Mercurial > repos > metexplore > met4j_createmetanetwork
comparison test-data/Human-GEM_pathways.xml @ 0:2bf2457aab90 draft
planemo upload for repository https://forgemia.inra.fr/metexplore/met4j-galaxy commit e28ca123295d50b85ba872e5a4720fd72697ecc3
| author | metexplore |
|---|---|
| date | Thu, 13 Mar 2025 15:41:28 +0000 |
| parents | |
| children |
comparison
equal
deleted
inserted
replaced
| -1:000000000000 | 0:2bf2457aab90 |
|---|---|
| 1 <?xml version="1.0" encoding="UTF-8"?> | |
| 2 <sbml fbc:required="false" groups:required="false" level="3" version="2" xmlns="http://www.sbml.org/sbml/level3/version2/core" xmlns:fbc="http://www.sbml.org/sbml/level3/version1/fbc/version2" xmlns:groups="http://www.sbml.org/sbml/level3/version1/groups/version1"> | |
| 3 <model fbc:strict="true" id="HumanGEM" metaid="HumanGEM" name="Generic genome-scale metabolic model of Homo sapiens"> | |
| 4 <notes> | |
| 5 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6 <p>Genome-scale metabolic models are valuable tools to study metabolism and provide a scaffold for the integrative analysis of omics data. This is the latest version of Human-GEM, which is a genome-scale metabolic model of a generic human cell. The objective of Human-GEM is to serve as a community model for enabling integrative and mechanistic studies of human metabolism.</p> | |
| 7 </body> | |
| 8 </notes> | |
| 9 <annotation> | |
| 10 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 11 <rdf:Description rdf:about="#HumanGEM"> | |
| 12 <bqbiol:is> | |
| 13 <rdf:Bag> | |
| 14 <rdf:li rdf:resource="https://identifiers.org/taxonomy/9606"/> | |
| 15 </rdf:Bag> | |
| 16 </bqbiol:is> | |
| 17 </rdf:Description> | |
| 18 </rdf:RDF> | |
| 19 </annotation> | |
| 20 <fbc:listOfObjectives fbc:activeObjective="obj"> | |
| 21 <fbc:objective fbc:id="obj" fbc:type="maximize"> | |
| 22 <fbc:listOfFluxObjectives> | |
| 23 <fbc:fluxObjective fbc:coefficient="1" fbc:reaction="R_biomass_human"/> | |
| 24 </fbc:listOfFluxObjectives> | |
| 25 </fbc:objective> | |
| 26 </fbc:listOfObjectives> | |
| 27 <fbc:listOfGeneProducts> | |
| 28 <fbc:geneProduct fbc:id="ENSG00000023697" fbc:label="ENSG00000023697" fbc:name="ENSG00000023697" metaid="_12915ddf-e017-4a38-a80d-e9982f8ac7cc"> | |
| 29 <notes> | |
| 30 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 31 <p>ensembl: ENSG00000023697</p> | |
| 32 <p>hgnc.symbol: DERA</p> | |
| 33 <p>ncbigene: 51071</p> | |
| 34 <p>uniprot: Q9Y315</p> | |
| 35 </body> | |
| 36 </notes> | |
| 37 </fbc:geneProduct> | |
| 38 <fbc:geneProduct fbc:id="ENSG00000130313" fbc:label="ENSG00000130313" fbc:name="ENSG00000130313" metaid="b7f31dab-0da6-4c9e-9c76-6ea1952d4f6b"> | |
| 39 <notes> | |
| 40 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 41 <p>ensembl: ENSG00000130313</p> | |
| 42 <p>hgnc.symbol: PGLS</p> | |
| 43 <p>ncbigene: 25796</p> | |
| 44 <p>uniprot: O95336</p> | |
| 45 </body> | |
| 46 </notes> | |
| 47 </fbc:geneProduct> | |
| 48 <fbc:geneProduct fbc:id="ENSG00000157353" fbc:label="ENSG00000157353" fbc:name="ENSG00000157353" metaid="f2bfd1a8-b479-4718-bb3f-030aed87a562"> | |
| 49 <notes> | |
| 50 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 51 <p>ensembl: ENSG00000157353</p> | |
| 52 <p>hgnc.symbol: FCSK</p> | |
| 53 <p>ncbigene: 197258</p> | |
| 54 <p>uniprot: Q8N0W3</p> | |
| 55 </body> | |
| 56 </notes> | |
| 57 </fbc:geneProduct> | |
| 58 <fbc:geneProduct fbc:id="ENSG00000114268" fbc:label="ENSG00000114268" fbc:name="ENSG00000114268" metaid="d1ad0711-77a6-4e33-85ba-dff0e0e56b5c"> | |
| 59 <notes> | |
| 60 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 61 <p>ensembl: ENSG00000114268</p> | |
| 62 <p>hgnc.symbol: PFKFB4</p> | |
| 63 <p>ncbigene: 5210</p> | |
| 64 <p>uniprot: Q16877</p> | |
| 65 </body> | |
| 66 </notes> | |
| 67 </fbc:geneProduct> | |
| 68 <fbc:geneProduct fbc:id="ENSG00000197417" fbc:label="ENSG00000197417" fbc:name="ENSG00000197417" metaid="_36aac772-72a3-44fd-97f3-84213d36d9e2"> | |
| 69 <notes> | |
| 70 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 71 <p>ensembl: ENSG00000197417</p> | |
| 72 <p>hgnc.symbol: SHPK</p> | |
| 73 <p>ncbigene: 23729</p> | |
| 74 <p>uniprot: Q9UHJ6</p> | |
| 75 </body> | |
| 76 </notes> | |
| 77 </fbc:geneProduct> | |
| 78 <fbc:geneProduct fbc:id="ENSG00000117411" fbc:label="ENSG00000117411" fbc:name="ENSG00000117411" metaid="_8a05124a-b1a0-492d-83cd-3aac293621f3"> | |
| 79 <notes> | |
| 80 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 81 <p>ensembl: ENSG00000117411</p> | |
| 82 <p>hgnc.symbol: B4GALT2</p> | |
| 83 <p>ncbigene: 8704</p> | |
| 84 <p>uniprot: O60909</p> | |
| 85 </body> | |
| 86 </notes> | |
| 87 </fbc:geneProduct> | |
| 88 <fbc:geneProduct fbc:id="ENSG00000170525" fbc:label="ENSG00000170525" fbc:name="ENSG00000170525" metaid="_37605db9-6c99-4033-a556-016ad0da13f8"> | |
| 89 <notes> | |
| 90 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 91 <p>ensembl: ENSG00000170525</p> | |
| 92 <p>hgnc.symbol: PFKFB3</p> | |
| 93 <p>ncbigene: 5209</p> | |
| 94 <p>uniprot: Q16875</p> | |
| 95 </body> | |
| 96 </notes> | |
| 97 </fbc:geneProduct> | |
| 98 <fbc:geneProduct fbc:id="ENSG00000229937" fbc:label="ENSG00000229937" fbc:name="ENSG00000229937" metaid="_58f34e8c-42a2-4a2a-8de9-714e67c5b732"> | |
| 99 <notes> | |
| 100 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 101 <p>ensembl: ENSG00000229937</p> | |
| 102 <p>hgnc.symbol: PRPS1L1</p> | |
| 103 <p>ncbigene: 221823</p> | |
| 104 </body> | |
| 105 </notes> | |
| 106 </fbc:geneProduct> | |
| 107 <fbc:geneProduct fbc:id="ENSG00000085662" fbc:label="ENSG00000085662" fbc:name="ENSG00000085662" metaid="fb8056b5-fb1e-42ed-b1e3-0f3530b674e2"> | |
| 108 <notes> | |
| 109 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 110 <p>ensembl: ENSG00000085662</p> | |
| 111 <p>hgnc.symbol: AKR1B1</p> | |
| 112 <p>ncbigene: 231</p> | |
| 113 <p>uniprot: P15121</p> | |
| 114 </body> | |
| 115 </notes> | |
| 116 </fbc:geneProduct> | |
| 117 <fbc:geneProduct fbc:id="ENSG00000101911" fbc:label="ENSG00000101911" fbc:name="ENSG00000101911" metaid="b98d9eef-49ad-45d4-8889-02e296604457"> | |
| 118 <notes> | |
| 119 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 120 <p>ensembl: ENSG00000101911</p> | |
| 121 <p>hgnc.symbol: PRPS2</p> | |
| 122 <p>ncbigene: 5634</p> | |
| 123 <p>uniprot: P11908</p> | |
| 124 </body> | |
| 125 </notes> | |
| 126 </fbc:geneProduct> | |
| 127 <fbc:geneProduct fbc:id="ENSG00000138030" fbc:label="ENSG00000138030" fbc:name="ENSG00000138030" metaid="a0549ed3-97c1-4eb0-9891-467f734cfd29"> | |
| 128 <notes> | |
| 129 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 130 <p>ensembl: ENSG00000138030</p> | |
| 131 <p>hgnc.symbol: KHK</p> | |
| 132 <p>ncbigene: 3795</p> | |
| 133 <p>uniprot: P50053</p> | |
| 134 </body> | |
| 135 </notes> | |
| 136 </fbc:geneProduct> | |
| 137 <fbc:geneProduct fbc:id="ENSG00000167363" fbc:label="ENSG00000167363" fbc:name="ENSG00000167363" metaid="_940a3aa4-9800-407e-a89c-3c2940a0c773"> | |
| 138 <notes> | |
| 139 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 140 <p>ensembl: ENSG00000167363</p> | |
| 141 <p>hgnc.symbol: FN3K</p> | |
| 142 <p>ncbigene: 64122</p> | |
| 143 <p>uniprot: Q9H479</p> | |
| 144 </body> | |
| 145 </notes> | |
| 146 </fbc:geneProduct> | |
| 147 <fbc:geneProduct fbc:id="ENSG00000160211" fbc:label="ENSG00000160211" fbc:name="ENSG00000160211" metaid="d7d059c0-a147-4808-a248-4b83244f07eb"> | |
| 148 <notes> | |
| 149 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 150 <p>ensembl: ENSG00000160211</p> | |
| 151 <p>hgnc.symbol: G6PD</p> | |
| 152 <p>ncbigene: 2539</p> | |
| 153 <p>uniprot: P11413</p> | |
| 154 </body> | |
| 155 </notes> | |
| 156 </fbc:geneProduct> | |
