unfold the table" | |
| 9182 > | |
| 9183 [DELETED] - Batch_correction - 3.0.0 | |
| 9184 </h2> | |
| 9185 <p> | |
| 9186 Outputs: | |
| 9187 </p> | |
| 9188 <p class="history_metadata_extractor_status"> | |
| 9189 Status: Failed (127) | |
| 9190 </p> | |
| 9191 <p class="history_metadata_extractor_glitter"></p> | |
| 9192 <table class=" | |
| 9193 table | |
| 9194 table-bordered | |
| 9195 table-dark | |
| 9196 table-striped | |
| 9197 table-hover | |
| 9198 d-block | |
| 9199 overflow-auto | |
| 9200 history_metadata_extractor_table | |
| 9201 "> | |
| 9202 <thead> | |
| 9203 <tr> | |
| 9204 <th scope="col"></th> | |
| 9205 <th scope="col">value</th> | |
| 9206 <th scope="col">name</th> | |
| 9207 <th scope="col">extension</th> | |
| 9208 <th scope="col">hid</th> | |
| 9209 </tr> | |
| 9210 </thead> | |
| 9211 <tr class=""> | |
| 9212 <th scope="row">dataMatrix</th> | |
| 9213 <td>9a0ce47bd1734ae7</td> | |
| 9214 <td>peaklist_fragments.tsv</td> | |
| 9215 <td>tabular</td> | |
| 9216 <td>42</td> | |
| 9217 </tr><tr class=""> | |
| 9218 <th scope="row">sampleMetadata</th> | |
| 9219 <td>9a0ce47bd1734ae7</td> | |
| 9220 <td>peaklist_fragments.tsv</td> | |
| 9221 <td>tabular</td> | |
| 9222 <td>42</td> | |
| 9223 </tr><tr class=""> | |
| 9224 <th scope="row">batch_col_name</th> | |
| 9225 <td>batch</td> | |
| 9226 <td></td> | |
| 9227 <td></td> | |
| 9228 <td></td> | |
| 9229 </tr><tr class=""> | |
| 9230 <th scope="row">injection_order_col_name</th> | |
| 9231 <td>injectionOrder</td> | |
| 9232 <td></td> | |
| 9233 <td></td> | |
| 9234 <td></td> | |
| 9235 </tr><tr class=""> | |
| 9236 <th scope="row">sampleTypeTagBlank</th> | |
| 9237 <td>blank</td> | |
| 9238 <td></td> | |
| 9239 <td></td> | |
| 9240 <td></td> | |
| 9241 </tr><tr class=""> | |
| 9242 <th scope="row">sampleTypeTagPool</th> | |
| 9243 <td>pool</td> | |
| 9244 <td></td> | |
| 9245 <td></td> | |
| 9246 <td></td> | |
| 9247 </tr><tr class=""> | |
| 9248 <th scope="row">sampleTypeTagSample</th> | |
| 9249 <td>sample</td> | |
| 9250 <td></td> | |
| 9251 <td></td> | |
| 9252 <td></td> | |
| 9253 </tr><tr class=""> | |
| 9254 <th scope="row">sample_type_col_name</th> | |
| 9255 <td>sampleType</td> | |
| 9256 <td></td> | |
| 9257 <td></td> | |
| 9258 <td></td> | |
| 9259 </tr><tr class=""> | |
| 9260 <th scope="row">detail</th> | |
| 9261 <td>no</td> | |
| 9262 <td></td> | |
| 9263 <td></td> | |
| 9264 <td></td> | |
| 9265 </tr><tr class=""> | |
| 9266 <th scope="row">method</th> | |
| 9267 <td>linear</td> | |
| 9268 <td></td> | |
| 9269 <td></td> | |
| 9270 <td></td> | |
| 9271 </tr><tr class=""> | |
| 9272 <th scope="row">ref_factor</th> | |
| 9273 <td>batch</td> | |
| 9274 <td></td> | |
| 9275 <td></td> | |
| 9276 <td></td> | |
| 9277 </tr><tr class=""> | |
| 9278 <th scope="row">valnull</th> | |
| 9279 <td>none</td> | |
| 9280 <td></td> | |
| 9281 <td></td> | |
| 9282 <td></td> | |
| 9283 </tr><tr class=""> | |
| 9284 <th scope="row">variableMetadata</th> | |
| 9285 <td>9a0ce47bd1734ae7</td> | |
| 9286 <td>peaklist_fragments.tsv</td> | |
| 9287 <td>tabular</td> | |
| 9288 <td>42</td> | |
| 9289 </tr> | |
| 9290 </table> | |
| 9291 </div> | |
| 9292 | |
| 9293 | |
| 9294 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 9295 <h2 | |
| 9296 class="history_metadata_extractor_h2" | |
| 9297 style="cursor: pointer" | |
| 9298 title="click to fold/unfold the table" | |
| 9299 > | |
| 9300 [DELETED] - Batch_correction - 3.0.0 | |
| 9301 </h2> | |
| 9302 <p> | |
| 9303 Outputs: | |
| 9304 </p> | |
| 9305 <p class="history_metadata_extractor_status"> | |
| 9306 Status: Failed (127) | |
| 9307 </p> | |
| 9308 <p class="history_metadata_extractor_glitter"></p> | |
| 9309 <table class=" | |
| 9310 table | |
| 9311 table-bordered | |
| 9312 table-dark | |
| 9313 table-striped | |
| 9314 table-hover | |
| 9315 d-block | |
| 9316 overflow-auto | |
| 9317 history_metadata_extractor_table | |
| 9318 "> | |
| 9319 <thead> | |
| 9320 <tr> | |
| 9321 <th scope="col"></th> | |
| 9322 <th scope="col">value</th> | |
| 9323 <th scope="col">name</th> | |
| 9324 <th scope="col">extension</th> | |
| 9325 <th scope="col">hid</th> | |
| 9326 </tr> | |
| 9327 </thead> | |
| 9328 <tr class=""> | |
| 9329 <th scope="row">dataMatrix</th> | |
| 9330 <td>9a0ce47bd1734ae7</td> | |
| 9331 <td>peaklist_fragments.tsv</td> | |
| 9332 <td>tabular</td> | |
| 9333 <td>42</td> | |
| 9334 </tr><tr class=""> | |
| 9335 <th scope="row">sampleMetadata</th> | |
| 9336 <td>9a0ce47bd1734ae7</td> | |
| 9337 <td>peaklist_fragments.tsv</td> | |
| 9338 <td>tabular</td> | |
| 9339 <td>42</td> | |
| 9340 </tr><tr class=""> | |
| 9341 <th scope="row">batch_col_name</th> | |
| 9342 <td>batch</td> | |
| 9343 <td></td> | |
| 9344 <td></td> | |
| 9345 <td></td> | |
| 9346 </tr><tr class=""> | |
| 9347 <th scope="row">injection_order_col_name</th> | |
| 9348 <td>injectionOrder</td> | |
| 9349 <td></td> | |
| 9350 <td></td> | |
| 9351 <td></td> | |
| 9352 </tr><tr class=""> | |
| 9353 <th scope="row">sampleTypeTagBlank</th> | |
| 9354 <td>blank</td> | |
| 9355 <td></td> | |
| 9356 <td></td> | |
| 9357 <td></td> | |
| 9358 </tr><tr class=""> | |
| 9359 <th scope="row">sampleTypeTagPool</th> | |
| 9360 <td>pool</td> | |
| 9361 <td></td> | |
| 9362 <td></td> | |
| 9363 <td></td> | |
| 9364 </tr><tr class=""> | |
| 9365 <th scope="row">sampleTypeTagSample</th> | |
| 9366 <td>sample</td> | |
| 9367 <td></td> | |
| 9368 <td></td> | |
| 9369 <td></td> | |
| 9370 </tr><tr class=""> | |
| 9371 <th scope="row">sample_type_col_name</th> | |
| 9372 <td>sampleType</td> | |
| 9373 <td></td> | |
| 9374 <td></td> | |
| 9375 <td></td> | |
| 9376 </tr><tr class=""> | |
| 9377 <th scope="row">detail</th> | |
| 9378 <td>no</td> | |
| 9379 <td></td> | |
| 9380 <td></td> | |
| 9381 <td></td> | |
| 9382 </tr><tr class=""> | |
| 9383 <th scope="row">method</th> | |
| 9384 <td>linear</td> | |
| 9385 <td></td> | |
| 9386 <td></td> | |
| 9387 <td></td> | |
| 9388 </tr><tr class=""> | |
| 9389 <th scope="row">ref_factor</th> | |
| 9390 <td>batch</td> | |
| 9391 <td></td> | |
| 9392 <td></td> | |
| 9393 <td></td> | |
| 9394 </tr><tr class=""> | |
| 9395 <th scope="row">valnull</th> | |
| 9396 <td>none</td> | |
| 9397 <td></td> | |
| 9398 <td></td> | |
| 9399 <td></td> | |
| 9400 </tr><tr class=""> | |
| 9401 <th scope="row">variableMetadata</th> | |
| 9402 <td>9a0ce47bd1734ae7</td> | |
| 9403 <td>peaklist_fragments.tsv</td> | |
| 9404 <td>tabular</td> | |
| 9405 <td>42</td> | |
| 9406 </tr> | |
| 9407 </table> | |
| 9408 </div> | |
| 9409 | |
| 9410 | |
| 9411 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 9412 <h2 | |
| 9413 class="history_metadata_extractor_h2" | |
| 9414 style="cursor: pointer" | |
| 9415 title="click to fold/unfold the table" | |
| 9416 > | |
| 9417 [DELETED] - Batch_correction - 3.0.0 | |
| 9418 </h2> | |
| 9419 <p> | |
| 9420 Outputs: | |
| 9421 </p> | |
| 9422 <p class="history_metadata_extractor_status"> | |
| 9423 Status: Failed (127) | |
| 9424 </p> | |
| 9425 <p class="history_metadata_extractor_glitter"></p> | |
| 9426 <table class=" | |
| 9427 table | |
| 9428 table-bordered | |
| 9429 table-dark | |
| 9430 table-striped | |
| 9431 table-hover | |
| 9432 d-block | |
| 9433 overflow-auto | |
| 9434 history_metadata_extractor_table | |
| 9435 "> | |
| 9436 <thead> | |
| 9437 <tr> | |
| 9438 <th scope="col"></th> | |
| 9439 <th scope="col">value</th> | |
| 9440 <th scope="col">name</th> | |
| 9441 <th scope="col">extension</th> | |
| 9442 <th scope="col">hid</th> | |
| 9443 </tr> | |
| 9444 </thead> | |
| 9445 <tr class=""> | |
| 9446 <th scope="row">dataMatrix</th> | |
| 9447 <td>9a0ce47bd1734ae7</td> | |
| 9448 <td>peaklist_fragments.tsv</td> | |
| 9449 <td>tabular</td> | |
| 9450 <td>42</td> | |
| 9451 </tr><tr class=""> | |
| 9452 <th scope="row">sampleMetadata</th> | |
| 9453 <td>9a0ce47bd1734ae7</td> | |
| 9454 <td>peaklist_fragments.tsv</td> | |
| 9455 <td>tabular</td> | |
| 9456 <td>42</td> | |
| 9457 </tr><tr class=""> | |
| 9458 <th scope="row">batch_col_name</th> | |
| 9459 <td>batch</td> | |
| 9460 <td></td> | |
| 9461 <td></td> | |
| 9462 <td></td> | |
| 9463 </tr><tr class=""> | |
| 9464 <th scope="row">injection_order_col_name</th> | |
| 9465 <td>injectionOrder</td> | |
| 9466 <td></td> | |
| 9467 <td></td> | |
| 9468 <td></td> | |
| 9469 </tr><tr class=""> | |
| 9470 <th scope="row">sampleTypeTagBlank</th> | |
| 9471 <td>blank</td> | |
| 9472 <td></td> | |
| 9473 <td></td> | |
| 9474 <td></td> | |
| 9475 </tr><tr class=""> | |
| 9476 <th scope="row">sampleTypeTagPool</th> | |
| 9477 <td>pool</td> | |
| 9478 <td></td> | |
| 9479 <td></td> | |
| 9480 <td></td> | |
| 9481 </tr><tr class=""> | |
| 9482 <th scope="row">sampleTypeTagSample</th> | |
| 9483 <td>sample</td> | |
| 9484 <td></td> | |
| 9485 <td></td> | |
| 9486 <td></td> | |
| 9487 </tr><tr class=""> | |
| 9488 <th scope="row">sample_type_col_name</th> | |
| 9489 <td>sampleType</td> | |
| 9490 <td></td> | |
| 9491 <td></td> | |
| 9492 <td></td> | |
| 9493 </tr><tr class=""> | |
| 9494 <th scope="row">detail</th> | |
| 9495 <td>no</td> | |
| 9496 <td></td> | |
| 9497 <td></td> | |
| 9498 <td></td> | |
| 9499 </tr><tr class=""> | |
| 9500 <th scope="row">method</th> | |
| 9501 <td>linear</td> | |
| 9502 <td></td> | |
| 9503 <td></td> | |
| 9504 <td></td> | |
| 9505 </tr><tr class=""> | |
| 9506 <th scope="row">ref_factor</th> | |
| 9507 <td>batch</td> | |
| 9508 <td></td> | |
| 9509 <td></td> | |
| 9510 <td></td> | |
| 9511 </tr><tr class=""> | |
| 9512 <th scope="row">valnull</th> | |
| 9513 <td>none</td> | |
| 9514 <td></td> | |
| 9515 <td></td> | |
| 9516 <td></td> | |
| 9517 </tr><tr class=""> | |
| 9518 <th scope="row">variableMetadata</th> | |
| 9519 <td>9a0ce47bd1734ae7</td> | |
| 9520 <td>peaklist_fragments.tsv</td> | |
| 9521 <td>tabular</td> | |
| 9522 <td>42</td> | |
| 9523 </tr> | |
| 9524 </table> | |
| 9525 </div> | |
| 9526 | |
| 9527 | |
| 9528 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 9529 <h2 | |
| 9530 class="history_metadata_extractor_h2" | |
| 9531 style="cursor: pointer" | |
| 9532 title="click to fold/unfold the table" | |
| 9533 > | |
| 9534 [DELETED] - Batch_correction - 3.0.0 | |
| 9535 </h2> | |
| 9536 <p> | |
| 9537 Outputs: | |
| 9538 </p> | |
| 9539 <p class="history_metadata_extractor_status"> | |
| 9540 Status: Failed (127) | |
| 9541 </p> | |
| 9542 <p class="history_metadata_extractor_glitter"></p> | |
| 9543 <table class=" | |
| 9544 table | |
| 9545 table-bordered | |
| 9546 table-dark | |
| 9547 table-striped | |
| 9548 table-hover | |
| 9549 d-block | |
| 9550 overflow-auto | |
| 9551 history_metadata_extractor_table | |
| 9552 "> | |
| 9553 <thead> | |
| 9554 <tr> | |
| 9555 <th scope="col"></th> | |
| 9556 <th scope="col">value</th> | |
| 9557 <th scope="col">name</th> | |
| 9558 <th scope="col">extension</th> | |
| 9559 <th scope="col">hid</th> | |
| 9560 </tr> | |
| 9561 </thead> | |
| 9562 <tr class=""> | |
| 9563 <th scope="row">dataMatrix</th> | |
| 9564 <td>9a0ce47bd1734ae7</td> | |
| 9565 <td>peaklist_fragments.tsv</td> | |
| 9566 <td>tabular</td> | |
| 9567 <td>42</td> | |
| 9568 </tr><tr class=""> | |
| 9569 <th scope="row">sampleMetadata</th> | |
| 9570 <td>9a0ce47bd1734ae7</td> | |
| 9571 <td>peaklist_fragments.tsv</td> | |
| 9572 <td>tabular</td> | |
| 9573 <td>42</td> | |
| 9574 </tr><tr class=""> | |
| 9575 <th scope="row">batch_col_name</th> | |
| 9576 <td>batch</td> | |
| 9577 <td></td> | |
| 9578 <td></td> | |
| 9579 <td></td> | |
| 9580 </tr><tr class=""> | |
| 9581 <th scope="row">injection_order_col_name</th> | |
| 9582 <td>injectionOrder</td> | |
| 9583 <td></td> | |
| 9584 <td></td> | |
| 9585 <td></td> | |
| 9586 </tr><tr class=""> | |
| 9587 <th scope="row">sampleTypeTagBlank</th> | |
| 9588 <td>blank</td> | |
| 9589 <td></td> | |
| 9590 <td></td> | |
| 9591 <td></td> | |
| 9592 </tr><tr class=""> | |
| 9593 <th scope="row">sampleTypeTagPool</th> | |
| 9594 <td>pool</td> | |
| 9595 <td></td> | |
| 9596 <td></td> | |
| 9597 <td></td> | |
| 9598 </tr><tr class=""> | |
| 9599 <th scope="row">sampleTypeTagSample</th> | |
| 9600 <td>sample</td> | |
| 9601 <td></td> | |
| 9602 <td></td> | |
| 9603 <td></td> | |
| 9604 </tr><tr class=""> | |
| 9605 <th scope="row">sample_type_col_name</th> | |
| 9606 <td>sampleType</td> | |
| 9607 <td></td> | |
| 9608 <td></td> | |
| 9609 <td></td> | |
| 9610 </tr><tr class=""> | |
| 9611 <th scope="row">detail</th> | |
| 9612 <td>no</td> | |
| 9613 <td></td> | |
| 9614 <td></td> | |
| 9615 <td></td> | |
| 9616 </tr><tr class=""> | |
| 9617 <th scope="row">method</th> | |
| 9618 <td>linear</td> | |
| 9619 <td></td> | |
| 9620 <td></td> | |
| 9621 <td></td> | |
| 9622 </tr><tr class=""> | |
| 9623 <th scope="row">ref_factor</th> | |
| 9624 <td>batch</td> | |
| 9625 <td></td> | |
| 9626 <td></td> | |
| 9627 <td></td> | |
| 9628 </tr><tr class=""> | |
| 9629 <th scope="row">valnull</th> | |
| 9630 <td>none</td> | |
| 9631 <td></td> | |
| 9632 <td></td> | |
| 9633 <td></td> | |
| 9634 </tr><tr class=""> | |
| 9635 <th scope="row">variableMetadata</th> | |
| 9636 <td>9a0ce47bd1734ae7</td> | |
| 9637 <td>peaklist_fragments.tsv</td> | |
| 9638 <td>tabular</td> | |
| 9639 <td>42</td> | |
| 9640 </tr> | |
| 9641 </table> | |
| 9642 </div> | |
| 9643 | |
| 9644 | |
| 9645 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 9646 <h2 | |
| 9647 class="history_metadata_extractor_h2" | |
| 9648 style="cursor: pointer" | |
| 9649 title="click to fold/unfold the table" | |
| 9650 > | |
| 9651 [DELETED] - Batch_correction - 3.0.0 | |
| 9652 </h2> | |
| 9653 <p> | |
| 9654 Outputs: | |
| 9655 </p> | |
| 9656 <p class="history_metadata_extractor_status"> | |
| 9657 Status: Failed (127) | |
| 9658 </p> | |
| 9659 <p class="history_metadata_extractor_glitter"></p> | |
| 9660 <table class=" | |
| 9661 table | |
| 9662 table-bordered | |
| 9663 table-dark | |
| 9664 table-striped | |
| 9665 table-hover | |
| 9666 d-block | |
| 9667 overflow-auto | |
| 9668 history_metadata_extractor_table | |
| 9669 "> | |
| 9670 <thead> | |
| 9671 <tr> | |
| 9672 <th scope="col"></th> | |
| 9673 <th scope="col">value</th> | |
| 9674 <th scope="col">name</th> | |
| 9675 <th scope="col">extension</th> | |
| 9676 <th scope="col">hid</th> | |
| 9677 </tr> | |
| 9678 </thead> | |
| 9679 <tr class=""> | |
| 9680 <th scope="row">dataMatrix</th> | |
| 9681 <td>9a0ce47bd1734ae7</td> | |
| 9682 <td>peaklist_fragments.tsv</td> | |
| 9683 <td>tabular</td> | |
| 9684 <td>42</td> | |
| 9685 </tr><tr class=""> | |
| 9686 <th scope="row">sampleMetadata</th> | |
| 9687 <td>9a0ce47bd1734ae7</td> | |
| 9688 <td>peaklist_fragments.tsv</td> | |
| 9689 <td>tabular</td> | |
| 9690 <td>42</td> | |
| 9691 </tr><tr class=""> | |
| 9692 <th scope="row">batch_col_name</th> | |
| 9693 <td>batch</td> | |
| 9694 <td></td> | |
| 9695 <td></td> | |
| 9696 <td></td> | |
| 9697 </tr><tr class=""> | |
| 9698 <th scope="row">injection_order_col_name</th> | |
| 9699 <td>injectionOrder</td> | |
| 9700 <td></td> | |
| 9701 <td></td> | |
| 9702 <td></td> | |
| 9703 </tr><tr class=""> | |
| 9704 <th scope="row">sampleTypeTagBlank</th> | |
| 9705 <td>blank</td> | |
| 9706 <td></td> | |
| 9707 <td></td> | |
| 9708 <td></td> | |
| 9709 </tr><tr class=""> | |
| 9710 <th scope="row">sampleTypeTagPool</th> | |
| 9711 <td>pool</td> | |
| 9712 <td></td> | |
| 9713 <td></td> | |
| 9714 <td></td> | |
| 9715 </tr><tr class=""> | |
| 9716 <th scope="row">sampleTypeTagSample</th> | |
| 9717 <td>sample</td> | |
| 9718 <td></td> | |
| 9719 <td></td> | |
| 9720 <td></td> | |
| 9721 </tr><tr class=""> | |
| 9722 <th scope="row">sample_type_col_name</th> | |
| 9723 <td>sampleType</td> | |
| 9724 <td></td> | |
| 9725 <td></td> | |
| 9726 <td></td> | |
| 9727 </tr><tr class=""> | |
| 9728 <th scope="row">detail</th> | |
| 9729 <td>no</td> | |
| 9730 <td></td> | |
| 9731 <td></td> | |
| 9732 <td></td> | |
| 9733 </tr><tr class=""> | |
| 9734 <th scope="row">method</th> | |
| 9735 <td>linear</td> | |
| 9736 <td></td> | |
| 9737 <td></td> | |
| 9738 <td></td> | |
| 9739 </tr><tr class=""> | |
| 9740 <th scope="row">ref_factor</th> | |
| 9741 <td>batch</td> | |
| 9742 <td></td> | |
| 9743 <td></td> | |
| 9744 <td></td> | |
| 9745 </tr><tr class=""> | |
| 9746 <th scope="row">valnull</th> | |
| 9747 <td>none</td> | |
| 9748 <td></td> | |
| 9749 <td></td> | |
| 9750 <td></td> | |
| 9751 </tr><tr class=""> | |
| 9752 <th scope="row">variableMetadata</th> | |
| 9753 <td>9a0ce47bd1734ae7</td> | |
| 9754 <td>peaklist_fragments.tsv</td> | |
| 9755 <td>tabular</td> | |
| 9756 <td>42</td> | |
| 9757 </tr> | |
| 9758 </table> | |
| 9759 </div> | |
| 9760 | |
| 9761 | |
| 9762 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 9763 <h2 | |
| 9764 class="history_metadata_extractor_h2" | |
| 9765 style="cursor: pointer" | |
| 9766 title="click to fold/unfold the table" | |
| 9767 > | |
| 9768 [DELETED] - Batch_correction - 3.0.0 | |
| 9769 </h2> | |
| 9770 <p> | |
| 9771 Outputs: | |
| 9772 </p> | |
| 9773 <p class="history_metadata_extractor_status"> | |
| 9774 Status: Failed (127) | |
| 9775 </p> | |
| 9776 <p class="history_metadata_extractor_glitter"></p> | |
| 9777 <table class=" | |
| 9778 table | |
| 9779 table-bordered | |
| 9780 table-dark | |
| 9781 table-striped | |
| 9782 table-hover | |
| 9783 d-block | |
| 9784 overflow-auto | |
| 9785 history_metadata_extractor_table | |
| 9786 "> | |
| 9787 <thead> | |
| 9788 <tr> | |
| 9789 <th scope="col"></th> | |
| 9790 <th scope="col">value</th> | |
| 9791 <th scope="col">name</th> | |
| 9792 <th scope="col">extension</th> | |
| 9793 <th scope="col">hid</th> | |
| 9794 </tr> | |
| 9795 </thead> | |
| 9796 <tr class=""> | |
| 9797 <th scope="row">dataMatrix</th> | |
| 9798 <td>9a0ce47bd1734ae7</td> | |
| 9799 <td>peaklist_fragments.tsv</td> | |
| 9800 <td>tabular</td> | |
| 9801 <td>42</td> | |
| 9802 </tr><tr class=""> | |
| 9803 <th scope="row">sampleMetadata</th> | |
| 9804 <td>9a0ce47bd1734ae7</td> | |
| 9805 <td>peaklist_fragments.tsv</td> | |
| 9806 <td>tabular</td> | |
| 9807 <td>42</td> | |
| 9808 </tr><tr class=""> | |
| 9809 <th scope="row">batch_col_name</th> | |
| 9810 <td>batch</td> | |
| 9811 <td></td> | |
| 9812 <td></td> | |
| 9813 <td></td> | |
| 9814 </tr><tr class=""> | |
| 9815 <th scope="row">injection_order_col_name</th> | |
| 9816 <td>injectionOrder</td> | |
| 9817 <td></td> | |
| 9818 <td></td> | |
| 9819 <td></td> | |
| 9820 </tr><tr class=""> | |
| 9821 <th scope="row">sampleTypeTagBlank</th> | |
| 9822 <td>blank</td> | |
| 9823 <td></td> | |
| 9824 <td></td> | |
| 9825 <td></td> | |
| 9826 </tr><tr class=""> | |
| 9827 <th scope="row">sampleTypeTagPool</th> | |
| 9828 <td>pool</td> | |
| 9829 <td></td> | |
| 9830 <td></td> | |
| 9831 <td></td> | |
| 9832 </tr><tr class=""> | |
| 9833 <th scope="row">sampleTypeTagSample</th> | |
| 9834 <td>sample</td> | |
| 9835 <td></td> | |
| 9836 <td></td> | |
| 9837 <td></td> | |
| 9838 </tr><tr class=""> | |
| 9839 <th scope="row">sample_type_col_name</th> | |
| 9840 <td>sampleType</td> | |
| 9841 <td></td> | |
| 9842 <td></td> | |
| 9843 <td></td> | |
| 9844 </tr><tr class=""> | |
| 9845 <th scope="row">detail</th> | |
| 9846 <td>no</td> | |
| 9847 <td></td> | |
| 9848 <td></td> | |
| 9849 <td></td> | |
| 9850 </tr><tr class=""> | |
| 9851 <th scope="row">method</th> | |
| 9852 <td>linear</td> | |
| 9853 <td></td> | |
| 9854 <td></td> | |
| 9855 <td></td> | |
| 9856 </tr><tr class=""> | |
| 9857 <th scope="row">ref_factor</th> | |
| 9858 <td>batch</td> | |
| 9859 <td></td> | |
| 9860 <td></td> | |
| 9861 <td></td> | |
| 9862 </tr><tr class=""> | |
| 9863 <th scope="row">valnull</th> | |
| 9864 <td>none</td> | |
| 9865 <td></td> | |
| 9866 <td></td> | |
| 9867 <td></td> | |
| 9868 </tr><tr class=""> | |
| 9869 <th scope="row">variableMetadata</th> | |
| 9870 <td>9a0ce47bd1734ae7</td> | |
| 9871 <td>peaklist_fragments.tsv</td> | |
| 9872 <td>tabular</td> | |
| 9873 <td>42</td> | |
| 9874 </tr> | |
| 9875 </table> | |
| 9876 </div> | |
| 9877 | |
| 9878 | |
| 9879 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 9880 <h2 | |
| 9881 class="history_metadata_extractor_h2" | |
| 9882 style="cursor: pointer" | |
| 9883 title="click to fold/unfold the table" | |
| 9884 > | |
| 9885 [DELETED] - Batch_correction - 3.0.0 | |
| 9886 </h2> | |
| 9887 <p> | |
| 9888 Outputs: | |
| 9889 </p> | |
| 9890 <p class="history_metadata_extractor_status"> | |
| 9891 Status: Failed (1) | |
| 9892 </p> | |
| 9893 <p class="history_metadata_extractor_glitter"></p> | |
| 9894 <table class=" | |
| 9895 table | |
| 9896 table-bordered | |
| 9897 table-dark | |
| 9898 table-striped | |
| 9899 table-hover | |
| 9900 d-block | |
| 9901 overflow-auto | |
| 9902 history_metadata_extractor_table | |
| 9903 "> | |
| 9904 <thead> | |
| 9905 <tr> | |
| 9906 <th scope="col"></th> | |
| 9907 <th scope="col">value</th> | |
| 9908 <th scope="col">name</th> | |
| 9909 <th scope="col">extension</th> | |
| 9910 <th scope="col">hid</th> | |
| 9911 </tr> | |
| 9912 </thead> | |
| 9913 <tr class=""> | |
| 9914 <th scope="row">dataMatrix</th> | |
| 9915 <td>9a0ce47bd1734ae7</td> | |
| 9916 <td>peaklist_fragments.tsv</td> | |
| 9917 <td>tabular</td> | |
| 9918 <td>42</td> | |
| 9919 </tr><tr class=""> | |
| 9920 <th scope="row">sampleMetadata</th> | |
| 9921 <td>9a0ce47bd1734ae7</td> | |
| 9922 <td>peaklist_fragments.tsv</td> | |
| 9923 <td>tabular</td> | |
| 9924 <td>42</td> | |
| 9925 </tr><tr class=""> | |
| 9926 <th scope="row">batch_col_name</th> | |
| 9927 <td>batch</td> | |
| 9928 <td></td> | |
| 9929 <td></td> | |
| 9930 <td></td> | |
| 9931 </tr><tr class=""> | |
| 9932 <th scope="row">injection_order_col_name</th> | |
| 9933 <td>injectionOrder</td> | |
| 9934 <td></td> | |
| 9935 <td></td> | |
| 9936 <td></td> | |
| 9937 </tr><tr class=""> | |
| 9938 <th scope="row">sampleTypeTagBlank</th> | |
| 9939 <td>blank</td> | |
| 9940 <td></td> | |
| 9941 <td></td> | |
| 9942 <td></td> | |
| 9943 </tr><tr class=""> | |
| 9944 <th scope="row">sampleTypeTagPool</th> | |
| 9945 <td>pool</td> | |
| 9946 <td></td> | |
| 9947 <td></td> | |
| 9948 <td></td> | |
| 9949 </tr><tr class=""> | |
| 9950 <th scope="row">sampleTypeTagSample</th> | |
| 9951 <td>sample</td> | |
| 9952 <td></td> | |
| 9953 <td></td> | |
| 9954 <td></td> | |
| 9955 </tr><tr class=""> | |
| 9956 <th scope="row">sample_type_col_name</th> | |
| 9957 <td>sampleType</td> | |
| 9958 <td></td> | |
| 9959 <td></td> | |
| 9960 <td></td> | |
| 9961 </tr><tr class=""> | |
| 9962 <th scope="row">detail</th> | |
| 9963 <td>no</td> | |
| 9964 <td></td> | |
| 9965 <td></td> | |
| 9966 <td></td> | |
| 9967 </tr><tr class=""> | |
| 9968 <th scope="row">method</th> | |
| 9969 <td>linear</td> | |
| 9970 <td></td> | |
| 9971 <td></td> | |
| 9972 <td></td> | |
| 9973 </tr><tr class=""> | |
| 9974 <th scope="row">ref_factor</th> | |
| 9975 <td>batch</td> | |
| 9976 <td></td> | |
| 9977 <td></td> | |
| 9978 <td></td> | |
| 9979 </tr><tr class=""> | |
| 9980 <th scope="row">valnull</th> | |
| 9981 <td>none</td> | |
| 9982 <td></td> | |
| 9983 <td></td> | |
| 9984 <td></td> | |
| 9985 </tr><tr class=""> | |
| 9986 <th scope="row">variableMetadata</th> | |
| 9987 <td>9a0ce47bd1734ae7</td> | |
| 9988 <td>peaklist_fragments.tsv</td> | |
| 9989 <td>tabular</td> | |
| 9990 <td>42</td> | |
| 9991 </tr> | |
| 9992 </table> | |
| 9993 </div> | |
| 9994 | |
| 9995 | |
| 9996 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 9997 <h2 | |
| 9998 class="history_metadata_extractor_h2" | |
| 9999 style="cursor: pointer" | |
| 10000 title="click to fold/unfold the table" | |
| 10001 > | |
| 10002 [DELETED] - Batch_correction - 3.0.0 | |
| 10003 </h2> | |
| 10004 <p> | |
| 10005 Outputs: | |
| 10006 </p> | |
| 10007 <p class="history_metadata_extractor_status"> | |
| 10008 Status: Failed (1) | |
| 10009 </p> | |
| 10010 <p class="history_metadata_extractor_glitter"></p> | |
| 10011 <table class=" | |
| 10012 table | |
| 10013 table-bordered | |
| 10014 table-dark | |
| 10015 table-striped | |
| 10016 table-hover | |
| 10017 d-block | |
| 10018 overflow-auto | |
| 10019 history_metadata_extractor_table | |
| 10020 "> | |
| 10021 <thead> | |
| 10022 <tr> | |
| 10023 <th scope="col"></th> | |
| 10024 <th scope="col">value</th> | |
| 10025 <th scope="col">name</th> | |
| 10026 <th scope="col">extension</th> | |
| 10027 <th scope="col">hid</th> | |
| 10028 </tr> | |
| 10029 </thead> | |
| 10030 <tr class=""> | |
| 10031 <th scope="row">dataMatrix</th> | |
| 10032 <td>9a0ce47bd1734ae7</td> | |
| 10033 <td>peaklist_fragments.tsv</td> | |
| 10034 <td>tabular</td> | |
| 10035 <td>42</td> | |
| 10036 </tr><tr class=""> | |
| 10037 <th scope="row">sampleMetadata</th> | |
| 10038 <td>9a0ce47bd1734ae7</td> | |
| 10039 <td>peaklist_fragments.tsv</td> | |
| 10040 <td>tabular</td> | |
| 10041 <td>42</td> | |
| 10042 </tr><tr class=""> | |
| 10043 <th scope="row">batch_col_name</th> | |
| 10044 <td>batch</td> | |
| 10045 <td></td> | |
| 10046 <td></td> | |
| 10047 <td></td> | |
| 10048 </tr><tr class=""> | |
| 10049 <th scope="row">injection_order_col_name</th> | |
| 10050 <td>injectionOrder</td> | |
| 10051 <td></td> | |
| 10052 <td></td> | |
| 10053 <td></td> | |
| 10054 </tr><tr class=""> | |
| 10055 <th scope="row">sampleTypeTagBlank</th> | |
| 10056 <td>blank</td> | |
| 10057 <td></td> | |
| 10058 <td></td> | |
| 10059 <td></td> | |
| 10060 </tr><tr class=""> | |
| 10061 <th scope="row">sampleTypeTagPool</th> | |
| 10062 <td>pool</td> | |
| 10063 <td></td> | |
| 10064 <td></td> | |
| 10065 <td></td> | |
| 10066 </tr><tr class=""> | |
| 10067 <th scope="row">sampleTypeTagSample</th> | |
| 10068 <td>sample</td> | |
| 10069 <td></td> | |
| 10070 <td></td> | |
| 10071 <td></td> | |
| 10072 </tr><tr class=""> | |
| 10073 <th scope="row">sample_type_col_name</th> | |
| 10074 <td>sampleType</td> | |