| 157 <fbc:geneProduct fbc:id="ENSG00000090402" fbc:label="ENSG00000090402" fbc:name="ENSG00000090402" metaid="_3ac56916-54f0-4fcd-8dc5-767cbd61ff9b"> | |
| 158 <notes> | |
| 159 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 160 <p>ensembl: ENSG00000090402</p> | |
| 161 <p>hgnc.symbol: SI</p> | |
| 162 <p>ncbigene: 6476</p> | |
| 163 <p>uniprot: P14410</p> | |
| 164 </body> | |
| 165 </notes> | |
| 166 </fbc:geneProduct> | |
| 167 <fbc:geneProduct fbc:id="ENSG00000163521" fbc:label="ENSG00000163521" fbc:name="ENSG00000163521" metaid="cb001f39-7403-47ab-a7f6-94ccbf288b16"> | |
| 168 <notes> | |
| 169 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 170 <p>ensembl: ENSG00000163521</p> | |
| 171 <p>hgnc.symbol: GLB1L</p> | |
| 172 <p>ncbigene: 79411</p> | |
| 173 <p>uniprot: Q6UWU2</p> | |
| 174 </body> | |
| 175 </notes> | |
| 176 </fbc:geneProduct> | |
| 177 <fbc:geneProduct fbc:id="ENSG00000235376" fbc:label="ENSG00000235376" fbc:name="ENSG00000235376" metaid="fc35bd7a-90b3-4ede-927f-fd37279642dd"> | |
| 178 <notes> | |
| 179 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 180 <p>ensembl: ENSG00000235376</p> | |
| 181 <p>hgnc.symbol: RPEL1</p> | |
| 182 <p>ncbigene: 729020</p> | |
| 183 <p>uniprot: Q2QD12</p> | |
| 184 </body> | |
| 185 </notes> | |
| 186 </fbc:geneProduct> | |
| 187 <fbc:geneProduct fbc:id="ENSG00000049239" fbc:label="ENSG00000049239" fbc:name="ENSG00000049239" metaid="_32ef79cb-7c0c-4511-b69b-34ab8e054773"> | |
| 188 <notes> | |
| 189 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 190 <p>ensembl: ENSG00000049239</p> | |
| 191 <p>hgnc.symbol: H6PD</p> | |
| 192 <p>ncbigene: 9563</p> | |
| 193 <p>uniprot: O95479</p> | |
| 194 </body> | |
| 195 </notes> | |
| 196 </fbc:geneProduct> | |
| 197 <fbc:geneProduct fbc:id="ENSG00000102393" fbc:label="ENSG00000102393" fbc:name="ENSG00000102393" metaid="_5fc82091-e274-44d1-9963-ee5037073028"> | |
| 198 <notes> | |
| 199 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 200 <p>ensembl: ENSG00000102393</p> | |
| 201 <p>hgnc.symbol: GLA</p> | |
| 202 <p>ncbigene: 2717</p> | |
| 203 <p>uniprot: P06280</p> | |
| 204 </body> | |
| 205 </notes> | |
| 206 </fbc:geneProduct> | |
| 207 <fbc:geneProduct fbc:id="ENSG00000109107" fbc:label="ENSG00000109107" fbc:name="ENSG00000109107" metaid="f8bf3621-aa7c-4b44-851a-391c43c7cbb2"> | |
| 208 <notes> | |
| 209 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 210 <p>ensembl: ENSG00000109107</p> | |
| 211 <p>hgnc.symbol: ALDOC</p> | |
| 212 <p>ncbigene: 230</p> | |
| 213 <p>uniprot: P09972</p> | |
| 214 </body> | |
| 215 </notes> | |
| 216 </fbc:geneProduct> | |
| 217 <fbc:geneProduct fbc:id="ENSG00000285043" fbc:label="ENSG00000285043" fbc:name="ENSG00000285043" metaid="c11eee35-7869-49f9-9544-50a998907f37"> | |
| 218 <notes> | |
| 219 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 220 <p>ensembl: ENSG00000285043</p> | |
| 221 <p>hgnc.symbol: AC093512.2</p> | |
| 222 <p>ncbigene: 112694756</p> | |
| 223 </body> | |
| 224 </notes> | |
| 225 </fbc:geneProduct> | |
| 226 <fbc:geneProduct fbc:id="ENSG00000132746" fbc:label="ENSG00000132746" fbc:name="ENSG00000132746" metaid="_471be81a-0170-4a4f-af8d-346cd6ae65e4"> | |
| 227 <notes> | |
| 228 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 229 <p>ensembl: ENSG00000132746</p> | |
| 230 <p>hgnc.symbol: ALDH3B2</p> | |
| 231 <p>ncbigene: 222</p> | |
| 232 <p>uniprot: P48448</p> | |
| 233 </body> | |
| 234 </notes> | |
| 235 </fbc:geneProduct> | |
| 236 <fbc:geneProduct fbc:id="ENSG00000141959" fbc:label="ENSG00000141959" fbc:name="ENSG00000141959" metaid="_9b6348d8-9868-49a9-8ea5-b19d1936b26e"> | |
| 237 <notes> | |
| 238 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 239 <p>ensembl: ENSG00000141959</p> | |
| 240 <p>hgnc.symbol: PFKL</p> | |
| 241 <p>ncbigene: 5211</p> | |
| 242 <p>uniprot: P17858</p> | |
| 243 </body> | |
| 244 </notes> | |
| 245 </fbc:geneProduct> | |
| 246 <fbc:geneProduct fbc:id="ENSG00000108813" fbc:label="ENSG00000108813" fbc:name="ENSG00000108813" metaid="_7a5c0fbb-1847-4113-bb3b-28088fca4338"> | |
| 247 <notes> | |
| 248 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 249 <p>ensembl: ENSG00000108813</p> | |
| 250 <p>hgnc.symbol: DLX4</p> | |
| 251 <p>ncbigene: 1748</p> | |
| 252 <p>uniprot: Q92988</p> | |
| 253 </body> | |
| 254 </notes> | |
| 255 </fbc:geneProduct> | |
| 256 <fbc:geneProduct fbc:id="ENSG00000144591" fbc:label="ENSG00000144591" fbc:name="ENSG00000144591" metaid="_51230f4a-d1e5-4390-9313-7228d09b99fe"> | |
| 257 <notes> | |
| 258 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 259 <p>ensembl: ENSG00000144591</p> | |
| 260 <p>hgnc.symbol: GMPPA</p> | |
| 261 <p>ncbigene: 29926</p> | |
| 262 <p>uniprot: Q96IJ6</p> | |
| 263 </body> | |
| 264 </notes> | |
| 265 </fbc:geneProduct> | |
| 266 <fbc:geneProduct fbc:id="ENSG00000213930" fbc:label="ENSG00000213930" fbc:name="ENSG00000213930" metaid="_74d4cb52-23dc-49d0-adc2-7526f07863ab"> | |
| 267 <notes> | |
| 268 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 269 <p>ensembl: ENSG00000213930</p> | |
| 270 <p>hgnc.symbol: GALT</p> | |
| 271 <p>ncbigene: 2592</p> | |
| 272 <p>uniprot: P07902</p> | |
| 273 </body> | |
| 274 </notes> | |
| 275 </fbc:geneProduct> | |
| 276 <fbc:geneProduct fbc:id="ENSG00000170266" fbc:label="ENSG00000170266" fbc:name="ENSG00000170266" metaid="e1de023f-00b6-4b3e-9be0-e9ae93a2c334"> | |
| 277 <notes> | |
| 278 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 279 <p>ensembl: ENSG00000170266</p> | |
| 280 <p>hgnc.symbol: GLB1</p> | |
| 281 <p>ncbigene: 2720</p> | |
| 282 <p>uniprot: P16278</p> | |
| 283 </body> | |
| 284 </notes> | |
| 285 </fbc:geneProduct> | |
| 286 <fbc:geneProduct fbc:id="ENSG00000241343" fbc:label="ENSG00000241343" fbc:name="ENSG00000241343" metaid="_25cf8431-007a-45f6-b496-f624fde5f63b"> | |
| 287 <notes> | |
| 288 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 289 <p>ensembl: ENSG00000241343</p> | |
| 290 <p>hgnc.symbol: RPL36A</p> | |
| 291 <p>ncbigene: 6173</p> | |
| 292 <p>uniprot: P83881</p> | |
| 293 </body> | |
| 294 </notes> | |
| 295 </fbc:geneProduct> | |
| 296 <fbc:geneProduct fbc:id="ENSG00000151005" fbc:label="ENSG00000151005" fbc:name="ENSG00000151005" metaid="_46587b13-0f5e-4416-b277-0a03f5b571eb"> | |
| 297 <notes> | |
| 298 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 299 <p>ensembl: ENSG00000151005</p> | |
| 300 <p>hgnc.symbol: TKTL2</p> | |
| 301 <p>ncbigene: 84076</p> | |
| 302 <p>uniprot: Q9H0I9</p> | |
| 303 </body> | |
| 304 </notes> | |
| 305 </fbc:geneProduct> | |
| 306 <fbc:geneProduct fbc:id="ENSG00000123836" fbc:label="ENSG00000123836" fbc:name="ENSG00000123836" metaid="d5c747e3-5a3b-4577-ac04-56469d75e91c"> | |
| 307 <notes> | |
| 308 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 309 <p>ensembl: ENSG00000123836</p> | |
| 310 <p>hgnc.symbol: PFKFB2</p> | |
| 311 <p>ncbigene: 5208</p> | |
| 312 <p>uniprot: O60825</p> | |
| 313 </body> | |
| 314 </notes> | |
| 315 </fbc:geneProduct> | |
| 316 <fbc:geneProduct fbc:id="ENSG00000116199" fbc:label="ENSG00000116199" fbc:name="ENSG00000116199" metaid="_76a43217-c502-4f65-9a11-d073910cfd5c"> | |
| 317 <notes> | |
| 318 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 319 <p>ensembl: ENSG00000116199</p> | |
| 320 <p>hgnc.symbol: FAM20B</p> | |
| 321 <p>ncbigene: 9917</p> | |
| 322 <p>uniprot: O75063</p> | |
| 323 </body> | |
| 324 </notes> | |
| 325 </fbc:geneProduct> | |
| 326 <fbc:geneProduct fbc:id="ENSG00000164068" fbc:label="ENSG00000164068" fbc:name="ENSG00000164068" metaid="e4d5b9d5-59c0-4c44-9088-ad7a6080049f"> | |
| 327 <notes> | |
| 328 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 329 <p>ensembl: ENSG00000164068</p> | |
| 330 <p>hgnc.symbol: RNF123</p> | |
| 331 <p>ncbigene: 63891</p> | |
| 332 <p>uniprot: Q5XPI4</p> | |
| 333 </body> | |
| 334 </notes> | |
| 335 </fbc:geneProduct> | |
| 336 <fbc:geneProduct fbc:id="ENSG00000100417" fbc:label="ENSG00000100417" fbc:name="ENSG00000100417" metaid="_26c82f2c-e9c8-4d20-9e49-8640aff44e96"> | |
| 337 <notes> | |
| 338 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 339 <p>ensembl: ENSG00000100417</p> | |
| 340 <p>hgnc.symbol: PMM1</p> | |
| 341 <p>ncbigene: 5372</p> | |
| 342 <p>uniprot: Q92871</p> | |
| 343 </body> | |
| 344 </notes> | |
| 345 </fbc:geneProduct> | |
| 346 <fbc:geneProduct fbc:id="ENSG00000167531" fbc:label="ENSG00000167531" fbc:name="ENSG00000167531" metaid="_6173500e-92e9-4814-b379-bea6c79b96d6"> | |
| 347 <notes> | |
| 348 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 349 <p>ensembl: ENSG00000167531</p> | |
| 350 <p>hgnc.symbol: LALBA</p> | |
| 351 <p>ncbigene: 3906</p> | |
| 352 <p>uniprot: P00709</p> | |
| 353 </body> | |
| 354 </notes> | |
| 355 </fbc:geneProduct> | |
| 356 <fbc:geneProduct fbc:id="ENSG00000149925" fbc:label="ENSG00000149925" fbc:name="ENSG00000149925" metaid="_844a3d97-d13a-4529-a1be-baa8040739b6"> | |
| 357 <notes> | |
| 358 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 359 <p>ensembl: ENSG00000149925</p> | |
| 360 <p>hgnc.symbol: ALDOA</p> | |
| 361 <p>ncbigene: 226</p> | |
| 362 <p>uniprot: P04075</p> | |
| 363 </body> | |
| 364 </notes> | |
| 365 </fbc:geneProduct> | |
| 366 <fbc:geneProduct fbc:id="ENSG00000141560" fbc:label="ENSG00000141560" fbc:name="ENSG00000141560" metaid="_5a622d9f-6dee-420e-bb39-e7c40ca653b2"> | |
| 367 <notes> | |
| 368 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 369 <p>ensembl: ENSG00000141560</p> | |
| 370 <p>hgnc.symbol: FN3KRP</p> | |
| 371 <p>ncbigene: 79672</p> | |
| 372 <p>uniprot: Q9HA64</p> | |
| 373 </body> | |
| 374 </notes> | |
| 375 </fbc:geneProduct> | |
| 376 <fbc:geneProduct fbc:id="ENSG00000100413" fbc:label="ENSG00000100413" fbc:name="ENSG00000100413" metaid="_85b3bca0-ab21-4d12-b312-d8b2b366af39"> | |
| 377 <notes> | |
| 378 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 379 <p>ensembl: ENSG00000100413</p> | |
| 380 <p>hgnc.symbol: POLR3H</p> | |
| 381 <p>ncbigene: 171568</p> | |
| 382 <p>uniprot: Q9Y535</p> | |
| 383 </body> | |
| 384 </notes> | |
| 385 </fbc:geneProduct> | |
| 386 <fbc:geneProduct fbc:id="ENSG00000007350" fbc:label="ENSG00000007350" fbc:name="ENSG00000007350" metaid="_6601c12a-ae74-4669-9b3e-db90da268d86"> | |
| 387 <notes> | |
| 388 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 389 <p>ensembl: ENSG00000007350</p> | |
| 390 <p>hgnc.symbol: TKTL1</p> | |
| 391 <p>ncbigene: 8277</p> | |
| 392 <p>uniprot: P51854</p> | |
| 393 </body> | |
| 394 </notes> | |
| 395 </fbc:geneProduct> | |
| 396 <fbc:geneProduct fbc:id="ENSG00000184254" fbc:label="ENSG00000184254" fbc:name="ENSG00000184254" metaid="_1bee2946-bc61-47c3-8dbf-7b84f796515d"> | |
| 397 <notes> | |
| 398 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 399 <p>ensembl: ENSG00000184254</p> | |
| 400 <p>hgnc.symbol: ALDH1A3</p> | |
| 401 <p>ncbigene: 220</p> | |
| 402 <p>uniprot: P47895</p> | |
| 403 </body> | |
| 404 </notes> | |
| 405 </fbc:geneProduct> | |
| 406 <fbc:geneProduct fbc:id="ENSG00000163931" fbc:label="ENSG00000163931" fbc:name="ENSG00000163931" metaid="dc4a1857-080d-45fc-987e-2adf5620ea3d"> | |
| 407 <notes> | |
| 408 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 409 <p>ensembl: ENSG00000163931</p> | |
| 410 <p>hgnc.symbol: TKT</p> | |
| 411 <p>ncbigene: 7086</p> | |
| 412 <p>uniprot: P29401</p> | |
| 413 </body> | |
| 414 </notes> | |
| 415 </fbc:geneProduct> | |
| 416 <fbc:geneProduct fbc:id="ENSG00000147224" fbc:label="ENSG00000147224" fbc:name="ENSG00000147224" metaid="c4d0c0db-49df-4667-a605-36cd16b32f8c"> | |
| 417 <notes> | |
| 418 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 419 <p>ensembl: ENSG00000147224</p> | |
| 420 <p>hgnc.symbol: PRPS1</p> | |
| 421 <p>ncbigene: 5631</p> | |
| 422 <p>uniprot: P60891</p> | |
| 423 </body> | |
| 424 </notes> | |
| 425 </fbc:geneProduct> | |
| 426 <fbc:geneProduct fbc:id="ENSG00000142657" fbc:label="ENSG00000142657" fbc:name="ENSG00000142657" metaid="beabaf4f-5581-48ed-b522-8dcd497f96aa"> | |
| 427 <notes> | |
| 428 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 429 <p>ensembl: ENSG00000142657</p> | |
| 430 <p>hgnc.symbol: PGD</p> | |
| 431 <p>ncbigene: 5226</p> | |
| 432 <p>uniprot: P52209</p> | |
| 433 </body> | |
| 434 </notes> | |
| 435 </fbc:geneProduct> | |
| 436 <fbc:geneProduct fbc:id="ENSG00000086062" fbc:label="ENSG00000086062" fbc:name="ENSG00000086062" metaid="_5e8317c7-1bfe-47e1-bebb-535601d5f6aa"> | |
| 437 <notes> | |
| 438 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 439 <p>ensembl: ENSG00000086062</p> | |
| 440 <p>hgnc.symbol: B4GALT1</p> | |
| 441 <p>ncbigene: 2683</p> | |
| 442 <p>uniprot: P15291</p> | |
| 443 </body> | |
| 444 </notes> | |
| 445 </fbc:geneProduct> | |
| 446 <fbc:geneProduct fbc:id="ENSG00000079739" fbc:label="ENSG00000079739" fbc:name="ENSG00000079739" metaid="_224dd45b-ce2d-4b1b-9b2e-b1c2ecbd40c9"> | |
| 447 <notes> | |
| 448 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 449 <p>ensembl: ENSG00000079739</p> | |
| 450 <p>hgnc.symbol: PGM1</p> | |
| 451 <p>ncbigene: 5236</p> | |
| 452 <p>uniprot: P36871</p> | |
| 453 </body> | |
| 454 </notes> | |
| 455 </fbc:geneProduct> | |
| 456 <fbc:geneProduct fbc:id="ENSG00000254685" fbc:label="ENSG00000254685" fbc:name="ENSG00000254685" metaid="e68446d0-1583-4e86-a77d-d8dc3ce4f50c"> | |
| 457 <notes> | |
| 458 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 459 <p>ensembl: ENSG00000254685</p> | |
| 460 <p>hgnc.symbol: FPGT</p> | |
| 461 <p>ncbigene: 8790</p> | |
| 462 <p>uniprot: O14772</p> | |
| 463 </body> | |
| 464 </notes> | |
| 465 </fbc:geneProduct> | |
| 466 <fbc:geneProduct fbc:id="ENSG00000153574" fbc:label="ENSG00000153574" fbc:name="ENSG00000153574" metaid="_3830d3c8-693c-4d4c-bb14-8c9f169e5898"> | |
| 467 <notes> | |
| 468 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 469 <p>ensembl: ENSG00000153574</p> | |
| 470 <p>hgnc.symbol: RPIA</p> | |
| 471 <p>ncbigene: 22934</p> | |
| 472 <p>uniprot: P49247</p> | |
| 473 </body> | |
| 474 </notes> | |
| 475 </fbc:geneProduct> | |
| 476 <fbc:geneProduct fbc:id="ENSG00000108602" fbc:label="ENSG00000108602" fbc:name="ENSG00000108602" metaid="a488fe33-4083-4e23-a23a-76ca737cd093"> | |
| 477 <notes> | |
| 478 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 479 <p>ensembl: ENSG00000108602</p> | |
| 480 <p>hgnc.symbol: ALDH3A1</p> | |
| 481 <p>ncbigene: 218</p> | |
| 482 <p>uniprot: P30838</p> | |
| 483 </body> | |
| 484 </notes> | |
| 485 </fbc:geneProduct> | |
| 486 <fbc:geneProduct fbc:id="ENSG00000214013" fbc:label="ENSG00000214013" fbc:name="ENSG00000214013" metaid="_2117f97e-9b80-42e9-a912-66e60108428e"> | |
| 487 <notes> | |
| 488 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 489 <p>ensembl: ENSG00000214013</p> | |
| 490 <p>hgnc.symbol: GANC</p> | |
| 491 <p>ncbigene: 2595</p> | |
| 492 <p>uniprot: Q8TET4</p> | |
| 493 </body> | |
| 494 </notes> | |
| 495 </fbc:geneProduct> | |
| 496 <fbc:geneProduct fbc:id="ENSG00000104522" fbc:label="ENSG00000104522" fbc:name="ENSG00000104522" metaid="bc4e7c8d-cd54-48a1-b42c-0ebd38d1753c"> | |
| 497 <notes> | |
| 498 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 499 <p>ensembl: ENSG00000104522</p> | |
| 500 <p>hgnc.symbol: TSTA3</p> | |
| 501 <p>ncbigene: 7264</p> | |
| 502 <p>uniprot: Q13630</p> | |
| 503 </body> | |
| 504 </notes> | |
| 505 </fbc:geneProduct> | |
| 506 <fbc:geneProduct fbc:id="ENSG00000067057" fbc:label="ENSG00000067057" fbc:name="ENSG00000067057" metaid="d6009707-416e-44ba-af3c-bf5d42e5b2ae"> | |
| 507 <notes> | |
| 508 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 509 <p>ensembl: ENSG00000067057</p> | |