| 10075 <td></td> | |
| 10076 <td></td> | |
| 10077 <td></td> | |
| 10078 </tr><tr class=""> | |
| 10079 <th scope="row">detail</th> | |
| 10080 <td>no</td> | |
| 10081 <td></td> | |
| 10082 <td></td> | |
| 10083 <td></td> | |
| 10084 </tr><tr class=""> | |
| 10085 <th scope="row">method</th> | |
| 10086 <td>linear</td> | |
| 10087 <td></td> | |
| 10088 <td></td> | |
| 10089 <td></td> | |
| 10090 </tr><tr class=""> | |
| 10091 <th scope="row">ref_factor</th> | |
| 10092 <td>batch</td> | |
| 10093 <td></td> | |
| 10094 <td></td> | |
| 10095 <td></td> | |
| 10096 </tr><tr class=""> | |
| 10097 <th scope="row">valnull</th> | |
| 10098 <td>none</td> | |
| 10099 <td></td> | |
| 10100 <td></td> | |
| 10101 <td></td> | |
| 10102 </tr><tr class=""> | |
| 10103 <th scope="row">variableMetadata</th> | |
| 10104 <td>9a0ce47bd1734ae7</td> | |
| 10105 <td>peaklist_fragments.tsv</td> | |
| 10106 <td>tabular</td> | |
| 10107 <td>42</td> | |
| 10108 </tr> | |
| 10109 </table> | |
| 10110 </div> | |
| 10111 | |
| 10112 | |
| 10113 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 10114 <h2 | |
| 10115 class="history_metadata_extractor_h2" | |
| 10116 style="cursor: pointer" | |
| 10117 title="click to fold/unfold the table" | |
| 10118 > | |
| 10119 [DELETED] - Batch_correction - 3.0.0 | |
| 10120 </h2> | |
| 10121 <p> | |
| 10122 Outputs: | |
| 10123 </p> | |
| 10124 <p class="history_metadata_extractor_status"> | |
| 10125 Status: Failed (1) | |
| 10126 </p> | |
| 10127 <p class="history_metadata_extractor_glitter"></p> | |
| 10128 <table class=" | |
| 10129 table | |
| 10130 table-bordered | |
| 10131 table-dark | |
| 10132 table-striped | |
| 10133 table-hover | |
| 10134 d-block | |
| 10135 overflow-auto | |
| 10136 history_metadata_extractor_table | |
| 10137 "> | |
| 10138 <thead> | |
| 10139 <tr> | |
| 10140 <th scope="col"></th> | |
| 10141 <th scope="col">value</th> | |
| 10142 <th scope="col">name</th> | |
| 10143 <th scope="col">extension</th> | |
| 10144 <th scope="col">hid</th> | |
| 10145 </tr> | |
| 10146 </thead> | |
| 10147 <tr class=""> | |
| 10148 <th scope="row">dataMatrix</th> | |
| 10149 <td>9a0ce47bd1734ae7</td> | |
| 10150 <td>peaklist_fragments.tsv</td> | |
| 10151 <td>tabular</td> | |
| 10152 <td>42</td> | |
| 10153 </tr><tr class=""> | |
| 10154 <th scope="row">sampleMetadata</th> | |
| 10155 <td>9a0ce47bd1734ae7</td> | |
| 10156 <td>peaklist_fragments.tsv</td> | |
| 10157 <td>tabular</td> | |
| 10158 <td>42</td> | |
| 10159 </tr><tr class=""> | |
| 10160 <th scope="row">batch_col_name</th> | |
| 10161 <td>batch</td> | |
| 10162 <td></td> | |
| 10163 <td></td> | |
| 10164 <td></td> | |
| 10165 </tr><tr class=""> | |
| 10166 <th scope="row">injection_order_col_name</th> | |
| 10167 <td>injectionOrder</td> | |
| 10168 <td></td> | |
| 10169 <td></td> | |
| 10170 <td></td> | |
| 10171 </tr><tr class=""> | |
| 10172 <th scope="row">sampleTypeTagBlank</th> | |
| 10173 <td>blank</td> | |
| 10174 <td></td> | |
| 10175 <td></td> | |
| 10176 <td></td> | |
| 10177 </tr><tr class=""> | |
| 10178 <th scope="row">sampleTypeTagPool</th> | |
| 10179 <td>pool</td> | |
| 10180 <td></td> | |
| 10181 <td></td> | |
| 10182 <td></td> | |
| 10183 </tr><tr class=""> | |
| 10184 <th scope="row">sampleTypeTagSample</th> | |
| 10185 <td>sample</td> | |
| 10186 <td></td> | |
| 10187 <td></td> | |
| 10188 <td></td> | |
| 10189 </tr><tr class=""> | |
| 10190 <th scope="row">sample_type_col_name</th> | |
| 10191 <td>sampleType</td> | |
| 10192 <td></td> | |
| 10193 <td></td> | |
| 10194 <td></td> | |
| 10195 </tr><tr class=""> | |
| 10196 <th scope="row">detail</th> | |
| 10197 <td>no</td> | |
| 10198 <td></td> | |
| 10199 <td></td> | |
| 10200 <td></td> | |
| 10201 </tr><tr class=""> | |
| 10202 <th scope="row">method</th> | |
| 10203 <td>linear</td> | |
| 10204 <td></td> | |
| 10205 <td></td> | |
| 10206 <td></td> | |
| 10207 </tr><tr class=""> | |
| 10208 <th scope="row">ref_factor</th> | |
| 10209 <td>batch</td> | |
| 10210 <td></td> | |
| 10211 <td></td> | |
| 10212 <td></td> | |
| 10213 </tr><tr class=""> | |
| 10214 <th scope="row">valnull</th> | |
| 10215 <td>none</td> | |
| 10216 <td></td> | |
| 10217 <td></td> | |
| 10218 <td></td> | |
| 10219 </tr><tr class=""> | |
| 10220 <th scope="row">variableMetadata</th> | |
| 10221 <td>9a0ce47bd1734ae7</td> | |
| 10222 <td>peaklist_fragments.tsv</td> | |
| 10223 <td>tabular</td> | |
| 10224 <td>42</td> | |
| 10225 </tr> | |
| 10226 </table> | |
| 10227 </div> | |
| 10228 | |
| 10229 | |
| 10230 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 10231 <h2 | |
| 10232 class="history_metadata_extractor_h2" | |
| 10233 style="cursor: pointer" | |
| 10234 title="click to fold/unfold the table" | |
| 10235 > | |
| 10236 [DELETED] - Determine_BC - 3.0.0 | |
| 10237 </h2> | |
| 10238 <p> | |
| 10239 Outputs: | |
| 10240 </p> | |
| 10241 <p class="history_metadata_extractor_status"> | |
| 10242 Status: Failed (1) | |
| 10243 </p> | |
| 10244 <p class="history_metadata_extractor_glitter"></p> | |
| 10245 <table class=" | |
| 10246 table | |
| 10247 table-bordered | |
| 10248 table-dark | |
| 10249 table-striped | |
| 10250 table-hover | |
| 10251 d-block | |
| 10252 overflow-auto | |
| 10253 history_metadata_extractor_table | |
| 10254 "> | |
| 10255 <thead> | |
| 10256 <tr> | |
| 10257 <th scope="col"></th> | |
| 10258 <th scope="col">value</th> | |
| 10259 <th scope="col">name</th> | |
| 10260 <th scope="col">extension</th> | |
| 10261 <th scope="col">hid</th> | |
| 10262 </tr> | |
| 10263 </thead> | |
| 10264 <tr class=""> | |
| 10265 <th scope="row">option</th> | |
| 10266 <td>hide</td> | |
| 10267 <td></td> | |
| 10268 <td></td> | |
| 10269 <td></td> | |
| 10270 </tr><tr class=""> | |
| 10271 <th scope="row">dataMatrix</th> | |
| 10272 <td>7cf499d16bd542b2</td> | |
| 10273 <td>compounds_pos.txt</td> | |
| 10274 <td>tabular</td> | |
| 10275 <td>44</td> | |
| 10276 </tr><tr class=""> | |
| 10277 <th scope="row">ref_factor</th> | |
| 10278 <td>batch</td> | |
| 10279 <td></td> | |
| 10280 <td></td> | |
| 10281 <td></td> | |
| 10282 </tr><tr class=""> | |
| 10283 <th scope="row">sampleMetadata</th> | |
| 10284 <td>7cf499d16bd542b2</td> | |
| 10285 <td>compounds_pos.txt</td> | |
| 10286 <td>tabular</td> | |
| 10287 <td>44</td> | |
| 10288 </tr><tr class=""> | |
| 10289 <th scope="row">batch_col_name</th> | |
| 10290 <td>batch</td> | |
| 10291 <td></td> | |
| 10292 <td></td> | |
| 10293 <td></td> | |
| 10294 </tr><tr class=""> | |
| 10295 <th scope="row">injection_order_col_name</th> | |
| 10296 <td>injectionOrder</td> | |
| 10297 <td></td> | |
| 10298 <td></td> | |
| 10299 <td></td> | |
| 10300 </tr><tr class=""> | |
| 10301 <th scope="row">sampleTypeTagBlank</th> | |
| 10302 <td>blank</td> | |
| 10303 <td></td> | |
| 10304 <td></td> | |
| 10305 <td></td> | |
| 10306 </tr><tr class=""> | |
| 10307 <th scope="row">sampleTypeTagPool</th> | |
| 10308 <td>pool</td> | |
| 10309 <td></td> | |
| 10310 <td></td> | |
| 10311 <td></td> | |
| 10312 </tr><tr class=""> | |
| 10313 <th scope="row">sampleTypeTagSample</th> | |
| 10314 <td>sample</td> | |
| 10315 <td></td> | |
| 10316 <td></td> | |
| 10317 <td></td> | |
| 10318 </tr><tr class=""> | |
| 10319 <th scope="row">sample_type_col_name</th> | |
| 10320 <td>sampleType</td> | |
| 10321 <td></td> | |
| 10322 <td></td> | |
| 10323 <td></td> | |
| 10324 </tr> | |
| 10325 </table> | |
| 10326 </div> | |
| 10327 | |
| 10328 | |
| 10329 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 10330 <h2 | |
| 10331 class="history_metadata_extractor_h2" | |
| 10332 style="cursor: pointer" | |
| 10333 title="click to fold/unfold the table" | |
| 10334 > | |
| 10335 [DELETED] - Determine_BC - 3.0.0 | |
| 10336 </h2> | |
| 10337 <p> | |
| 10338 Outputs: | |
| 10339 </p> | |
| 10340 <p class="history_metadata_extractor_status"> | |
| 10341 Status: Failed (1) | |
| 10342 </p> | |
| 10343 <p class="history_metadata_extractor_glitter"></p> | |
| 10344 <table class=" | |
| 10345 table | |
| 10346 table-bordered | |
| 10347 table-dark | |
| 10348 table-striped | |
| 10349 table-hover | |
| 10350 d-block | |
| 10351 overflow-auto | |
| 10352 history_metadata_extractor_table | |
| 10353 "> | |
| 10354 <thead> | |
| 10355 <tr> | |
| 10356 <th scope="col"></th> | |
| 10357 <th scope="col">value</th> | |
| 10358 <th scope="col">name</th> | |
| 10359 <th scope="col">extension</th> | |
| 10360 <th scope="col">hid</th> | |
| 10361 </tr> | |
| 10362 </thead> | |
| 10363 <tr class=""> | |
| 10364 <th scope="row">option</th> | |
| 10365 <td>hide</td> | |
| 10366 <td></td> | |
| 10367 <td></td> | |
| 10368 <td></td> | |
| 10369 </tr><tr class=""> | |
| 10370 <th scope="row">dataMatrix</th> | |
| 10371 <td>7cf499d16bd542b2</td> | |
| 10372 <td>compounds_pos.txt</td> | |
| 10373 <td>tabular</td> | |
| 10374 <td>44</td> | |
| 10375 </tr><tr class=""> | |
| 10376 <th scope="row">ref_factor</th> | |
| 10377 <td>batch</td> | |
| 10378 <td></td> | |
| 10379 <td></td> | |
| 10380 <td></td> | |
| 10381 </tr><tr class=""> | |
| 10382 <th scope="row">sampleMetadata</th> | |
| 10383 <td>7cf499d16bd542b2</td> | |
| 10384 <td>compounds_pos.txt</td> | |
| 10385 <td>tabular</td> | |
| 10386 <td>44</td> | |
| 10387 </tr><tr class=""> | |
| 10388 <th scope="row">batch_col_name</th> | |
| 10389 <td>batch</td> | |
| 10390 <td></td> | |
| 10391 <td></td> | |
| 10392 <td></td> | |
| 10393 </tr><tr class=""> | |
| 10394 <th scope="row">injection_order_col_name</th> | |
| 10395 <td>injectionOrder</td> | |
| 10396 <td></td> | |
| 10397 <td></td> | |
| 10398 <td></td> | |
| 10399 </tr><tr class=""> | |
| 10400 <th scope="row">sampleTypeTagBlank</th> | |
| 10401 <td>blank</td> | |
| 10402 <td></td> | |
| 10403 <td></td> | |
| 10404 <td></td> | |
| 10405 </tr><tr class=""> | |
| 10406 <th scope="row">sampleTypeTagPool</th> | |
| 10407 <td>pool</td> | |
| 10408 <td></td> | |
| 10409 <td></td> | |
| 10410 <td></td> | |
| 10411 </tr><tr class=""> | |
| 10412 <th scope="row">sampleTypeTagSample</th> | |
| 10413 <td>sample</td> | |
| 10414 <td></td> | |
| 10415 <td></td> | |
| 10416 <td></td> | |
| 10417 </tr><tr class=""> | |
| 10418 <th scope="row">sample_type_col_name</th> | |
| 10419 <td>sampleType</td> | |
| 10420 <td></td> | |
| 10421 <td></td> | |
| 10422 <td></td> | |
| 10423 </tr> | |
| 10424 </table> | |
| 10425 </div> | |
| 10426 | |
| 10427 | |
| 10428 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 10429 <h2 | |
| 10430 class="history_metadata_extractor_h2" | |
| 10431 style="cursor: pointer" | |
| 10432 title="click to fold/unfold the table" | |
| 10433 > | |
| 10434 [DELETED] - Batch_correction - 3.0.0 | |
| 10435 </h2> | |
| 10436 <p> | |
| 10437 Outputs: | |
| 10438 </p> | |
| 10439 <p class="history_metadata_extractor_status"> | |
| 10440 Status: Failed (1) | |
| 10441 </p> | |
| 10442 <p class="history_metadata_extractor_glitter"></p> | |
| 10443 <table class=" | |
| 10444 table | |
| 10445 table-bordered | |
| 10446 table-dark | |
| 10447 table-striped | |
| 10448 table-hover | |
| 10449 d-block | |
| 10450 overflow-auto | |
| 10451 history_metadata_extractor_table | |
| 10452 "> | |
| 10453 <thead> | |
| 10454 <tr> | |
| 10455 <th scope="col"></th> | |
| 10456 <th scope="col">value</th> | |
| 10457 <th scope="col">name</th> | |
| 10458 <th scope="col">extension</th> | |
| 10459 <th scope="col">hid</th> | |
| 10460 </tr> | |
| 10461 </thead> | |
| 10462 <tr class=""> | |
| 10463 <th scope="row">dataMatrix</th> | |
| 10464 <td>7cf499d16bd542b2</td> | |
| 10465 <td>compounds_pos.txt</td> | |
| 10466 <td>tabular</td> | |
| 10467 <td>44</td> | |
| 10468 </tr><tr class=""> | |
| 10469 <th scope="row">sampleMetadata</th> | |
| 10470 <td>7cf499d16bd542b2</td> | |
| 10471 <td>compounds_pos.txt</td> | |
| 10472 <td>tabular</td> | |
| 10473 <td>44</td> | |
| 10474 </tr><tr class=""> | |
| 10475 <th scope="row">batch_col_name</th> | |
| 10476 <td>batch</td> | |
| 10477 <td></td> | |
| 10478 <td></td> | |
| 10479 <td></td> | |
| 10480 </tr><tr class=""> | |
| 10481 <th scope="row">injection_order_col_name</th> | |
| 10482 <td>injectionOrder</td> | |
| 10483 <td></td> | |
| 10484 <td></td> | |
| 10485 <td></td> | |
| 10486 </tr><tr class=""> | |
| 10487 <th scope="row">sampleTypeTagBlank</th> | |
| 10488 <td>blank</td> | |
| 10489 <td></td> | |
| 10490 <td></td> | |
| 10491 <td></td> | |
| 10492 </tr><tr class=""> | |
| 10493 <th scope="row">sampleTypeTagPool</th> | |
| 10494 <td>pool</td> | |
| 10495 <td></td> | |
| 10496 <td></td> | |
| 10497 <td></td> | |
| 10498 </tr><tr class=""> | |
| 10499 <th scope="row">sampleTypeTagSample</th> | |
| 10500 <td>sample</td> | |
| 10501 <td></td> | |
| 10502 <td></td> | |
| 10503 <td></td> | |
| 10504 </tr><tr class=""> | |
| 10505 <th scope="row">sample_type_col_name</th> | |
| 10506 <td>sampleType</td> | |
| 10507 <td></td> | |
| 10508 <td></td> | |
| 10509 <td></td> | |
| 10510 </tr><tr class=""> | |
| 10511 <th scope="row">detail</th> | |
| 10512 <td>no</td> | |
| 10513 <td></td> | |
| 10514 <td></td> | |
| 10515 <td></td> | |
| 10516 </tr><tr class=""> | |
| 10517 <th scope="row">method</th> | |
| 10518 <td>linear</td> | |
| 10519 <td></td> | |
| 10520 <td></td> | |
| 10521 <td></td> | |
| 10522 </tr><tr class=""> | |
| 10523 <th scope="row">ref_factor</th> | |
| 10524 <td>batch</td> | |
| 10525 <td></td> | |
| 10526 <td></td> | |
| 10527 <td></td> | |
| 10528 </tr><tr class=""> | |
| 10529 <th scope="row">valnull</th> | |
| 10530 <td>none</td> | |
| 10531 <td></td> | |
| 10532 <td></td> | |
| 10533 <td></td> | |
| 10534 </tr><tr class=""> | |
| 10535 <th scope="row">variableMetadata</th> | |
| 10536 <td>7cf499d16bd542b2</td> | |
| 10537 <td>compounds_pos.txt</td> | |
| 10538 <td>tabular</td> | |
| 10539 <td>44</td> | |
| 10540 </tr> | |
| 10541 </table> | |
| 10542 </div> | |
| 10543 | |
| 10544 | |
| 10545 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 10546 <h2 | |
| 10547 class="history_metadata_extractor_h2" | |
| 10548 style="cursor: pointer" | |
| 10549 title="click to fold/unfold the table" | |
| 10550 > | |
| 10551 [DELETED] - Batch_correction - 3.0.0 | |
| 10552 </h2> | |
| 10553 <p> | |
| 10554 Outputs: | |
| 10555 </p> | |
| 10556 <p class="history_metadata_extractor_status"> | |
| 10557 Status: Failed (1) | |
| 10558 </p> | |
| 10559 <p class="history_metadata_extractor_glitter"></p> | |
| 10560 <table class=" | |
| 10561 table | |
| 10562 table-bordered | |
| 10563 table-dark | |
| 10564 table-striped | |
| 10565 table-hover | |
| 10566 d-block | |
| 10567 overflow-auto | |
| 10568 history_metadata_extractor_table | |
| 10569 "> | |
| 10570 <thead> | |
| 10571 <tr> | |
| 10572 <th scope="col"></th> | |
| 10573 <th scope="col">value</th> | |
| 10574 <th scope="col">name</th> | |
| 10575 <th scope="col">extension</th> | |
| 10576 <th scope="col">hid</th> | |
| 10577 </tr> | |
| 10578 </thead> | |
| 10579 <tr class=""> | |
| 10580 <th scope="row">dataMatrix</th> | |
| 10581 <td>7cf499d16bd542b2</td> | |
| 10582 <td>compounds_pos.txt</td> | |
| 10583 <td>tabular</td> | |
| 10584 <td>44</td> | |
| 10585 </tr><tr class=""> | |
| 10586 <th scope="row">sampleMetadata</th> | |
| 10587 <td>7cf499d16bd542b2</td> | |
| 10588 <td>compounds_pos.txt</td> | |
| 10589 <td>tabular</td> | |
| 10590 <td>44</td> | |
| 10591 </tr><tr class=""> | |
| 10592 <th scope="row">batch_col_name</th> | |
| 10593 <td>batch</td> | |
| 10594 <td></td> | |
| 10595 <td></td> | |
| 10596 <td></td> | |
| 10597 </tr><tr class=""> | |
| 10598 <th scope="row">injection_order_col_name</th> | |
| 10599 <td>injectionOrder</td> | |
| 10600 <td></td> | |
| 10601 <td></td> | |
| 10602 <td></td> | |
| 10603 </tr><tr class=""> | |
| 10604 <th scope="row">sampleTypeTagBlank</th> | |
| 10605 <td>blank</td> | |
| 10606 <td></td> | |
| 10607 <td></td> | |
| 10608 <td></td> | |
| 10609 </tr><tr class=""> | |
| 10610 <th scope="row">sampleTypeTagPool</th> | |
| 10611 <td>pool</td> | |
| 10612 <td></td> | |
| 10613 <td></td> | |
| 10614 <td></td> | |
| 10615 </tr><tr class=""> | |
| 10616 <th scope="row">sampleTypeTagSample</th> | |
| 10617 <td>sample</td> | |
| 10618 <td></td> | |
| 10619 <td></td> | |
| 10620 <td></td> | |
| 10621 </tr><tr class=""> | |
| 10622 <th scope="row">sample_type_col_name</th> | |
| 10623 <td>sampleType</td> | |
| 10624 <td></td> | |
| 10625 <td></td> | |
| 10626 <td></td> | |
| 10627 </tr><tr class=""> | |
| 10628 <th scope="row">detail</th> | |
| 10629 <td>no</td> | |
| 10630 <td></td> | |
| 10631 <td></td> | |
| 10632 <td></td> | |
| 10633 </tr><tr class=""> | |
| 10634 <th scope="row">method</th> | |
| 10635 <td>linear</td> | |
| 10636 <td></td> | |
| 10637 <td></td> | |
| 10638 <td></td> | |
| 10639 </tr><tr class=""> | |
| 10640 <th scope="row">ref_factor</th> | |
| 10641 <td>batch</td> | |
| 10642 <td></td> | |
| 10643 <td></td> | |
| 10644 <td></td> | |
| 10645 </tr><tr class=""> | |
| 10646 <th scope="row">valnull</th> | |
| 10647 <td>none</td> | |
| 10648 <td></td> | |
| 10649 <td></td> | |
| 10650 <td></td> | |
| 10651 </tr><tr class=""> | |
| 10652 <th scope="row">variableMetadata</th> | |
| 10653 <td>7cf499d16bd542b2</td> | |
| 10654 <td>compounds_pos.txt</td> | |
| 10655 <td>tabular</td> | |
| 10656 <td>44</td> | |
| 10657 </tr> | |
| 10658 </table> | |
| 10659 </div> | |
| 10660 | |
| 10661 | |
| 10662 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 10663 <h2 | |
| 10664 class="history_metadata_extractor_h2" | |
| 10665 style="cursor: pointer" | |
| 10666 title="click to fold/unfold the table" | |
| 10667 > | |
| 10668 [DELETED] - Batch_correction - 3.0.0 | |
| 10669 </h2> | |
| 10670 <p> | |
| 10671 Outputs: | |
| 10672 </p> | |
| 10673 <p class="history_metadata_extractor_status"> | |
| 10674 Status: Failed (1) | |
| 10675 </p> | |
| 10676 <p class="history_metadata_extractor_glitter"></p> | |
| 10677 <table class=" | |
| 10678 table | |
| 10679 table-bordered | |
| 10680 table-dark | |
| 10681 table-striped | |
| 10682 table-hover | |
| 10683 d-block | |
| 10684 overflow-auto | |
| 10685 history_metadata_extractor_table | |
| 10686 "> | |
| 10687 <thead> | |
| 10688 <tr> | |
| 10689 <th scope="col"></th> | |
| 10690 <th scope="col">value</th> | |
| 10691 <th scope="col">name</th> | |
| 10692 <th scope="col">extension</th> | |
| 10693 <th scope="col">hid</th> | |
| 10694 </tr> | |
| 10695 </thead> | |
| 10696 <tr class=""> | |
| 10697 <th scope="row">dataMatrix</th> | |
| 10698 <td>7cf499d16bd542b2</td> | |
| 10699 <td>compounds_pos.txt</td> | |
| 10700 <td>tabular</td> | |
| 10701 <td>44</td> | |
| 10702 </tr><tr class=""> | |
| 10703 <th scope="row">sampleMetadata</th> | |
| 10704 <td>7cf499d16bd542b2</td> | |
| 10705 <td>compounds_pos.txt</td> | |
| 10706 <td>tabular</td> | |
| 10707 <td>44</td> | |
| 10708 </tr><tr class=""> | |
| 10709 <th scope="row">batch_col_name</th> | |
| 10710 <td>batch</td> | |
| 10711 <td></td> | |
| 10712 <td></td> | |
| 10713 <td></td> | |
| 10714 </tr><tr class=""> | |
| 10715 <th scope="row">injection_order_col_name</th> | |
| 10716 <td>injectionOrder</td> | |
| 10717 <td></td> | |
| 10718 <td></td> | |
| 10719 <td></td> | |
| 10720 </tr><tr class=""> | |
| 10721 <th scope="row">sampleTypeTagBlank</th> | |
| 10722 <td>blank</td> | |
| 10723 <td></td> | |
| 10724 <td></td> | |
| 10725 <td></td> | |
| 10726 </tr><tr class=""> | |
| 10727 <th scope="row">sampleTypeTagPool</th> | |
| 10728 <td>pool</td> | |
| 10729 <td></td> | |
| 10730 <td></td> | |
| 10731 <td></td> | |
| 10732 </tr><tr class=""> | |
| 10733 <th scope="row">sampleTypeTagSample</th> | |
| 10734 <td>sample</td> | |
| 10735 <td></td> | |
| 10736 <td></td> | |
| 10737 <td></td> | |
| 10738 </tr><tr class=""> | |
| 10739 <th scope="row">sample_type_col_name</th> | |
| 10740 <td>sampleType</td> | |
| 10741 <td></td> | |
| 10742 <td></td> | |
| 10743 <td></td> | |
| 10744 </tr><tr class=""> | |
| 10745 <th scope="row">detail</th> | |
| 10746 <td>no</td> | |
| 10747 <td></td> | |
| 10748 <td></td> | |
| 10749 <td></td> | |
| 10750 </tr><tr class=""> | |
| 10751 <th scope="row">method</th> | |
| 10752 <td>linear</td> | |
| 10753 <td></td> | |
| 10754 <td></td> | |
| 10755 <td></td> | |
| 10756 </tr><tr class=""> | |
| 10757 <th scope="row">ref_factor</th> | |
| 10758 <td>batch</td> | |
| 10759 <td></td> | |
| 10760 <td></td> | |
| 10761 <td></td> | |
| 10762 </tr><tr class=""> | |
| 10763 <th scope="row">valnull</th> | |
| 10764 <td>none</td> | |
| 10765 <td></td> | |
| 10766 <td></td> | |
| 10767 <td></td> | |
| 10768 </tr><tr class=""> | |
| 10769 <th scope="row">variableMetadata</th> | |
| 10770 <td>7cf499d16bd542b2</td> | |
| 10771 <td>compounds_pos.txt</td> | |
| 10772 <td>tabular</td> | |
| 10773 <td>44</td> | |
| 10774 </tr> | |
| 10775 </table> | |
| 10776 </div> | |
| 10777 | |
| 10778 | |
| 10779 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 10780 <h2 | |
| 10781 class="history_metadata_extractor_h2" | |
| 10782 style="cursor: pointer" | |
| 10783 title="click to fold/unfold the table" | |
| 10784 > | |
| 10785 [DELETED] - Determine_BC - 3.0.0 | |
| 10786 </h2> | |
| 10787 <p> | |
| 10788 Outputs: | |
| 10789 </p> | |
| 10790 <p class="history_metadata_extractor_status"> | |
| 10791 Status: Failed (1) | |
| 10792 </p> | |
| 10793 <p class="history_metadata_extractor_glitter"></p> | |
| 10794 <table class=" | |
| 10795 table | |
| 10796 table-bordered | |
| 10797 table-dark | |
| 10798 table-striped | |
| 10799 table-hover | |
| 10800 d-block | |
| 10801 overflow-auto | |
| 10802 history_metadata_extractor_table | |
| 10803 "> | |
| 10804 <thead> | |
| 10805 <tr> | |
| 10806 <th scope="col"></th> | |
| 10807 <th scope="col">value</th> | |
| 10808 <th scope="col">name</th> | |
| 10809 <th scope="col">extension</th> | |
| 10810 <th scope="col">hid</th> | |
| 10811 </tr> | |
| 10812 </thead> | |
| 10813 <tr class=""> | |
| 10814 <th scope="row">option</th> | |
| 10815 <td>hide</td> | |
| 10816 <td></td> | |
| 10817 <td></td> | |
| 10818 <td></td> | |
| 10819 </tr><tr class=""> | |
| 10820 <th scope="row">dataMatrix</th> | |
| 10821 <td>9a0ce47bd1734ae7</td> | |
| 10822 <td>peaklist_fragments.tsv</td> | |
| 10823 <td>tabular</td> | |
| 10824 <td>42</td> | |
| 10825 </tr><tr class=""> | |
| 10826 <th scope="row">ref_factor</th> | |
| 10827 <td>batch</td> | |
| 10828 <td></td> | |
| 10829 <td></td> | |
| 10830 <td></td> | |
| 10831 </tr><tr class=""> | |
| 10832 <th scope="row">sampleMetadata</th> | |
| 10833 <td>9a0ce47bd1734ae7</td> | |
| 10834 <td>peaklist_fragments.tsv</td> | |
| 10835 <td>tabular</td> | |
| 10836 <td>42</td> | |
| 10837 </tr><tr class=""> | |
| 10838 <th scope="row">batch_col_name</th> | |
| 10839 <td>batch</td> | |
| 10840 <td></td> | |
| 10841 <td></td> | |
| 10842 <td></td> | |
| 10843 </tr><tr class=""> | |
| 10844 <th scope="row">injection_order_col_name</th> | |
| 10845 <td>injectionOrder</td> | |
| 10846 <td></td> | |
| 10847 <td></td> | |
| 10848 <td></td> | |
| 10849 </tr><tr class=""> | |
| 10850 <th scope="row">sampleTypeTagBlank</th> | |
| 10851 <td>blank</td> | |
| 10852 <td></td> | |
| 10853 <td></td> | |
| 10854 <td></td> | |
| 10855 </tr><tr class=""> | |
| 10856 <th scope="row">sampleTypeTagPool</th> | |
| 10857 <td>pool</td> | |
| 10858 <td></td> | |
| 10859 <td></td> | |
| 10860 <td></td> | |
| 10861 </tr><tr class=""> | |
| 10862 <th scope="row">sampleTypeTagSample</th> | |
| 10863 <td>sample</td> | |
| 10864 <td></td> | |
| 10865 <td></td> | |
| 10866 <td></td> | |
| 10867 </tr><tr class=""> | |
| 10868 <th scope="row">sample_type_col_name</th> | |
| 10869 <td>sampleType</td> | |
| 10870 <td></td> | |
| 10871 <td></td> | |
| 10872 <td></td> | |
| 10873 </tr> | |
| 10874 </table> | |
| 10875 </div> | |
| 10876 | |
| 10877 | |
| 10878 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 10879 <h2 | |
| 10880 class="history_metadata_extractor_h2" | |
| 10881 style="cursor: pointer" | |
| 10882 title="click to fold/unfold the table" | |
| 10883 > | |
| 10884 [DELETED] - Determine_BC - 3.0.0 | |
| 10885 </h2> | |
| 10886 <p> | |
| 10887 Outputs: | |
| 10888 </p> | |
| 10889 <p class="history_metadata_extractor_status"> | |
| 10890 Status: Failed (1) | |
| 10891 </p> | |
| 10892 <p class="history_metadata_extractor_glitter"></p> | |
| 10893 <table class=" | |
| 10894 table | |
| 10895 table-bordered | |
| 10896 table-dark | |
| 10897 table-striped | |
| 10898 table-hover | |
| 10899 d-block | |
| 10900 overflow-auto | |
| 10901 history_metadata_extractor_table | |
| 10902 "> | |
| 10903 <thead> | |
| 10904 <tr> | |
| 10905 <th scope="col"></th> | |
| 10906 <th scope="col">value</th> | |
| 10907 <th scope="col">name</th> | |
| 10908 <th scope="col">extension</th> | |
| 10909 <th scope="col">hid</th> | |
| 10910 </tr> | |
| 10911 </thead> | |
| 10912 <tr class=""> | |
| 10913 <th scope="row">option</th> | |
| 10914 <td>hide</td> | |
| 10915 <td></td> | |
| 10916 <td></td> | |
| 10917 <td></td> | |
| 10918 </tr><tr class=""> | |
| 10919 <th scope="row">dataMatrix</th> | |
| 10920 <td>9a0ce47bd1734ae7</td> | |
| 10921 <td>peaklist_fragments.tsv</td> | |
| 10922 <td>tabular</td> | |
| 10923 <td>42</td> | |
| 10924 </tr><tr class=""> | |
| 10925 <th scope="row">ref_factor</th> | |
| 10926 <td>batch</td> | |
| 10927 <td></td> | |
| 10928 <td></td> | |
| 10929 <td></td> | |
| 10930 </tr><tr class=""> | |
| 10931 <th scope="row">sampleMetadata</th> | |
| 10932 <td>9a0ce47bd1734ae7</td> | |
| 10933 <td>peaklist_fragments.tsv</td> | |
| 10934 <td>tabular</td> | |
| 10935 <td>42</td> | |
| 10936 </tr><tr class=""> | |
| 10937 <th scope="row">batch_col_name</th> | |
| 10938 <td>batch</td> | |
| 10939 <td></td> | |
| 10940 <td></td> | |
| 10941 <td></td> | |
| 10942 </tr><tr class=""> | |
| 10943 <th scope="row">injection_order_col_name</th> | |
| 10944 <td>injectionOrder</td> | |
| 10945 <td></td> | |
| 10946 <td></td> | |
| 10947 <td></td> | |
| 10948 </tr><tr class=""> | |
| 10949 <th scope="row">sampleTypeTagBlank</th> | |
| 10950 <td>blank</td> | |
| 10951 <td></td> | |
| 10952 <td></td> | |
| 10953 <td></td> | |
| 10954 </tr><tr class=""> | |
| 10955 <th scope="row">sampleTypeTagPool</th> | |
| 10956 <td>pool</td> | |
| 10957 <td></td> | |
| 10958 <td></td> | |
| 10959 <td></td> | |
| 10960 </tr><tr class=""> | |
| 10961 <th scope="row">sampleTypeTagSample</th> | |
| 10962 <td>sample</td> | |
| 10963 <td></td> | |
| 10964 <td></td> | |
| 10965 <td></td> | |
| 10966 </tr><tr class=""> | |
| 10967 <th scope="row">sample_type_col_name</th> | |
| 10968 <td>sampleType</td> | |
| 10969 <td></td> | |
| 10970 <td></td> | |
| 10971 <td></td> | |
| 10972 </tr> | |
| 10973 </table> | |
| 10974 </div> | |
| 10975 | |
| 10976 | |
| 10977 <div class="alert alert-success history_metadata_extractor_deleted"> | |
| 10978 <h2 | |
| 10979 class="history_metadata_extractor_h2" | |
| 10980 style="cursor: pointer" | |
| 10981 title="click to fold/unfold the table" | |
| 10982 > | |
| 10983 [DELETED] - corrtable - 1.0.0 | |
| 10984 </h2> | |
| 10985 <p> | |
| 10986 Outputs: | |
| 10987 </p> | |
| 10988 <p class="history_metadata_extractor_status"> | |
| 10989 Status: Ok (0) | |
| 10990 </p> | |
| 10991 <p class="history_metadata_extractor_glitter"></p> | |
| 10992 <table class=" | |
| 10993 table | |
| 10994 table-bordered | |
| 10995 table-dark | |
| 10996 table-striped | |
| 10997 table-hover | |
| 10998 d-block | |
| 10999 overflow-auto | |
| 11000 history_metadata_extractor_table | |
| 11001 "> | |
| 11002 <thead> | |
| 11003 <tr> | |
| 11004 <th scope="col"></th> | |
| 11005 <th scope="col">value</th> | |
| 11006 <th scope="col">name</th> | |
| 11007 <th scope="col">extension</th> | |
| 11008 <th scope="col">hid</th> | |
| 11009 </tr> | |
| 11010 </thead> | |
| 11011 <tr class=""> | |
| 11012 <th scope="row">corr_method</th> | |
| 11013 <td>pearson</td> | |
| 11014 <td></td> | |
| 11015 <td></td> | |
| 11016 <td></td> | |
| 11017 </tr><tr class=""> | |
| 11018 <th scope="row">filter</th> | |
| 11019 <td>no</td> | |
| 11020 <td></td> | |
| 11021 <td></td> | |
| 11022 <td></td> | |
| 11023 </tr><tr class=""> | |
| 11024 <th scope="row">test_corr</th> | |
| 11025 <td>no</td> | |
| 11026 <td></td> | |
| 11027 <td></td> | |
| 11028 <td></td> | |
| 11029 </tr><tr class=""> | |
| 11030 <th scope="row">color_heatmap</th> | |
| 11031 <td>no</td> | |
| 11032 <td></td> | |
| 11033 <td></td> | |
| 11034 <td></td> | |
| 11035 </tr><tr class=""> | |
| 11036 <th scope="row">plot_choice</th> | |
| 11037 <td>auto</td> | |
| 11038 <td></td> | |
| 11039 <td></td> | |
| 11040 <td></td> | |
| 11041 </tr><tr class=""> | |
| 11042 <th scope="row">reorder_var</th> | |
| 11043 <td>no</td> | |
| 11044 <td></td> | |
| 11045 <td></td> | |
| 11046 <td></td> | |
| 11047 </tr><tr class=""> | |
| 11048 <th scope="row">tab1_in</th> | |
| 11049 <td>7cf499d16bd542b2</td> | |
| 11050 <td>compounds_pos.txt</td> | |
| 11051 <td>tabular</td> | |
| 11052 <td>44</td> | |
| 11053 </tr><tr class=""> | |
| 11054 <th scope="row">tab1_samples</th> | |
| 11055 <td>row</td> | |
| 11056 <td></td> | |
| 11057 <td></td> | |
| 11058 <td></td> | |
| 11059 </tr><tr class=""> | |
| 11060 <th scope="row">tab2_in</th> | |
| 11061 <td>7cf499d16bd542b2</td> | |
| 11062 <td>compounds_pos.txt</td> | |
| 11063 <td>tabular</td> | |
| 11064 <td>44</td> | |
| 11065 </tr><tr class=""> | |
| 11066 <th scope="row">tab2_samples</th> | |
| 11067 <td>row</td> | |
| 11068 <td></td> | |
| 11069 <td></td> | |
| 11070 <td></td> | |
| 11071 </tr> | |
| 11072 </table> | |
| 11073 </div> | |
| 11074 | |
| 11075 | |
| 11076 <div class="alert alert-success history_metadata_extractor_deleted"> | |
| 11077 <h2 | |
| 11078 class="history_metadata_extractor_h2" | |
| 11079 style="cursor: pointer" | |
| 11080 title="click to fold/unfold the table" | |
| 11081 > | |
| 11082 [DELETED] - corrtable - 1.0.0 | |
| 11083 </h2> | |
| 11084 <p> | |
| 11085 Outputs: | |
| 11086 </p> | |
| 11087 <p class="history_metadata_extractor_status"> | |
| 11088 Status: Ok (0) | |
| 11089 </p> | |
| 11090 <p class="history_metadata_extractor_glitter"></p> | |
| 11091 <table class=" | |
| 11092 table | |
| 11093 table-bordered | |
| 11094 table-dark | |
| 11095 table-striped | |
| 11096 table-hover | |
| 11097 d-block | |
| 11098 overflow-auto | |
| 11099 history_metadata_extractor_table | |
| 11100 "> | |
| 11101 <thead> | |
| 11102 <tr> | |
| 11103 <th scope="col"></th> | |
| 11104 <th scope="col">value</th> | |
| 11105 <th scope="col">name</th> | |
| 11106 <th scope="col">extension</th> | |
| 11107 <th scope="col">hid</th> | |
| 11108 </tr> | |
| 11109 </thead> | |
| 11110 <tr class=""> | |
| 11111 <th scope="row">corr_method</th> | |
| 11112 <td>pearson</td> | |
| 11113 <td></td> | |
| 11114 <td></td> | |
| 11115 <td></td> | |
| 11116 </tr><tr class=""> | |
| 11117 <th scope="row">filter</th> | |
| 11118 <td>no</td> | |
| 11119 <td></td> | |
| 11120 <td></td> | |
| 11121 <td></td> | |
| 11122 </tr><tr class=""> | |
| 11123 <th scope="row">test_corr</th> | |
| 11124 <td>no</td> | |
| 11125 <td></td> | |
| 11126 <td></td> | |
| 11127 <td></td> | |
| 11128 </tr><tr class=""> | |
| 11129 <th scope="row">color_heatmap</th> | |
| 11130 <td>no</td> | |
| 11131 <td></td> | |
| 11132 <td></td> | |
| 11133 <td></td> | |
| 11134 </tr><tr class=""> | |
| 11135 <th scope="row">plot_choice</th> | |
| 11136 <td>auto</td> | |
| 11137 <td></td> | |
| 11138 <td></td> | |
| 11139 <td></td> | |
| 11140 </tr><tr class=""> | |
| 11141 <th scope="row">reorder_var</th> | |
| 11142 <td>no</td> | |
| 11143 <td></td> | |
| 11144 <td></td> | |
| 11145 <td></td> | |
| 11146 </tr><tr class=""> | |
| 11147 <th scope="row">tab1_in</th> | |
| 11148 <td>7cf499d16bd542b2</td> | |
| 11149 <td>compounds_pos.txt</td> | |
| 11150 <td>tabular</td> | |
| 11151 <td>44</td> | |
| 11152 </tr><tr class=""> | |
| 11153 <th scope="row">tab1_samples</th> | |
| 11154 <td>row</td> | |
| 11155 <td></td> | |
| 11156 <td></td> | |
| 11157 <td></td> | |
| 11158 </tr><tr class=""> | |
| 11159 <th scope="row">tab2_in</th> | |
| 11160 <td>7cf499d16bd542b2</td> | |
| 11161 <td>compounds_pos.txt</td> | |
| 11162 <td>tabular</td> | |
| 11163 <td>44</td> | |
| 11164 </tr><tr class=""> | |
| 11165 <th scope="row">tab2_samples</th> | |
| 11166 <td>row</td> | |
| 11167 <td></td> | |
| 11168 <td></td> | |
| 11169 <td></td> | |
| 11170 </tr> | |
| 11171 </table> | |
| 11172 </div> | |
| 11173 | |
| 11174 | |
| 11175 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 11176 <h2 | |
| 11177 class="history_metadata_extractor_h2" | |
| 11178 style="cursor: pointer" | |
| 11179 title="click to fold/unfold the table" | |
| 11180 > | |
| 11181 [DELETED] - Multivariate - 2.4.0 | |
| 11182 </h2> | |
| 11183 <p> | |
| 11184 Outputs: | |
| 11185 </p> | |
| 11186 <p class="history_metadata_extractor_status"> | |
| 11187 Status: Failed (1) | |
| 11188 </p> | |
| 11189 <p class="history_metadata_extractor_glitter"></p> | |
| 11190 <table class=" | |
| 11191 table | |
| 11192 table-bordered | |
| 11193 table-dark | |
| 11194 table-striped | |
| 11195 table-hover | |
| 11196 d-block | |
| 11197 overflow-auto | |
| 11198 history_metadata_extractor_table | |
| 11199 "> | |
| 11200 <thead> | |
| 11201 <tr> | |
| 11202 <th scope="col"></th> | |
| 11203 <th scope="col">value</th> | |
| 11204 <th scope="col">name</th> | |
| 11205 <th scope="col">extension</th> | |
| 11206 <th scope="col">hid</th> | |
| 11207 </tr> | |
| 11208 </thead> | |
| 11209 <tr class=""> | |
| 11210 <th scope="row">algorithm</th> | |
| 11211 <td>default</td> | |
| 11212 <td></td> | |
| 11213 <td></td> | |
| 11214 <td></td> | |
| 11215 </tr><tr class=""> | |
| 11216 <th scope="row">cross_validation_number</th> | |
| 11217 <td>7</td> | |
| 11218 <td></td> | |
| 11219 <td></td> | |
| 11220 <td></td> | |
| 11221 </tr><tr class=""> | |
| 11222 <th scope="row">log10L</th> | |
| 11223 <td>FALSE</td> | |
| 11224 <td></td> | |
| 11225 <td></td> | |
| 11226 <td></td> | |
| 11227 </tr><tr class=""> | |
| 11228 <th scope="row">permutation_number</th> | |
| 11229 <td>20</td> | |
| 11230 <td></td> | |
| 11231 <td></td> | |
| 11232 <td></td> | |
| 11233 </tr><tr class=""> | |
| 11234 <th scope="row">scaling</th> | |
| 11235 <td>standard</td> | |
| 11236 <td></td> | |
| 11237 <td></td> | |
| 11238 <td></td> | |
| 11239 </tr><tr class=""> | |
| 11240 <th scope="row">dataMatrix_in</th> | |
| 11241 <td>9a0ce47bd1734ae7</td> | |
| 11242 <td>peaklist_fragments.tsv</td> | |
| 11243 <td>tabular</td> | |
| 11244 <td>42</td> | |
| 11245 </tr><tr class=""> | |
| 11246 <th scope="row">abcissa_parameter</th> | |
| 11247 <td>1</td> | |
| 11248 <td></td> | |
| 11249 <td></td> | |
| 11250 <td></td> | |
| 11251 </tr><tr class=""> | |
| 11252 <th scope="row">color_parameter</th> | |
| 11253 <td>None</td> | |
| 11254 <td></td> | |
| 11255 <td></td> | |
| 11256 <td></td> | |
| 11257 </tr><tr class=""> | |
| 11258 <th scope="row">ellipsis_component</th> | |
| 11259 <td>NA</td> | |
| 11260 <td></td> | |
| 11261 <td></td> | |
| 11262 <td></td> | |
| 11263 </tr><tr class=""> | |
| 11264 <th scope="row">graphic_type</th> | |
| 11265 <td>summary</td> | |
| 11266 <td></td> | |
| 11267 <td></td> | |
| 11268 <td></td> | |
| 11269 </tr><tr class=""> | |
| 11270 <th scope="row">labels_parameter</th> | |
| 11271 <td>None</td> | |
| 11272 <td></td> | |
| 11273 <td></td> | |
| 11274 <td></td> | |
| 11275 </tr><tr class=""> | |
| 11276 <th scope="row">magnify_text</th> | |
| 11277 <td>0.8</td> | |
| 11278 <td></td> | |
| 11279 <td></td> | |
| 11280 <td></td> | |
| 11281 </tr><tr class=""> | |
| 11282 <th scope="row">ordinate_parameter</th> | |
| 11283 <td>2</td> | |
| 11284 <td></td> | |
| 11285 <td></td> | |
| 11286 <td></td> | |
| 11287 </tr><tr class=""> | |
| 11288 <th scope="row">orthogonal_component_number</th> | |
| 11289 <td>0</td> | |
| 11290 <td></td> | |
| 11291 <td></td> | |
| 11292 <td></td> | |
| 11293 </tr><tr class=""> | |
| 11294 <th scope="row">predictive_component_number</th> | |
| 11295 <td>NA</td> | |
| 11296 <td></td> | |
| 11297 <td></td> | |
| 11298 <td></td> | |
| 11299 </tr><tr class=""> | |
| 11300 <th scope="row">response_component</th> | |
| 11301 <td>1</td> | |
| 11302 <td></td> | |
| 11303 <td></td> | |
| 11304 <td></td> | |
| 11305 </tr><tr class=""> | |
| 11306 <th scope="row">sampleMetadata_in</th> | |
| 11307 <td>9a0ce47bd1734ae7</td> | |
| 11308 <td>peaklist_fragments.tsv</td> | |
| 11309 <td>tabular</td> | |
| 11310 <td>42</td> | |
| 11311 </tr><tr class=""> | |
| 11312 <th scope="row">save_rdata</th> | |
| 11313 <td>false</td> | |
| 11314 <td></td> | |
| 11315 <td></td> | |
| 11316 <td></td> | |
| 11317 </tr><tr class=""> | |
| 11318 <th scope="row">test_sample</th> | |
| 11319 <td>FALSE</td> | |
| 11320 <td></td> | |
| 11321 <td></td> | |
| 11322 <td></td> | |
| 11323 </tr><tr class=""> | |
| 11324 <th scope="row">variableMetadata_in</th> | |
| 11325 <td>9a0ce47bd1734ae7</td> | |
| 11326 <td>peaklist_fragments.tsv</td> | |
| 11327 <td>tabular</td> | |
| 11328 <td>42</td> | |
| 11329 </tr> | |
| 11330 </table> | |
| 11331 </div> | |
| 11332 | |
| 11333 | |
| 11334 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 11335 <h2 | |
| 11336 class="history_metadata_extractor_h2" | |
| 11337 style="cursor: pointer" | |
| 11338 title="click to fold/unfold the table" | |
| 11339 > | |
| 11340 [DELETED] - Multivariate - 2.4.0 | |
| 11341 </h2> | |
| 11342 <p> | |
| 11343 Outputs: | |
| 11344 </p> | |
| 11345 <p class="history_metadata_extractor_status"> | |
| 11346 Status: Failed (1) | |
| 11347 </p> | |
| 11348 <p class="history_metadata_extractor_glitter"></p> | |
| 11349 <table class=" | |
| 11350 table | |
| 11351 table-bordered | |
| 11352 table-dark | |
| 11353 table-striped | |
| 11354 table-hover | |
| 11355 d-block | |
| 11356 overflow-auto | |
| 11357 history_metadata_extractor_table | |
| 11358 "> | |
| 11359 <thead> | |
| 11360 <tr> | |
| 11361 <th scope="col"></th> | |
| 11362 <th scope="col">value</th> | |
| 11363 <th scope="col">name</th> | |
| 11364 <th scope="col">extension</th> | |
| 11365 <th scope="col">hid</th> | |
| 11366 </tr> | |
| 11367 </thead> | |
| 11368 <tr class=""> | |
| 11369 <th scope="row">algorithm</th> | |
| 11370 <td>default</td> | |
| 11371 <td></td> | |
| 11372 <td></td> | |
| 11373 <td></td> | |
| 11374 </tr><tr class=""> | |
| 11375 <th scope="row">cross_validation_number</th> | |
| 11376 <td>7</td> | |
| 11377 <td></td> | |
| 11378 <td></td> | |
| 11379 <td></td> | |
| 11380 </tr><tr class=""> | |
| 11381 <th scope="row">log10L</th> | |
| 11382 <td>FALSE</td> | |
| 11383 <td></td> | |
| 11384 <td></td> | |
| 11385 <td></td> | |
| 11386 </tr><tr class=""> | |
| 11387 <th scope="row">permutation_number</th> | |
| 11388 <td>20</td> | |
| 11389 <td></td> | |
| 11390 <td></td> | |
| 11391 <td></td> | |
| 11392 </tr><tr class=""> | |
| 11393 <th scope="row">scaling</th> | |
| 11394 <td>standard</td> | |
| 11395 <td></td> | |
| 11396 <td></td> | |
| 11397 <td></td> | |
| 11398 </tr><tr class=""> | |
| 11399 <th scope="row">dataMatrix_in</th> | |
| 11400 <td>9a0ce47bd1734ae7</td> | |
| 11401 <td>peaklist_fragments.tsv</td> | |
| 11402 <td>tabular</td> | |
| 11403 <td>42</td> | |
| 11404 </tr><tr class=""> | |
| 11405 <th scope="row">abcissa_parameter</th> | |
| 11406 <td>1</td> | |
| 11407 <td></td> | |
| 11408 <td></td> | |
| 11409 <td></td> | |
| 11410 </tr><tr class=""> | |
| 11411 <th scope="row">color_parameter</th> | |
| 11412 <td>None</td> | |
| 11413 <td></td> | |
| 11414 <td></td> | |
| 11415 <td></td> | |
| 11416 </tr><tr class=""> | |
| 11417 <th scope="row">ellipsis_component</th> | |
| 11418 <td>NA</td> | |
| 11419 <td></td> | |
| 11420 <td></td> | |
| 11421 <td></td> | |
| 11422 </tr><tr class=""> | |
| 11423 <th scope="row">graphic_type</th> | |
| 11424 <td>summary</td> | |
| 11425 <td></td> | |
| 11426 <td></td> | |
| 11427 <td></td> | |
| 11428 </tr><tr class=""> | |
| 11429 <th scope="row">labels_parameter</th> | |
| 11430 <td>None</td> | |
| 11431 <td></td> | |
| 11432 <td></td> | |
| 11433 <td></td> | |
| 11434 </tr><tr class=""> | |
| 11435 <th scope="row">magnify_text</th> | |
| 11436 <td>0.8</td> | |
| 11437 <td></td> | |
| 11438 <td></td> | |
| 11439 <td></td> | |
| 11440 </tr><tr class=""> | |
| 11441 <th scope="row">ordinate_parameter</th> | |
| 11442 <td>2</td> | |
| 11443 <td></td> | |
| 11444 <td></td> | |
| 11445 <td></td> | |
| 11446 </tr><tr class=""> | |
| 11447 <th scope="row">orthogonal_component_number</th> | |
| 11448 <td>0</td> | |
| 11449 <td></td> | |
| 11450 <td></td> | |
| 11451 <td></td> | |
| 11452 </tr><tr class=""> | |
| 11453 <th scope="row">predictive_component_number</th> | |
| 11454 <td>NA</td> | |
| 11455 <td></td> | |
| 11456 <td></td> | |
| 11457 <td></td> | |
| 11458 </tr><tr class=""> | |
| 11459 <th scope="row">response_component</th> | |
| 11460 <td>1</td> | |
| 11461 <td></td> | |
| 11462 <td></td> | |
| 11463 <td></td> | |
| 11464 </tr><tr class=""> | |
| 11465 <th scope="row">sampleMetadata_in</th> | |
| 11466 <td>9a0ce47bd1734ae7</td> | |
| 11467 <td>peaklist_fragments.tsv</td> | |
| 11468 <td>tabular</td> | |
| 11469 <td>42</td> | |
| 11470 </tr><tr class=""> | |
| 11471 <th scope="row">save_rdata</th> | |
| 11472 <td>false</td> | |
| 11473 <td></td> | |
| 11474 <td></td> | |
| 11475 <td></td> | |
| 11476 </tr><tr class=""> | |
| 11477 <th scope="row">test_sample</th> | |
| 11478 <td>FALSE</td> | |
| 11479 <td></td> | |
| 11480 <td></td> | |
| 11481 <td></td> | |
| 11482 </tr><tr class=""> | |
| 11483 <th scope="row">variableMetadata_in</th> | |
| 11484 <td>9a0ce47bd1734ae7</td> | |
| 11485 <td>peaklist_fragments.tsv</td> | |
| 11486 <td>tabular</td> | |
| 11487 <td>42</td> | |
| 11488 </tr> | |
| 11489 </table> | |
| 11490 </div> | |
| 11491 | |
| 11492 | |
| 11493 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 11494 <h2 | |
| 11495 class="history_metadata_extractor_h2" | |
| 11496 style="cursor: pointer" | |
| 11497 title="click to fold/unfold the table" | |
| 11498 > | |
| 11499 [DELETED] - Multivariate - 2.4.0 | |
| 11500 </h2> | |
| 11501 <p> | |
| 11502 Outputs: | |
| 11503 </p> | |
| 11504 <p class="history_metadata_extractor_status"> | |
| 11505 Status: Failed (1) | |
| 11506 </p> | |
| 11507 <p class="history_metadata_extractor_glitter"></p> | |
| 11508 <table class=" | |
| 11509 table | |
| 11510 table-bordered | |
| 11511 table-dark | |
| 11512 table-striped | |
| 11513 table-hover | |
| 11514 d-block | |
| 11515 overflow-auto | |
| 11516 history_metadata_extractor_table | |
| 11517 "> | |
| 11518 <thead> | |
| 11519 <tr> | |
| 11520 <th scope="col"></th> | |
| 11521 <th scope="col">value</th> | |
| 11522 <th scope="col">name</th> | |
| 11523 <th scope="col">extension</th> | |
| 11524 <th scope="col">hid</th> | |
| 11525 </tr> | |
| 11526 </thead> | |
| 11527 <tr class=""> | |
| 11528 <th scope="row">algorithm</th> | |
| 11529 <td>default</td> | |
| 11530 <td></td> | |
| 11531 <td></td> | |
| 11532 <td></td> | |
| 11533 </tr><tr class=""> | |
| 11534 <th scope="row">cross_validation_number</th> | |
| 11535 <td>7</td> | |
| 11536 <td></td> | |
| 11537 <td></td> | |
| 11538 <td></td> | |
| 11539 </tr><tr class=""> | |
| 11540 <th scope="row">log10L</th> | |
| 11541 <td>FALSE</td> | |
| 11542 <td></td> | |
| 11543 <td></td> | |
| 11544 <td></td> | |
| 11545 </tr><tr class=""> | |
| 11546 <th scope="row">permutation_number</th> | |
| 11547 <td>20</td> | |
| 11548 <td></td> | |
| 11549 <td></td> | |
| 11550 <td></td> | |
| 11551 </tr><tr class=""> | |
| 11552 <th scope="row">scaling</th> | |
| 11553 <td>standard</td> | |
| 11554 <td></td> | |
| 11555 <td></td> | |
| 11556 <td></td> | |
| 11557 </tr><tr class=""> | |
| 11558 <th scope="row">dataMatrix_in</th> | |
| 11559 <td>9a0ce47bd1734ae7</td> | |
| 11560 <td>peaklist_fragments.tsv</td> | |
| 11561 <td>tabular</td> | |
| 11562 <td>42</td> | |
| 11563 </tr><tr class=""> | |
| 11564 <th scope="row">abcissa_parameter</th> | |
| 11565 <td>1</td> | |
| 11566 <td></td> | |
| 11567 <td></td> | |
| 11568 <td></td> | |
| 11569 </tr><tr class=""> | |
| 11570 <th scope="row">color_parameter</th> | |
| 11571 <td>None</td> | |
| 11572 <td></td> | |
| 11573 <td></td> | |
| 11574 <td></td> | |
| 11575 </tr><tr class=""> | |
| 11576 <th scope="row">ellipsis_component</th> | |
| 11577 <td>NA</td> | |
| 11578 <td></td> | |
| 11579 <td></td> | |
| 11580 <td></td> | |
| 11581 </tr><tr class=""> | |
| 11582 <th scope="row">graphic_type</th> | |
| 11583 <td>summary</td> | |
| 11584 <td></td> | |
| 11585 <td></td> | |
| 11586 <td></td> | |
| 11587 </tr><tr class=""> | |
| 11588 <th scope="row">labels_parameter</th> | |
| 11589 <td>None</td> | |
| 11590 <td></td> | |
| 11591 <td></td> | |
| 11592 <td></td> | |
| 11593 </tr><tr class=""> | |
| 11594 <th scope="row">magnify_text</th> | |
| 11595 <td>0.8</td> | |
| 11596 <td></td> | |
| 11597 <td></td> | |
| 11598 <td></td> | |
| 11599 </tr><tr class=""> | |
| 11600 <th scope="row">ordinate_parameter</th> | |
| 11601 <td>2</td> | |
| 11602 <td></td> | |
| 11603 <td></td> | |
| 11604 <td></td> | |
| 11605 </tr><tr class=""> | |
| 11606 <th scope="row">orthogonal_component_number</th> | |
| 11607 <td>0</td> | |
| 11608 <td></td> | |
| 11609 <td></td> | |
| 11610 <td></td> | |
| 11611 </tr><tr class=""> | |
| 11612 <th scope="row">predictive_component_number</th> | |
| 11613 <td>NA</td> | |
| 11614 <td></td> | |
| 11615 <td></td> | |
| 11616 <td></td> | |
| 11617 </tr><tr class=""> | |
| 11618 <th scope="row">response_component</th> | |
| 11619 <td>1</td> | |
| 11620 <td></td> | |
| 11621 <td></td> | |
| 11622 <td></td> | |
| 11623 </tr><tr class=""> | |
| 11624 <th scope="row">sampleMetadata_in</th> | |
| 11625 <td>9a0ce47bd1734ae7</td> | |
| 11626 <td>peaklist_fragments.tsv</td> | |
| 11627 <td>tabular</td> | |
| 11628 <td>42</td> | |
| 11629 </tr><tr class=""> | |
| 11630 <th scope="row">save_rdata</th> | |
| 11631 <td>false</td> | |
| 11632 <td></td> | |
| 11633 <td></td> | |
| 11634 <td></td> | |
| 11635 </tr><tr class=""> | |
| 11636 <th scope="row">test_sample</th> | |
| 11637 <td>FALSE</td> | |
| 11638 <td></td> | |
| 11639 <td></td> | |
| 11640 <td></td> | |
| 11641 </tr><tr class=""> | |
| 11642 <th scope="row">variableMetadata_in</th> | |
| 11643 <td>9a0ce47bd1734ae7</td> | |
| 11644 <td>peaklist_fragments.tsv</td> | |
| 11645 <td>tabular</td> | |
| 11646 <td>42</td> | |
| 11647 </tr> | |
| 11648 </table> | |
| 11649 </div> | |
| 11650 | |
| 11651 | |
| 11652 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 11653 <h2 | |
| 11654 class="history_metadata_extractor_h2" | |
| 11655 style="cursor: pointer" | |
| 11656 title="click to fold/unfold the table" | |
| 11657 > | |
| 11658 [DELETED] - Multivariate - 2.4.0 | |
| 11659 </h2> | |
| 11660 <p> | |
| 11661 Outputs: | |
| 11662 </p> | |
| 11663 <p class="history_metadata_extractor_status"> | |
| 11664 Status: Failed (1) | |
| 11665 </p> | |
| 11666 <p class="history_metadata_extractor_glitter"></p> | |
| 11667 <table class=" | |
| 11668 table | |
| 11669 table-bordered | |
| 11670 table-dark | |
| 11671 table-striped | |
| 11672 table-hover | |
| 11673 d-block | |
| 11674 overflow-auto | |
| 11675 history_metadata_extractor_table | |
| 11676 "> | |
| 11677 <thead> | |
| 11678 <tr> | |
| 11679 <th scope="col"></th> | |
| 11680 <th scope="col">value</th> | |
| 11681 <th scope="col">name</th> | |
| 11682 <th scope="col">extension</th> | |
| 11683 <th scope="col">hid</th> | |
| 11684 </tr> | |
| 11685 </thead> | |
| 11686 <tr class=""> | |
| 11687 <th scope="row">algorithm</th> | |
| 11688 <td>default</td> | |
| 11689 <td></td> | |
| 11690 <td></td> | |
| 11691 <td></td> | |
| 11692 </tr><tr class=""> | |
| 11693 <th scope="row">cross_validation_number</th> | |
| 11694 <td>7</td> | |
| 11695 <td></td> | |
| 11696 <td></td> | |
| 11697 <td></td> | |
| 11698 </tr><tr class=""> | |
| 11699 <th scope="row">log10L</th> | |
| 11700 <td>FALSE</td> | |
| 11701 <td></td> | |
| 11702 <td></td> | |
| 11703 <td></td> | |
| 11704 </tr><tr class=""> | |
| 11705 <th scope="row">permutation_number</th> | |
| 11706 <td>20</td> | |
| 11707 <td></td> | |
| 11708 <td></td> | |
| 11709 <td></td> | |
| 11710 </tr><tr class=""> | |
| 11711 <th scope="row">scaling</th> | |
| 11712 <td>standard</td> | |
| 11713 <td></td> | |
| 11714 <td></td> | |
| 11715 <td></td> | |
| 11716 </tr><tr class=""> | |
| 11717 <th scope="row">dataMatrix_in</th> | |
| 11718 <td>9a0ce47bd1734ae7</td> | |
| 11719 <td>peaklist_fragments.tsv</td> | |
| 11720 <td>tabular</td> | |
| 11721 <td>42</td> | |
| 11722 </tr><tr class=""> | |
| 11723 <th scope="row">abcissa_parameter</th> | |
| 11724 <td>1</td> | |
| 11725 <td></td> | |
| 11726 <td></td> | |
| 11727 <td></td> | |
| 11728 </tr><tr class=""> | |
| 11729 <th scope="row">color_parameter</th> | |
| 11730 <td>None</td> | |
| 11731 <td></td> | |
| 11732 <td></td> | |
| 11733 <td></td> | |
| 11734 </tr><tr class=""> | |
| 11735 <th scope="row">ellipsis_component</th> | |
| 11736 <td>NA</td> | |
| 11737 <td></td> | |
| 11738 <td></td> | |
| 11739 <td></td> | |
| 11740 </tr><tr class=""> | |
| 11741 <th scope="row">graphic_type</th> | |
| 11742 <td>summary</td> | |
| 11743 <td></td> | |
| 11744 <td></td> | |
| 11745 <td></td> | |
| 11746 </tr><tr class=""> | |
| 11747 <th scope="row">labels_parameter</th> | |
| 11748 <td>None</td> | |
| 11749 <td></td> | |
| 11750 <td></td> | |
| 11751 <td></td> | |
| 11752 </tr><tr class=""> | |
| 11753 <th scope="row">magnify_text</th> | |
| 11754 <td>0.8</td> | |
| 11755 <td></td> | |
| 11756 <td></td> | |
| 11757 <td></td> | |
| 11758 </tr><tr class=""> | |
| 11759 <th scope="row">ordinate_parameter</th> | |
| 11760 <td>2</td> | |
| 11761 <td></td> | |
| 11762 <td></td> | |
| 11763 <td></td> | |
| 11764 </tr><tr class=""> | |
| 11765 <th scope="row">orthogonal_component_number</th> | |
| 11766 <td>0</td> | |
| 11767 <td></td> | |
| 11768 <td></td> | |
| 11769 <td></td> | |
| 11770 </tr><tr class=""> | |
| 11771 <th scope="row">predictive_component_number</th> | |
| 11772 <td>NA</td> | |
| 11773 <td></td> | |
| 11774 <td></td> | |
| 11775 <td></td> | |
| 11776 </tr><tr class=""> | |
| 11777 <th scope="row">response_component</th> | |
| 11778 <td>1</td> | |
| 11779 <td></td> | |
| 11780 <td></td> | |
| 11781 <td></td> | |
| 11782 </tr><tr class=""> | |
| 11783 <th scope="row">sampleMetadata_in</th> | |
| 11784 <td>9a0ce47bd1734ae7</td> | |
| 11785 <td>peaklist_fragments.tsv</td> | |
| 11786 <td>tabular</td> | |
| 11787 <td>42</td> | |
| 11788 </tr><tr class=""> | |
| 11789 <th scope="row">save_rdata</th> | |
| 11790 <td>false</td> | |
| 11791 <td></td> | |
| 11792 <td></td> | |
| 11793 <td></td> | |
| 11794 </tr><tr class=""> | |
| 11795 <th scope="row">test_sample</th> | |
| 11796 <td>FALSE</td> | |
| 11797 <td></td> | |
| 11798 <td></td> | |
| 11799 <td></td> | |
| 11800 </tr><tr class=""> | |
| 11801 <th scope="row">variableMetadata_in</th> | |
| 11802 <td>9a0ce47bd1734ae7</td> | |
| 11803 <td>peaklist_fragments.tsv</td> | |
| 11804 <td>tabular</td> | |
| 11805 <td>42</td> | |
| 11806 </tr> | |
| 11807 </table> | |
| 11808 </div> | |
| 11809 | |
| 11810 | |
| 11811 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 11812 <h2 | |
| 11813 class="history_metadata_extractor_h2" | |
| 11814 style="cursor: pointer" | |
| 11815 title="click to fold/unfold the table" | |
| 11816 > | |
| 11817 [DELETED] - biosigner - 2.2.7 | |
| 11818 </h2> | |
| 11819 <p> | |
| 11820 Outputs: | |
| 11821 </p> | |
| 11822 <p class="history_metadata_extractor_status"> | |
| 11823 Status: Failed (1) | |
| 11824 </p> | |
| 11825 <p class="history_metadata_extractor_glitter"></p> | |
| 11826 <table class=" | |
| 11827 table | |
| 11828 table-bordered | |
| 11829 table-dark | |
| 11830 table-striped | |
| 11831 table-hover | |