| 510 <p>hgnc.symbol: PFKP</p> | |
| 511 <p>ncbigene: 5214</p> | |
| 512 <p>uniprot: Q01813</p> | |
| 513 </body> | |
| 514 </notes> | |
| 515 </fbc:geneProduct> | |
| 516 <fbc:geneProduct fbc:id="ENSG00000173540" fbc:label="ENSG00000173540" fbc:name="ENSG00000173540" metaid="_35aa5df1-9cdd-4670-9b8e-1070b94d1a97"> | |
| 517 <notes> | |
| 518 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 519 <p>ensembl: ENSG00000173540</p> | |
| 520 <p>hgnc.symbol: GMPPB</p> | |
| 521 <p>ncbigene: 29925</p> | |
| 522 <p>uniprot: Q9Y5P6</p> | |
| 523 </body> | |
| 524 </notes> | |
| 525 </fbc:geneProduct> | |
| 526 <fbc:geneProduct fbc:id="ENSG00000162408" fbc:label="ENSG00000162408" fbc:name="ENSG00000162408" metaid="_14129ba8-0b75-4879-8b15-1391ec64be48"> | |
| 527 <notes> | |
| 528 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 529 <p>ensembl: ENSG00000162408</p> | |
| 530 <p>hgnc.symbol: NOL9</p> | |
| 531 <p>ncbigene: 79707</p> | |
| 532 <p>uniprot: Q5SY16</p> | |
| 533 </body> | |
| 534 </notes> | |
| 535 </fbc:geneProduct> | |
| 536 <fbc:geneProduct fbc:id="ENSG00000159399" fbc:label="ENSG00000159399" fbc:name="ENSG00000159399" metaid="e69bc97a-c6e6-4251-b0e8-ad2336c2a6c1"> | |
| 537 <notes> | |
| 538 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 539 <p>ensembl: ENSG00000159399</p> | |
| 540 <p>hgnc.symbol: HK2</p> | |
| 541 <p>ncbigene: 3099</p> | |
| 542 <p>uniprot: P52789</p> | |
| 543 </body> | |
| 544 </notes> | |
| 545 </fbc:geneProduct> | |
| 546 <fbc:geneProduct fbc:id="ENSG00000136872" fbc:label="ENSG00000136872" fbc:name="ENSG00000136872" metaid="_8b796b8b-662b-479f-a03d-8f584914568c"> | |
| 547 <notes> | |
| 548 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 549 <p>ensembl: ENSG00000136872</p> | |
| 550 <p>hgnc.symbol: ALDOB</p> | |
| 551 <p>ncbigene: 229</p> | |
| 552 <p>uniprot: P05062</p> | |
| 553 </body> | |
| 554 </notes> | |
| 555 </fbc:geneProduct> | |
| 556 <fbc:geneProduct fbc:id="ENSG00000197713" fbc:label="ENSG00000197713" fbc:name="ENSG00000197713" metaid="b06a020b-806e-49ce-886c-c05931b71761"> | |
| 557 <notes> | |
| 558 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 559 <p>ensembl: ENSG00000197713</p> | |
| 560 <p>hgnc.symbol: RPE</p> | |
| 561 <p>ncbigene: 6120</p> | |
| 562 <p>uniprot: Q96AT9</p> | |
| 563 </body> | |
| 564 </notes> | |
| 565 </fbc:geneProduct> | |
| 566 <fbc:geneProduct fbc:id="ENSG00000115850" fbc:label="ENSG00000115850" fbc:name="ENSG00000115850" metaid="bdf0a3e9-cde6-4941-a89c-f31093c2f23c"> | |
| 567 <notes> | |
| 568 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 569 <p>ensembl: ENSG00000115850</p> | |
| 570 <p>hgnc.symbol: LCT</p> | |
| 571 <p>ncbigene: 3938</p> | |
| 572 <p>uniprot: P09848</p> | |
| 573 </body> | |
| 574 </notes> | |
| 575 </fbc:geneProduct> | |
| 576 <fbc:geneProduct fbc:id="ENSG00000172456" fbc:label="ENSG00000172456" fbc:name="ENSG00000172456" metaid="_43cdde20-f842-41ff-9a7c-f23706c9478f"> | |
| 577 <notes> | |
| 578 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 579 <p>ensembl: ENSG00000172456</p> | |
| 580 <p>hgnc.symbol: FGGY</p> | |
| 581 <p>ncbigene: 55277</p> | |
| 582 <p>uniprot: Q96C11</p> | |
| 583 </body> | |
| 584 </notes> | |
| 585 </fbc:geneProduct> | |
| 586 <fbc:geneProduct fbc:id="ENSG00000006534" fbc:label="ENSG00000006534" fbc:name="ENSG00000006534" metaid="e9d8a15a-9726-409a-aed9-cec6b317c4e6"> | |
| 587 <notes> | |
| 588 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 589 <p>ensembl: ENSG00000006534</p> | |
| 590 <p>hgnc.symbol: ALDH3B1</p> | |
| 591 <p>ncbigene: 221</p> | |
| 592 <p>uniprot: P43353</p> | |
| 593 </body> | |
| 594 </notes> | |
| 595 </fbc:geneProduct> | |
| 596 <fbc:geneProduct fbc:id="ENSG00000116783" fbc:label="ENSG00000116783" fbc:name="ENSG00000116783" metaid="_73d80bcf-dfe5-4ec8-b501-98ebfc6d6067"> | |
| 597 <notes> | |
| 598 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 599 <p>ensembl: ENSG00000116783</p> | |
| 600 <p>hgnc.symbol: TNNI3K</p> | |
| 601 <p>ncbigene: 51086</p> | |
| 602 <p>uniprot: Q59H18</p> | |
| 603 </body> | |
| 604 </notes> | |
| 605 </fbc:geneProduct> | |
| 606 <fbc:geneProduct fbc:id="ENSG00000169764" fbc:label="ENSG00000169764" fbc:name="ENSG00000169764" metaid="_948d2e18-a12b-4208-aaa3-127cb64223c2"> | |
| 607 <notes> | |
| 608 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 609 <p>ensembl: ENSG00000169764</p> | |
| 610 <p>hgnc.symbol: UGP2</p> | |
| 611 <p>ncbigene: 7360</p> | |
| 612 <p>uniprot: Q16851</p> | |
| 613 </body> | |
| 614 </notes> | |
| 615 </fbc:geneProduct> | |
| 616 <fbc:geneProduct fbc:id="ENSG00000140263" fbc:label="ENSG00000140263" fbc:name="ENSG00000140263" metaid="a50ba3ac-966e-434e-9674-e0c5f2e25b79"> | |
| 617 <notes> | |
| 618 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 619 <p>ensembl: ENSG00000140263</p> | |
| 620 <p>hgnc.symbol: SORD</p> | |
| 621 <p>ncbigene: 6652</p> | |
| 622 <p>uniprot: Q00796</p> | |
| 623 </body> | |
| 624 </notes> | |
| 625 </fbc:geneProduct> | |
| 626 <fbc:geneProduct fbc:id="ENSG00000188167" fbc:label="ENSG00000188167" fbc:name="ENSG00000188167" metaid="_2490e5dd-19aa-47d5-a66a-9f660b0085d3"> | |
| 627 <notes> | |
| 628 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 629 <p>ensembl: ENSG00000188167</p> | |
| 630 <p>hgnc.symbol: TMPPE</p> | |
| 631 <p>ncbigene: 643853</p> | |
| 632 <p>uniprot: Q6ZT21</p> | |
| 633 </body> | |
| 634 </notes> | |
| 635 </fbc:geneProduct> | |
| 636 <fbc:geneProduct fbc:id="ENSG00000177156" fbc:label="ENSG00000177156" fbc:name="ENSG00000177156" metaid="a63ba87e-11e6-4a4e-868b-ce7846566b64"> | |
| 637 <notes> | |
| 638 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 639 <p>ensembl: ENSG00000177156</p> | |
| 640 <p>hgnc.symbol: TALDO1</p> | |
| 641 <p>ncbigene: 6888</p> | |
| 642 <p>uniprot: P37837</p> | |
| 643 </body> | |
| 644 </notes> | |
| 645 </fbc:geneProduct> | |
| 646 <fbc:geneProduct fbc:id="ENSG00000198074" fbc:label="ENSG00000198074" fbc:name="ENSG00000198074" metaid="_809d317a-4047-4e3d-b2f4-1386e3129360"> | |
| 647 <notes> | |
| 648 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 649 <p>ensembl: ENSG00000198074</p> | |
| 650 <p>hgnc.symbol: AKR1B10</p> | |
| 651 <p>ncbigene: 57016</p> | |
| 652 <p>uniprot: O60218</p> | |
| 653 </body> | |
| 654 </notes> | |
| 655 </fbc:geneProduct> | |
| 656 <fbc:geneProduct fbc:id="ENSG00000176020" fbc:label="ENSG00000176020" fbc:name="ENSG00000176020" metaid="_513bae08-bdd4-4b97-98ae-07e801676dfe"> | |
| 657 <notes> | |
| 658 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 659 <p>ensembl: ENSG00000176020</p> | |
| 660 <p>hgnc.symbol: AMIGO3</p> | |
| 661 <p>ncbigene: 386724</p> | |
| 662 <p>uniprot: Q86WK7</p> | |
| 663 </body> | |
| 664 </notes> | |
| 665 </fbc:geneProduct> | |
| 666 <fbc:geneProduct fbc:id="ENSG00000156510" fbc:label="ENSG00000156510" fbc:name="ENSG00000156510" metaid="_61c6553c-2336-4290-82a1-7d87591a8fd8"> | |
| 667 <notes> | |
| 668 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 669 <p>ensembl: ENSG00000156510</p> | |
| 670 <p>hgnc.symbol: HKDC1</p> | |
| 671 <p>ncbigene: 80201</p> | |
| 672 <p>uniprot: Q2TB90</p> | |
| 673 </body> | |
| 674 </notes> | |
| 675 </fbc:geneProduct> | |
| 676 <fbc:geneProduct fbc:id="ENSG00000108479" fbc:label="ENSG00000108479" fbc:name="ENSG00000108479" metaid="aacb39b1-6ea5-4359-97fc-d8c44b24d923"> | |
| 677 <notes> | |
| 678 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 679 <p>ensembl: ENSG00000108479</p> | |
| 680 <p>hgnc.symbol: GALK1</p> | |
| 681 <p>ncbigene: 2584</p> | |
| 682 <p>uniprot: P51570</p> | |
| 683 </body> | |
| 684 </notes> | |
| 685 </fbc:geneProduct> | |
| 686 <fbc:geneProduct fbc:id="ENSG00000171174" fbc:label="ENSG00000171174" fbc:name="ENSG00000171174" metaid="d405b7b0-3b31-4a66-97af-a85fa4a32ce6"> | |