| 11832 d-block | |
| 11833 overflow-auto | |
| 11834 history_metadata_extractor_table | |
| 11835 "> | |
| 11836 <thead> | |
| 11837 <tr> | |
| 11838 <th scope="col"></th> | |
| 11839 <th scope="col">value</th> | |
| 11840 <th scope="col">name</th> | |
| 11841 <th scope="col">extension</th> | |
| 11842 <th scope="col">hid</th> | |
| 11843 </tr> | |
| 11844 </thead> | |
| 11845 <tr class=""> | |
| 11846 <th scope="row">opcC</th> | |
| 11847 <td>default</td> | |
| 11848 <td></td> | |
| 11849 <td></td> | |
| 11850 <td></td> | |
| 11851 </tr><tr class=""> | |
| 11852 <th scope="row">dataMatrix_in</th> | |
| 11853 <td>9a0ce47bd1734ae7</td> | |
| 11854 <td>peaklist_fragments.tsv</td> | |
| 11855 <td>tabular</td> | |
| 11856 <td>42</td> | |
| 11857 </tr><tr class=""> | |
| 11858 <th scope="row">respC</th> | |
| 11859 <td></td> | |
| 11860 <td></td> | |
| 11861 <td></td> | |
| 11862 <td></td> | |
| 11863 </tr><tr class=""> | |
| 11864 <th scope="row">sampleMetadata_in</th> | |
| 11865 <td>9a0ce47bd1734ae7</td> | |
| 11866 <td>peaklist_fragments.tsv</td> | |
| 11867 <td>tabular</td> | |
| 11868 <td>42</td> | |
| 11869 </tr><tr class=""> | |
| 11870 <th scope="row">variableMetadata_in</th> | |
| 11871 <td>9a0ce47bd1734ae7</td> | |
| 11872 <td>peaklist_fragments.tsv</td> | |
| 11873 <td>tabular</td> | |
| 11874 <td>42</td> | |
| 11875 </tr> | |
| 11876 </table> | |
| 11877 </div> | |
| 11878 | |
| 11879 | |
| 11880 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 11881 <h2 | |
| 11882 class="history_metadata_extractor_h2" | |
| 11883 style="cursor: pointer" | |
| 11884 title="click to fold/unfold the table" | |
| 11885 > | |
| 11886 [DELETED] - biosigner - 2.2.7 | |
| 11887 </h2> | |
| 11888 <p> | |
| 11889 Outputs: | |
| 11890 </p> | |
| 11891 <p class="history_metadata_extractor_status"> | |
| 11892 Status: Failed (1) | |
| 11893 </p> | |
| 11894 <p class="history_metadata_extractor_glitter"></p> | |
| 11895 <table class=" | |
| 11896 table | |
| 11897 table-bordered | |
| 11898 table-dark | |
| 11899 table-striped | |
| 11900 table-hover | |
| 11901 d-block | |
| 11902 overflow-auto | |
| 11903 history_metadata_extractor_table | |
| 11904 "> | |
| 11905 <thead> | |
| 11906 <tr> | |
| 11907 <th scope="col"></th> | |
| 11908 <th scope="col">value</th> | |
| 11909 <th scope="col">name</th> | |
| 11910 <th scope="col">extension</th> | |
| 11911 <th scope="col">hid</th> | |
| 11912 </tr> | |
| 11913 </thead> | |
| 11914 <tr class=""> | |
| 11915 <th scope="row">opcC</th> | |
| 11916 <td>default</td> | |
| 11917 <td></td> | |
| 11918 <td></td> | |
| 11919 <td></td> | |
| 11920 </tr><tr class=""> | |
| 11921 <th scope="row">dataMatrix_in</th> | |
| 11922 <td>9a0ce47bd1734ae7</td> | |
| 11923 <td>peaklist_fragments.tsv</td> | |
| 11924 <td>tabular</td> | |
| 11925 <td>42</td> | |
| 11926 </tr><tr class=""> | |
| 11927 <th scope="row">respC</th> | |
| 11928 <td></td> | |
| 11929 <td></td> | |
| 11930 <td></td> | |
| 11931 <td></td> | |
| 11932 </tr><tr class=""> | |
| 11933 <th scope="row">sampleMetadata_in</th> | |
| 11934 <td>9a0ce47bd1734ae7</td> | |
| 11935 <td>peaklist_fragments.tsv</td> | |
| 11936 <td>tabular</td> | |
| 11937 <td>42</td> | |
| 11938 </tr><tr class=""> | |
| 11939 <th scope="row">variableMetadata_in</th> | |
| 11940 <td>9a0ce47bd1734ae7</td> | |
| 11941 <td>peaklist_fragments.tsv</td> | |
| 11942 <td>tabular</td> | |
| 11943 <td>42</td> | |
| 11944 </tr> | |
| 11945 </table> | |
| 11946 </div> | |
| 11947 | |
| 11948 | |
| 11949 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 11950 <h2 | |
| 11951 class="history_metadata_extractor_h2" | |
| 11952 style="cursor: pointer" | |
| 11953 title="click to fold/unfold the table" | |
| 11954 > | |
| 11955 [DELETED] - biosigner - 2.2.7 | |
| 11956 </h2> | |
| 11957 <p> | |
| 11958 Outputs: | |
| 11959 </p> | |
| 11960 <p class="history_metadata_extractor_status"> | |
| 11961 Status: Failed (1) | |
| 11962 </p> | |
| 11963 <p class="history_metadata_extractor_glitter"></p> | |
| 11964 <table class=" | |
| 11965 table | |
| 11966 table-bordered | |
| 11967 table-dark | |
| 11968 table-striped | |
| 11969 table-hover | |
| 11970 d-block | |
| 11971 overflow-auto | |
| 11972 history_metadata_extractor_table | |
| 11973 "> | |
| 11974 <thead> | |
| 11975 <tr> | |
| 11976 <th scope="col"></th> | |
| 11977 <th scope="col">value</th> | |
| 11978 <th scope="col">name</th> | |
| 11979 <th scope="col">extension</th> | |
| 11980 <th scope="col">hid</th> | |
| 11981 </tr> | |
| 11982 </thead> | |
| 11983 <tr class=""> | |
| 11984 <th scope="row">opcC</th> | |
| 11985 <td>default</td> | |
| 11986 <td></td> | |
| 11987 <td></td> | |
| 11988 <td></td> | |
| 11989 </tr><tr class=""> | |
| 11990 <th scope="row">dataMatrix_in</th> | |
| 11991 <td>9a0ce47bd1734ae7</td> | |
| 11992 <td>peaklist_fragments.tsv</td> | |
| 11993 <td>tabular</td> | |
| 11994 <td>42</td> | |
| 11995 </tr><tr class=""> | |
| 11996 <th scope="row">respC</th> | |
| 11997 <td></td> | |
| 11998 <td></td> | |
| 11999 <td></td> | |
| 12000 <td></td> | |
| 12001 </tr><tr class=""> | |
| 12002 <th scope="row">sampleMetadata_in</th> | |
| 12003 <td>9a0ce47bd1734ae7</td> | |
| 12004 <td>peaklist_fragments.tsv</td> | |
| 12005 <td>tabular</td> | |
| 12006 <td>42</td> | |
| 12007 </tr><tr class=""> | |
| 12008 <th scope="row">variableMetadata_in</th> | |
| 12009 <td>9a0ce47bd1734ae7</td> | |
| 12010 <td>peaklist_fragments.tsv</td> | |
| 12011 <td>tabular</td> | |
| 12012 <td>42</td> | |
| 12013 </tr> | |
| 12014 </table> | |
| 12015 </div> | |
| 12016 | |
| 12017 | |
| 12018 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 12019 <h2 | |
| 12020 class="history_metadata_extractor_h2" | |
| 12021 style="cursor: pointer" | |
| 12022 title="click to fold/unfold the table" | |
| 12023 > | |
| 12024 [DELETED] - biosigner - 2.2.7 | |
| 12025 </h2> | |
| 12026 <p> | |
| 12027 Outputs: | |
| 12028 </p> | |
| 12029 <p class="history_metadata_extractor_status"> | |
| 12030 Status: Failed (1) | |
| 12031 </p> | |
| 12032 <p class="history_metadata_extractor_glitter"></p> | |
| 12033 <table class=" | |
| 12034 table | |
| 12035 table-bordered | |
| 12036 table-dark | |
| 12037 table-striped | |
| 12038 table-hover | |
| 12039 d-block | |
| 12040 overflow-auto | |
| 12041 history_metadata_extractor_table | |
| 12042 "> | |
| 12043 <thead> | |
| 12044 <tr> | |
| 12045 <th scope="col"></th> | |
| 12046 <th scope="col">value</th> | |
| 12047 <th scope="col">name</th> | |
| 12048 <th scope="col">extension</th> | |
| 12049 <th scope="col">hid</th> | |
| 12050 </tr> | |
| 12051 </thead> | |
| 12052 <tr class=""> | |
| 12053 <th scope="row">opcC</th> | |
| 12054 <td>default</td> | |
| 12055 <td></td> | |
| 12056 <td></td> | |
| 12057 <td></td> | |
| 12058 </tr><tr class=""> | |
| 12059 <th scope="row">dataMatrix_in</th> | |
| 12060 <td>9a0ce47bd1734ae7</td> | |
| 12061 <td>peaklist_fragments.tsv</td> | |
| 12062 <td>tabular</td> | |
| 12063 <td>42</td> | |
| 12064 </tr><tr class=""> | |
| 12065 <th scope="row">respC</th> | |
| 12066 <td></td> | |
| 12067 <td></td> | |
| 12068 <td></td> | |
| 12069 <td></td> | |
| 12070 </tr><tr class=""> | |
| 12071 <th scope="row">sampleMetadata_in</th> | |
| 12072 <td>9a0ce47bd1734ae7</td> | |
| 12073 <td>peaklist_fragments.tsv</td> | |
| 12074 <td>tabular</td> | |
| 12075 <td>42</td> | |
| 12076 </tr><tr class=""> | |
| 12077 <th scope="row">variableMetadata_in</th> | |
| 12078 <td>9a0ce47bd1734ae7</td> | |
| 12079 <td>peaklist_fragments.tsv</td> | |
| 12080 <td>tabular</td> | |
| 12081 <td>42</td> | |
| 12082 </tr> | |
| 12083 </table> | |
| 12084 </div> | |
| 12085 | |
| 12086 | |
| 12087 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 12088 <h2 | |
| 12089 class="history_metadata_extractor_h2" | |
| 12090 style="cursor: pointer" | |
| 12091 title="click to fold/unfold the table" | |
| 12092 > | |
| 12093 [DELETED] - Univariate - 2.2.4 | |
| 12094 </h2> | |
| 12095 <p> | |
| 12096 Outputs: | |
| 12097 </p> | |
| 12098 <p class="history_metadata_extractor_status"> | |
| 12099 Status: Failed (1) | |
| 12100 </p> | |
| 12101 <p class="history_metadata_extractor_glitter"></p> | |
| 12102 <table class=" | |
| 12103 table | |
| 12104 table-bordered | |
| 12105 table-dark | |
| 12106 table-striped | |
| 12107 table-hover | |
| 12108 d-block | |
| 12109 overflow-auto | |
| 12110 history_metadata_extractor_table | |
| 12111 "> | |
| 12112 <thead> | |
| 12113 <tr> | |
| 12114 <th scope="col"></th> | |
| 12115 <th scope="col">value</th> | |
| 12116 <th scope="col">name</th> | |
| 12117 <th scope="col">extension</th> | |
| 12118 <th scope="col">hid</th> | |
| 12119 </tr> | |
| 12120 </thead> | |
| 12121 <tr class=""> | |
| 12122 <th scope="row">adjC</th> | |
| 12123 <td>fdr</td> | |
| 12124 <td></td> | |
| 12125 <td></td> | |
| 12126 <td></td> | |
| 12127 </tr><tr class=""> | |
| 12128 <th scope="row">dataMatrix_in</th> | |
| 12129 <td>7cf499d16bd542b2</td> | |
| 12130 <td>compounds_pos.txt</td> | |
| 12131 <td>tabular</td> | |
| 12132 <td>44</td> | |
| 12133 </tr><tr class=""> | |
| 12134 <th scope="row">facC</th> | |
| 12135 <td></td> | |
| 12136 <td></td> | |
| 12137 <td></td> | |
| 12138 <td></td> | |
| 12139 </tr><tr class=""> | |
| 12140 <th scope="row">sampleMetadata_in</th> | |
| 12141 <td>7cf499d16bd542b2</td> | |
| 12142 <td>compounds_pos.txt</td> | |
| 12143 <td>tabular</td> | |
| 12144 <td>44</td> | |
| 12145 </tr><tr class=""> | |
| 12146 <th scope="row">tesC</th> | |
| 12147 <td>ttest</td> | |
| 12148 <td></td> | |
| 12149 <td></td> | |
| 12150 <td></td> | |
| 12151 </tr><tr class=""> | |
| 12152 <th scope="row">thrN</th> | |
| 12153 <td>0.05</td> | |
| 12154 <td></td> | |
| 12155 <td></td> | |
| 12156 <td></td> | |
| 12157 </tr><tr class=""> | |
| 12158 <th scope="row">variableMetadata_in</th> | |
| 12159 <td>7cf499d16bd542b2</td> | |
| 12160 <td>compounds_pos.txt</td> | |
| 12161 <td>tabular</td> | |
| 12162 <td>44</td> | |
| 12163 </tr> | |
| 12164 </table> | |
| 12165 </div> | |
| 12166 | |
| 12167 | |
| 12168 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 12169 <h2 | |
| 12170 class="history_metadata_extractor_h2" | |
| 12171 style="cursor: pointer" | |
| 12172 title="click to fold/unfold the table" | |
| 12173 > | |
| 12174 [DELETED] - Univariate - 2.2.4 | |
| 12175 </h2> | |
| 12176 <p> | |
| 12177 Outputs: | |
| 12178 </p> | |
| 12179 <p class="history_metadata_extractor_status"> | |
| 12180 Status: Failed (1) | |
| 12181 </p> | |
| 12182 <p class="history_metadata_extractor_glitter"></p> | |
| 12183 <table class=" | |
| 12184 table | |
| 12185 table-bordered | |
| 12186 table-dark | |
| 12187 table-striped | |
| 12188 table-hover | |
| 12189 d-block | |
| 12190 overflow-auto | |
| 12191 history_metadata_extractor_table | |
| 12192 "> | |
| 12193 <thead> | |
| 12194 <tr> | |
| 12195 <th scope="col"></th> | |
| 12196 <th scope="col">value</th> | |
| 12197 <th scope="col">name</th> | |
| 12198 <th scope="col">extension</th> | |
| 12199 <th scope="col">hid</th> | |
| 12200 </tr> | |
| 12201 </thead> | |
| 12202 <tr class=""> | |
| 12203 <th scope="row">adjC</th> | |
| 12204 <td>fdr</td> | |
| 12205 <td></td> | |
| 12206 <td></td> | |
| 12207 <td></td> | |
| 12208 </tr><tr class=""> | |
| 12209 <th scope="row">dataMatrix_in</th> | |
| 12210 <td>7cf499d16bd542b2</td> | |
| 12211 <td>compounds_pos.txt</td> | |
| 12212 <td>tabular</td> | |
| 12213 <td>44</td> | |
| 12214 </tr><tr class=""> | |
| 12215 <th scope="row">facC</th> | |
| 12216 <td></td> | |
| 12217 <td></td> | |
| 12218 <td></td> | |
| 12219 <td></td> | |
| 12220 </tr><tr class=""> | |
| 12221 <th scope="row">sampleMetadata_in</th> | |
| 12222 <td>7cf499d16bd542b2</td> | |
| 12223 <td>compounds_pos.txt</td> | |
| 12224 <td>tabular</td> | |
| 12225 <td>44</td> | |
| 12226 </tr><tr class=""> | |
| 12227 <th scope="row">tesC</th> | |
| 12228 <td>ttest</td> | |
| 12229 <td></td> | |
| 12230 <td></td> | |
| 12231 <td></td> | |
| 12232 </tr><tr class=""> | |
| 12233 <th scope="row">thrN</th> | |
| 12234 <td>0.05</td> | |
| 12235 <td></td> | |
| 12236 <td></td> | |
| 12237 <td></td> | |
| 12238 </tr><tr class=""> | |
| 12239 <th scope="row">variableMetadata_in</th> | |
| 12240 <td>7cf499d16bd542b2</td> | |
| 12241 <td>compounds_pos.txt</td> | |
| 12242 <td>tabular</td> | |
| 12243 <td>44</td> | |
| 12244 </tr> | |
| 12245 </table> | |
| 12246 </div> | |
| 12247 | |
| 12248 | |
| 12249 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 12250 <h2 | |
| 12251 class="history_metadata_extractor_h2" | |
| 12252 style="cursor: pointer" | |
| 12253 title="click to fold/unfold the table" | |
| 12254 > | |
| 12255 [DELETED] - Univariate - 2.2.4 | |
| 12256 </h2> | |
| 12257 <p> | |
| 12258 Outputs: | |
| 12259 </p> | |
| 12260 <p class="history_metadata_extractor_status"> | |
| 12261 Status: Failed (1) | |
| 12262 </p> | |
| 12263 <p class="history_metadata_extractor_glitter"></p> | |
| 12264 <table class=" | |
| 12265 table | |
| 12266 table-bordered | |
| 12267 table-dark | |
| 12268 table-striped | |
| 12269 table-hover | |
| 12270 d-block | |
| 12271 overflow-auto | |
| 12272 history_metadata_extractor_table | |
| 12273 "> | |
| 12274 <thead> | |
| 12275 <tr> | |
| 12276 <th scope="col"></th> | |
| 12277 <th scope="col">value</th> | |
| 12278 <th scope="col">name</th> | |
| 12279 <th scope="col">extension</th> | |
| 12280 <th scope="col">hid</th> | |
| 12281 </tr> | |
| 12282 </thead> | |
| 12283 <tr class=""> | |
| 12284 <th scope="row">adjC</th> | |
| 12285 <td>fdr</td> | |
| 12286 <td></td> | |
| 12287 <td></td> | |
| 12288 <td></td> | |
| 12289 </tr><tr class=""> | |
| 12290 <th scope="row">dataMatrix_in</th> | |
| 12291 <td>7cf499d16bd542b2</td> | |
| 12292 <td>compounds_pos.txt</td> | |
| 12293 <td>tabular</td> | |
| 12294 <td>44</td> | |
| 12295 </tr><tr class=""> | |
| 12296 <th scope="row">facC</th> | |
| 12297 <td></td> | |
| 12298 <td></td> | |
| 12299 <td></td> | |
| 12300 <td></td> | |
| 12301 </tr><tr class=""> | |
| 12302 <th scope="row">sampleMetadata_in</th> | |
| 12303 <td>7cf499d16bd542b2</td> | |
| 12304 <td>compounds_pos.txt</td> | |
| 12305 <td>tabular</td> | |
| 12306 <td>44</td> | |
| 12307 </tr><tr class=""> | |
| 12308 <th scope="row">tesC</th> | |
| 12309 <td>ttest</td> | |
| 12310 <td></td> | |
| 12311 <td></td> | |
| 12312 <td></td> | |
| 12313 </tr><tr class=""> | |
| 12314 <th scope="row">thrN</th> | |
| 12315 <td>0.05</td> | |
| 12316 <td></td> | |
| 12317 <td></td> | |
| 12318 <td></td> | |
| 12319 </tr><tr class=""> | |
| 12320 <th scope="row">variableMetadata_in</th> | |
| 12321 <td>7cf499d16bd542b2</td> | |
| 12322 <td>compounds_pos.txt</td> | |
| 12323 <td>tabular</td> | |
| 12324 <td>44</td> | |
| 12325 </tr> | |
| 12326 </table> | |
| 12327 </div> | |
| 12328 | |
| 12329 | |
| 12330 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 12331 <h2 | |
| 12332 class="history_metadata_extractor_h2" | |
| 12333 style="cursor: pointer" | |
| 12334 title="click to fold/unfold the table" | |
| 12335 > | |
| 12336 [DELETED] - abims_anova - 1.2.1 | |
| 12337 </h2> | |
| 12338 <p> | |
| 12339 Outputs: | |
| 12340 </p> | |
| 12341 <p class="history_metadata_extractor_status"> | |
| 12342 Status: Failed (1) | |
| 12343 </p> | |
| 12344 <p class="history_metadata_extractor_glitter"></p> | |
| 12345 <table class=" | |
| 12346 table | |
| 12347 table-bordered | |
| 12348 table-dark | |
| 12349 table-striped | |
| 12350 table-hover | |
| 12351 d-block | |
| 12352 overflow-auto | |
| 12353 history_metadata_extractor_table | |
| 12354 "> | |
| 12355 <thead> | |
| 12356 <tr> | |
| 12357 <th scope="col"></th> | |
| 12358 <th scope="col">value</th> | |
| 12359 <th scope="col">name</th> | |
| 12360 <th scope="col">extension</th> | |
| 12361 <th scope="col">hid</th> | |
| 12362 </tr> | |
| 12363 </thead> | |
| 12364 <tr class=""> | |
| 12365 <th scope="row">condition_1</th> | |
| 12366 <td></td> | |
| 12367 <td></td> | |
| 12368 <td></td> | |
| 12369 <td></td> | |
| 12370 </tr><tr class=""> | |
| 12371 <th scope="row">conditions</th> | |
| 12372 <td></td> | |
| 12373 <td></td> | |
| 12374 <td></td> | |
| 12375 <td></td> | |
| 12376 </tr><tr class=""> | |
| 12377 <th scope="row">dec</th> | |
| 12378 <td>.</td> | |
| 12379 <td></td> | |
| 12380 <td></td> | |
| 12381 <td></td> | |
| 12382 </tr><tr class=""> | |
| 12383 <th scope="row">input</th> | |
| 12384 <td>9a0ce47bd1734ae7</td> | |
| 12385 <td>peaklist_fragments.tsv</td> | |
| 12386 <td>tabular</td> | |
| 12387 <td>42</td> | |
| 12388 </tr><tr class=""> | |
| 12389 <th scope="row">interaction</th> | |
| 12390 <td>false</td> | |
| 12391 <td></td> | |
| 12392 <td></td> | |
| 12393 <td></td> | |
| 12394 </tr><tr class=""> | |
| 12395 <th scope="row">method</th> | |
| 12396 <td>none</td> | |
| 12397 <td></td> | |
| 12398 <td></td> | |
| 12399 <td></td> | |
| 12400 </tr><tr class=""> | |
| 12401 <th scope="row">mode</th> | |
| 12402 <td>row</td> | |
| 12403 <td></td> | |
| 12404 <td></td> | |
| 12405 <td></td> | |
| 12406 </tr><tr class=""> | |
| 12407 <th scope="row">sampleinfo</th> | |
| 12408 <td>9a0ce47bd1734ae7</td> | |
| 12409 <td>peaklist_fragments.tsv</td> | |
| 12410 <td>tabular</td> | |
| 12411 <td>42</td> | |
| 12412 </tr><tr class=""> | |
| 12413 <th scope="row">selection_method</th> | |
| 12414 <td>intersection</td> | |
| 12415 <td></td> | |
| 12416 <td></td> | |
| 12417 <td></td> | |
| 12418 </tr><tr class=""> | |
| 12419 <th scope="row">sep</th> | |
| 12420 <td>tabulation</td> | |
| 12421 <td></td> | |
| 12422 <td></td> | |
| 12423 <td></td> | |
| 12424 </tr><tr class=""> | |
| 12425 <th scope="row">threshold</th> | |
| 12426 <td>0.01</td> | |
| 12427 <td></td> | |
| 12428 <td></td> | |
| 12429 <td></td> | |
| 12430 </tr><tr class=""> | |
| 12431 <th scope="row">varinfo</th> | |
| 12432 <td>9a0ce47bd1734ae7</td> | |
| 12433 <td>peaklist_fragments.tsv</td> | |
| 12434 <td>tabular</td> | |
| 12435 <td>42</td> | |
| 12436 </tr> | |
| 12437 </table> | |
| 12438 </div> | |
| 12439 | |
| 12440 | |
| 12441 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 12442 <h2 | |
| 12443 class="history_metadata_extractor_h2" | |
| 12444 style="cursor: pointer" | |
| 12445 title="click to fold/unfold the table" | |
| 12446 > | |
| 12447 [DELETED] - abims_anova - 1.2.1 | |
| 12448 </h2> | |
| 12449 <p> | |
| 12450 Outputs: | |
| 12451 </p> | |
| 12452 <p class="history_metadata_extractor_status"> | |
| 12453 Status: Failed (1) | |
| 12454 </p> | |
| 12455 <p class="history_metadata_extractor_glitter"></p> | |
| 12456 <table class=" | |
| 12457 table | |
| 12458 table-bordered | |
| 12459 table-dark | |
| 12460 table-striped | |
| 12461 table-hover | |
| 12462 d-block | |
| 12463 overflow-auto | |
| 12464 history_metadata_extractor_table | |
| 12465 "> | |
| 12466 <thead> | |
| 12467 <tr> | |
| 12468 <th scope="col"></th> | |
| 12469 <th scope="col">value</th> | |
| 12470 <th scope="col">name</th> | |
| 12471 <th scope="col">extension</th> | |
| 12472 <th scope="col">hid</th> | |
| 12473 </tr> | |
| 12474 </thead> | |
| 12475 <tr class=""> | |
| 12476 <th scope="row">condition_1</th> | |
| 12477 <td></td> | |
| 12478 <td></td> | |
| 12479 <td></td> | |
| 12480 <td></td> | |
| 12481 </tr><tr class=""> | |
| 12482 <th scope="row">conditions</th> | |
| 12483 <td></td> | |
| 12484 <td></td> | |
| 12485 <td></td> | |
| 12486 <td></td> | |
| 12487 </tr><tr class=""> | |
| 12488 <th scope="row">dec</th> | |
| 12489 <td>.</td> | |
| 12490 <td></td> | |
| 12491 <td></td> | |
| 12492 <td></td> | |
| 12493 </tr><tr class=""> | |
| 12494 <th scope="row">input</th> | |
| 12495 <td>9a0ce47bd1734ae7</td> | |
| 12496 <td>peaklist_fragments.tsv</td> | |
| 12497 <td>tabular</td> | |
| 12498 <td>42</td> | |
| 12499 </tr><tr class=""> | |
| 12500 <th scope="row">interaction</th> | |
| 12501 <td>false</td> | |
| 12502 <td></td> | |
| 12503 <td></td> | |
| 12504 <td></td> | |
| 12505 </tr><tr class=""> | |
| 12506 <th scope="row">method</th> | |
| 12507 <td>none</td> | |
| 12508 <td></td> | |
| 12509 <td></td> | |
| 12510 <td></td> | |
| 12511 </tr><tr class=""> | |
| 12512 <th scope="row">mode</th> | |
| 12513 <td>row</td> | |
| 12514 <td></td> | |
| 12515 <td></td> | |
| 12516 <td></td> | |
| 12517 </tr><tr class=""> | |
| 12518 <th scope="row">sampleinfo</th> | |
| 12519 <td>9a0ce47bd1734ae7</td> | |
| 12520 <td>peaklist_fragments.tsv</td> | |
| 12521 <td>tabular</td> | |
| 12522 <td>42</td> | |
| 12523 </tr><tr class=""> | |
| 12524 <th scope="row">selection_method</th> | |
| 12525 <td>intersection</td> | |
| 12526 <td></td> | |
| 12527 <td></td> | |
| 12528 <td></td> | |
| 12529 </tr><tr class=""> | |
| 12530 <th scope="row">sep</th> | |
| 12531 <td>tabulation</td> | |
| 12532 <td></td> | |
| 12533 <td></td> | |
| 12534 <td></td> | |
| 12535 </tr><tr class=""> | |
| 12536 <th scope="row">threshold</th> | |
| 12537 <td>0.01</td> | |
| 12538 <td></td> | |
| 12539 <td></td> | |
| 12540 <td></td> | |
| 12541 </tr><tr class=""> | |
| 12542 <th scope="row">varinfo</th> | |
| 12543 <td>9a0ce47bd1734ae7</td> | |
| 12544 <td>peaklist_fragments.tsv</td> | |
| 12545 <td>tabular</td> | |
| 12546 <td>42</td> | |
| 12547 </tr> | |
| 12548 </table> | |
| 12549 </div> | |
| 12550 | |
| 12551 | |
| 12552 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 12553 <h2 | |
| 12554 class="history_metadata_extractor_h2" | |
| 12555 style="cursor: pointer" | |
| 12556 title="click to fold/unfold the table" | |
| 12557 > | |
| 12558 [DELETED] - wsdl_hmdb - 1.7.2 | |
| 12559 </h2> | |
| 12560 <p> | |
| 12561 Outputs: | |
| 12562 </p> | |
| 12563 <p class="history_metadata_extractor_status"> | |
| 12564 Status: Failed (255) | |
| 12565 </p> | |
| 12566 <p class="history_metadata_extractor_glitter"></p> | |
| 12567 <table class=" | |
| 12568 table | |
| 12569 table-bordered | |
| 12570 table-dark | |
| 12571 table-striped | |
| 12572 table-hover | |
| 12573 d-block | |
| 12574 overflow-auto | |
| 12575 history_metadata_extractor_table | |
| 12576 "> | |
| 12577 <thead> | |
| 12578 <tr> | |
| 12579 <th scope="col"></th> | |
| 12580 <th scope="col">value</th> | |
| 12581 <th scope="col">name</th> | |
| 12582 <th scope="col">extension</th> | |
| 12583 <th scope="col">hid</th> | |
| 12584 </tr> | |
| 12585 </thead> | |
| 12586 <tr class=""> | |
| 12587 <th scope="row">advancedFeatures</th> | |
| 12588 <td>0</td> | |
| 12589 <td></td> | |
| 12590 <td></td> | |
| 12591 <td></td> | |
| 12592 </tr><tr class=""> | |
| 12593 <th scope="row">delta</th> | |
| 12594 <td>0.05</td> | |
| 12595 <td></td> | |
| 12596 <td></td> | |
| 12597 <td></td> | |
| 12598 </tr><tr class=""> | |
| 12599 <th scope="row">choice</th> | |
| 12600 <td>YES</td> | |
| 12601 <td></td> | |
| 12602 <td></td> | |
| 12603 <td></td> | |
| 12604 </tr><tr class=""> | |
| 12605 <th scope="row">colfactor</th> | |
| 12606 <td>1</td> | |
| 12607 <td></td> | |
| 12608 <td></td> | |
| 12609 <td></td> | |
| 12610 </tr><tr class=""> | |
| 12611 <th scope="row">header_choice</th> | |
| 12612 <td>yes</td> | |
| 12613 <td></td> | |
| 12614 <td></td> | |
| 12615 <td></td> | |
| 12616 </tr><tr class=""> | |
| 12617 <th scope="row">nbHeader</th> | |
| 12618 <td>1</td> | |
| 12619 <td></td> | |
| 12620 <td></td> | |
| 12621 <td></td> | |
| 12622 </tr><tr class=""> | |
| 12623 <th scope="row">masses</th> | |
| 12624 <td>7cf499d16bd542b2</td> | |
| 12625 <td>compounds_pos.txt</td> | |
| 12626 <td>tabular</td> | |
| 12627 <td>44</td> | |
| 12628 </tr><tr class=""> | |
| 12629 <th scope="row">maxquery</th> | |
| 12630 <td>10</td> | |
| 12631 <td></td> | |
| 12632 <td></td> | |
| 12633 <td></td> | |
| 12634 </tr><tr class=""> | |
| 12635 <th scope="row">data_neutral_adducts</th> | |
| 12636 <td>M</td> | |
| 12637 <td></td> | |
| 12638 <td></td> | |
| 12639 <td></td> | |
| 12640 </tr><tr class=""> | |
| 12641 <th scope="row">mode</th> | |
| 12642 <td>neutral</td> | |
| 12643 <td></td> | |
| 12644 <td></td> | |
| 12645 <td></td> | |
| 12646 </tr><tr class=""> | |
| 12647 <th scope="row">verbose</th> | |
| 12648 <td>1</td> | |
| 12649 <td></td> | |
| 12650 <td></td> | |
| 12651 <td></td> | |
| 12652 </tr> | |
| 12653 </table> | |
| 12654 </div> | |
| 12655 | |
| 12656 | |
| 12657 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 12658 <h2 | |
| 12659 class="history_metadata_extractor_h2" | |
| 12660 style="cursor: pointer" | |
| 12661 title="click to fold/unfold the table" | |
| 12662 > | |
| 12663 [DELETED] - wsdl_hmdb - 1.7.2 | |
| 12664 </h2> | |
| 12665 <p> | |
| 12666 Outputs: | |
| 12667 </p> | |
| 12668 <p class="history_metadata_extractor_status"> | |
| 12669 Status: Failed (255) | |
| 12670 </p> | |
| 12671 <p class="history_metadata_extractor_glitter"></p> | |
| 12672 <table class=" | |
| 12673 table | |
| 12674 table-bordered | |
| 12675 table-dark | |
| 12676 table-striped | |
| 12677 table-hover | |
| 12678 d-block | |
| 12679 overflow-auto | |
| 12680 history_metadata_extractor_table | |
| 12681 "> | |
| 12682 <thead> | |
| 12683 <tr> | |
| 12684 <th scope="col"></th> | |
| 12685 <th scope="col">value</th> | |
| 12686 <th scope="col">name</th> | |
| 12687 <th scope="col">extension</th> | |
| 12688 <th scope="col">hid</th> | |
| 12689 </tr> | |
| 12690 </thead> | |
| 12691 <tr class=""> | |
| 12692 <th scope="row">advancedFeatures</th> | |
| 12693 <td>0</td> | |
| 12694 <td></td> | |
| 12695 <td></td> | |
| 12696 <td></td> | |
| 12697 </tr><tr class=""> | |
| 12698 <th scope="row">delta</th> | |
| 12699 <td>0.05</td> | |
| 12700 <td></td> | |
| 12701 <td></td> | |
| 12702 <td></td> | |
| 12703 </tr><tr class=""> | |
| 12704 <th scope="row">choice</th> | |
| 12705 <td>YES</td> | |
| 12706 <td></td> | |
| 12707 <td></td> | |
| 12708 <td></td> | |
| 12709 </tr><tr class=""> | |
| 12710 <th scope="row">colfactor</th> | |
| 12711 <td>1</td> | |
| 12712 <td></td> | |
| 12713 <td></td> | |
| 12714 <td></td> | |
| 12715 </tr><tr class=""> | |
| 12716 <th scope="row">header_choice</th> | |
| 12717 <td>yes</td> | |
| 12718 <td></td> | |
| 12719 <td></td> | |
| 12720 <td></td> | |
| 12721 </tr><tr class=""> | |
| 12722 <th scope="row">nbHeader</th> | |
| 12723 <td>1</td> | |
| 12724 <td></td> | |
| 12725 <td></td> | |
| 12726 <td></td> | |
| 12727 </tr><tr class=""> | |
| 12728 <th scope="row">masses</th> | |
| 12729 <td>7cf499d16bd542b2</td> | |
| 12730 <td>compounds_pos.txt</td> | |
| 12731 <td>tabular</td> | |
| 12732 <td>44</td> | |
| 12733 </tr><tr class=""> | |
| 12734 <th scope="row">maxquery</th> | |
| 12735 <td>10</td> | |
| 12736 <td></td> | |
| 12737 <td></td> | |
| 12738 <td></td> | |
| 12739 </tr><tr class=""> | |
| 12740 <th scope="row">data_neutral_adducts</th> | |
| 12741 <td>M</td> | |
| 12742 <td></td> | |
| 12743 <td></td> | |
| 12744 <td></td> | |
| 12745 </tr><tr class=""> | |
| 12746 <th scope="row">mode</th> | |
| 12747 <td>neutral</td> | |
| 12748 <td></td> | |
| 12749 <td></td> | |
| 12750 <td></td> | |
| 12751 </tr><tr class=""> | |
| 12752 <th scope="row">verbose</th> | |
| 12753 <td>1</td> | |
| 12754 <td></td> | |
| 12755 <td></td> | |
| 12756 <td></td> | |
| 12757 </tr> | |
| 12758 </table> | |
| 12759 </div> | |
| 12760 | |
| 12761 | |
| 12762 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 12763 <h2 | |
| 12764 class="history_metadata_extractor_h2" | |
| 12765 style="cursor: pointer" | |
| 12766 title="click to fold/unfold the table" | |
| 12767 > | |
| 12768 [DELETED] - wsdl_hmdb - 1.7.2 | |
| 12769 </h2> | |
| 12770 <p> | |
| 12771 Outputs: | |
| 12772 </p> | |
| 12773 <p class="history_metadata_extractor_status"> | |
| 12774 Status: Failed (255) | |
| 12775 </p> | |
| 12776 <p class="history_metadata_extractor_glitter"></p> | |
| 12777 <table class=" | |
| 12778 table | |
| 12779 table-bordered | |
| 12780 table-dark | |
| 12781 table-striped | |
| 12782 table-hover | |
| 12783 d-block | |
| 12784 overflow-auto | |
| 12785 history_metadata_extractor_table | |
| 12786 "> | |
| 12787 <thead> | |
| 12788 <tr> | |
| 12789 <th scope="col"></th> | |
| 12790 <th scope="col">value</th> | |
| 12791 <th scope="col">name</th> | |
| 12792 <th scope="col">extension</th> | |
| 12793 <th scope="col">hid</th> | |
| 12794 </tr> | |
| 12795 </thead> | |
| 12796 <tr class=""> | |
| 12797 <th scope="row">advancedFeatures</th> | |
| 12798 <td>0</td> | |
| 12799 <td></td> | |
| 12800 <td></td> | |
| 12801 <td></td> | |
| 12802 </tr><tr class=""> | |
| 12803 <th scope="row">delta</th> | |
| 12804 <td>0.05</td> | |
| 12805 <td></td> | |
| 12806 <td></td> | |
| 12807 <td></td> | |
| 12808 </tr><tr class=""> | |
| 12809 <th scope="row">choice</th> | |
| 12810 <td>YES</td> | |
| 12811 <td></td> | |
| 12812 <td></td> | |
| 12813 <td></td> | |
| 12814 </tr><tr class=""> | |
| 12815 <th scope="row">colfactor</th> | |
| 12816 <td>1</td> | |
| 12817 <td></td> | |
| 12818 <td></td> | |
| 12819 <td></td> | |
| 12820 </tr><tr class=""> | |
| 12821 <th scope="row">header_choice</th> | |
| 12822 <td>yes</td> | |
| 12823 <td></td> | |
| 12824 <td></td> | |
| 12825 <td></td> | |
| 12826 </tr><tr class=""> | |
| 12827 <th scope="row">nbHeader</th> | |
| 12828 <td>1</td> | |
| 12829 <td></td> | |
| 12830 <td></td> | |
| 12831 <td></td> | |
| 12832 </tr><tr class=""> | |
| 12833 <th scope="row">masses</th> | |
| 12834 <td>7cf499d16bd542b2</td> | |
| 12835 <td>compounds_pos.txt</td> | |
| 12836 <td>tabular</td> | |
| 12837 <td>44</td> | |
| 12838 </tr><tr class=""> | |
| 12839 <th scope="row">maxquery</th> | |
| 12840 <td>10</td> | |
| 12841 <td></td> | |
| 12842 <td></td> | |
| 12843 <td></td> | |
| 12844 </tr><tr class=""> | |
| 12845 <th scope="row">data_neutral_adducts</th> | |
| 12846 <td>M</td> | |
| 12847 <td></td> | |
| 12848 <td></td> | |
| 12849 <td></td> | |
| 12850 </tr><tr class=""> | |
| 12851 <th scope="row">mode</th> | |
| 12852 <td>neutral</td> | |
| 12853 <td></td> | |
| 12854 <td></td> | |
| 12855 <td></td> | |
| 12856 </tr><tr class=""> | |
| 12857 <th scope="row">verbose</th> | |
| 12858 <td>1</td> | |
| 12859 <td></td> | |
| 12860 <td></td> | |
| 12861 <td></td> | |
| 12862 </tr> | |
| 12863 </table> | |
| 12864 </div> | |
| 12865 | |
| 12866 | |
| 12867 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 12868 <h2 | |
| 12869 class="history_metadata_extractor_h2" | |
| 12870 style="cursor: pointer" | |
| 12871 title="click to fold/unfold the table" | |
| 12872 > | |
| 12873 [DELETED] - bank_inhouse - 1.2.1 | |
| 12874 </h2> | |
| 12875 <p> | |
| 12876 Outputs: | |
| 12877 </p> | |
| 12878 <p class="history_metadata_extractor_status"> | |
| 12879 Status: Failed (255) | |
| 12880 </p> | |
| 12881 <p class="history_metadata_extractor_glitter"></p> | |
| 12882 <table class=" | |
| 12883 table | |
| 12884 table-bordered | |
| 12885 table-dark | |
| 12886 table-striped | |
| 12887 table-hover | |
| 12888 d-block | |
| 12889 overflow-auto | |
| 12890 history_metadata_extractor_table | |
| 12891 "> | |
| 12892 <thead> | |
| 12893 <tr> | |
| 12894 <th scope="col"></th> | |
| 12895 <th scope="col">value</th> | |
| 12896 <th scope="col">name</th> | |
| 12897 <th scope="col">extension</th> | |
| 12898 <th scope="col">hid</th> | |
| 12899 </tr> | |
| 12900 </thead> | |
| 12901 <tr class=""> | |
| 12902 <th scope="row">bank_in</th> | |
| 12903 <td></td> | |
| 12904 <td></td> | |
| 12905 <td></td> | |
| 12906 <td></td> | |
| 12907 </tr><tr class=""> | |
| 12908 <th scope="row">bank_rt_choice</th> | |
| 12909 <td>true</td> | |
| 12910 <td></td> | |
| 12911 <td></td> | |
| 12912 <td></td> | |
| 12913 </tr><tr class=""> | |
| 12914 <th scope="row">rtdb</th> | |
| 12915 <td>1</td> | |
| 12916 <td></td> | |
| 12917 <td></td> | |
| 12918 <td></td> | |
| 12919 </tr><tr class=""> | |
| 12920 <th scope="row">mzdb</th> | |
| 12921 <td>1</td> | |
| 12922 <td></td> | |
| 12923 <td></td> | |
| 12924 <td></td> | |
| 12925 </tr><tr class=""> | |
| 12926 <th scope="row">perso_bank</th> | |
| 12927 <td>true</td> | |
| 12928 <td></td> | |
| 12929 <td></td> | |
| 12930 <td></td> | |
| 12931 </tr><tr class=""> | |
| 12932 <th scope="row">choice</th> | |
| 12933 <td>YES</td> | |
| 12934 <td></td> | |
| 12935 <td></td> | |
| 12936 <td></td> | |
| 12937 </tr><tr class=""> | |
| 12938 <th scope="row">colmass</th> | |
| 12939 <td>1</td> | |
| 12940 <td></td> | |
| 12941 <td></td> | |
| 12942 <td></td> | |
| 12943 </tr><tr class=""> | |
| 12944 <th scope="row">header_choice</th> | |
| 12945 <td>true</td> | |
| 12946 <td></td> | |
| 12947 <td></td> | |
| 12948 <td></td> | |
| 12949 </tr><tr class=""> | |
| 12950 <th scope="row">nbheader</th> | |
| 12951 <td>1</td> | |
| 12952 <td></td> | |
| 12953 <td></td> | |
| 12954 <td></td> | |
| 12955 </tr><tr class=""> | |
| 12956 <th scope="row">colrt</th> | |
| 12957 <td>1</td> | |
| 12958 <td></td> | |
| 12959 <td></td> | |
| 12960 <td></td> | |
| 12961 </tr><tr class=""> | |
| 12962 <th scope="row">rt_file_choice</th> | |
| 12963 <td>true</td> | |
| 12964 <td></td> | |
| 12965 <td></td> | |
| 12966 <td></td> | |
| 12967 </tr><tr class=""> | |
| 12968 <th scope="row">rt_file_delta</th> | |
| 12969 <td>0.1</td> | |
| 12970 <td></td> | |
| 12971 <td></td> | |
| 12972 <td></td> | |
| 12973 </tr><tr class=""> | |
| 12974 <th scope="row">variableMetadata_in</th> | |
| 12975 <td></td> | |
| 12976 <td></td> | |
| 12977 <td></td> | |
| 12978 <td></td> | |
| 12979 </tr><tr class=""> | |
| 12980 <th scope="row">mass_delta</th> | |
| 12981 <td>0.005</td> | |
| 12982 <td></td> | |
| 12983 <td></td> | |
| 12984 <td></td> | |
| 12985 </tr><tr class=""> | |
| 12986 <th scope="row">mz_delta</th> | |
| 12987 <td>Da</td> | |
| 12988 <td></td> | |
| 12989 <td></td> | |
| 12990 <td></td> | |
| 12991 </tr><tr class=""> | |
| 12992 <th scope="row">outfiles</th> | |
| 12993 <td>NO</td> | |
| 12994 <td></td> | |
| 12995 <td></td> | |
| 12996 <td></td> | |
| 12997 </tr> | |
| 12998 </table> | |
| 12999 </div> | |
| 13000 | |
| 13001 | |
| 13002 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 13003 <h2 | |
| 13004 class="history_metadata_extractor_h2" | |
| 13005 style="cursor: pointer" | |
| 13006 title="click to fold/unfold the table" | |
| 13007 > | |
| 13008 [DELETED] - bank_inhouse - 1.2.1 | |
| 13009 </h2> | |
| 13010 <p> | |
| 13011 Outputs: | |
| 13012 </p> | |
| 13013 <p class="history_metadata_extractor_status"> | |
| 13014 Status: Failed (255) | |
| 13015 </p> | |
| 13016 <p class="history_metadata_extractor_glitter"></p> | |
| 13017 <table class=" | |
| 13018 table | |
| 13019 table-bordered | |
| 13020 table-dark | |
| 13021 table-striped | |
| 13022 table-hover | |
| 13023 d-block | |
| 13024 overflow-auto | |
| 13025 history_metadata_extractor_table | |
| 13026 "> | |
| 13027 <thead> | |
| 13028 <tr> | |
| 13029 <th scope="col"></th> | |
| 13030 <th scope="col">value</th> | |
| 13031 <th scope="col">name</th> | |
| 13032 <th scope="col">extension</th> | |
| 13033 <th scope="col">hid</th> | |
| 13034 </tr> | |
| 13035 </thead> | |
| 13036 <tr class=""> | |
| 13037 <th scope="row">bank_in</th> | |
| 13038 <td></td> | |
| 13039 <td></td> | |
| 13040 <td></td> | |
| 13041 <td></td> | |
| 13042 </tr><tr class=""> | |
| 13043 <th scope="row">bank_rt_choice</th> | |
| 13044 <td>true</td> | |
| 13045 <td></td> | |
| 13046 <td></td> | |
| 13047 <td></td> | |
| 13048 </tr><tr class=""> | |
| 13049 <th scope="row">rtdb</th> | |
| 13050 <td>1</td> | |
| 13051 <td></td> | |
| 13052 <td></td> | |
| 13053 <td></td> | |
| 13054 </tr><tr class=""> | |
| 13055 <th scope="row">mzdb</th> | |
| 13056 <td>1</td> | |
| 13057 <td></td> | |
| 13058 <td></td> | |
| 13059 <td></td> | |
| 13060 </tr><tr class=""> | |
| 13061 <th scope="row">perso_bank</th> | |
| 13062 <td>true</td> | |
| 13063 <td></td> | |
| 13064 <td></td> | |
| 13065 <td></td> | |
| 13066 </tr><tr class=""> | |
| 13067 <th scope="row">choice</th> | |
| 13068 <td>YES</td> | |
| 13069 <td></td> | |
| 13070 <td></td> | |
| 13071 <td></td> | |
| 13072 </tr><tr class=""> | |
| 13073 <th scope="row">colmass</th> | |
| 13074 <td>1</td> | |
| 13075 <td></td> | |
| 13076 <td></td> | |
| 13077 <td></td> | |
| 13078 </tr><tr class=""> | |
| 13079 <th scope="row">header_choice</th> | |
| 13080 <td>true</td> | |
| 13081 <td></td> | |
| 13082 <td></td> | |
| 13083 <td></td> | |
| 13084 </tr><tr class=""> | |
| 13085 <th scope="row">nbheader</th> | |
| 13086 <td>1</td> | |
| 13087 <td></td> | |
| 13088 <td></td> | |
| 13089 <td></td> | |
| 13090 </tr><tr class=""> | |
| 13091 <th scope="row">colrt</th> | |
| 13092 <td>1</td> | |
| 13093 <td></td> | |
| 13094 <td></td> | |
| 13095 <td></td> | |
| 13096 </tr><tr class=""> | |
| 13097 <th scope="row">rt_file_choice</th> | |
| 13098 <td>true</td> | |
| 13099 <td></td> | |
| 13100 <td></td> | |
| 13101 <td></td> | |
| 13102 </tr><tr class=""> | |
| 13103 <th scope="row">rt_file_delta</th> | |
| 13104 <td>0.1</td> | |
| 13105 <td></td> | |
| 13106 <td></td> | |
| 13107 <td></td> | |
| 13108 </tr><tr class=""> | |
| 13109 <th scope="row">variableMetadata_in</th> | |
| 13110 <td></td> | |
| 13111 <td></td> | |
| 13112 <td></td> | |
| 13113 <td></td> | |
| 13114 </tr><tr class=""> | |
| 13115 <th scope="row">mass_delta</th> | |
| 13116 <td>0.005</td> | |
| 13117 <td></td> | |
| 13118 <td></td> | |
| 13119 <td></td> | |
| 13120 </tr><tr class=""> | |
| 13121 <th scope="row">mz_delta</th> | |
| 13122 <td>Da</td> | |
| 13123 <td></td> | |
| 13124 <td></td> | |
| 13125 <td></td> | |
| 13126 </tr><tr class=""> | |
| 13127 <th scope="row">outfiles</th> | |
| 13128 <td>NO</td> | |
| 13129 <td></td> | |
| 13130 <td></td> | |
| 13131 <td></td> | |
| 13132 </tr> | |
| 13133 </table> | |
| 13134 </div> | |
| 13135 | |
| 13136 | |
| 13137 <div class="alert alert-success"> | |
| 13138 <h2 | |
| 13139 class="history_metadata_extractor_h2" | |
| 13140 style="cursor: pointer" | |
| 13141 title="click to fold/unfold the table" | |
| 13142 > | |
| 13143 [576] - bih4bloodexposome - 0.1.2 | |
| 13144 </h2> | |
| 13145 <p> | |
| 13146 Outputs: | |
| 13147 </p> | |
| 13148 <p class="history_metadata_extractor_status"> | |
| 13149 Status: Ok (0) | |
| 13150 </p> | |
| 13151 <p class="history_metadata_extractor_glitter"></p> | |
| 13152 <table class=" | |
| 13153 table | |
| 13154 table-bordered | |
| 13155 table-dark | |
| 13156 table-striped | |
| 13157 table-hover | |
| 13158 d-block | |
| 13159 overflow-auto | |
| 13160 history_metadata_extractor_table | |
| 13161 "> | |
| 13162 <thead> | |
| 13163 <tr> | |
| 13164 <th scope="col"></th> | |
| 13165 <th scope="col">value</th> | |
| 13166 <th scope="col">name</th> | |
| 13167 <th scope="col">extension</th> | |
| 13168 <th scope="col">hid</th> | |
| 13169 </tr> | |
| 13170 </thead> | |
| 13171 <tr class=""> | |
| 13172 <th scope="row">colmass</th> | |
| 13173 <td>1</td> | |
| 13174 <td></td> | |
| 13175 <td></td> | |
| 13176 <td></td> | |
| 13177 </tr><tr class=""> | |
| 13178 <th scope="row">header</th> | |
| 13179 <td>1</td> | |
| 13180 <td></td> | |
| 13181 <td></td> | |
| 13182 <td></td> | |
| 13183 </tr><tr class=""> | |
| 13184 <th scope="row">header_choice</th> | |
| 13185 <td>true</td> | |
| 13186 <td></td> | |
| 13187 <td></td> | |
| 13188 <td></td> | |
| 13189 </tr><tr class=""> | |
| 13190 <th scope="row">mode</th> | |
| 13191 <td>POSITIVE</td> | |
| 13192 <td></td> | |
| 13193 <td></td> | |
| 13194 <td></td> | |
| 13195 </tr><tr class=""> | |
| 13196 <th scope="row">ppm_error</th> | |
| 13197 <td>5.0</td> | |
| 13198 <td></td> | |
| 13199 <td></td> | |
| 13200 <td></td> | |
| 13201 </tr><tr class=""> | |
| 13202 <th scope="row">variableMetadata_in</th> | |
| 13203 <td>9a0ce47bd1734ae7</td> | |
| 13204 <td>peaklist_fragments.tsv</td> | |
| 13205 <td>tabular</td> | |
| 13206 <td>42</td> | |
| 13207 </tr><tr class=""> | |
| 13208 <th scope="row">verbose</th> | |
| 13209 <td>1</td> | |
| 13210 <td></td> | |
| 13211 <td></td> | |
| 13212 <td></td> | |
| 13213 </tr> | |
| 13214 </table> | |
| 13215 </div> | |
| 13216 | |
| 13217 | |
| 13218 <div class="alert alert-success"> | |
| 13219 <h2 | |
| 13220 class="history_metadata_extractor_h2" | |
| 13221 style="cursor: pointer" | |
| 13222 title="click to fold/unfold the table" | |
| 13223 > | |
| 13224 [577] - bih4bloodexposome - 0.1.2 | |
| 13225 </h2> | |
| 13226 <p> | |
| 13227 Outputs: | |
| 13228 </p> | |
| 13229 <p class="history_metadata_extractor_status"> | |
| 13230 Status: Ok (0) | |
| 13231 </p> | |
| 13232 <p class="history_metadata_extractor_glitter"></p> | |
| 13233 <table class=" | |
| 13234 table | |
| 13235 table-bordered | |
| 13236 table-dark | |
| 13237 table-striped | |
| 13238 table-hover | |
| 13239 d-block | |
| 13240 overflow-auto | |
| 13241 history_metadata_extractor_table | |
| 13242 "> | |
| 13243 <thead> | |
| 13244 <tr> | |
| 13245 <th scope="col"></th> | |
| 13246 <th scope="col">value</th> | |
| 13247 <th scope="col">name</th> | |
| 13248 <th scope="col">extension</th> | |
| 13249 <th scope="col">hid</th> | |
| 13250 </tr> | |
| 13251 </thead> | |
| 13252 <tr class=""> | |
| 13253 <th scope="row">colmass</th> | |
| 13254 <td>1</td> | |
| 13255 <td></td> | |
| 13256 <td></td> | |
| 13257 <td></td> | |
| 13258 </tr><tr class=""> | |
| 13259 <th scope="row">header</th> | |
| 13260 <td>1</td> | |
| 13261 <td></td> | |
| 13262 <td></td> | |
| 13263 <td></td> | |
| 13264 </tr><tr class=""> | |
| 13265 <th scope="row">header_choice</th> | |
| 13266 <td>true</td> | |
| 13267 <td></td> | |
| 13268 <td></td> | |
| 13269 <td></td> | |
| 13270 </tr><tr class=""> | |
| 13271 <th scope="row">mode</th> | |
| 13272 <td>POSITIVE</td> | |
| 13273 <td></td> | |
| 13274 <td></td> | |
| 13275 <td></td> | |
| 13276 </tr><tr class=""> | |
| 13277 <th scope="row">ppm_error</th> | |
| 13278 <td>5.0</td> | |
| 13279 <td></td> | |
| 13280 <td></td> | |
| 13281 <td></td> | |
| 13282 </tr><tr class=""> | |
| 13283 <th scope="row">variableMetadata_in</th> | |
| 13284 <td>9a0ce47bd1734ae7</td> | |
| 13285 <td>peaklist_fragments.tsv</td> | |
| 13286 <td>tabular</td> | |
| 13287 <td>42</td> | |
| 13288 </tr><tr class=""> | |
| 13289 <th scope="row">verbose</th> | |
| 13290 <td>1</td> | |
| 13291 <td></td> | |
| 13292 <td></td> | |
| 13293 <td></td> | |
| 13294 </tr> | |
| 13295 </table> | |
| 13296 </div> | |
| 13297 | |
| 13298 | |
| 13299 <div class="alert alert-success history_metadata_extractor_deleted"> | |
| 13300 <h2 | |
| 13301 class="history_metadata_extractor_h2" | |
| 13302 style="cursor: pointer" | |
| 13303 title="click to fold/unfold the table" | |
| 13304 > | |
| 13305 [DELETED] - bih4maconda - 0.1.4 | |
| 13306 </h2> | |
| 13307 <p> | |
| 13308 Outputs: | |
| 13309 </p> | |
| 13310 <p class="history_metadata_extractor_status"> | |
| 13311 Status: Ok (0) | |
| 13312 </p> | |
| 13313 <p class="history_metadata_extractor_glitter"></p> | |
| 13314 <table class=" | |
| 13315 table | |
| 13316 table-bordered | |
| 13317 table-dark | |
| 13318 table-striped | |
| 13319 table-hover | |
| 13320 d-block | |
| 13321 overflow-auto | |
| 13322 history_metadata_extractor_table | |
| 13323 "> | |
| 13324 <thead> | |
| 13325 <tr> | |
| 13326 <th scope="col"></th> | |
| 13327 <th scope="col">value</th> | |
| 13328 <th scope="col">name</th> | |
| 13329 <th scope="col">extension</th> | |
| 13330 <th scope="col">hid</th> | |
| 13331 </tr> | |
| 13332 </thead> | |
| 13333 <tr class=""> | |
| 13334 <th scope="row">colmass</th> | |
| 13335 <td>1</td> | |
| 13336 <td></td> | |
| 13337 <td></td> | |
| 13338 <td></td> | |
| 13339 </tr><tr class=""> | |
| 13340 <th scope="row">header</th> | |
| 13341 <td>1</td> | |
| 13342 <td></td> | |
| 13343 <td></td> | |
| 13344 <td></td> | |
| 13345 </tr><tr class=""> | |
| 13346 <th scope="row">header_choice</th> | |
| 13347 <td>true</td> | |
| 13348 <td></td> | |
| 13349 <td></td> | |
| 13350 <td></td> | |
| 13351 </tr><tr class=""> | |
| 13352 <th scope="row">mode</th> | |
| 13353 <td>POSITIVE</td> | |
| 13354 <td></td> | |
| 13355 <td></td> | |
| 13356 <td></td> | |
| 13357 </tr><tr class=""> | |
| 13358 <th scope="row">ppm_error</th> | |
| 13359 <td>5.0</td> | |
| 13360 <td></td> | |
| 13361 <td></td> | |
| 13362 <td></td> | |
| 13363 </tr><tr class=""> | |
| 13364 <th scope="row">variableMetadata_in</th> | |
| 13365 <td>7cf499d16bd542b2</td> | |
| 13366 <td>compounds_pos.txt</td> | |
| 13367 <td>tabular</td> | |
| 13368 <td>44</td> | |
| 13369 </tr><tr class=""> | |
| 13370 <th scope="row">verbose</th> | |
| 13371 <td>1</td> | |
| 13372 <td></td> | |
| 13373 <td></td> | |
| 13374 <td></td> | |
| 13375 </tr> | |
| 13376 </table> | |
| 13377 </div> | |
| 13378 | |
| 13379 | |
| 13380 <div class="alert alert-success history_metadata_extractor_deleted"> | |
| 13381 <h2 | |
| 13382 class="history_metadata_extractor_h2" | |
| 13383 style="cursor: pointer" | |
| 13384 title="click to fold/unfold the table" | |
| 13385 > | |
| 13386 [DELETED] - bih4maconda - 0.1.4 | |
| 13387 </h2> | |
| 13388 <p> | |
| 13389 Outputs: | |
| 13390 </p> | |
| 13391 <p class="history_metadata_extractor_status"> | |
| 13392 Status: Ok (0) | |
| 13393 </p> | |
| 13394 <p class="history_metadata_extractor_glitter"></p> | |
| 13395 <table class=" | |
| 13396 table | |
| 13397 table-bordered | |
| 13398 table-dark | |
| 13399 table-striped | |
| 13400 table-hover | |
| 13401 d-block | |
| 13402 overflow-auto | |
| 13403 history_metadata_extractor_table | |
| 13404 "> | |
| 13405 <thead> | |
| 13406 <tr> | |
| 13407 <th scope="col"></th> | |
| 13408 <th scope="col">value</th> | |
| 13409 <th scope="col">name</th> | |
| 13410 <th scope="col">extension</th> | |
| 13411 <th scope="col">hid</th> | |
| 13412 </tr> | |
| 13413 </thead> | |
| 13414 <tr class=""> | |
| 13415 <th scope="row">colmass</th> | |
| 13416 <td>1</td> | |
| 13417 <td></td> | |
| 13418 <td></td> | |
| 13419 <td></td> | |
| 13420 </tr><tr class=""> | |
| 13421 <th scope="row">header</th> | |
| 13422 <td>1</td> | |
| 13423 <td></td> | |
| 13424 <td></td> | |
| 13425 <td></td> | |
| 13426 </tr><tr class=""> | |
| 13427 <th scope="row">header_choice</th> | |
| 13428 <td>true</td> | |
| 13429 <td></td> | |
| 13430 <td></td> | |
| 13431 <td></td> | |
| 13432 </tr><tr class=""> | |
| 13433 <th scope="row">mode</th> | |
| 13434 <td>POSITIVE</td> | |
| 13435 <td></td> | |
| 13436 <td></td> | |
| 13437 <td></td> | |
| 13438 </tr><tr class=""> | |
| 13439 <th scope="row">ppm_error</th> | |
| 13440 <td>5.0</td> | |
| 13441 <td></td> | |
| 13442 <td></td> | |
| 13443 <td></td> | |
| 13444 </tr><tr class=""> | |
| 13445 <th scope="row">variableMetadata_in</th> | |
| 13446 <td>7cf499d16bd542b2</td> | |
| 13447 <td>compounds_pos.txt</td> | |
| 13448 <td>tabular</td> | |
| 13449 <td>44</td> | |
| 13450 </tr><tr class=""> | |
| 13451 <th scope="row">verbose</th> | |
| 13452 <td>1</td> | |
| 13453 <td></td> | |
| 13454 <td></td> | |
| 13455 <td></td> | |
| 13456 </tr> | |
| 13457 </table> | |
| 13458 </div> | |
| 13459 | |
| 13460 | |
| 13461 <div class="alert alert-danger"> | |
| 13462 <h2 | |
| 13463 class="history_metadata_extractor_h2" | |
| 13464 style="cursor: pointer" | |
| 13465 title="click to fold/unfold the table" | |
| 13466 > | |
| 13467 [580] - hr2 - 1.1.1.7 | |
| 13468 </h2> | |
| 13469 <p> | |
| 13470 Outputs: | |
| 13471 </p> | |
| 13472 <p class="history_metadata_extractor_status"> | |
| 13473 Status: Failed (None) | |
| 13474 </p> | |
| 13475 <p class="history_metadata_extractor_glitter"></p> | |
| 13476 <table class=" | |
| 13477 table | |
| 13478 table-bordered | |
| 13479 table-dark | |
| 13480 table-striped | |
| 13481 table-hover | |
| 13482 d-block | |
| 13483 overflow-auto | |
| 13484 history_metadata_extractor_table | |
| 13485 "> | |
| 13486 <thead> | |
| 13487 <tr> | |
| 13488 <th scope="col"></th> | |
| 13489 <th scope="col">value</th> | |
| 13490 <th scope="col">name</th> | |
| 13491 <th scope="col">extension</th> | |
| 13492 <th scope="col">hid</th> | |
| 13493 </tr> | |
| 13494 </thead> | |
| 13495 <tr class=""> | |
| 13496 <th scope="row">atomes_basic</th> | |
| 13497 <td>C;N;O;H;P</td> | |
| 13498 <td></td> | |
| 13499 <td></td> | |
| 13500 <td></td> | |
| 13501 </tr><tr class=""> | |
| 13502 <th scope="row">atomes_sup</th> | |
| 13503 <td>None</td> | |
| 13504 <td></td> | |
| 13505 <td></td> | |
| 13506 <td></td> | |
| 13507 </tr><tr class=""> | |
| 13508 <th scope="row">choice</th> | |
| 13509 <td>YES</td> | |
| 13510 <td></td> | |
| 13511 <td></td> | |
| 13512 <td></td> | |
| 13513 </tr><tr class=""> | |
| 13514 <th scope="row">colId</th> | |
| 13515 <td>1</td> | |
| 13516 <td></td> | |
| 13517 <td></td> | |
| 13518 <td></td> | |
| 13519 </tr><tr class=""> | |
| 13520 <th scope="row">colmass</th> | |
| 13521 <td>1</td> | |
| 13522 <td></td> | |
| 13523 <td></td> | |
| 13524 <td></td> | |
| 13525 </tr><tr class=""> | |
| 13526 <th scope="row">header_choice</th> | |
| 13527 <td>true</td> | |
| 13528 <td></td> | |
| 13529 <td></td> | |
| 13530 <td></td> | |
| 13531 </tr><tr class=""> | |
| 13532 <th scope="row">nbHeader</th> | |
| 13533 <td>1</td> | |
| 13534 <td></td> | |
| 13535 <td></td> | |
| 13536 <td></td> | |
| 13537 </tr><tr class=""> | |
| 13538 <th scope="row">input</th> | |
| 13539 <td>9a0ce47bd1734ae7</td> | |
| 13540 <td>peaklist_fragments.tsv</td> | |
| 13541 <td>tabular</td> | |
| 13542 <td>42</td> | |
| 13543 </tr><tr class=""> | |
| 13544 <th scope="row">mode</th> | |
| 13545 <td>neutral</td> | |
| 13546 <td></td> | |
| 13547 <td></td> | |
| 13548 <td></td> | |
| 13549 </tr><tr class=""> | |
| 13550 <th scope="row">regleOr</th> | |
| 13551 <td>NO</td> | |
| 13552 <td></td> | |
| 13553 <td></td> | |
| 13554 <td></td> | |
| 13555 </tr><tr class=""> | |
| 13556 <th scope="row">tol</th> | |
| 13557 <td>1.0</td> | |
| 13558 <td></td> | |
| 13559 <td></td> | |
| 13560 <td></td> | |
| 13561 </tr><tr class=""> | |
| 13562 <th scope="row">verbose</th> | |
| 13563 <td>1</td> | |
| 13564 <td></td> | |
| 13565 <td></td> | |
| 13566 <td></td> | |
| 13567 </tr> | |
| 13568 </table> | |
| 13569 </div> | |
| 13570 | |
| 13571 | |
| 13572 <div class="alert alert-danger"> | |
| 13573 <h2 | |
| 13574 class="history_metadata_extractor_h2" | |
| 13575 style="cursor: pointer" | |
| 13576 title="click to fold/unfold the table" | |
| 13577 > | |
| 13578 [581] - hr2 - 1.1.1.7 | |
| 13579 </h2> | |
| 13580 <p> | |
| 13581 Outputs: | |
| 13582 </p> | |
| 13583 <p class="history_metadata_extractor_status"> | |
| 13584 Status: Failed (None) | |
| 13585 </p> | |
| 13586 <p class="history_metadata_extractor_glitter"></p> | |
| 13587 <table class=" | |
| 13588 table | |
| 13589 table-bordered | |
| 13590 table-dark | |
| 13591 table-striped | |
| 13592 table-hover | |
| 13593 d-block | |
| 13594 overflow-auto | |
| 13595 history_metadata_extractor_table | |
| 13596 "> | |
| 13597 <thead> | |
| 13598 <tr> | |
| 13599 <th scope="col"></th> | |
| 13600 <th scope="col">value</th> | |
| 13601 <th scope="col">name</th> | |
| 13602 <th scope="col">extension</th> | |
| 13603 <th scope="col">hid</th> | |
| 13604 </tr> | |
| 13605 </thead> | |
| 13606 <tr class=""> | |
| 13607 <th scope="row">atomes_basic</th> | |
| 13608 <td>C;N;O;H;P</td> | |
| 13609 <td></td> | |
| 13610 <td></td> | |
| 13611 <td></td> | |
| 13612 </tr><tr class=""> | |
| 13613 <th scope="row">atomes_sup</th> | |
| 13614 <td>None</td> | |
| 13615 <td></td> | |
| 13616 <td></td> | |
| 13617 <td></td> | |
| 13618 </tr><tr class=""> | |
| 13619 <th scope="row">choice</th> | |
| 13620 <td>YES</td> | |
| 13621 <td></td> | |
| 13622 <td></td> | |
| 13623 <td></td> | |
| 13624 </tr><tr class=""> | |
| 13625 <th scope="row">colId</th> | |
| 13626 <td>1</td> | |
| 13627 <td></td> | |
| 13628 <td></td> | |
| 13629 <td></td> | |
| 13630 </tr><tr class=""> | |
| 13631 <th scope="row">colmass</th> | |
| 13632 <td>1</td> | |
| 13633 <td></td> | |
| 13634 <td></td> | |
| 13635 <td></td> | |