| 687 <notes> | |
| 688 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 689 <p>ensembl: ENSG00000171174</p> | |
| 690 <p>hgnc.symbol: RBKS</p> | |
| 691 <p>ncbigene: 64080</p> | |
| 692 <p>uniprot: Q9H477</p> | |
| 693 </body> | |
| 694 </notes> | |
| 695 </fbc:geneProduct> | |
| 696 <fbc:geneProduct fbc:id="ENSG00000259030" fbc:label="ENSG00000259030" fbc:name="ENSG00000259030" metaid="df89c41c-5769-4933-a26d-75489f2009cb"> | |
| 697 <notes> | |
| 698 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 699 <p>ensembl: ENSG00000259030</p> | |
| 700 <p>hgnc.symbol: FPGT-TNNI3K</p> | |
| 701 <p>ncbigene: 100526835</p> | |
| 702 </body> | |
| 703 </notes> | |
| 704 </fbc:geneProduct> | |
| 705 <fbc:geneProduct fbc:id="ENSG00000078237" fbc:label="ENSG00000078237" fbc:name="ENSG00000078237" metaid="a9faff55-64a8-4038-b4b9-e85a053970f0"> | |
| 706 <notes> | |
| 707 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 708 <p>ensembl: ENSG00000078237</p> | |
| 709 <p>hgnc.symbol: TIGAR</p> | |
| 710 <p>ncbigene: 57103</p> | |
| 711 <p>uniprot: Q9NQ88</p> | |
| 712 </body> | |
| 713 </notes> | |
| 714 </fbc:geneProduct> | |
| 715 <fbc:geneProduct fbc:id="ENSG00000171298" fbc:label="ENSG00000171298" fbc:name="ENSG00000171298" metaid="_510705a7-d23b-480a-bb95-8b9bcdcd3c9b"> | |
| 716 <notes> | |
| 717 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 718 <p>ensembl: ENSG00000171298</p> | |
| 719 <p>hgnc.symbol: GAA</p> | |
| 720 <p>ncbigene: 2548</p> | |
| 721 <p>uniprot: P10253</p> | |
| 722 </body> | |
| 723 </notes> | |
| 724 </fbc:geneProduct> | |
| 725 <fbc:geneProduct fbc:id="ENSG00000117308" fbc:label="ENSG00000117308" fbc:name="ENSG00000117308" metaid="ecfe5f24-1fb3-4f45-8964-128b17595266"> | |
| 726 <notes> | |
| 727 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 728 <p>ensembl: ENSG00000117308</p> | |
| 729 <p>hgnc.symbol: GALE</p> | |
| 730 <p>ncbigene: 2582</p> | |
| 731 <p>uniprot: Q14376</p> | |
| 732 </body> | |
| 733 </notes> | |
| 734 </fbc:geneProduct> | |
| 735 <fbc:geneProduct fbc:id="ENSG00000156958" fbc:label="ENSG00000156958" fbc:name="ENSG00000156958" metaid="_0ffa4e53-a04d-43a9-86a7-7017ab4b8bb0"> | |
| 736 <notes> | |
| 737 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 738 <p>ensembl: ENSG00000156958</p> | |
| 739 <p>hgnc.symbol: GALK2</p> | |
| 740 <p>ncbigene: 2585</p> | |
| 741 <p>uniprot: Q01415</p> | |
| 742 </body> | |
| 743 </notes> | |
| 744 </fbc:geneProduct> | |
| 745 <fbc:geneProduct fbc:id="ENSG00000112699" fbc:label="ENSG00000112699" fbc:name="ENSG00000112699" metaid="_0d9ddbad-2dcb-402f-9849-c6ae59283884"> | |
| 746 <notes> | |
| 747 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 748 <p>ensembl: ENSG00000112699</p> | |
| 749 <p>hgnc.symbol: GMDS</p> | |
| 750 <p>ncbigene: 2762</p> | |
| 751 <p>uniprot: O60547</p> | |
| 752 </body> | |
| 753 </notes> | |
| 754 </fbc:geneProduct> | |
| 755 <fbc:geneProduct fbc:id="ENSG00000156515" fbc:label="ENSG00000156515" fbc:name="ENSG00000156515" metaid="_1b7eb559-32a1-41f1-89ee-9ea63fc8ebb1"> | |
| 756 <notes> | |
| 757 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 758 <p>ensembl: ENSG00000156515</p> | |
| 759 <p>hgnc.symbol: HK1</p> | |
| 760 <p>ncbigene: 3098</p> | |
| 761 <p>uniprot: P19367</p> | |
| 762 </body> | |
| 763 </notes> | |
| 764 </fbc:geneProduct> | |
| 765 <fbc:geneProduct fbc:id="ENSG00000130066" fbc:label="ENSG00000130066" fbc:name="ENSG00000130066" metaid="_21cc9685-34dc-4f6f-b332-e409179228f9"> | |
| 766 <notes> | |
| 767 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 768 <p>ensembl: ENSG00000130066</p> | |
| 769 <p>hgnc.symbol: SAT1</p> | |
| 770 <p>ncbigene: 6303</p> | |
| 771 <p>uniprot: P21673</p> | |
| 772 </body> | |
| 773 </notes> | |
| 774 </fbc:geneProduct> | |
| 775 <fbc:geneProduct fbc:id="ENSG00000152556" fbc:label="ENSG00000152556" fbc:name="ENSG00000152556" metaid="_9978139a-2d36-41b2-8a16-ae119ad9c62a"> | |
| 776 <notes> | |
| 777 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 778 <p>ensembl: ENSG00000152556</p> | |
| 779 <p>hgnc.symbol: PFKM</p> | |
| 780 <p>ncbigene: 5213</p> | |
| 781 <p>uniprot: P08237</p> | |
| 782 </body> | |
| 783 </notes> | |
| 784 </fbc:geneProduct> | |
| 785 <fbc:geneProduct fbc:id="ENSG00000178802" fbc:label="ENSG00000178802" fbc:name="ENSG00000178802" metaid="_4cd75726-c25f-4f11-b645-1f763ef8eb84"> | |
| 786 <notes> | |
| 787 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 788 <p>ensembl: ENSG00000178802</p> | |
| 789 <p>hgnc.symbol: MPI</p> | |
| 790 <p>ncbigene: 4351</p> | |
| 791 <p>uniprot: P34949</p> | |
| 792 </body> | |
| 793 </notes> | |
| 794 </fbc:geneProduct> | |
| 795 <fbc:geneProduct fbc:id="ENSG00000158019" fbc:label="ENSG00000158019" fbc:name="ENSG00000158019" metaid="_538c0091-8464-47eb-91e1-646a853db46d"> | |
| 796 <notes> | |
| 797 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 798 <p>ensembl: ENSG00000158019</p> | |
| 799 <p>hgnc.symbol: BABAM2</p> | |
| 800 <p>ncbigene: 9577</p> | |
| 801 <p>uniprot: Q9NXR7</p> | |
| 802 </body> | |
| 803 </notes> | |
| 804 </fbc:geneProduct> | |
| 805 <fbc:geneProduct fbc:id="ENSG00000140650" fbc:label="ENSG00000140650" fbc:name="ENSG00000140650" metaid="_1fe1abbd-efb3-45fd-aac2-755de9d9f7c8"> | |
| 806 <notes> | |
| 807 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 808 <p>ensembl: ENSG00000140650</p> | |
| 809 <p>hgnc.symbol: PMM2</p> | |
| 810 <p>ncbigene: 5373</p> | |
| 811 <p>uniprot: O15305</p> | |
| 812 </body> | |
| 813 </notes> | |
| 814 </fbc:geneProduct> | |
| 815 <fbc:geneProduct fbc:id="ENSG00000166262" fbc:label="ENSG00000166262" fbc:name="ENSG00000166262" metaid="cfd467d1-528c-484b-8fda-084b7869c1f4"> | |
| 816 <notes> | |
| 817 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 818 <p>ensembl: ENSG00000166262</p> | |
| 819 <p>hgnc.symbol: FAM227B</p> | |
| 820 <p>ncbigene: 196951</p> | |
| 821 <p>uniprot: Q96M60</p> | |
| 822 </body> | |
| 823 </notes> | |
| 824 </fbc:geneProduct> | |
| 825 <fbc:geneProduct fbc:id="ENSG00000169299" fbc:label="ENSG00000169299" fbc:name="ENSG00000169299" metaid="_629f4e87-2b63-44ab-beb3-af1d667022ad"> | |
| 826 <notes> | |
| 827 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 828 <p>ensembl: ENSG00000169299</p> | |
| 829 <p>hgnc.symbol: PGM2</p> | |
| 830 <p>ncbigene: 55276</p> | |
| 831 <p>uniprot: Q96G03</p> | |
| 832 </body> | |
| 833 </notes> | |
| 834 </fbc:geneProduct> | |
| 835 <fbc:geneProduct fbc:id="ENSG00000158571" fbc:label="ENSG00000158571" fbc:name="ENSG00000158571" metaid="_4c698159-e0c6-4eed-b154-53776218f614"> | |
| 836 <notes> | |
| 837 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 838 <p>ensembl: ENSG00000158571</p> | |
| 839 <p>hgnc.symbol: PFKFB1</p> | |
| 840 <p>ncbigene: 5207</p> | |
| 841 <p>uniprot: P16118</p> | |
| 842 </body> | |
| 843 </notes> | |
| 844 </fbc:geneProduct> | |
| 845 <fbc:geneProduct fbc:id="ENSG00000160883" fbc:label="ENSG00000160883" fbc:name="ENSG00000160883" metaid="a2ac8838-366b-48b0-80e3-3274be26154e"> | |
| 846 <notes> | |
| 847 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 848 <p>ensembl: ENSG00000160883</p> | |
| 849 <p>hgnc.symbol: HK3</p> | |
| 850 <p>ncbigene: 3101</p> | |
| 851 <p>uniprot: P52790</p> | |
| 852 </body> | |
| 853 </notes> | |
| 854 </fbc:geneProduct> | |
| 855 <fbc:geneProduct fbc:id="ENSG00000141504" fbc:label="ENSG00000141504" fbc:name="ENSG00000141504" metaid="_54737a26-c3ba-47f6-9e01-83c9eba83079"> | |
| 856 <notes> | |
| 857 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 858 <p>ensembl: ENSG00000141504</p> | |
| 859 <p>hgnc.symbol: SAT2</p> | |
| 860 <p>ncbigene: 112483</p> | |
| 861 <p>uniprot: Q96F10</p> | |
| 862 </body> | |
| 863 </notes> | |
| 864 </fbc:geneProduct> | |
| 865 <fbc:geneProduct fbc:id="ENSG00000257335" fbc:label="ENSG00000257335" fbc:name="ENSG00000257335" metaid="_2f618266-9c9a-4c56-a73a-97dc9c6829b2"> | |
| 866 <notes> | |
| 867 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 868 <p>ensembl: ENSG00000257335</p> | |
| 869 <p>hgnc.symbol: MGAM</p> | |
| 870 <p>ncbigene: 8972</p> | |
| 871 <p>uniprot: O43451</p> | |
| 872 </body> | |
| 873 </notes> | |
| 874 </fbc:geneProduct> | |
| 875 <fbc:geneProduct fbc:id="ENSG00000180953" fbc:label="ENSG00000180953" fbc:name="ENSG00000180953" metaid="_125ff8ee-12ec-4eef-8955-07983faac86b"> | |
| 876 <notes> | |
| 877 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 878 <p>ensembl: ENSG00000180953</p> | |
| 879 <p>hgnc.symbol: ST20</p> | |
| 880 <p>uniprot: Q9HBF5</p> | |
| 881 </body> | |
| 882 </notes> | |
| 883 </fbc:geneProduct> | |
| 884 </fbc:listOfGeneProducts> | |
| 885 <groups:listOfGroups> | |
| 886 <groups:group groups:id="group102" groups:kind="classification" groups:name="Pentose phosphate pathway"> | |
| 887 <groups:listOfMembers> | |
| 888 <groups:member groups:idRef="R_HMR_4710"/> | |
| 889 <groups:member groups:idRef="R_RPEc"/> | |
| 890 <groups:member groups:idRef="R_PGLc"/> | |
| 891 <groups:member groups:idRef="R_GLYPHEHYc"/> | |
| 892 <groups:member groups:idRef="R_GNDc"/> | |
| 893 <groups:member groups:idRef="R_ABTD1"/> | |
| 894 <groups:member groups:idRef="R_HMR_4565"/> | |
| 895 <groups:member groups:idRef="R_HMR_9799"/> | |
| 896 <groups:member groups:idRef="R_HMR_4841"/> | |
| 897 <groups:member groups:idRef="R_HMR_4501"/> | |
| 898 <groups:member groups:idRef="R_HMR_4567"/> | |
| 899 <groups:member groups:idRef="R_HMR_4304"/> | |
| 900 <groups:member groups:idRef="R_HMR_4568"/> | |
| 901 <groups:member groups:idRef="R_HMR_4623"/> | |
| 902 <groups:member groups:idRef="R_HMR_4404"/> | |
| 903 <groups:member groups:idRef="R_HMR_4306"/> | |
| 904 <groups:member groups:idRef="R_HMR_4625"/> | |
| 905 <groups:member groups:idRef="R_G6PDH2c"/> | |
| 906 <groups:member groups:idRef="R_HMR_8074"/> | |
| 907 <groups:member groups:idRef="R_HMR_4052"/> | |
| 908 <groups:member groups:idRef="R_HMR_4350"/> | |
| 909 <groups:member groups:idRef="R_HMR_8653"/> | |
| 910 <groups:member groups:idRef="R_HMR_4351"/> | |
| 911 <groups:member groups:idRef="R_HMR_4352"/> | |
| 912 <groups:member groups:idRef="R_HMR_4473"/> | |
| 913 <groups:member groups:idRef="R_HMR_4474"/> | |
| 914 <groups:member groups:idRef="R_HMR_9800"/> | |
| 915 <groups:member groups:idRef="R_HMR_4354"/> | |
| 916 <groups:member groups:idRef="R_HMR_4398"/> | |
| 917 <groups:member groups:idRef="R_HMR_4476"/> | |
| 918 <groups:member groups:idRef="R_HMR_4477"/> | |
| 919 </groups:listOfMembers> | |
| 920 </groups:group> | |
| 921 <groups:group groups:id="group66" groups:kind="classification" groups:name="Galactose metabolism"> | |
| 922 <groups:listOfMembers> | |
| 923 <groups:member groups:idRef="R_HMR_4775"/> | |
| 924 <groups:member groups:idRef="R_HMR_4303"/> | |
| 925 <groups:member groups:idRef="R_HMR_4831"/> | |
| 926 <groups:member groups:idRef="R_HMR_4128"/> | |
| 927 <groups:member groups:idRef="R_HMR_4414"/> | |
| 928 <groups:member groups:idRef="R_HMR_4832"/> | |
| 929 <groups:member groups:idRef="R_HMR_4415"/> | |
| 930 <groups:member groups:idRef="R_HMR_4416"/> | |
| 931 <groups:member groups:idRef="R_HMR_3944"/> | |
| 932 <groups:member groups:idRef="R_FBA5"/> | |
| 933 <groups:member groups:idRef="R_HMR_8762"/> | |
| 934 <groups:member groups:idRef="R_HMR_4130"/> | |
| 935 <groups:member groups:idRef="R_KHK3"/> | |
| 936 <groups:member groups:idRef="R_HMR_4131"/> | |
| 937 <groups:member groups:idRef="R_HMR_7674"/> | |
| 938 <groups:member groups:idRef="R_HMR_4132"/> | |
| 939 <groups:member groups:idRef="R_HMR_8761"/> | |
| 940 <groups:member groups:idRef="R_HMR_8766"/> | |
| 941 <groups:member groups:idRef="R_HMR_8767"/> | |
| 942 <groups:member groups:idRef="R_HMR_8764"/> | |
| 943 <groups:member groups:idRef="R_HMR_4774"/> | |
| 944 </groups:listOfMembers> | |
| 945 </groups:group> | |
| 946 <groups:group groups:id="group65" groups:kind="classification" groups:name="Fructose and mannose metabolism"> | |
| 947 <groups:listOfMembers> | |
| 948 <groups:member groups:idRef="R_HMR_4401"/> | |
| 949 <groups:member groups:idRef="R_RE1342C"/> | |
| 950 <groups:member groups:idRef="R_HMR_4402"/> | |
| 951 <groups:member groups:idRef="R_HMR_4315"/> | |
| 952 <groups:member groups:idRef="R_HMR_4403"/> | |
| 953 <groups:member groups:idRef="R_HMR_8768"/> | |
| 954 <groups:member groups:idRef="R_HMR_4316"/> | |
| 955 <groups:member groups:idRef="R_HMR_4317"/> | |
| 956 <groups:member groups:idRef="R_HMR_4318"/> | |
| 957 <groups:member groups:idRef="R_HMR_4319"/> | |
| 958 <groups:member groups:idRef="R_HMR_4706"/> | |
| 959 <groups:member groups:idRef="R_HMR_4490"/> | |
| 960 <groups:member groups:idRef="R_HMR_4383"/> | |
| 961 <groups:member groups:idRef="R_HMR_4297"/> | |
| 962 <groups:member groups:idRef="R_HMR_4385"/> | |
| 963 <groups:member groups:idRef="R_HMR_0454"/> | |
| 964 <groups:member groups:idRef="R_HMR_4320"/> | |
| 965 <groups:member groups:idRef="R_HMR_4386"/> | |
| 966 <groups:member groups:idRef="R_HMR_4310"/> | |
| 967 <groups:member groups:idRef="R_HMR_4387"/> | |
| 968 <groups:member groups:idRef="R_HMR_4399"/> | |
| 969 <groups:member groups:idRef="R_HMR_4356"/> | |
| 970 <groups:member groups:idRef="R_HMR_4400"/> | |
| 971 </groups:listOfMembers> | |
| 972 </groups:group> | |
| 973 </groups:listOfGroups> | |
| 974 <listOfUnitDefinitions> | |
| 975 <unitDefinition id="mmol_per_gDW_per_hr" name="mmol_per_gDW_per_hr"> | |
| 976 <listOfUnits> | |
| 977 <unit exponent="-1" kind="gram" multiplier="1" scale="0"/> | |
| 978 <unit exponent="1" kind="mole" multiplier="1" scale="-3"/> | |
| 979 <unit exponent="-1" kind="second" multiplier="3600" scale="0"/> | |
| 980 </listOfUnits> | |
| 981 </unitDefinition> | |
| 982 </listOfUnitDefinitions> | |
| 983 <listOfCompartments> | |
| 984 <compartment constant="true" id="r" metaid="_884904cc-79eb-427d-b91b-3858ebf3f596" name="Endoplasmic reticulum" sboTerm="SBO:0000290" spatialDimensions="3"/> | |
| 985 <compartment constant="true" id="s" metaid="c2091cbb-7712-4d49-8306-2c20463fde5c" name="Extracellular" sboTerm="SBO:0000290" spatialDimensions="3"/> | |
| 986 <compartment constant="true" id="c" metaid="_9e846238-9a89-4c76-93c0-2ad9f62b3f5f" name="Cytosol" sboTerm="SBO:0000290" spatialDimensions="3"/> | |
| 987 <compartment constant="true" id="l" metaid="_1eae95e5-962a-462b-b3af-730aa2c62bf8" name="Lysosome" sboTerm="SBO:0000290" spatialDimensions="3"/> | |
| 988 <compartment constant="true" id="g" metaid="a36d7b30-c3c7-46e7-91bc-11d957f9efde" name="Golgi apparatus" sboTerm="SBO:0000290" spatialDimensions="3"/> | |
| 989 </listOfCompartments> | |
| 990 <listOfSpecies> | |
| 991 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C21H27N7O14P2" hasOnlySubstanceUnits="true" id="M_m02553c" initialConcentration="0" metaid="cdf46bb5-653c-4e4c-bf33-28c9d8abecaa" name="NADH" sboTerm="SBO:0000247"> | |
| 992 <notes> | |
| 993 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 994 <p>kegg.compound: C00004</p> | |
| 995 <p>hmdb: HMDB01487</p> | |
| 996 <p>bigg.metabolite: nadh</p> | |
| 997 <p>chebi: CHEBI:16908</p> | |
| 998 <p>pubchem.compound: 928</p> | |
| 999 <p>metanetx.chemical: MNXM10</p> | |
| 1000 <p>formula: C21H27N7O14P2</p> | |
| 1001 <p>charge: -2</p> | |
| 1002 </body> | |
| 1003 </notes> | |
| 1004 <annotation> | |
| 1005 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1006 <rdf:Description rdf:about="#cdf46bb5-653c-4e4c-bf33-28c9d8abecaa"> | |
| 1007 <bqbiol:is> | |
| 1008 <rdf:Bag> | |
| 1009 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00004"/> | |