| 13636 </tr><tr class=""> | |
| 13637 <th scope="row">header_choice</th> | |
| 13638 <td>true</td> | |
| 13639 <td></td> | |
| 13640 <td></td> | |
| 13641 <td></td> | |
| 13642 </tr><tr class=""> | |
| 13643 <th scope="row">nbHeader</th> | |
| 13644 <td>1</td> | |
| 13645 <td></td> | |
| 13646 <td></td> | |
| 13647 <td></td> | |
| 13648 </tr><tr class=""> | |
| 13649 <th scope="row">input</th> | |
| 13650 <td>9a0ce47bd1734ae7</td> | |
| 13651 <td>peaklist_fragments.tsv</td> | |
| 13652 <td>tabular</td> | |
| 13653 <td>42</td> | |
| 13654 </tr><tr class=""> | |
| 13655 <th scope="row">mode</th> | |
| 13656 <td>neutral</td> | |
| 13657 <td></td> | |
| 13658 <td></td> | |
| 13659 <td></td> | |
| 13660 </tr><tr class=""> | |
| 13661 <th scope="row">regleOr</th> | |
| 13662 <td>NO</td> | |
| 13663 <td></td> | |
| 13664 <td></td> | |
| 13665 <td></td> | |
| 13666 </tr><tr class=""> | |
| 13667 <th scope="row">tol</th> | |
| 13668 <td>1.0</td> | |
| 13669 <td></td> | |
| 13670 <td></td> | |
| 13671 <td></td> | |
| 13672 </tr><tr class=""> | |
| 13673 <th scope="row">verbose</th> | |
| 13674 <td>1</td> | |
| 13675 <td></td> | |
| 13676 <td></td> | |
| 13677 <td></td> | |
| 13678 </tr> | |
| 13679 </table> | |
| 13680 </div> | |
| 13681 | |
| 13682 | |
| 13683 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 13684 <h2 | |
| 13685 class="history_metadata_extractor_h2" | |
| 13686 style="cursor: pointer" | |
| 13687 title="click to fold/unfold the table" | |
| 13688 > | |
| 13689 [DELETED] - metams_runGC - 2.1.1 | |
| 13690 </h2> | |
| 13691 <p> | |
| 13692 Outputs: | |
| 13693 </p> | |
| 13694 <p class="history_metadata_extractor_status"> | |
| 13695 Status: Failed (1) | |
| 13696 </p> | |
| 13697 <p class="history_metadata_extractor_glitter"></p> | |
| 13698 <table class=" | |
| 13699 table | |
| 13700 table-bordered | |
| 13701 table-dark | |
| 13702 table-striped | |
| 13703 table-hover | |
| 13704 d-block | |
| 13705 overflow-auto | |
| 13706 history_metadata_extractor_table | |
| 13707 "> | |
| 13708 <thead> | |
| 13709 <tr> | |
| 13710 <th scope="col"></th> | |
| 13711 <th scope="col">value</th> | |
| 13712 <th scope="col">name</th> | |
| 13713 <th scope="col">extension</th> | |
| 13714 <th scope="col">hid</th> | |
| 13715 </tr> | |
| 13716 </thead> | |
| 13717 <tr class=""> | |
| 13718 <th scope="row">input</th> | |
| 13719 <td>xset</td> | |
| 13720 <td></td> | |
| 13721 <td></td> | |
| 13722 <td></td> | |
| 13723 </tr><tr class=""> | |
| 13724 <th scope="row">xset</th> | |
| 13725 <td>9e77b3d7d0887128</td> | |
| 13726 <td>test.rdata</td> | |
| 13727 <td>rdata</td> | |
| 13728 <td>1</td> | |
| 13729 </tr><tr class=""> | |
| 13730 <th scope="row">option</th> | |
| 13731 <td>false</td> | |
| 13732 <td></td> | |
| 13733 <td></td> | |
| 13734 <td></td> | |
| 13735 </tr><tr class=""> | |
| 13736 <th scope="row">option</th> | |
| 13737 <td>hide</td> | |
| 13738 <td></td> | |
| 13739 <td></td> | |
| 13740 <td></td> | |
| 13741 </tr><tr class=""> | |
| 13742 <th scope="row">option</th> | |
| 13743 <td>hide</td> | |
| 13744 <td></td> | |
| 13745 <td></td> | |
| 13746 <td></td> | |
| 13747 </tr><tr class=""> | |
| 13748 <th scope="row">option</th> | |
| 13749 <td>hide</td> | |
| 13750 <td></td> | |
| 13751 <td></td> | |
| 13752 <td></td> | |
| 13753 </tr><tr class=""> | |
| 13754 <th scope="row">setting</th> | |
| 13755 <td>gcdefault</td> | |
| 13756 <td></td> | |
| 13757 <td></td> | |
| 13758 <td></td> | |
| 13759 </tr><tr class=""> | |
| 13760 <th scope="row">unkn</th> | |
| 13761 <td>1:5</td> | |
| 13762 <td></td> | |
| 13763 <td></td> | |
| 13764 <td></td> | |
| 13765 </tr> | |
| 13766 </table> | |
| 13767 </div> | |
| 13768 | |
| 13769 | |
| 13770 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 13771 <h2 | |
| 13772 class="history_metadata_extractor_h2" | |
| 13773 style="cursor: pointer" | |
| 13774 title="click to fold/unfold the table" | |
| 13775 > | |
| 13776 [DELETED] - metams_runGC - 2.1.1 | |
| 13777 </h2> | |
| 13778 <p> | |
| 13779 Outputs: | |
| 13780 </p> | |
| 13781 <p class="history_metadata_extractor_status"> | |
| 13782 Status: Failed (1) | |
| 13783 </p> | |
| 13784 <p class="history_metadata_extractor_glitter"></p> | |
| 13785 <table class=" | |
| 13786 table | |
| 13787 table-bordered | |
| 13788 table-dark | |
| 13789 table-striped | |
| 13790 table-hover | |
| 13791 d-block | |
| 13792 overflow-auto | |
| 13793 history_metadata_extractor_table | |
| 13794 "> | |
| 13795 <thead> | |
| 13796 <tr> | |
| 13797 <th scope="col"></th> | |
| 13798 <th scope="col">value</th> | |
| 13799 <th scope="col">name</th> | |
| 13800 <th scope="col">extension</th> | |
| 13801 <th scope="col">hid</th> | |
| 13802 </tr> | |
| 13803 </thead> | |
| 13804 <tr class=""> | |
| 13805 <th scope="row">input</th> | |
| 13806 <td>xset</td> | |
| 13807 <td></td> | |
| 13808 <td></td> | |
| 13809 <td></td> | |
| 13810 </tr><tr class=""> | |
| 13811 <th scope="row">xset</th> | |
| 13812 <td>9e77b3d7d0887128</td> | |
| 13813 <td>test.rdata</td> | |
| 13814 <td>rdata</td> | |
| 13815 <td>1</td> | |
| 13816 </tr><tr class=""> | |
| 13817 <th scope="row">option</th> | |
| 13818 <td>false</td> | |
| 13819 <td></td> | |
| 13820 <td></td> | |
| 13821 <td></td> | |
| 13822 </tr><tr class=""> | |
| 13823 <th scope="row">option</th> | |
| 13824 <td>hide</td> | |
| 13825 <td></td> | |
| 13826 <td></td> | |
| 13827 <td></td> | |
| 13828 </tr><tr class=""> | |
| 13829 <th scope="row">option</th> | |
| 13830 <td>hide</td> | |
| 13831 <td></td> | |
| 13832 <td></td> | |
| 13833 <td></td> | |
| 13834 </tr><tr class=""> | |
| 13835 <th scope="row">option</th> | |
| 13836 <td>hide</td> | |
| 13837 <td></td> | |
| 13838 <td></td> | |
| 13839 <td></td> | |
| 13840 </tr><tr class=""> | |
| 13841 <th scope="row">setting</th> | |
| 13842 <td>gcdefault</td> | |
| 13843 <td></td> | |
| 13844 <td></td> | |
| 13845 <td></td> | |
| 13846 </tr><tr class=""> | |
| 13847 <th scope="row">unkn</th> | |
| 13848 <td>1:5</td> | |
| 13849 <td></td> | |
| 13850 <td></td> | |
| 13851 <td></td> | |
| 13852 </tr> | |
| 13853 </table> | |
| 13854 </div> | |
| 13855 | |
| 13856 | |
| 13857 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 13858 <h2 | |
| 13859 class="history_metadata_extractor_h2" | |
| 13860 style="cursor: pointer" | |
| 13861 title="click to fold/unfold the table" | |
| 13862 > | |
| 13863 [DELETED] - metams_runGC - 2.1.1 | |
| 13864 </h2> | |
| 13865 <p> | |
| 13866 Outputs: | |
| 13867 </p> | |
| 13868 <p class="history_metadata_extractor_status"> | |
| 13869 Status: Failed (1) | |
| 13870 </p> | |
| 13871 <p class="history_metadata_extractor_glitter"></p> | |
| 13872 <table class=" | |
| 13873 table | |
| 13874 table-bordered | |
| 13875 table-dark | |
| 13876 table-striped | |
| 13877 table-hover | |
| 13878 d-block | |
| 13879 overflow-auto | |
| 13880 history_metadata_extractor_table | |
| 13881 "> | |
| 13882 <thead> | |
| 13883 <tr> | |
| 13884 <th scope="col"></th> | |
| 13885 <th scope="col">value</th> | |
| 13886 <th scope="col">name</th> | |
| 13887 <th scope="col">extension</th> | |
| 13888 <th scope="col">hid</th> | |
| 13889 </tr> | |
| 13890 </thead> | |
| 13891 <tr class=""> | |
| 13892 <th scope="row">input</th> | |
| 13893 <td>xset</td> | |
| 13894 <td></td> | |
| 13895 <td></td> | |
| 13896 <td></td> | |
| 13897 </tr><tr class=""> | |
| 13898 <th scope="row">xset</th> | |
| 13899 <td>9e77b3d7d0887128</td> | |
| 13900 <td>test.rdata</td> | |
| 13901 <td>rdata</td> | |
| 13902 <td>1</td> | |
| 13903 </tr><tr class=""> | |
| 13904 <th scope="row">option</th> | |
| 13905 <td>false</td> | |
| 13906 <td></td> | |
| 13907 <td></td> | |
| 13908 <td></td> | |
| 13909 </tr><tr class=""> | |
| 13910 <th scope="row">option</th> | |
| 13911 <td>hide</td> | |
| 13912 <td></td> | |
| 13913 <td></td> | |
| 13914 <td></td> | |
| 13915 </tr><tr class=""> | |
| 13916 <th scope="row">option</th> | |
| 13917 <td>hide</td> | |
| 13918 <td></td> | |
| 13919 <td></td> | |
| 13920 <td></td> | |
| 13921 </tr><tr class=""> | |
| 13922 <th scope="row">option</th> | |
| 13923 <td>hide</td> | |
| 13924 <td></td> | |
| 13925 <td></td> | |
| 13926 <td></td> | |
| 13927 </tr><tr class=""> | |
| 13928 <th scope="row">setting</th> | |
| 13929 <td>gcdefault</td> | |
| 13930 <td></td> | |
| 13931 <td></td> | |
| 13932 <td></td> | |
| 13933 </tr><tr class=""> | |
| 13934 <th scope="row">unkn</th> | |
| 13935 <td>1:5</td> | |
| 13936 <td></td> | |
| 13937 <td></td> | |
| 13938 <td></td> | |
| 13939 </tr> | |
| 13940 </table> | |
| 13941 </div> | |
| 13942 | |
| 13943 | |
| 13944 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 13945 <h2 | |
| 13946 class="history_metadata_extractor_h2" | |
| 13947 style="cursor: pointer" | |
| 13948 title="click to fold/unfold the table" | |
| 13949 > | |
| 13950 [DELETED] - metams_runGC - 2.1.1 | |
| 13951 </h2> | |
| 13952 <p> | |
| 13953 Outputs: | |
| 13954 </p> | |
| 13955 <p class="history_metadata_extractor_status"> | |
| 13956 Status: Failed (1) | |
| 13957 </p> | |
| 13958 <p class="history_metadata_extractor_glitter"></p> | |
| 13959 <table class=" | |
| 13960 table | |
| 13961 table-bordered | |
| 13962 table-dark | |
| 13963 table-striped | |
| 13964 table-hover | |
| 13965 d-block | |
| 13966 overflow-auto | |
| 13967 history_metadata_extractor_table | |
| 13968 "> | |
| 13969 <thead> | |
| 13970 <tr> | |
| 13971 <th scope="col"></th> | |
| 13972 <th scope="col">value</th> | |
| 13973 <th scope="col">name</th> | |
| 13974 <th scope="col">extension</th> | |
| 13975 <th scope="col">hid</th> | |
| 13976 </tr> | |
| 13977 </thead> | |
| 13978 <tr class=""> | |
| 13979 <th scope="row">input</th> | |
| 13980 <td>xset</td> | |
| 13981 <td></td> | |
| 13982 <td></td> | |
| 13983 <td></td> | |
| 13984 </tr><tr class=""> | |
| 13985 <th scope="row">xset</th> | |
| 13986 <td>9e77b3d7d0887128</td> | |
| 13987 <td>test.rdata</td> | |
| 13988 <td>rdata</td> | |
| 13989 <td>1</td> | |
| 13990 </tr><tr class=""> | |
| 13991 <th scope="row">option</th> | |
| 13992 <td>false</td> | |
| 13993 <td></td> | |
| 13994 <td></td> | |
| 13995 <td></td> | |
| 13996 </tr><tr class=""> | |
| 13997 <th scope="row">option</th> | |
| 13998 <td>hide</td> | |
| 13999 <td></td> | |
| 14000 <td></td> | |
| 14001 <td></td> | |
| 14002 </tr><tr class=""> | |
| 14003 <th scope="row">option</th> | |
| 14004 <td>hide</td> | |
| 14005 <td></td> | |
| 14006 <td></td> | |
| 14007 <td></td> | |
| 14008 </tr><tr class=""> | |
| 14009 <th scope="row">option</th> | |
| 14010 <td>hide</td> | |
| 14011 <td></td> | |
| 14012 <td></td> | |
| 14013 <td></td> | |
| 14014 </tr><tr class=""> | |
| 14015 <th scope="row">setting</th> | |
| 14016 <td>gcdefault</td> | |
| 14017 <td></td> | |
| 14018 <td></td> | |
| 14019 <td></td> | |
| 14020 </tr><tr class=""> | |
| 14021 <th scope="row">unkn</th> | |
| 14022 <td>1:5</td> | |
| 14023 <td></td> | |
| 14024 <td></td> | |
| 14025 <td></td> | |
| 14026 </tr> | |
| 14027 </table> | |
| 14028 </div> | |
| 14029 | |
| 14030 | |
| 14031 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 14032 <h2 | |
| 14033 class="history_metadata_extractor_h2" | |
| 14034 style="cursor: pointer" | |
| 14035 title="click to fold/unfold the table" | |
| 14036 > | |
| 14037 [DELETED] - metams_runGC - 2.1.1 | |
| 14038 </h2> | |
| 14039 <p> | |
| 14040 Outputs: | |
| 14041 </p> | |
| 14042 <p class="history_metadata_extractor_status"> | |
| 14043 Status: Failed (1) | |
| 14044 </p> | |
| 14045 <p class="history_metadata_extractor_glitter"></p> | |
| 14046 <table class=" | |
| 14047 table | |
| 14048 table-bordered | |
| 14049 table-dark | |
| 14050 table-striped | |
| 14051 table-hover | |
| 14052 d-block | |
| 14053 overflow-auto | |
| 14054 history_metadata_extractor_table | |
| 14055 "> | |
| 14056 <thead> | |
| 14057 <tr> | |
| 14058 <th scope="col"></th> | |
| 14059 <th scope="col">value</th> | |
| 14060 <th scope="col">name</th> | |
| 14061 <th scope="col">extension</th> | |
| 14062 <th scope="col">hid</th> | |
| 14063 </tr> | |
| 14064 </thead> | |
| 14065 <tr class=""> | |
| 14066 <th scope="row">input</th> | |
| 14067 <td>xset</td> | |
| 14068 <td></td> | |
| 14069 <td></td> | |
| 14070 <td></td> | |
| 14071 </tr><tr class=""> | |
| 14072 <th scope="row">xset</th> | |
| 14073 <td>9e77b3d7d0887128</td> | |
| 14074 <td>test.rdata</td> | |
| 14075 <td>rdata</td> | |
| 14076 <td>1</td> | |
| 14077 </tr><tr class=""> | |
| 14078 <th scope="row">option</th> | |
| 14079 <td>false</td> | |
| 14080 <td></td> | |
| 14081 <td></td> | |
| 14082 <td></td> | |
| 14083 </tr><tr class=""> | |
| 14084 <th scope="row">option</th> | |
| 14085 <td>hide</td> | |
| 14086 <td></td> | |
| 14087 <td></td> | |
| 14088 <td></td> | |
| 14089 </tr><tr class=""> | |
| 14090 <th scope="row">option</th> | |
| 14091 <td>hide</td> | |
| 14092 <td></td> | |
| 14093 <td></td> | |
| 14094 <td></td> | |
| 14095 </tr><tr class=""> | |
| 14096 <th scope="row">option</th> | |
| 14097 <td>hide</td> | |
| 14098 <td></td> | |
| 14099 <td></td> | |
| 14100 <td></td> | |
| 14101 </tr><tr class=""> | |
| 14102 <th scope="row">setting</th> | |
| 14103 <td>gcdefault</td> | |
| 14104 <td></td> | |
| 14105 <td></td> | |
| 14106 <td></td> | |
| 14107 </tr><tr class=""> | |
| 14108 <th scope="row">unkn</th> | |
| 14109 <td>1:5</td> | |
| 14110 <td></td> | |
| 14111 <td></td> | |
| 14112 <td></td> | |
| 14113 </tr> | |
| 14114 </table> | |
| 14115 </div> | |
| 14116 | |
| 14117 | |
| 14118 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 14119 <h2 | |
| 14120 class="history_metadata_extractor_h2" | |
| 14121 style="cursor: pointer" | |
| 14122 title="click to fold/unfold the table" | |
| 14123 > | |
| 14124 [DELETED] - metams_runGC - 2.1.1 | |
| 14125 </h2> | |
| 14126 <p> | |
| 14127 Outputs: | |
| 14128 </p> | |
| 14129 <p class="history_metadata_extractor_status"> | |
| 14130 Status: Failed (1) | |
| 14131 </p> | |
| 14132 <p class="history_metadata_extractor_glitter"></p> | |
| 14133 <table class=" | |
| 14134 table | |
| 14135 table-bordered | |
| 14136 table-dark | |
| 14137 table-striped | |
| 14138 table-hover | |
| 14139 d-block | |
| 14140 overflow-auto | |
| 14141 history_metadata_extractor_table | |
| 14142 "> | |
| 14143 <thead> | |
| 14144 <tr> | |
| 14145 <th scope="col"></th> | |
| 14146 <th scope="col">value</th> | |
| 14147 <th scope="col">name</th> | |
| 14148 <th scope="col">extension</th> | |
| 14149 <th scope="col">hid</th> | |
| 14150 </tr> | |
| 14151 </thead> | |
| 14152 <tr class=""> | |
| 14153 <th scope="row">input</th> | |
| 14154 <td>xset</td> | |
| 14155 <td></td> | |
| 14156 <td></td> | |
| 14157 <td></td> | |
| 14158 </tr><tr class=""> | |
| 14159 <th scope="row">xset</th> | |
| 14160 <td>9e77b3d7d0887128</td> | |
| 14161 <td>test.rdata</td> | |
| 14162 <td>rdata</td> | |
| 14163 <td>1</td> | |
| 14164 </tr><tr class=""> | |
| 14165 <th scope="row">option</th> | |
| 14166 <td>false</td> | |
| 14167 <td></td> | |
| 14168 <td></td> | |
| 14169 <td></td> | |
| 14170 </tr><tr class=""> | |
| 14171 <th scope="row">option</th> | |
| 14172 <td>hide</td> | |
| 14173 <td></td> | |
| 14174 <td></td> | |
| 14175 <td></td> | |
| 14176 </tr><tr class=""> | |
| 14177 <th scope="row">option</th> | |
| 14178 <td>hide</td> | |
| 14179 <td></td> | |
| 14180 <td></td> | |
| 14181 <td></td> | |
| 14182 </tr><tr class=""> | |
| 14183 <th scope="row">option</th> | |
| 14184 <td>hide</td> | |
| 14185 <td></td> | |
| 14186 <td></td> | |
| 14187 <td></td> | |
| 14188 </tr><tr class=""> | |
| 14189 <th scope="row">setting</th> | |
| 14190 <td>gcdefault</td> | |
| 14191 <td></td> | |
| 14192 <td></td> | |
| 14193 <td></td> | |
| 14194 </tr><tr class=""> | |
| 14195 <th scope="row">unkn</th> | |
| 14196 <td>1:5</td> | |
| 14197 <td></td> | |
| 14198 <td></td> | |
| 14199 <td></td> | |
| 14200 </tr> | |
| 14201 </table> | |
| 14202 </div> | |
| 14203 | |
| 14204 | |
| 14205 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 14206 <h2 | |
| 14207 class="history_metadata_extractor_h2" | |
| 14208 style="cursor: pointer" | |
| 14209 title="click to fold/unfold the table" | |
| 14210 > | |
| 14211 [DELETED] - metams_runGC - 2.1.1 | |
| 14212 </h2> | |
| 14213 <p> | |
| 14214 Outputs: | |
| 14215 </p> | |
| 14216 <p class="history_metadata_extractor_status"> | |
| 14217 Status: Failed (1) | |
| 14218 </p> | |
| 14219 <p class="history_metadata_extractor_glitter"></p> | |
| 14220 <table class=" | |
| 14221 table | |
| 14222 table-bordered | |
| 14223 table-dark | |
| 14224 table-striped | |
| 14225 table-hover | |
| 14226 d-block | |
| 14227 overflow-auto | |
| 14228 history_metadata_extractor_table | |
| 14229 "> | |
| 14230 <thead> | |
| 14231 <tr> | |
| 14232 <th scope="col"></th> | |
| 14233 <th scope="col">value</th> | |
| 14234 <th scope="col">name</th> | |
| 14235 <th scope="col">extension</th> | |
| 14236 <th scope="col">hid</th> | |
| 14237 </tr> | |
| 14238 </thead> | |
| 14239 <tr class=""> | |
| 14240 <th scope="row">input</th> | |
| 14241 <td>xset</td> | |
| 14242 <td></td> | |
| 14243 <td></td> | |
| 14244 <td></td> | |
| 14245 </tr><tr class=""> | |
| 14246 <th scope="row">xset</th> | |
| 14247 <td>9e77b3d7d0887128</td> | |
| 14248 <td>test.rdata</td> | |
| 14249 <td>rdata</td> | |
| 14250 <td>1</td> | |
| 14251 </tr><tr class=""> | |
| 14252 <th scope="row">option</th> | |
| 14253 <td>false</td> | |
| 14254 <td></td> | |
| 14255 <td></td> | |
| 14256 <td></td> | |
| 14257 </tr><tr class=""> | |
| 14258 <th scope="row">option</th> | |
| 14259 <td>hide</td> | |
| 14260 <td></td> | |
| 14261 <td></td> | |
| 14262 <td></td> | |
| 14263 </tr><tr class=""> | |
| 14264 <th scope="row">option</th> | |
| 14265 <td>hide</td> | |
| 14266 <td></td> | |
| 14267 <td></td> | |
| 14268 <td></td> | |
| 14269 </tr><tr class=""> | |
| 14270 <th scope="row">option</th> | |
| 14271 <td>hide</td> | |
| 14272 <td></td> | |
| 14273 <td></td> | |
| 14274 <td></td> | |
| 14275 </tr><tr class=""> | |
| 14276 <th scope="row">setting</th> | |
| 14277 <td>gcdefault</td> | |
| 14278 <td></td> | |
| 14279 <td></td> | |
| 14280 <td></td> | |
| 14281 </tr><tr class=""> | |
| 14282 <th scope="row">unkn</th> | |
| 14283 <td>1:5</td> | |
| 14284 <td></td> | |
| 14285 <td></td> | |
| 14286 <td></td> | |
| 14287 </tr> | |
| 14288 </table> | |
| 14289 </div> | |
| 14290 | |
| 14291 | |
| 14292 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 14293 <h2 | |
| 14294 class="history_metadata_extractor_h2" | |
| 14295 style="cursor: pointer" | |
| 14296 title="click to fold/unfold the table" | |
| 14297 > | |
| 14298 [DELETED] - metams_runGC - 2.1.1 | |
| 14299 </h2> | |
| 14300 <p> | |
| 14301 Outputs: | |
| 14302 </p> | |
| 14303 <p class="history_metadata_extractor_status"> | |
| 14304 Status: Failed (1) | |
| 14305 </p> | |
| 14306 <p class="history_metadata_extractor_glitter"></p> | |
| 14307 <table class=" | |
| 14308 table | |
| 14309 table-bordered | |
| 14310 table-dark | |
| 14311 table-striped | |
| 14312 table-hover | |
| 14313 d-block | |
| 14314 overflow-auto | |
| 14315 history_metadata_extractor_table | |
| 14316 "> | |
| 14317 <thead> | |
| 14318 <tr> | |
| 14319 <th scope="col"></th> | |
| 14320 <th scope="col">value</th> | |
| 14321 <th scope="col">name</th> | |
| 14322 <th scope="col">extension</th> | |
| 14323 <th scope="col">hid</th> | |
| 14324 </tr> | |
| 14325 </thead> | |
| 14326 <tr class=""> | |
| 14327 <th scope="row">input</th> | |
| 14328 <td>xset</td> | |
| 14329 <td></td> | |
| 14330 <td></td> | |
| 14331 <td></td> | |
| 14332 </tr><tr class=""> | |
| 14333 <th scope="row">xset</th> | |
| 14334 <td>9e77b3d7d0887128</td> | |
| 14335 <td>test.rdata</td> | |
| 14336 <td>rdata</td> | |
| 14337 <td>1</td> | |
| 14338 </tr><tr class=""> | |
| 14339 <th scope="row">option</th> | |
| 14340 <td>false</td> | |
| 14341 <td></td> | |
| 14342 <td></td> | |
| 14343 <td></td> | |
| 14344 </tr><tr class=""> | |
| 14345 <th scope="row">option</th> | |
| 14346 <td>hide</td> | |
| 14347 <td></td> | |
| 14348 <td></td> | |
| 14349 <td></td> | |
| 14350 </tr><tr class=""> | |
| 14351 <th scope="row">option</th> | |
| 14352 <td>hide</td> | |
| 14353 <td></td> | |
| 14354 <td></td> | |
| 14355 <td></td> | |
| 14356 </tr><tr class=""> | |
| 14357 <th scope="row">option</th> | |
| 14358 <td>hide</td> | |
| 14359 <td></td> | |
| 14360 <td></td> | |
| 14361 <td></td> | |
| 14362 </tr><tr class=""> | |
| 14363 <th scope="row">setting</th> | |
| 14364 <td>gcdefault</td> | |
| 14365 <td></td> | |
| 14366 <td></td> | |
| 14367 <td></td> | |
| 14368 </tr><tr class=""> | |
| 14369 <th scope="row">unkn</th> | |
| 14370 <td>1:5</td> | |
| 14371 <td></td> | |
| 14372 <td></td> | |
| 14373 <td></td> | |
| 14374 </tr> | |
| 14375 </table> | |
| 14376 </div> | |
| 14377 | |
| 14378 | |
| 14379 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 14380 <h2 | |
| 14381 class="history_metadata_extractor_h2" | |
| 14382 style="cursor: pointer" | |
| 14383 title="click to fold/unfold the table" | |
| 14384 > | |
| 14385 [DELETED] - metams_runGC - 2.1.1 | |
| 14386 </h2> | |
| 14387 <p> | |
| 14388 Outputs: | |
| 14389 </p> | |
| 14390 <p class="history_metadata_extractor_status"> | |
| 14391 Status: Failed (1) | |
| 14392 </p> | |
| 14393 <p class="history_metadata_extractor_glitter"></p> | |
| 14394 <table class=" | |
| 14395 table | |
| 14396 table-bordered | |
| 14397 table-dark | |
| 14398 table-striped | |
| 14399 table-hover | |
| 14400 d-block | |
| 14401 overflow-auto | |
| 14402 history_metadata_extractor_table | |
| 14403 "> | |
| 14404 <thead> | |
| 14405 <tr> | |
| 14406 <th scope="col"></th> | |
| 14407 <th scope="col">value</th> | |
| 14408 <th scope="col">name</th> | |
| 14409 <th scope="col">extension</th> | |
| 14410 <th scope="col">hid</th> | |
| 14411 </tr> | |
| 14412 </thead> | |
| 14413 <tr class=""> | |
| 14414 <th scope="row">input</th> | |
| 14415 <td>xset</td> | |
| 14416 <td></td> | |
| 14417 <td></td> | |
| 14418 <td></td> | |
| 14419 </tr><tr class=""> | |
| 14420 <th scope="row">xset</th> | |
| 14421 <td>9e77b3d7d0887128</td> | |
| 14422 <td>test.rdata</td> | |
| 14423 <td>rdata</td> | |
| 14424 <td>1</td> | |
| 14425 </tr><tr class=""> | |
| 14426 <th scope="row">option</th> | |
| 14427 <td>false</td> | |
| 14428 <td></td> | |
| 14429 <td></td> | |
| 14430 <td></td> | |
| 14431 </tr><tr class=""> | |
| 14432 <th scope="row">option</th> | |
| 14433 <td>hide</td> | |
| 14434 <td></td> | |
| 14435 <td></td> | |
| 14436 <td></td> | |
| 14437 </tr><tr class=""> | |
| 14438 <th scope="row">option</th> | |
| 14439 <td>hide</td> | |
| 14440 <td></td> | |
| 14441 <td></td> | |
| 14442 <td></td> | |
| 14443 </tr><tr class=""> | |
| 14444 <th scope="row">option</th> | |
| 14445 <td>hide</td> | |
| 14446 <td></td> | |
| 14447 <td></td> | |
| 14448 <td></td> | |
| 14449 </tr><tr class=""> | |
| 14450 <th scope="row">setting</th> | |
| 14451 <td>gcdefault</td> | |
| 14452 <td></td> | |
| 14453 <td></td> | |
| 14454 <td></td> | |
| 14455 </tr><tr class=""> | |
| 14456 <th scope="row">unkn</th> | |
| 14457 <td>1:5</td> | |
| 14458 <td></td> | |
| 14459 <td></td> | |
| 14460 <td></td> | |
| 14461 </tr> | |
| 14462 </table> | |
| 14463 </div> | |
| 14464 | |
| 14465 | |
| 14466 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 14467 <h2 | |
| 14468 class="history_metadata_extractor_h2" | |
| 14469 style="cursor: pointer" | |
| 14470 title="click to fold/unfold the table" | |
| 14471 > | |
| 14472 [DELETED] - metams_runGC - 2.1.1 | |
| 14473 </h2> | |
| 14474 <p> | |
| 14475 Outputs: | |
| 14476 </p> | |
| 14477 <p class="history_metadata_extractor_status"> | |
| 14478 Status: Failed (1) | |
| 14479 </p> | |
| 14480 <p class="history_metadata_extractor_glitter"></p> | |
| 14481 <table class=" | |
| 14482 table | |
| 14483 table-bordered | |
| 14484 table-dark | |
| 14485 table-striped | |
| 14486 table-hover | |
| 14487 d-block | |
| 14488 overflow-auto | |
| 14489 history_metadata_extractor_table | |
| 14490 "> | |
| 14491 <thead> | |
| 14492 <tr> | |
| 14493 <th scope="col"></th> | |
| 14494 <th scope="col">value</th> | |
| 14495 <th scope="col">name</th> | |
| 14496 <th scope="col">extension</th> | |
| 14497 <th scope="col">hid</th> | |
| 14498 </tr> | |
| 14499 </thead> | |
| 14500 <tr class=""> | |
| 14501 <th scope="row">input</th> | |
| 14502 <td>xset</td> | |
| 14503 <td></td> | |
| 14504 <td></td> | |
| 14505 <td></td> | |
| 14506 </tr><tr class=""> | |
| 14507 <th scope="row">xset</th> | |
| 14508 <td>9e77b3d7d0887128</td> | |
| 14509 <td>test.rdata</td> | |
| 14510 <td>rdata</td> | |
| 14511 <td>1</td> | |
| 14512 </tr><tr class=""> | |
| 14513 <th scope="row">option</th> | |
| 14514 <td>false</td> | |
| 14515 <td></td> | |
| 14516 <td></td> | |
| 14517 <td></td> | |
| 14518 </tr><tr class=""> | |
| 14519 <th scope="row">option</th> | |
| 14520 <td>hide</td> | |
| 14521 <td></td> | |
| 14522 <td></td> | |
| 14523 <td></td> | |
| 14524 </tr><tr class=""> | |
| 14525 <th scope="row">option</th> | |
| 14526 <td>hide</td> | |
| 14527 <td></td> | |
| 14528 <td></td> | |
| 14529 <td></td> | |
| 14530 </tr><tr class=""> | |
| 14531 <th scope="row">option</th> | |
| 14532 <td>hide</td> | |
| 14533 <td></td> | |
| 14534 <td></td> | |
| 14535 <td></td> | |
| 14536 </tr><tr class=""> | |
| 14537 <th scope="row">setting</th> | |
| 14538 <td>gcdefault</td> | |
| 14539 <td></td> | |
| 14540 <td></td> | |
| 14541 <td></td> | |
| 14542 </tr><tr class=""> | |
| 14543 <th scope="row">unkn</th> | |
| 14544 <td>1:5</td> | |
| 14545 <td></td> | |
| 14546 <td></td> | |
| 14547 <td></td> | |
| 14548 </tr> | |
| 14549 </table> | |
| 14550 </div> | |
| 14551 | |
| 14552 | |
| 14553 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 14554 <h2 | |
| 14555 class="history_metadata_extractor_h2" | |
| 14556 style="cursor: pointer" | |
| 14557 title="click to fold/unfold the table" | |
| 14558 > | |
| 14559 [DELETED] - metams_runGC - 2.1.1 | |
| 14560 </h2> | |
| 14561 <p> | |
| 14562 Outputs: | |
| 14563 </p> | |
| 14564 <p class="history_metadata_extractor_status"> | |
| 14565 Status: Failed (1) | |
| 14566 </p> | |
| 14567 <p class="history_metadata_extractor_glitter"></p> | |
| 14568 <table class=" | |
| 14569 table | |
| 14570 table-bordered | |
| 14571 table-dark | |
| 14572 table-striped | |
| 14573 table-hover | |
| 14574 d-block | |
| 14575 overflow-auto | |
| 14576 history_metadata_extractor_table | |
| 14577 "> | |
| 14578 <thead> | |
| 14579 <tr> | |
| 14580 <th scope="col"></th> | |
| 14581 <th scope="col">value</th> | |
| 14582 <th scope="col">name</th> | |
| 14583 <th scope="col">extension</th> | |
| 14584 <th scope="col">hid</th> | |
| 14585 </tr> | |
| 14586 </thead> | |
| 14587 <tr class=""> | |
| 14588 <th scope="row">input</th> | |
| 14589 <td>xset</td> | |
| 14590 <td></td> | |
| 14591 <td></td> | |
| 14592 <td></td> | |
| 14593 </tr><tr class=""> | |
| 14594 <th scope="row">xset</th> | |
| 14595 <td>9e77b3d7d0887128</td> | |
| 14596 <td>test.rdata</td> | |
| 14597 <td>rdata</td> | |
| 14598 <td>1</td> | |
| 14599 </tr><tr class=""> | |
| 14600 <th scope="row">option</th> | |
| 14601 <td>false</td> | |
| 14602 <td></td> | |
| 14603 <td></td> | |
| 14604 <td></td> | |
| 14605 </tr><tr class=""> | |
| 14606 <th scope="row">option</th> | |
| 14607 <td>hide</td> | |
| 14608 <td></td> | |
| 14609 <td></td> | |
| 14610 <td></td> | |
| 14611 </tr><tr class=""> | |
| 14612 <th scope="row">option</th> | |
| 14613 <td>hide</td> | |
| 14614 <td></td> | |
| 14615 <td></td> | |
| 14616 <td></td> | |
| 14617 </tr><tr class=""> | |
| 14618 <th scope="row">option</th> | |
| 14619 <td>hide</td> | |
| 14620 <td></td> | |
| 14621 <td></td> | |
| 14622 <td></td> | |
| 14623 </tr><tr class=""> | |
| 14624 <th scope="row">setting</th> | |
| 14625 <td>gcdefault</td> | |
| 14626 <td></td> | |
| 14627 <td></td> | |
| 14628 <td></td> | |
| 14629 </tr><tr class=""> | |
| 14630 <th scope="row">unkn</th> | |
| 14631 <td>1:5</td> | |
| 14632 <td></td> | |
| 14633 <td></td> | |
| 14634 <td></td> | |
| 14635 </tr> | |
| 14636 </table> | |
| 14637 </div> | |
| 14638 | |
| 14639 | |
| 14640 <div class="alert alert-danger"> | |
| 14641 <h2 | |
| 14642 class="history_metadata_extractor_h2" | |
| 14643 style="cursor: pointer" | |
| 14644 title="click to fold/unfold the table" | |
| 14645 > | |
| 14646 [595] - golm_ws_lib_search - 2016-12-05 | |
| 14647 </h2> | |
| 14648 <p> | |
| 14649 Outputs: | |
| 14650 </p> | |
| 14651 <p class="history_metadata_extractor_status"> | |
| 14652 Status: Failed (2) | |
| 14653 </p> | |
| 14654 <p class="history_metadata_extractor_glitter"></p> | |
| 14655 <table class=" | |
| 14656 table | |
| 14657 table-bordered | |
| 14658 table-dark | |
| 14659 table-striped | |
| 14660 table-hover | |
| 14661 d-block | |
| 14662 overflow-auto | |
| 14663 history_metadata_extractor_table | |
| 14664 "> | |
| 14665 <thead> | |
| 14666 <tr> | |
| 14667 <th scope="col"></th> | |
| 14668 <th scope="col">value</th> | |
| 14669 <th scope="col">name</th> | |
| 14670 <th scope="col">extension</th> | |
| 14671 <th scope="col">hid</th> | |
| 14672 </tr> | |
| 14673 </thead> | |
| 14674 <tr class=""> | |
| 14675 <th scope="row">DotproductDistanceThreshold</th> | |
| 14676 <td>0.5</td> | |
| 14677 <td></td> | |
| 14678 <td></td> | |
| 14679 <td></td> | |
| 14680 </tr><tr class=""> | |
| 14681 <th scope="row">EuclideanDistanceThreshold</th> | |
| 14682 <td>0.5</td> | |
| 14683 <td></td> | |
| 14684 <td></td> | |
| 14685 <td></td> | |
| 14686 </tr><tr class=""> | |
| 14687 <th scope="row">HammingDistanceThreshold</th> | |
| 14688 <td>500.0</td> | |
| 14689 <td></td> | |
| 14690 <td></td> | |
| 14691 <td></td> | |
| 14692 </tr><tr class=""> | |
| 14693 <th scope="row">JaccardDistanceThreshold</th> | |
| 14694 <td>0.9</td> | |
| 14695 <td></td> | |
| 14696 <td></td> | |
| 14697 <td></td> | |
| 14698 </tr><tr class=""> | |
| 14699 <th scope="row">columnType</th> | |
| 14700 <td>VAR5</td> | |
| 14701 <td></td> | |
| 14702 <td></td> | |
| 14703 <td></td> | |
| 14704 </tr><tr class=""> | |
| 14705 <th scope="row">choice</th> | |
| 14706 <td>YES</td> | |
| 14707 <td></td> | |
| 14708 <td></td> | |
| 14709 <td></td> | |
| 14710 </tr><tr class=""> | |
| 14711 <th scope="row">masses</th> | |
| 14712 <td>9a0ce47bd1734ae7</td> | |
| 14713 <td>peaklist_fragments.tsv</td> | |
| 14714 <td>tabular</td> | |
| 14715 <td>42</td> | |
| 14716 </tr><tr class=""> | |
| 14717 <th scope="row">intensity_type</th> | |
| 14718 <td>true</td> | |
| 14719 <td></td> | |
| 14720 <td></td> | |
| 14721 <td></td> | |
| 14722 </tr><tr class=""> | |
| 14723 <th scope="row">maxHits</th> | |
| 14724 <td>100</td> | |
| 14725 <td></td> | |
| 14726 <td></td> | |
| 14727 <td></td> | |
| 14728 </tr><tr class=""> | |
| 14729 <th scope="row">maxIons</th> | |
| 14730 <td>0</td> | |
| 14731 <td></td> | |
| 14732 <td></td> | |
| 14733 <td></td> | |
| 14734 </tr><tr class=""> | |
| 14735 <th scope="row">mzRes</th> | |
| 14736 <td>0</td> | |
| 14737 <td></td> | |
| 14738 <td></td> | |
| 14739 <td></td> | |
| 14740 </tr><tr class=""> | |
| 14741 <th scope="row">ri</th> | |
| 14742 <td>1898</td> | |
| 14743 <td></td> | |
| 14744 <td></td> | |
| 14745 <td></td> | |
| 14746 </tr><tr class=""> | |
| 14747 <th scope="row">riWindow</th> | |
| 14748 <td>5</td> | |
| 14749 <td></td> | |
| 14750 <td></td> | |
| 14751 <td></td> | |
| 14752 </tr><tr class=""> | |
| 14753 <th scope="row">s12GowerLegendreDistanceThreshold</th> | |
| 14754 <td>0.9</td> | |
| 14755 <td></td> | |
| 14756 <td></td> | |
| 14757 <td></td> | |
| 14758 </tr> | |
| 14759 </table> | |
| 14760 </div> | |
| 14761 | |
| 14762 | |
| 14763 <div class="alert alert-danger"> | |
| 14764 <h2 | |
| 14765 class="history_metadata_extractor_h2" | |
| 14766 style="cursor: pointer" | |
| 14767 title="click to fold/unfold the table" | |
| 14768 > | |
| 14769 [593] - golm_ws_lib_search - 2016-12-05 | |
| 14770 </h2> | |
| 14771 <p> | |
| 14772 Outputs: | |
| 14773 </p> | |
| 14774 <p class="history_metadata_extractor_status"> | |
| 14775 Status: Failed (2) | |
| 14776 </p> | |
| 14777 <p class="history_metadata_extractor_glitter"></p> | |
| 14778 <table class=" | |
| 14779 table | |
| 14780 table-bordered | |
| 14781 table-dark | |
| 14782 table-striped | |
| 14783 table-hover | |
| 14784 d-block | |
| 14785 overflow-auto | |
| 14786 history_metadata_extractor_table | |
| 14787 "> | |
| 14788 <thead> | |
| 14789 <tr> | |
| 14790 <th scope="col"></th> | |
| 14791 <th scope="col">value</th> | |
| 14792 <th scope="col">name</th> | |
| 14793 <th scope="col">extension</th> | |
| 14794 <th scope="col">hid</th> | |
| 14795 </tr> | |
| 14796 </thead> | |
| 14797 <tr class=""> | |
| 14798 <th scope="row">DotproductDistanceThreshold</th> | |
| 14799 <td>0.5</td> | |
| 14800 <td></td> | |
| 14801 <td></td> | |
| 14802 <td></td> | |
| 14803 </tr><tr class=""> | |
| 14804 <th scope="row">EuclideanDistanceThreshold</th> | |
| 14805 <td>0.5</td> | |
| 14806 <td></td> | |
| 14807 <td></td> | |
| 14808 <td></td> | |
| 14809 </tr><tr class=""> | |
| 14810 <th scope="row">HammingDistanceThreshold</th> | |
| 14811 <td>500.0</td> | |
| 14812 <td></td> | |
| 14813 <td></td> | |
| 14814 <td></td> | |
| 14815 </tr><tr class=""> | |
| 14816 <th scope="row">JaccardDistanceThreshold</th> | |
| 14817 <td>0.9</td> | |
| 14818 <td></td> | |
| 14819 <td></td> | |
| 14820 <td></td> | |
| 14821 </tr><tr class=""> | |
| 14822 <th scope="row">columnType</th> | |
| 14823 <td>VAR5</td> | |
| 14824 <td></td> | |
| 14825 <td></td> | |
| 14826 <td></td> | |
| 14827 </tr><tr class=""> | |
| 14828 <th scope="row">choice</th> | |
| 14829 <td>YES</td> | |
| 14830 <td></td> | |
| 14831 <td></td> | |
| 14832 <td></td> | |
| 14833 </tr><tr class=""> | |
| 14834 <th scope="row">masses</th> | |
| 14835 <td>9a0ce47bd1734ae7</td> | |
| 14836 <td>peaklist_fragments.tsv</td> | |
| 14837 <td>tabular</td> | |
| 14838 <td>42</td> | |
| 14839 </tr><tr class=""> | |
| 14840 <th scope="row">intensity_type</th> | |
| 14841 <td>true</td> | |
| 14842 <td></td> | |
| 14843 <td></td> | |
| 14844 <td></td> | |
| 14845 </tr><tr class=""> | |
| 14846 <th scope="row">maxHits</th> | |
| 14847 <td>100</td> | |
| 14848 <td></td> | |
| 14849 <td></td> | |
| 14850 <td></td> | |
| 14851 </tr><tr class=""> | |
| 14852 <th scope="row">maxIons</th> | |
| 14853 <td>0</td> | |
| 14854 <td></td> | |
| 14855 <td></td> | |
| 14856 <td></td> | |
| 14857 </tr><tr class=""> | |
| 14858 <th scope="row">mzRes</th> | |
| 14859 <td>0</td> | |
| 14860 <td></td> | |
| 14861 <td></td> | |
| 14862 <td></td> | |
| 14863 </tr><tr class=""> | |
| 14864 <th scope="row">ri</th> | |
| 14865 <td>1898</td> | |
| 14866 <td></td> | |
| 14867 <td></td> | |
| 14868 <td></td> | |
| 14869 </tr><tr class=""> | |
| 14870 <th scope="row">riWindow</th> | |
| 14871 <td>5</td> | |
| 14872 <td></td> | |
| 14873 <td></td> | |
| 14874 <td></td> | |
| 14875 </tr><tr class=""> | |
| 14876 <th scope="row">s12GowerLegendreDistanceThreshold</th> | |
| 14877 <td>0.9</td> | |
| 14878 <td></td> | |
| 14879 <td></td> | |
| 14880 <td></td> | |
| 14881 </tr> | |
| 14882 </table> | |
| 14883 </div> | |
| 14884 | |
| 14885 | |
| 14886 <div class="alert alert-danger"> | |
| 14887 <h2 | |
| 14888 class="history_metadata_extractor_h2" | |
| 14889 style="cursor: pointer" | |
| 14890 title="click to fold/unfold the table" | |
| 14891 > | |
| 14892 [594] - golm_ws_lib_search - 2016-12-05 | |
| 14893 </h2> | |
| 14894 <p> | |
| 14895 Outputs: | |
| 14896 </p> | |
| 14897 <p class="history_metadata_extractor_status"> | |
| 14898 Status: Failed (2) | |
| 14899 </p> | |
| 14900 <p class="history_metadata_extractor_glitter"></p> | |
| 14901 <table class=" | |
| 14902 table | |
| 14903 table-bordered | |
| 14904 table-dark | |
| 14905 table-striped | |
| 14906 table-hover | |
| 14907 d-block | |
| 14908 overflow-auto | |
| 14909 history_metadata_extractor_table | |
| 14910 "> | |
| 14911 <thead> | |
| 14912 <tr> | |
| 14913 <th scope="col"></th> | |
| 14914 <th scope="col">value</th> | |
| 14915 <th scope="col">name</th> | |
| 14916 <th scope="col">extension</th> | |
| 14917 <th scope="col">hid</th> | |
| 14918 </tr> | |
| 14919 </thead> | |
| 14920 <tr class=""> | |
| 14921 <th scope="row">DotproductDistanceThreshold</th> | |
| 14922 <td>0.5</td> | |
| 14923 <td></td> | |
| 14924 <td></td> | |
| 14925 <td></td> | |
| 14926 </tr><tr class=""> | |
| 14927 <th scope="row">EuclideanDistanceThreshold</th> | |
| 14928 <td>0.5</td> | |
| 14929 <td></td> | |
| 14930 <td></td> | |
| 14931 <td></td> | |
| 14932 </tr><tr class=""> | |
| 14933 <th scope="row">HammingDistanceThreshold</th> | |
| 14934 <td>500.0</td> | |
| 14935 <td></td> | |
| 14936 <td></td> | |
| 14937 <td></td> | |
| 14938 </tr><tr class=""> | |
| 14939 <th scope="row">JaccardDistanceThreshold</th> | |
| 14940 <td>0.9</td> | |
| 14941 <td></td> | |
| 14942 <td></td> | |
| 14943 <td></td> | |
| 14944 </tr><tr class=""> | |
| 14945 <th scope="row">columnType</th> | |
| 14946 <td>VAR5</td> | |
| 14947 <td></td> | |
| 14948 <td></td> | |
| 14949 <td></td> | |
| 14950 </tr><tr class=""> | |
| 14951 <th scope="row">choice</th> | |
| 14952 <td>YES</td> | |
| 14953 <td></td> | |
| 14954 <td></td> | |
| 14955 <td></td> | |
| 14956 </tr><tr class=""> | |
| 14957 <th scope="row">masses</th> | |
| 14958 <td>9a0ce47bd1734ae7</td> | |
| 14959 <td>peaklist_fragments.tsv</td> | |
| 14960 <td>tabular</td> | |
| 14961 <td>42</td> | |
| 14962 </tr><tr class=""> | |
| 14963 <th scope="row">intensity_type</th> | |
| 14964 <td>true</td> | |
| 14965 <td></td> | |
| 14966 <td></td> | |
| 14967 <td></td> | |
| 14968 </tr><tr class=""> | |
| 14969 <th scope="row">maxHits</th> | |
| 14970 <td>100</td> | |
| 14971 <td></td> | |
| 14972 <td></td> | |
| 14973 <td></td> | |
| 14974 </tr><tr class=""> | |
| 14975 <th scope="row">maxIons</th> | |
| 14976 <td>0</td> | |
| 14977 <td></td> | |
| 14978 <td></td> | |
| 14979 <td></td> | |
| 14980 </tr><tr class=""> | |
| 14981 <th scope="row">mzRes</th> | |
| 14982 <td>0</td> | |
| 14983 <td></td> | |
| 14984 <td></td> | |
| 14985 <td></td> | |
| 14986 </tr><tr class=""> | |
| 14987 <th scope="row">ri</th> | |
| 14988 <td>1898</td> | |
| 14989 <td></td> | |
| 14990 <td></td> | |
| 14991 <td></td> | |
| 14992 </tr><tr class=""> | |
| 14993 <th scope="row">riWindow</th> | |
| 14994 <td>5</td> | |
| 14995 <td></td> | |
| 14996 <td></td> | |
| 14997 <td></td> | |
| 14998 </tr><tr class=""> | |
| 14999 <th scope="row">s12GowerLegendreDistanceThreshold</th> | |
| 15000 <td>0.9</td> | |
| 15001 <td></td> | |
| 15002 <td></td> | |
| 15003 <td></td> | |
| 15004 </tr> | |
| 15005 </table> | |
| 15006 </div> | |
| 15007 | |
| 15008 | |
| 15009 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 15010 <h2 | |
| 15011 class="history_metadata_extractor_h2" | |
| 15012 style="cursor: pointer" | |
| 15013 title="click to fold/unfold the table" | |
| 15014 > | |
| 15015 [DELETED] - tablemerge - 1.0.1 | |
| 15016 </h2> | |
| 15017 <p> | |
| 15018 Outputs: | |
| 15019 </p> | |
| 15020 <p class="history_metadata_extractor_status"> | |
| 15021 Status: Failed (1) | |
| 15022 </p> | |
| 15023 <p class="history_metadata_extractor_glitter"></p> | |
| 15024 <table class=" | |
| 15025 table | |
| 15026 table-bordered | |
| 15027 table-dark | |
| 15028 table-striped | |
| 15029 table-hover | |
| 15030 d-block | |
| 15031 overflow-auto | |
| 15032 history_metadata_extractor_table | |
| 15033 "> | |
| 15034 <thead> | |
| 15035 <tr> | |
| 15036 <th scope="col"></th> | |
| 15037 <th scope="col">value</th> | |
| 15038 <th scope="col">name</th> | |
| 15039 <th scope="col">extension</th> | |
| 15040 <th scope="col">hid</th> | |
| 15041 </tr> | |
| 15042 </thead> | |
| 15043 <tr class=""> | |
| 15044 <th scope="row">Metadata_in</th> | |
| 15045 <td>7cf499d16bd542b2</td> | |
| 15046 <td>compounds_pos.txt</td> | |
| 15047 <td>tabular</td> | |
| 15048 <td>44</td> | |
| 15049 </tr><tr class=""> | |
| 15050 <th scope="row">dataMatrix_in</th> | |
| 15051 <td>9a0ce47bd1734ae7</td> | |
| 15052 <td>peaklist_fragments.tsv</td> | |
| 15053 <td>tabular</td> | |
| 15054 <td>42</td> | |
| 15055 </tr><tr class=""> | |
| 15056 <th scope="row">metatype</th> | |
| 15057 <td>sample</td> | |
| 15058 <td></td> | |
| 15059 <td></td> | |
| 15060 <td></td> | |
| 15061 </tr> | |
| 15062 </table> | |
| 15063 </div> | |
| 15064 | |
| 15065 | |
| 15066 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 15067 <h2 | |
| 15068 class="history_metadata_extractor_h2" | |
| 15069 style="cursor: pointer" | |
| 15070 title="click to fold/unfold the table" | |
| 15071 > | |
| 15072 [DELETED] - idchoice - 19.12 | |
| 15073 </h2> | |
| 15074 <p> | |
| 15075 Outputs: | |
| 15076 </p> | |
| 15077 <p class="history_metadata_extractor_status"> | |
| 15078 Status: Failed (1) | |
| 15079 </p> | |
| 15080 <p class="history_metadata_extractor_glitter"></p> | |
| 15081 <table class=" | |
| 15082 table | |
| 15083 table-bordered | |
| 15084 table-dark | |
| 15085 table-striped | |
| 15086 table-hover | |
| 15087 d-block | |
| 15088 overflow-auto | |
| 15089 history_metadata_extractor_table | |
| 15090 "> | |
| 15091 <thead> | |
| 15092 <tr> | |
| 15093 <th scope="col"></th> | |
| 15094 <th scope="col">value</th> | |
| 15095 <th scope="col">name</th> | |
| 15096 <th scope="col">extension</th> | |
| 15097 <th scope="col">hid</th> | |
| 15098 </tr> | |
| 15099 </thead> | |
| 15100 <tr class=""> | |
| 15101 <th scope="row">Metadata_in</th> | |
| 15102 <td>9a0ce47bd1734ae7</td> | |
| 15103 <td>peaklist_fragments.tsv</td> | |
| 15104 <td>tabular</td> | |
| 15105 <td>42</td> | |
| 15106 </tr><tr class=""> | |
| 15107 <th scope="row">col_name</th> | |
| 15108 <td></td> | |
| 15109 <td></td> | |
| 15110 <td></td> | |
| 15111 <td></td> | |
| 15112 </tr><tr class=""> | |
| 15113 <th scope="row">dataMatrix_in</th> | |
| 15114 <td>9a0ce47bd1734ae7</td> | |
| 15115 <td>peaklist_fragments.tsv</td> | |
| 15116 <td>tabular</td> | |
| 15117 <td>42</td> | |
| 15118 </tr><tr class=""> | |
| 15119 <th scope="row">makeunique</th> | |
| 15120 <td>no</td> | |
| 15121 <td></td> | |
| 15122 <td></td> | |
| 15123 <td></td> | |
| 15124 </tr><tr class=""> | |
| 15125 <th scope="row">metatype</th> | |
| 15126 <td>variable</td> | |
| 15127 <td></td> | |
| 15128 <td></td> | |
| 15129 <td></td> | |
| 15130 </tr> | |
| 15131 </table> | |
| 15132 </div> | |
| 15133 | |
| 15134 | |
| 15135 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 15136 <h2 | |
| 15137 class="history_metadata_extractor_h2" | |
| 15138 style="cursor: pointer" | |
| 15139 title="click to fold/unfold the table" | |
| 15140 > | |
| 15141 [DELETED] - idchoice - 19.12 | |
| 15142 </h2> | |
| 15143 <p> | |
| 15144 Outputs: | |
| 15145 </p> | |
| 15146 <p class="history_metadata_extractor_status"> | |
| 15147 Status: Failed (1) | |
| 15148 </p> | |
| 15149 <p class="history_metadata_extractor_glitter"></p> | |
| 15150 <table class=" | |
| 15151 table | |
| 15152 table-bordered | |
| 15153 table-dark | |
| 15154 table-striped | |
| 15155 table-hover | |
| 15156 d-block | |
| 15157 overflow-auto | |
| 15158 history_metadata_extractor_table | |
| 15159 "> | |
| 15160 <thead> | |
| 15161 <tr> | |
| 15162 <th scope="col"></th> | |
| 15163 <th scope="col">value</th> | |
| 15164 <th scope="col">name</th> | |
| 15165 <th scope="col">extension</th> | |
| 15166 <th scope="col">hid</th> | |
| 15167 </tr> | |
| 15168 </thead> | |
| 15169 <tr class=""> | |
| 15170 <th scope="row">Metadata_in</th> | |
| 15171 <td>9a0ce47bd1734ae7</td> | |
| 15172 <td>peaklist_fragments.tsv</td> | |
| 15173 <td>tabular</td> | |
| 15174 <td>42</td> | |
| 15175 </tr><tr class=""> | |
| 15176 <th scope="row">col_name</th> | |
| 15177 <td></td> | |
| 15178 <td></td> | |
| 15179 <td></td> | |
| 15180 <td></td> | |
| 15181 </tr><tr class=""> | |
| 15182 <th scope="row">dataMatrix_in</th> | |
| 15183 <td>9a0ce47bd1734ae7</td> | |
| 15184 <td>peaklist_fragments.tsv</td> | |
| 15185 <td>tabular</td> | |
| 15186 <td>42</td> | |
| 15187 </tr><tr class=""> | |
| 15188 <th scope="row">makeunique</th> | |
| 15189 <td>no</td> | |
| 15190 <td></td> | |
| 15191 <td></td> | |
| 15192 <td></td> | |
| 15193 </tr><tr class=""> | |
| 15194 <th scope="row">metatype</th> | |
| 15195 <td>variable</td> | |
| 15196 <td></td> | |
| 15197 <td></td> | |
| 15198 <td></td> | |
| 15199 </tr> | |
| 15200 </table> | |
| 15201 </div> | |
| 15202 | |
| 15203 | |
| 15204 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 15205 <h2 | |
| 15206 class="history_metadata_extractor_h2" | |
| 15207 style="cursor: pointer" | |
| 15208 title="click to fold/unfold the table" | |
| 15209 > | |
| 15210 [DELETED] - generic_filter - 2020.01 | |
| 15211 </h2> | |
| 15212 <p> | |
| 15213 Outputs: | |
| 15214 </p> | |
| 15215 <p class="history_metadata_extractor_status"> | |
| 15216 Status: Failed (1) | |
| 15217 </p> | |
| 15218 <p class="history_metadata_extractor_glitter"></p> | |
| 15219 <table class=" | |
| 15220 table | |
| 15221 table-bordered | |
| 15222 table-dark | |
| 15223 table-striped | |
| 15224 table-hover | |
| 15225 d-block | |
| 15226 overflow-auto | |
| 15227 history_metadata_extractor_table | |
| 15228 "> | |
| 15229 <thead> | |
| 15230 <tr> | |
| 15231 <th scope="col"></th> | |
| 15232 <th scope="col">value</th> | |
| 15233 <th scope="col">name</th> | |
| 15234 <th scope="col">extension</th> | |
| 15235 <th scope="col">hid</th> | |
| 15236 </tr> | |
| 15237 </thead> | |
| 15238 <tr class=""> | |
| 15239 <th scope="row">dataMatrix_in</th> | |
| 15240 <td>9a0ce47bd1734ae7</td> | |
| 15241 <td>peaklist_fragments.tsv</td> | |
| 15242 <td>tabular</td> | |
| 15243 <td>42</td> | |
| 15244 </tr><tr class=""> | |
| 15245 <th scope="row">Factors</th> | |
| 15246 <td>FALSE</td> | |
| 15247 <td></td> | |
| 15248 <td></td> | |
| 15249 <td></td> | |
| 15250 </tr><tr class=""> | |
| 15251 <th scope="row">Factors</th> | |
| 15252 <td>FALSE</td> | |
| 15253 <td></td> | |
| 15254 <td></td> | |
| 15255 <td></td> | |
| 15256 </tr><tr class=""> | |
| 15257 <th scope="row">sampleMetadata_in</th> | |
| 15258 <td>9a0ce47bd1734ae7</td> | |
| 15259 <td>peaklist_fragments.tsv</td> | |
| 15260 <td>tabular</td> | |
| 15261 <td>42</td> | |
| 15262 </tr><tr class=""> | |
| 15263 <th scope="row">variableMetadata_in</th> | |
| 15264 <td>9a0ce47bd1734ae7</td> | |
| 15265 <td>peaklist_fragments.tsv</td> | |
| 15266 <td>tabular</td> | |
| 15267 <td>42</td> | |
| 15268 </tr> | |
| 15269 </table> | |
| 15270 </div> | |
| 15271 | |
| 15272 | |
| 15273 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 15274 <h2 | |
| 15275 class="history_metadata_extractor_h2" | |
| 15276 style="cursor: pointer" | |
| 15277 title="click to fold/unfold the table" | |
| 15278 > | |
| 15279 [DELETED] - generic_filter - 2020.01 | |
| 15280 </h2> | |
| 15281 <p> | |
| 15282 Outputs: | |
| 15283 </p> | |
| 15284 <p class="history_metadata_extractor_status"> | |
| 15285 Status: Failed (1) | |
| 15286 </p> | |
| 15287 <p class="history_metadata_extractor_glitter"></p> | |
| 15288 <table class=" | |
| 15289 table | |
| 15290 table-bordered | |
| 15291 table-dark | |
| 15292 table-striped | |
| 15293 table-hover | |
| 15294 d-block | |
| 15295 overflow-auto | |
| 15296 history_metadata_extractor_table | |
| 15297 "> | |
| 15298 <thead> | |
| 15299 <tr> | |
| 15300 <th scope="col"></th> | |
| 15301 <th scope="col">value</th> | |
| 15302 <th scope="col">name</th> | |
| 15303 <th scope="col">extension</th> | |
| 15304 <th scope="col">hid</th> | |
| 15305 </tr> | |
| 15306 </thead> | |
| 15307 <tr class=""> | |
| 15308 <th scope="row">dataMatrix_in</th> | |
| 15309 <td>9a0ce47bd1734ae7</td> | |
| 15310 <td>peaklist_fragments.tsv</td> | |
| 15311 <td>tabular</td> | |
| 15312 <td>42</td> | |
| 15313 </tr><tr class=""> | |
| 15314 <th scope="row">Factors</th> | |
| 15315 <td>FALSE</td> | |
| 15316 <td></td> | |
| 15317 <td></td> | |
| 15318 <td></td> | |
| 15319 </tr><tr class=""> | |
| 15320 <th scope="row">Factors</th> | |
| 15321 <td>FALSE</td> | |
| 15322 <td></td> | |
| 15323 <td></td> | |
| 15324 <td></td> | |
| 15325 </tr><tr class=""> | |
| 15326 <th scope="row">sampleMetadata_in</th> | |
| 15327 <td>9a0ce47bd1734ae7</td> | |
| 15328 <td>peaklist_fragments.tsv</td> | |
| 15329 <td>tabular</td> | |
| 15330 <td>42</td> | |
| 15331 </tr><tr class=""> | |
| 15332 <th scope="row">variableMetadata_in</th> | |
| 15333 <td>9a0ce47bd1734ae7</td> | |
| 15334 <td>peaklist_fragments.tsv</td> | |
| 15335 <td>tabular</td> | |
| 15336 <td>42</td> | |
| 15337 </tr> | |
| 15338 </table> | |
| 15339 </div> | |
| 15340 | |
| 15341 | |
| 15342 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 15343 <h2 | |
| 15344 class="history_metadata_extractor_h2" | |
| 15345 style="cursor: pointer" | |
| 15346 title="click to fold/unfold the table" | |
| 15347 > | |
| 15348 [DELETED] - generic_filter - 2020.01 | |
| 15349 </h2> | |
| 15350 <p> | |
| 15351 Outputs: | |
| 15352 </p> | |
| 15353 <p class="history_metadata_extractor_status"> | |
| 15354 Status: Failed (1) | |
| 15355 </p> | |
| 15356 <p class="history_metadata_extractor_glitter"></p> | |
| 15357 <table class=" | |
| 15358 table | |
| 15359 table-bordered | |
| 15360 table-dark | |
| 15361 table-striped | |
| 15362 table-hover | |
| 15363 d-block | |
| 15364 overflow-auto | |
| 15365 history_metadata_extractor_table | |
| 15366 "> | |
| 15367 <thead> | |
| 15368 <tr> | |
| 15369 <th scope="col"></th> | |
| 15370 <th scope="col">value</th> | |
| 15371 <th scope="col">name</th> | |
| 15372 <th scope="col">extension</th> | |
| 15373 <th scope="col">hid</th> | |
| 15374 </tr> | |
| 15375 </thead> | |
| 15376 <tr class=""> | |
| 15377 <th scope="row">dataMatrix_in</th> | |
| 15378 <td>9a0ce47bd1734ae7</td> | |
| 15379 <td>peaklist_fragments.tsv</td> | |
| 15380 <td>tabular</td> | |
| 15381 <td>42</td> | |
| 15382 </tr><tr class=""> | |
| 15383 <th scope="row">Factors</th> | |
| 15384 <td>FALSE</td> | |
| 15385 <td></td> | |
| 15386 <td></td> | |
| 15387 <td></td> | |
| 15388 </tr><tr class=""> | |
| 15389 <th scope="row">Factors</th> | |
| 15390 <td>FALSE</td> | |
| 15391 <td></td> | |
| 15392 <td></td> | |
| 15393 <td></td> | |
| 15394 </tr><tr class=""> | |
| 15395 <th scope="row">sampleMetadata_in</th> | |
| 15396 <td>9a0ce47bd1734ae7</td> | |
| 15397 <td>peaklist_fragments.tsv</td> | |
| 15398 <td>tabular</td> | |
| 15399 <td>42</td> | |
| 15400 </tr><tr class=""> | |
| 15401 <th scope="row">variableMetadata_in</th> | |
| 15402 <td>9a0ce47bd1734ae7</td> | |
| 15403 <td>peaklist_fragments.tsv</td> | |
| 15404 <td>tabular</td> | |
| 15405 <td>42</td> | |
| 15406 </tr> | |
| 15407 </table> | |
| 15408 </div> | |
| 15409 | |
| 15410 | |
| 15411 <div class="alert alert-danger"> | |
| 15412 <h2 | |
| 15413 class="history_metadata_extractor_h2" | |
| 15414 style="cursor: pointer" | |
| 15415 title="click to fold/unfold the table" | |
| 15416 > | |
| 15417 [602] - Add_a_column1 - 1.1.0 | |
| 15418 </h2> | |
| 15419 <p> | |
| 15420 Outputs: | |
| 15421 </p> | |
| 15422 <p class="history_metadata_extractor_status"> | |
| 15423 Status: Failed (1) | |
| 15424 </p> | |
| 15425 <p class="history_metadata_extractor_glitter"></p> | |
| 15426 <table class=" | |
| 15427 table | |
| 15428 table-bordered | |
| 15429 table-dark | |
| 15430 table-striped | |
| 15431 table-hover | |
| 15432 d-block | |
| 15433 overflow-auto | |
| 15434 history_metadata_extractor_table | |
| 15435 "> | |
| 15436 <thead> | |
| 15437 <tr> | |
| 15438 <th scope="col"></th> | |
| 15439 <th scope="col">value</th> | |
| 15440 <th scope="col">name</th> | |
| 15441 <th scope="col">extension</th> | |
| 15442 <th scope="col">hid</th> | |
| 15443 </tr> | |
| 15444 </thead> | |