| 1010 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB01487"/> | |
| 1011 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/nadh"/> | |
| 1012 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:16908"/> | |
| 1013 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/928"/> | |
| 1014 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM10"/> | |
| 1015 </rdf:Bag> | |
| 1016 </bqbiol:is> | |
| 1017 </rdf:Description> | |
| 1018 </rdf:RDF> | |
| 1019 </annotation> | |
| 1020 </species> | |
| 1021 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C16H21N5O15P2" hasOnlySubstanceUnits="true" id="M_m01949c" initialConcentration="0" metaid="e5ead912-a5af-4eae-a2ca-54c38ddb04ab" name="GDP-4-dehydro-6-deoxy-D-mannose" sboTerm="SBO:0000247"> | |
| 1022 <notes> | |
| 1023 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1024 <p>kegg.compound: C01222</p> | |
| 1025 <p>bigg.metabolite: gdpddman</p> | |
| 1026 <p>chebi: CHEBI:16955</p> | |
| 1027 <p>pubchem.compound: 439446</p> | |
| 1028 <p>metanetx.chemical: MNXM516</p> | |
| 1029 <p>formula: C16H21N5O15P2</p> | |
| 1030 <p>charge: -2</p> | |
| 1031 </body> | |
| 1032 </notes> | |
| 1033 <annotation> | |
| 1034 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1035 <rdf:Description rdf:about="#e5ead912-a5af-4eae-a2ca-54c38ddb04ab"> | |
| 1036 <bqbiol:is> | |
| 1037 <rdf:Bag> | |
| 1038 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01222"/> | |
| 1039 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/gdpddman"/> | |
| 1040 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:16955"/> | |
| 1041 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/439446"/> | |
| 1042 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM516"/> | |
| 1043 </rdf:Bag> | |
| 1044 </bqbiol:is> | |
| 1045 </rdf:Description> | |
| 1046 </rdf:RDF> | |
| 1047 </annotation> | |
| 1048 </species> | |
| 1049 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C6H11O9P" hasOnlySubstanceUnits="true" id="M_tag1p_D_c" initialConcentration="0" metaid="c7984b99-3c59-482c-a42b-699b4ec0058c" name="D-Tagatose 1-Phosphate" sboTerm="SBO:0000247"> | |
| 1050 <notes> | |
| 1051 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1052 <p>bigg.metabolite: tag1p__D</p> | |
| 1053 <p>pubchem.compound: 6101730</p> | |
| 1054 <p>metanetx.chemical: MNXM11293</p> | |
| 1055 <p>formula: C6H11O9P</p> | |
| 1056 <p>charge: -2</p> | |
| 1057 </body> | |
| 1058 </notes> | |
| 1059 <annotation> | |
| 1060 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1061 <rdf:Description rdf:about="#c7984b99-3c59-482c-a42b-699b4ec0058c"> | |
| 1062 <bqbiol:is> | |
| 1063 <rdf:Bag> | |
| 1064 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/tag1p__D"/> | |
| 1065 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/6101730"/> | |
| 1066 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM11293"/> | |
| 1067 </rdf:Bag> | |
| 1068 </bqbiol:is> | |
| 1069 </rdf:Description> | |
| 1070 </rdf:RDF> | |
| 1071 </annotation> | |
| 1072 </species> | |
| 1073 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="C11H14N2O3" hasOnlySubstanceUnits="true" id="M_glyphe_c" initialConcentration="0" metaid="_6fc683df-22a4-460b-bfae-8fbe15701927" name="Glycyl-Phenylalanine" sboTerm="SBO:0000247"> | |
| 1074 <notes> | |
| 1075 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1076 <p>hmdb: HMDB0028848</p> | |
| 1077 <p>bigg.metabolite: glyphe</p> | |
| 1078 <p>inchi: InChI=1S/C11H14N2O3/c12-7-10(14)13-9(11(15)16)6-8-4-2-1-3-5-8/h1-5,9H,6-7,12H2,(H,13,14)(H,15,16)</p> | |
| 1079 <p>metanetx.chemical: MNXM8669</p> | |
| 1080 <p>formula: C11H14N2O3</p> | |
| 1081 </body> | |
| 1082 </notes> | |
| 1083 <annotation> | |
| 1084 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1085 <rdf:Description rdf:about="#_6fc683df-22a4-460b-bfae-8fbe15701927"> | |
| 1086 <bqbiol:is> | |
| 1087 <rdf:Bag> | |
| 1088 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB0028848"/> | |
| 1089 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/glyphe"/> | |
| 1090 <rdf:li rdf:resource="https://identifiers.org/inchi/InChI=1S/C11H14N2O3/c12-7-10(14)13-9(11(15)16)6-8-4-2-1-3-5-8/h1-5,9H,6-7,12H2,(H,13,14)(H,15,16)"/> | |
| 1091 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM8669"/> | |
| 1092 </rdf:Bag> | |
| 1093 </bqbiol:is> | |
| 1094 </rdf:Description> | |
| 1095 </rdf:RDF> | |
| 1096 </annotation> | |
| 1097 </species> | |
| 1098 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H12O6" hasOnlySubstanceUnits="true" id="M_m01965c" initialConcentration="0" metaid="_94c2bee0-9d72-498c-ac24-cfc89072b989" name="glucose" sboTerm="SBO:0000247"> | |
| 1099 <notes> | |
| 1100 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1101 <p>kegg.compound: C00031</p> | |
| 1102 <p>hmdb: HMDB00122</p> | |
| 1103 <p>bigg.metabolite: glc__D</p> | |
| 1104 <p>chebi: CHEBI:4167</p> | |
| 1105 <p>pubchem.compound: 5793</p> | |
| 1106 <p>metanetx.chemical: MNXM41 || MNXM99</p> | |
| 1107 <p>formula: C6H12O6</p> | |
| 1108 </body> | |
| 1109 </notes> | |
| 1110 <annotation> | |
| 1111 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1112 <rdf:Description rdf:about="#_94c2bee0-9d72-498c-ac24-cfc89072b989"> | |
| 1113 <bqbiol:is> | |
| 1114 <rdf:Bag> | |
| 1115 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00031"/> | |
| 1116 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00122"/> | |
| 1117 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/glc__D"/> | |
| 1118 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:4167"/> | |
| 1119 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/5793"/> | |
| 1120 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM41"/> | |
| 1121 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM99"/> | |
| 1122 </rdf:Bag> | |
| 1123 </bqbiol:is> | |
| 1124 </rdf:Description> | |
| 1125 </rdf:RDF> | |
| 1126 </annotation> | |
| 1127 </species> | |
| 1128 <species boundaryCondition="false" compartment="s" constant="false" fbc:charge="0" fbc:chemicalFormula="C12H22O11" hasOnlySubstanceUnits="true" id="M_m02945s" initialConcentration="0" metaid="a013605d-e919-4407-ac07-58f2fa04eec0" name="sucrose" sboTerm="SBO:0000247"> | |
| 1129 <notes> | |
| 1130 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1131 <p>kegg.compound: C00089</p> | |
| 1132 <p>hmdb: HMDB00258</p> | |
| 1133 <p>bigg.metabolite: sucr</p> | |
| 1134 <p>chebi: CHEBI:17992</p> | |
| 1135 <p>pubchem.compound: 5988</p> | |
| 1136 <p>metanetx.chemical: MNXM167</p> | |
| 1137 <p>formula: C12H22O11</p> | |
| 1138 </body> | |
| 1139 </notes> | |
| 1140 <annotation> | |
| 1141 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1142 <rdf:Description rdf:about="#a013605d-e919-4407-ac07-58f2fa04eec0"> | |
| 1143 <bqbiol:is> | |
| 1144 <rdf:Bag> | |
| 1145 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00089"/> | |
| 1146 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00258"/> | |
| 1147 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/sucr"/> | |
| 1148 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17992"/> | |
| 1149 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/5988"/> | |
| 1150 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM167"/> | |
| 1151 </rdf:Bag> | |
| 1152 </bqbiol:is> | |
| 1153 </rdf:Description> | |
| 1154 </rdf:RDF> | |
| 1155 </annotation> | |
| 1156 </species> | |
| 1157 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C6H11O9P" hasOnlySubstanceUnits="true" id="M_m01844c" initialConcentration="0" metaid="c12fb463-a912-4ae2-a619-e6e7123535ff" name="fructose-3-phosphate" sboTerm="SBO:0000247"> | |
| 1158 <notes> | |
| 1159 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1160 <p>formula: C6H11O9P</p> | |
| 1161 <p>charge: -2</p> | |
| 1162 </body> | |
| 1163 </notes> | |
| 1164 </species> | |