| 15445 <tr class=""> | |
| 15446 <th scope="row">cond</th> | |
| 15447 <td>c3-c2</td> | |
| 15448 <td></td> | |
| 15449 <td></td> | |
| 15450 <td></td> | |
| 15451 </tr><tr class=""> | |
| 15452 <th scope="row">input</th> | |
| 15453 <td>9a0ce47bd1734ae7</td> | |
| 15454 <td>peaklist_fragments.tsv</td> | |
| 15455 <td>tabular</td> | |
| 15456 <td>42</td> | |
| 15457 </tr><tr class=""> | |
| 15458 <th scope="row">round</th> | |
| 15459 <td>no</td> | |
| 15460 <td></td> | |
| 15461 <td></td> | |
| 15462 <td></td> | |
| 15463 </tr> | |
| 15464 </table> | |
| 15465 </div> | |
| 15466 | |
| 15467 | |
| 15468 <div class="alert alert-success history_metadata_extractor_deleted"> | |
| 15469 <h2 | |
| 15470 class="history_metadata_extractor_h2" | |
| 15471 style="cursor: pointer" | |
| 15472 title="click to fold/unfold the table" | |
| 15473 > | |
| 15474 [DELETED] - Cut1 - 1.0.2 | |
| 15475 </h2> | |
| 15476 <p> | |
| 15477 Outputs: | |
| 15478 </p> | |
| 15479 <p class="history_metadata_extractor_status"> | |
| 15480 Status: Ok (0) | |
| 15481 </p> | |
| 15482 <p class="history_metadata_extractor_glitter"></p> | |
| 15483 <table class=" | |
| 15484 table | |
| 15485 table-bordered | |
| 15486 table-dark | |
| 15487 table-striped | |
| 15488 table-hover | |
| 15489 d-block | |
| 15490 overflow-auto | |
| 15491 history_metadata_extractor_table | |
| 15492 "> | |
| 15493 <thead> | |
| 15494 <tr> | |
| 15495 <th scope="col"></th> | |
| 15496 <th scope="col">value</th> | |
| 15497 <th scope="col">name</th> | |
| 15498 <th scope="col">extension</th> | |
| 15499 <th scope="col">hid</th> | |
| 15500 </tr> | |
| 15501 </thead> | |
| 15502 <tr class=""> | |
| 15503 <th scope="row">columnList</th> | |
| 15504 <td>c1,c2</td> | |
| 15505 <td></td> | |
| 15506 <td></td> | |
| 15507 <td></td> | |
| 15508 </tr><tr class=""> | |
| 15509 <th scope="row">delimiter</th> | |
| 15510 <td>T</td> | |
| 15511 <td></td> | |
| 15512 <td></td> | |
| 15513 <td></td> | |
| 15514 </tr><tr class=""> | |
| 15515 <th scope="row">input</th> | |
| 15516 <td>9a0ce47bd1734ae7</td> | |
| 15517 <td>peaklist_fragments.tsv</td> | |
| 15518 <td>tabular</td> | |
| 15519 <td>42</td> | |
| 15520 </tr> | |
| 15521 </table> | |
| 15522 </div> | |
| 15523 | |
| 15524 | |
| 15525 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 15526 <h2 | |
| 15527 class="history_metadata_extractor_h2" | |
| 15528 style="cursor: pointer" | |
| 15529 title="click to fold/unfold the table" | |
| 15530 > | |
| 15531 [DELETED] - quality_metrics - 2.2.8 | |
| 15532 </h2> | |
| 15533 <p> | |
| 15534 Outputs: | |
| 15535 </p> | |
| 15536 <p class="history_metadata_extractor_status"> | |
| 15537 Status: Failed (1) | |
| 15538 </p> | |
| 15539 <p class="history_metadata_extractor_glitter"></p> | |
| 15540 <table class=" | |
| 15541 table | |
| 15542 table-bordered | |
| 15543 table-dark | |
| 15544 table-striped | |
| 15545 table-hover | |
| 15546 d-block | |
| 15547 overflow-auto | |
| 15548 history_metadata_extractor_table | |
| 15549 "> | |
| 15550 <thead> | |
| 15551 <tr> | |
| 15552 <th scope="col"></th> | |
| 15553 <th scope="col">value</th> | |
| 15554 <th scope="col">name</th> | |
| 15555 <th scope="col">extension</th> | |
| 15556 <th scope="col">hid</th> | |
| 15557 </tr> | |
| 15558 </thead> | |
| 15559 <tr class=""> | |
| 15560 <th scope="row">CV</th> | |
| 15561 <td>FALSE</td> | |
| 15562 <td></td> | |
| 15563 <td></td> | |
| 15564 <td></td> | |
| 15565 </tr><tr class=""> | |
| 15566 <th scope="row">Compa</th> | |
| 15567 <td>TRUE</td> | |
| 15568 <td></td> | |
| 15569 <td></td> | |
| 15570 <td></td> | |
| 15571 </tr><tr class=""> | |
| 15572 <th scope="row">seuil</th> | |
| 15573 <td>1</td> | |
| 15574 <td></td> | |
| 15575 <td></td> | |
| 15576 <td></td> | |
| 15577 </tr><tr class=""> | |
| 15578 <th scope="row">optC</th> | |
| 15579 <td>default</td> | |
| 15580 <td></td> | |
| 15581 <td></td> | |
| 15582 <td></td> | |
| 15583 </tr><tr class=""> | |
| 15584 <th scope="row">poolAsPool1L</th> | |
| 15585 <td>TRUE</td> | |
| 15586 <td></td> | |
| 15587 <td></td> | |
| 15588 <td></td> | |
| 15589 </tr><tr class=""> | |
| 15590 <th scope="row">dataMatrix_in</th> | |
| 15591 <td>5c30ceded02186bf</td> | |
| 15592 <td>peaklist_fragmen.GOLM.txt</td> | |
| 15593 <td>tabular</td> | |
| 15594 <td>595</td> | |
| 15595 </tr><tr class=""> | |
| 15596 <th scope="row">sampleMetadata_in</th> | |
| 15597 <td>5c30ceded02186bf</td> | |
| 15598 <td>peaklist_fragmen.GOLM.txt</td> | |
| 15599 <td>tabular</td> | |
| 15600 <td>595</td> | |
| 15601 </tr><tr class=""> | |
| 15602 <th scope="row">variableMetadata_in</th> | |
| 15603 <td>5c30ceded02186bf</td> | |
| 15604 <td>peaklist_fragmen.GOLM.txt</td> | |
| 15605 <td>tabular</td> | |
| 15606 <td>595</td> | |
| 15607 </tr> | |
| 15608 </table> | |
| 15609 </div> | |
| 15610 | |
| 15611 | |
| 15612 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 15613 <h2 | |
| 15614 class="history_metadata_extractor_h2" | |
| 15615 style="cursor: pointer" | |
| 15616 title="click to fold/unfold the table" | |
| 15617 > | |
| 15618 [DELETED] - quality_metrics - 2.2.8 | |
| 15619 </h2> | |
| 15620 <p> | |
| 15621 Outputs: | |
| 15622 </p> | |
| 15623 <p class="history_metadata_extractor_status"> | |
| 15624 Status: Failed (1) | |
| 15625 </p> | |
| 15626 <p class="history_metadata_extractor_glitter"></p> | |
| 15627 <table class=" | |
| 15628 table | |
| 15629 table-bordered | |
| 15630 table-dark | |
| 15631 table-striped | |
| 15632 table-hover | |
| 15633 d-block | |
| 15634 overflow-auto | |
| 15635 history_metadata_extractor_table | |
| 15636 "> | |
| 15637 <thead> | |
| 15638 <tr> | |
| 15639 <th scope="col"></th> | |
| 15640 <th scope="col">value</th> | |
| 15641 <th scope="col">name</th> | |
| 15642 <th scope="col">extension</th> | |
| 15643 <th scope="col">hid</th> | |
| 15644 </tr> | |
| 15645 </thead> | |
| 15646 <tr class=""> | |
| 15647 <th scope="row">CV</th> | |
| 15648 <td>FALSE</td> | |
| 15649 <td></td> | |
| 15650 <td></td> | |
| 15651 <td></td> | |
| 15652 </tr><tr class=""> | |
| 15653 <th scope="row">Compa</th> | |
| 15654 <td>TRUE</td> | |
| 15655 <td></td> | |
| 15656 <td></td> | |
| 15657 <td></td> | |
| 15658 </tr><tr class=""> | |
| 15659 <th scope="row">seuil</th> | |
| 15660 <td>1</td> | |
| 15661 <td></td> | |
| 15662 <td></td> | |
| 15663 <td></td> | |
| 15664 </tr><tr class=""> | |
| 15665 <th scope="row">optC</th> | |
| 15666 <td>default</td> | |
| 15667 <td></td> | |
| 15668 <td></td> | |
| 15669 <td></td> | |
| 15670 </tr><tr class=""> | |
| 15671 <th scope="row">poolAsPool1L</th> | |
| 15672 <td>TRUE</td> | |
| 15673 <td></td> | |
| 15674 <td></td> | |
| 15675 <td></td> | |
| 15676 </tr><tr class=""> | |
| 15677 <th scope="row">dataMatrix_in</th> | |
| 15678 <td>5c30ceded02186bf</td> | |
| 15679 <td>peaklist_fragmen.GOLM.txt</td> | |
| 15680 <td>tabular</td> | |
| 15681 <td>595</td> | |
| 15682 </tr><tr class=""> | |
| 15683 <th scope="row">sampleMetadata_in</th> | |
| 15684 <td>5c30ceded02186bf</td> | |
| 15685 <td>peaklist_fragmen.GOLM.txt</td> | |
| 15686 <td>tabular</td> | |
| 15687 <td>595</td> | |
| 15688 </tr><tr class=""> | |
| 15689 <th scope="row">variableMetadata_in</th> | |
| 15690 <td>5c30ceded02186bf</td> | |
| 15691 <td>peaklist_fragmen.GOLM.txt</td> | |
| 15692 <td>tabular</td> | |
| 15693 <td>595</td> | |
| 15694 </tr> | |
| 15695 </table> | |
| 15696 </div> | |
| 15697 | |
| 15698 | |
| 15699 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 15700 <h2 | |
| 15701 class="history_metadata_extractor_h2" | |
| 15702 style="cursor: pointer" | |
| 15703 title="click to fold/unfold the table" | |
| 15704 > | |
| 15705 [DELETED] - quality_metrics - 2.2.8 | |
| 15706 </h2> | |
| 15707 <p> | |
| 15708 Outputs: | |
| 15709 </p> | |
| 15710 <p class="history_metadata_extractor_status"> | |
| 15711 Status: Failed (1) | |
| 15712 </p> | |
| 15713 <p class="history_metadata_extractor_glitter"></p> | |
| 15714 <table class=" | |
| 15715 table | |
| 15716 table-bordered | |
| 15717 table-dark | |
| 15718 table-striped | |
| 15719 table-hover | |
| 15720 d-block | |
| 15721 overflow-auto | |
| 15722 history_metadata_extractor_table | |
| 15723 "> | |
| 15724 <thead> | |
| 15725 <tr> | |
| 15726 <th scope="col"></th> | |
| 15727 <th scope="col">value</th> | |
| 15728 <th scope="col">name</th> | |
| 15729 <th scope="col">extension</th> | |
| 15730 <th scope="col">hid</th> | |
| 15731 </tr> | |
| 15732 </thead> | |
| 15733 <tr class=""> | |
| 15734 <th scope="row">CV</th> | |
| 15735 <td>FALSE</td> | |
| 15736 <td></td> | |
| 15737 <td></td> | |
| 15738 <td></td> | |
| 15739 </tr><tr class=""> | |
| 15740 <th scope="row">Compa</th> | |
| 15741 <td>TRUE</td> | |
| 15742 <td></td> | |
| 15743 <td></td> | |
| 15744 <td></td> | |
| 15745 </tr><tr class=""> | |
| 15746 <th scope="row">seuil</th> | |
| 15747 <td>1</td> | |
| 15748 <td></td> | |
| 15749 <td></td> | |
| 15750 <td></td> | |
| 15751 </tr><tr class=""> | |
| 15752 <th scope="row">optC</th> | |
| 15753 <td>default</td> | |
| 15754 <td></td> | |
| 15755 <td></td> | |
| 15756 <td></td> | |
| 15757 </tr><tr class=""> | |
| 15758 <th scope="row">poolAsPool1L</th> | |
| 15759 <td>TRUE</td> | |
| 15760 <td></td> | |
| 15761 <td></td> | |
| 15762 <td></td> | |
| 15763 </tr><tr class=""> | |
| 15764 <th scope="row">dataMatrix_in</th> | |
| 15765 <td>5c30ceded02186bf</td> | |
| 15766 <td>peaklist_fragmen.GOLM.txt</td> | |
| 15767 <td>tabular</td> | |
| 15768 <td>595</td> | |
| 15769 </tr><tr class=""> | |
| 15770 <th scope="row">sampleMetadata_in</th> | |
| 15771 <td>5c30ceded02186bf</td> | |
| 15772 <td>peaklist_fragmen.GOLM.txt</td> | |
| 15773 <td>tabular</td> | |
| 15774 <td>595</td> | |
| 15775 </tr><tr class=""> | |
| 15776 <th scope="row">variableMetadata_in</th> | |
| 15777 <td>5c30ceded02186bf</td> | |
| 15778 <td>peaklist_fragmen.GOLM.txt</td> | |
| 15779 <td>tabular</td> | |
| 15780 <td>595</td> | |
| 15781 </tr> | |
| 15782 </table> | |
| 15783 </div> | |
| 15784 | |
| 15785 | |
| 15786 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 15787 <h2 | |
| 15788 class="history_metadata_extractor_h2" | |
| 15789 style="cursor: pointer" | |
| 15790 title="click to fold/unfold the table" | |
| 15791 > | |
| 15792 [DELETED] - quality_metrics - 2.2.8 | |
| 15793 </h2> | |
| 15794 <p> | |
| 15795 Outputs: | |
| 15796 </p> | |
| 15797 <p class="history_metadata_extractor_status"> | |
| 15798 Status: Failed (1) | |
| 15799 </p> | |
| 15800 <p class="history_metadata_extractor_glitter"></p> | |
| 15801 <table class=" | |
| 15802 table | |
| 15803 table-bordered | |
| 15804 table-dark | |
| 15805 table-striped | |
| 15806 table-hover | |
| 15807 d-block | |
| 15808 overflow-auto | |
| 15809 history_metadata_extractor_table | |
| 15810 "> | |
| 15811 <thead> | |
| 15812 <tr> | |
| 15813 <th scope="col"></th> | |
| 15814 <th scope="col">value</th> | |
| 15815 <th scope="col">name</th> | |
| 15816 <th scope="col">extension</th> | |
| 15817 <th scope="col">hid</th> | |
| 15818 </tr> | |
| 15819 </thead> | |
| 15820 <tr class=""> | |
| 15821 <th scope="row">CV</th> | |
| 15822 <td>FALSE</td> | |
| 15823 <td></td> | |
| 15824 <td></td> | |
| 15825 <td></td> | |
| 15826 </tr><tr class=""> | |
| 15827 <th scope="row">Compa</th> | |
| 15828 <td>TRUE</td> | |
| 15829 <td></td> | |
| 15830 <td></td> | |
| 15831 <td></td> | |
| 15832 </tr><tr class=""> | |
| 15833 <th scope="row">seuil</th> | |
| 15834 <td>1</td> | |
| 15835 <td></td> | |
| 15836 <td></td> | |
| 15837 <td></td> | |
| 15838 </tr><tr class=""> | |
| 15839 <th scope="row">optC</th> | |
| 15840 <td>default</td> | |
| 15841 <td></td> | |
| 15842 <td></td> | |
| 15843 <td></td> | |
| 15844 </tr><tr class=""> | |
| 15845 <th scope="row">poolAsPool1L</th> | |
| 15846 <td>TRUE</td> | |
| 15847 <td></td> | |
| 15848 <td></td> | |
| 15849 <td></td> | |
| 15850 </tr><tr class=""> | |
| 15851 <th scope="row">dataMatrix_in</th> | |
| 15852 <td>5c30ceded02186bf</td> | |
| 15853 <td>peaklist_fragmen.GOLM.txt</td> | |
| 15854 <td>tabular</td> | |
| 15855 <td>595</td> | |
| 15856 </tr><tr class=""> | |
| 15857 <th scope="row">sampleMetadata_in</th> | |
| 15858 <td>5c30ceded02186bf</td> | |
| 15859 <td>peaklist_fragmen.GOLM.txt</td> | |
| 15860 <td>tabular</td> | |
| 15861 <td>595</td> | |
| 15862 </tr><tr class=""> | |
| 15863 <th scope="row">variableMetadata_in</th> | |
| 15864 <td>5c30ceded02186bf</td> | |
| 15865 <td>peaklist_fragmen.GOLM.txt</td> | |
| 15866 <td>tabular</td> | |
| 15867 <td>595</td> | |
| 15868 </tr> | |
| 15869 </table> | |
| 15870 </div> | |
| 15871 | |
| 15872 | |
| 15873 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 15874 <h2 | |
| 15875 class="history_metadata_extractor_h2" | |
| 15876 style="cursor: pointer" | |
| 15877 title="click to fold/unfold the table" | |
| 15878 > | |
| 15879 [DELETED] - quality_metrics - 2.2.8 | |
| 15880 </h2> | |
| 15881 <p> | |
| 15882 Outputs: | |
| 15883 </p> | |
| 15884 <p class="history_metadata_extractor_status"> | |
| 15885 Status: Failed (1) | |
| 15886 </p> | |
| 15887 <p class="history_metadata_extractor_glitter"></p> | |
| 15888 <table class=" | |
| 15889 table | |
| 15890 table-bordered | |
| 15891 table-dark | |
| 15892 table-striped | |
| 15893 table-hover | |
| 15894 d-block | |
| 15895 overflow-auto | |
| 15896 history_metadata_extractor_table | |
| 15897 "> | |
| 15898 <thead> | |
| 15899 <tr> | |
| 15900 <th scope="col"></th> | |
| 15901 <th scope="col">value</th> | |
| 15902 <th scope="col">name</th> | |
| 15903 <th scope="col">extension</th> | |
| 15904 <th scope="col">hid</th> | |
| 15905 </tr> | |
| 15906 </thead> | |
| 15907 <tr class=""> | |
| 15908 <th scope="row">CV</th> | |
| 15909 <td>FALSE</td> | |
| 15910 <td></td> | |
| 15911 <td></td> | |
| 15912 <td></td> | |
| 15913 </tr><tr class=""> | |
| 15914 <th scope="row">Compa</th> | |
| 15915 <td>TRUE</td> | |
| 15916 <td></td> | |
| 15917 <td></td> | |
| 15918 <td></td> | |
| 15919 </tr><tr class=""> | |
| 15920 <th scope="row">seuil</th> | |
| 15921 <td>1</td> | |
| 15922 <td></td> | |
| 15923 <td></td> | |
| 15924 <td></td> | |
| 15925 </tr><tr class=""> | |
| 15926 <th scope="row">optC</th> | |
| 15927 <td>default</td> | |
| 15928 <td></td> | |
| 15929 <td></td> | |
| 15930 <td></td> | |
| 15931 </tr><tr class=""> | |
| 15932 <th scope="row">poolAsPool1L</th> | |
| 15933 <td>TRUE</td> | |
| 15934 <td></td> | |
| 15935 <td></td> | |
| 15936 <td></td> | |
| 15937 </tr><tr class=""> | |
| 15938 <th scope="row">dataMatrix_in</th> | |
| 15939 <td>9a0ce47bd1734ae7</td> | |
| 15940 <td>peaklist_fragments.tsv</td> | |
| 15941 <td>tabular</td> | |
| 15942 <td>42</td> | |
| 15943 </tr><tr class=""> | |
| 15944 <th scope="row">sampleMetadata_in</th> | |
| 15945 <td>9a0ce47bd1734ae7</td> | |
| 15946 <td>peaklist_fragments.tsv</td> | |
| 15947 <td>tabular</td> | |
| 15948 <td>42</td> | |
| 15949 </tr><tr class=""> | |
| 15950 <th scope="row">variableMetadata_in</th> | |
| 15951 <td>9a0ce47bd1734ae7</td> | |
| 15952 <td>peaklist_fragments.tsv</td> | |
| 15953 <td>tabular</td> | |
| 15954 <td>42</td> | |
| 15955 </tr> | |
| 15956 </table> | |
| 15957 </div> | |
| 15958 | |
| 15959 | |
| 15960 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 15961 <h2 | |
| 15962 class="history_metadata_extractor_h2" | |
| 15963 style="cursor: pointer" | |
| 15964 title="click to fold/unfold the table" | |
| 15965 > | |
| 15966 [DELETED] - quality_metrics - 2.2.8 | |
| 15967 </h2> | |
| 15968 <p> | |
| 15969 Outputs: | |
| 15970 </p> | |
| 15971 <p class="history_metadata_extractor_status"> | |
| 15972 Status: Failed (1) | |
| 15973 </p> | |
| 15974 <p class="history_metadata_extractor_glitter"></p> | |
| 15975 <table class=" | |
| 15976 table | |
| 15977 table-bordered | |
| 15978 table-dark | |
| 15979 table-striped | |
| 15980 table-hover | |
| 15981 d-block | |
| 15982 overflow-auto | |
| 15983 history_metadata_extractor_table | |
| 15984 "> | |
| 15985 <thead> | |
| 15986 <tr> | |
| 15987 <th scope="col"></th> | |
| 15988 <th scope="col">value</th> | |
| 15989 <th scope="col">name</th> | |
| 15990 <th scope="col">extension</th> | |
| 15991 <th scope="col">hid</th> | |
| 15992 </tr> | |
| 15993 </thead> | |
| 15994 <tr class=""> | |
| 15995 <th scope="row">CV</th> | |
| 15996 <td>FALSE</td> | |
| 15997 <td></td> | |
| 15998 <td></td> | |
| 15999 <td></td> | |
| 16000 </tr><tr class=""> | |
| 16001 <th scope="row">Compa</th> | |
| 16002 <td>TRUE</td> | |
| 16003 <td></td> | |
| 16004 <td></td> | |
| 16005 <td></td> | |
| 16006 </tr><tr class=""> | |
| 16007 <th scope="row">seuil</th> | |
| 16008 <td>1</td> | |
| 16009 <td></td> | |
| 16010 <td></td> | |
| 16011 <td></td> | |
| 16012 </tr><tr class=""> | |
| 16013 <th scope="row">optC</th> | |
| 16014 <td>default</td> | |
| 16015 <td></td> | |
| 16016 <td></td> | |
| 16017 <td></td> | |
| 16018 </tr><tr class=""> | |
| 16019 <th scope="row">poolAsPool1L</th> | |
| 16020 <td>TRUE</td> | |
| 16021 <td></td> | |
| 16022 <td></td> | |
| 16023 <td></td> | |
| 16024 </tr><tr class=""> | |
| 16025 <th scope="row">dataMatrix_in</th> | |
| 16026 <td>9a0ce47bd1734ae7</td> | |
| 16027 <td>peaklist_fragments.tsv</td> | |
| 16028 <td>tabular</td> | |
| 16029 <td>42</td> | |
| 16030 </tr><tr class=""> | |
| 16031 <th scope="row">sampleMetadata_in</th> | |
| 16032 <td>9a0ce47bd1734ae7</td> | |
| 16033 <td>peaklist_fragments.tsv</td> | |
| 16034 <td>tabular</td> | |
| 16035 <td>42</td> | |
| 16036 </tr><tr class=""> | |
| 16037 <th scope="row">variableMetadata_in</th> | |
| 16038 <td>9a0ce47bd1734ae7</td> | |
| 16039 <td>peaklist_fragments.tsv</td> | |
| 16040 <td>tabular</td> | |
| 16041 <td>42</td> | |
| 16042 </tr> | |
| 16043 </table> | |
| 16044 </div> | |
| 16045 | |
| 16046 | |
| 16047 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 16048 <h2 | |
| 16049 class="history_metadata_extractor_h2" | |
| 16050 style="cursor: pointer" | |
| 16051 title="click to fold/unfold the table" | |
| 16052 > | |
| 16053 [DELETED] - quality_metrics - 2.2.8 | |
| 16054 </h2> | |
| 16055 <p> | |
| 16056 Outputs: | |
| 16057 </p> | |
| 16058 <p class="history_metadata_extractor_status"> | |
| 16059 Status: Failed (1) | |
| 16060 </p> | |
| 16061 <p class="history_metadata_extractor_glitter"></p> | |
| 16062 <table class=" | |
| 16063 table | |
| 16064 table-bordered | |
| 16065 table-dark | |
| 16066 table-striped | |
| 16067 table-hover | |
| 16068 d-block | |
| 16069 overflow-auto | |
| 16070 history_metadata_extractor_table | |
| 16071 "> | |
| 16072 <thead> | |
| 16073 <tr> | |
| 16074 <th scope="col"></th> | |
| 16075 <th scope="col">value</th> | |
| 16076 <th scope="col">name</th> | |
| 16077 <th scope="col">extension</th> | |
| 16078 <th scope="col">hid</th> | |
| 16079 </tr> | |
| 16080 </thead> | |
| 16081 <tr class=""> | |
| 16082 <th scope="row">CV</th> | |
| 16083 <td>FALSE</td> | |
| 16084 <td></td> | |
| 16085 <td></td> | |
| 16086 <td></td> | |
| 16087 </tr><tr class=""> | |
| 16088 <th scope="row">Compa</th> | |
| 16089 <td>TRUE</td> | |
| 16090 <td></td> | |
| 16091 <td></td> | |
| 16092 <td></td> | |
| 16093 </tr><tr class=""> | |
| 16094 <th scope="row">seuil</th> | |
| 16095 <td>1</td> | |
| 16096 <td></td> | |
| 16097 <td></td> | |
| 16098 <td></td> | |
| 16099 </tr><tr class=""> | |
| 16100 <th scope="row">optC</th> | |
| 16101 <td>default</td> | |
| 16102 <td></td> | |
| 16103 <td></td> | |
| 16104 <td></td> | |
| 16105 </tr><tr class=""> | |
| 16106 <th scope="row">poolAsPool1L</th> | |
| 16107 <td>TRUE</td> | |
| 16108 <td></td> | |
| 16109 <td></td> | |
| 16110 <td></td> | |
| 16111 </tr><tr class=""> | |
| 16112 <th scope="row">dataMatrix_in</th> | |
| 16113 <td>9a0ce47bd1734ae7</td> | |
| 16114 <td>peaklist_fragments.tsv</td> | |
| 16115 <td>tabular</td> | |
| 16116 <td>42</td> | |
| 16117 </tr><tr class=""> | |
| 16118 <th scope="row">sampleMetadata_in</th> | |
| 16119 <td>9a0ce47bd1734ae7</td> | |
| 16120 <td>peaklist_fragments.tsv</td> | |
| 16121 <td>tabular</td> | |
| 16122 <td>42</td> | |
| 16123 </tr><tr class=""> | |
| 16124 <th scope="row">variableMetadata_in</th> | |
| 16125 <td>9a0ce47bd1734ae7</td> | |
| 16126 <td>peaklist_fragments.tsv</td> | |
| 16127 <td>tabular</td> | |
| 16128 <td>42</td> | |
| 16129 </tr> | |
| 16130 </table> | |
| 16131 </div> | |
| 16132 | |
| 16133 | |
| 16134 <div class="alert alert-danger history_metadata_extractor_deleted"> | |
| 16135 <h2 | |
| 16136 class="history_metadata_extractor_h2" | |
| 16137 style="cursor: pointer" | |
| 16138 title="click to fold/unfold the table" | |
| 16139 > | |
| 16140 [DELETED] - quality_metrics - 2.2.8 | |
| 16141 </h2> | |
| 16142 <p> | |
| 16143 Outputs: | |
| 16144 </p> | |
| 16145 <p class="history_metadata_extractor_status"> | |
| 16146 Status: Failed (1) | |
| 16147 </p> | |
| 16148 <p class="history_metadata_extractor_glitter"></p> | |
| 16149 <table class=" | |
| 16150 table | |
| 16151 table-bordered | |
| 16152 table-dark | |
| 16153 table-striped | |
| 16154 table-hover | |
| 16155 d-block | |
| 16156 overflow-auto | |
| 16157 history_metadata_extractor_table | |
| 16158 "> | |
| 16159 <thead> | |
| 16160 <tr> | |
| 16161 <th scope="col"></th> | |
| 16162 <th scope="col">value</th> | |
| 16163 <th scope="col">name</th> | |
| 16164 <th scope="col">extension</th> | |
| 16165 <th scope="col">hid</th> | |
| 16166 </tr> | |
| 16167 </thead> | |
| 16168 <tr class=""> | |
| 16169 <th scope="row">CV</th> | |
| 16170 <td>FALSE</td> | |
| 16171 <td></td> | |
| 16172 <td></td> | |
| 16173 <td></td> | |
| 16174 </tr><tr class=""> | |
| 16175 <th scope="row">Compa</th> | |
| 16176 <td>TRUE</td> | |
| 16177 <td></td> | |
| 16178 <td></td> | |
| 16179 <td></td> | |
| 16180 </tr><tr class=""> | |
| 16181 <th scope="row">seuil</th> | |
| 16182 <td>1</td> | |
| 16183 <td></td> | |
| 16184 <td></td> | |
| 16185 <td></td> | |
| 16186 </tr><tr class=""> | |
| 16187 <th scope="row">optC</th> | |
| 16188 <td>default</td> | |
| 16189 <td></td> | |
| 16190 <td></td> | |
| 16191 <td></td> | |
| 16192 </tr><tr class=""> | |
| 16193 <th scope="row">poolAsPool1L</th> | |
| 16194 <td>TRUE</td> | |
| 16195 <td></td> | |
| 16196 <td></td> | |
| 16197 <td></td> | |
| 16198 </tr><tr class=""> | |
| 16199 <th scope="row">dataMatrix_in</th> | |
| 16200 <td>9a0ce47bd1734ae7</td> | |
| 16201 <td>peaklist_fragments.tsv</td> | |
| 16202 <td>tabular</td> | |
| 16203 <td>42</td> | |
| 16204 </tr><tr class=""> | |
| 16205 <th scope="row">sampleMetadata_in</th> | |
| 16206 <td>9a0ce47bd1734ae7</td> | |
| 16207 <td>peaklist_fragments.tsv</td> | |
| 16208 <td>tabular</td> | |
| 16209 <td>42</td> | |
| 16210 </tr><tr class=""> | |
| 16211 <th scope="row">variableMetadata_in</th> | |
| 16212 <td>9a0ce47bd1734ae7</td> | |
| 16213 <td>peaklist_fragments.tsv</td> | |
| 16214 <td>tabular</td> | |
| 16215 <td>42</td> | |
| 16216 </tr> | |
| 16217 </table> | |
| 16218 </div> | |
| 16219 | |
| 16220 <footer class="d-block py-3"> | |
| 16221 <div class="container text-center"> | |
| 16222 <p> | |
| 16223 Made with | |
| 16224 <span id="glitter-generator" title="click for glitter and kawaii >‿<"> | |
| 16225 ❤️ | |
| 16226 </span> | |
| 16227 by Lain (mail: lain pavot inrae fr) - feel free to contact me for improvement requests | |
| 16228 </p> | |
| 16229 </div> | |
| 16230 </footer> | |
| 16231 </div> | |
| 16232 <script> | |
| 16233 | |
| 16234 var content = document.getElementById("history_metadata_extractor_content") ; | |
| 16235 document.getElementById("history_metadata_extractor_top").onclick = () => { | |
| 16236 content.scrollTo(0, 0) ; | |
| 16237 } ; | |
| 16238 document.getElementById("history_metadata_extractor_bottom").onclick = () => { | |
| 16239 content.scrollTo(0, content.scrollHeight) ; | |
| 16240 } ; | |
| 16241 var folded = false ; | |
| 16242 document.getElementById("history_metadata_extractor_folder").onclick = (e) => { | |
| 16243 if (folded) { | |
| 16244 var func = (item) => item.classList.remove("d-none") ; | |
| 16245 } else { | |
| 16246 var func = (item) => item.classList.add("d-none") ; | |
| 16247 } | |
| 16248 Array.prototype.forEach.call(document.getElementsByClassName("history_metadata_extractor_table"), func) ; | |
| 16249 folded = ! folded ; | |
| 16250 } ; | |
| 16251 | |
| 16252 var kawaii = false ; | |
| 16253 document.getElementById("glitter-generator").onclick = (e) => { | |
| 16254 if (kawaii) { | |
| 16255 var func = (item) => item.classList.remove("kawaii") ; | |
| 16256 } else { | |
| 16257 var func = (item) => item.classList.add("kawaii") ; | |
| 16258 } | |
| 16259 Array.prototype.forEach.call(document.querySelectorAll("[class^=history_metadata_extractor_]"), func) ; | |
| 16260 kawaii = ! kawaii ; | |
| 16261 } ; | |
| 16262 | |
| 16263 var show_deleted = true ; | |
| 16264 document.getElementById("history_metadata_extractor_toggle_deleted").onclick = (e) => { | |
| 16265 show_deleted = !show_deleted ; | |
| 16266 if (show_deleted) { | |
| 16267 var func = (item) => item.classList.remove("d-none") ; | |
| 16268 } else { | |
| 16269 var func = (item) => item.classList.add("d-none") ; | |
| 16270 } | |
| 16271 Array.prototype.forEach.call( | |
| 16272 document.getElementsByClassName("history_metadata_extractor_deleted"), | |
| 16273 func | |
| 16274 ) ; | |
| 16275 } ; | |
| 16276 | |
| 16277 Array.prototype.forEach.call(document.getElementsByClassName( | |
| 16278 "history_metadata_extractor_h2"), | |
| 16279 (h2) => { | |
| 16280 var table = h2.nextSibling.nextSibling.nextSibling.nextSibling.nextSibling.nextSibling ; | |
| 16281 h2.onclick = (e) => { | |
| 16282 if (table.classList.contains("d-none")) { | |
| 16283 table.classList.remove("d-none") ; | |
| 16284 } else { | |
| 16285 table.classList.add("d-none") ; | |
| 16286 } | |
| 16287 } | |
| 16288 } | |
| 16289 ) | |
| 16290 | |
| 16291 </script> | |
| 16292 </body> | |
| 16293 </html> |