| 1165 <species boundaryCondition="false" compartment="g" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H12O6" hasOnlySubstanceUnits="true" id="M_m01965g" initialConcentration="0" metaid="c3ec1b4f-c423-4fb7-ba05-e21ba291103b" name="glucose" sboTerm="SBO:0000247"> | |
| 1166 <notes> | |
| 1167 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1168 <p>kegg.compound: C00031</p> | |
| 1169 <p>hmdb: HMDB00122</p> | |
| 1170 <p>bigg.metabolite: glc__D</p> | |
| 1171 <p>chebi: CHEBI:4167</p> | |
| 1172 <p>pubchem.compound: 5793</p> | |
| 1173 <p>metanetx.chemical: MNXM41 || MNXM99</p> | |
| 1174 <p>formula: C6H12O6</p> | |
| 1175 </body> | |
| 1176 </notes> | |
| 1177 <annotation> | |
| 1178 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1179 <rdf:Description rdf:about="#c3ec1b4f-c423-4fb7-ba05-e21ba291103b"> | |
| 1180 <bqbiol:is> | |
| 1181 <rdf:Bag> | |
| 1182 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00031"/> | |
| 1183 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00122"/> | |
| 1184 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/glc__D"/> | |
| 1185 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:4167"/> | |
| 1186 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/5793"/> | |
| 1187 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM41"/> | |
| 1188 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM99"/> | |
| 1189 </rdf:Bag> | |
| 1190 </bqbiol:is> | |
| 1191 </rdf:Description> | |
| 1192 </rdf:RDF> | |
| 1193 </annotation> | |
| 1194 </species> | |
| 1195 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="C7H14O7" hasOnlySubstanceUnits="true" id="M_m03165c" initialConcentration="0" metaid="_7fccf573-a7f5-4aeb-823a-e1049fe4b5c1" name="sedoheptulose" sboTerm="SBO:0000247"> | |
| 1196 <notes> | |
| 1197 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1198 <p>kegg.compound: C02076</p> | |
| 1199 <p>chebi: CHEBI:16802</p> | |
| 1200 <p>metanetx.chemical: MNXM44065</p> | |
| 1201 <p>formula: C7H14O7</p> | |
| 1202 </body> | |
| 1203 </notes> | |
| 1204 <annotation> | |
| 1205 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1206 <rdf:Description rdf:about="#_7fccf573-a7f5-4aeb-823a-e1049fe4b5c1"> | |
| 1207 <bqbiol:is> | |
| 1208 <rdf:Bag> | |
| 1209 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02076"/> | |
| 1210 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:16802"/> | |
| 1211 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM44065"/> | |
| 1212 </rdf:Bag> | |
| 1213 </bqbiol:is> | |
| 1214 </rdf:Description> | |
| 1215 </rdf:RDF> | |
| 1216 </annotation> | |
| 1217 </species> | |
| 1218 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-3" fbc:chemicalFormula="C10H12N5O10P2" hasOnlySubstanceUnits="true" id="M_m01285c" initialConcentration="0" metaid="_521f7ad8-f72e-4338-a6f2-c0a842e7122b" name="ADP" sboTerm="SBO:0000247"> | |
| 1219 <notes> | |
| 1220 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1221 <p>kegg.compound: C00008</p> | |
| 1222 <p>hmdb: HMDB01341</p> | |
| 1223 <p>bigg.metabolite: adp</p> | |
| 1224 <p>chebi: CHEBI:16761</p> | |
| 1225 <p>pubchem.compound: 6022</p> | |
| 1226 <p>metanetx.chemical: MNXM7</p> | |
| 1227 <p>formula: C10H12N5O10P2</p> | |
| 1228 <p>charge: -3</p> | |
| 1229 </body> | |
| 1230 </notes> | |
| 1231 <annotation> | |
| 1232 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1233 <rdf:Description rdf:about="#_521f7ad8-f72e-4338-a6f2-c0a842e7122b"> | |
| 1234 <bqbiol:is> | |
| 1235 <rdf:Bag> | |
| 1236 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00008"/> | |
| 1237 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB01341"/> | |
| 1238 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/adp"/> | |
| 1239 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:16761"/> | |
| 1240 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/6022"/> | |
| 1241 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM7"/> | |
| 1242 </rdf:Bag> | |
| 1243 </bqbiol:is> | |
| 1244 </rdf:Description> | |
| 1245 </rdf:RDF> | |
| 1246 </annotation> | |
| 1247 </species> | |
| 1248 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="C3H6O3" hasOnlySubstanceUnits="true" id="M_m01981c" initialConcentration="0" metaid="_28c079d9-0897-4cc1-ac53-057881862cfb" name="glyceraldehyde" sboTerm="SBO:0000247"> | |
| 1249 <notes> | |
| 1250 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1251 <p>kegg.compound: C02154</p> | |
| 1252 <p>hmdb: HMDB01051</p> | |
| 1253 <p>bigg.metabolite: glyald</p> | |
| 1254 <p>chebi: CHEBI:5445</p> | |
| 1255 <p>inchi: InChI=1S/C3H6O3/c4-1-3(6)2-5/h1,3,5-6H,2H2/t3-/m0/s1</p> | |
| 1256 <p>pubchem.compound: 751</p> | |
| 1257 <p>metanetx.chemical: MNXM435</p> | |
| 1258 <p>formula: C3H6O3</p> | |
| 1259 </body> | |
| 1260 </notes> | |
| 1261 <annotation> | |
| 1262 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1263 <rdf:Description rdf:about="#_28c079d9-0897-4cc1-ac53-057881862cfb"> | |
| 1264 <bqbiol:is> | |
| 1265 <rdf:Bag> | |
| 1266 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02154"/> | |
| 1267 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB01051"/> | |
| 1268 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/glyald"/> | |
| 1269 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:5445"/> | |
| 1270 <rdf:li rdf:resource="https://identifiers.org/inchi/InChI=1S/C3H6O3/c4-1-3(6)2-5/h1,3,5-6H,2H2/t3-/m0/s1"/> | |
| 1271 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/751"/> | |
| 1272 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM435"/> | |
| 1273 </rdf:Bag> | |
| 1274 </bqbiol:is> | |
| 1275 </rdf:Description> | |
| 1276 </rdf:RDF> | |
| 1277 </annotation> | |
| 1278 </species> | |
| 1279 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H14O6" hasOnlySubstanceUnits="true" id="M_m01682c" initialConcentration="0" metaid="ae904b43-59ad-4e95-88e1-8e34700a9056" name="D-glucitol" sboTerm="SBO:0000247"> | |
| 1280 <notes> | |
| 1281 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1282 <p>kegg.compound: C00794</p> | |
| 1283 <p>hmdb: HMDB00247</p> | |
| 1284 <p>bigg.metabolite: sbt__D</p> | |
| 1285 <p>chebi: CHEBI:17924</p> | |
| 1286 <p>pubchem.compound: 5780</p> | |
| 1287 <p>metanetx.chemical: MNXM469</p> | |
| 1288 <p>formula: C6H14O6</p> | |
| 1289 </body> | |
| 1290 </notes> | |
| 1291 <annotation> | |
| 1292 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1293 <rdf:Description rdf:about="#ae904b43-59ad-4e95-88e1-8e34700a9056"> | |
| 1294 <bqbiol:is> | |
| 1295 <rdf:Bag> | |
| 1296 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00794"/> | |
| 1297 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00247"/> | |
| 1298 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/sbt__D"/> | |
| 1299 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17924"/> | |
| 1300 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/5780"/> | |
| 1301 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM469"/> | |
| 1302 </rdf:Bag> | |
| 1303 </bqbiol:is> | |
| 1304 </rdf:Description> | |
| 1305 </rdf:RDF> | |
| 1306 </annotation> | |
| 1307 </species> | |
| 1308 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C6H13O9P" hasOnlySubstanceUnits="true" id="M_m02917c" initialConcentration="0" metaid="_42c68707-b6eb-4d18-8cc4-456bd62297d4" name="sorbitol-3-phosphate" sboTerm="SBO:0000247"> | |
| 1309 <notes> | |
| 1310 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1311 <p>pubchem.compound: 129544</p> | |
| 1312 <p>metanetx.chemical: MNXM48480</p> | |
| 1313 <p>formula: C6H13O9P</p> | |
| 1314 <p>charge: -2</p> | |
| 1315 </body> | |
| 1316 </notes> | |
| 1317 <annotation> | |
| 1318 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1319 <rdf:Description rdf:about="#_42c68707-b6eb-4d18-8cc4-456bd62297d4"> | |
| 1320 <bqbiol:is> | |
| 1321 <rdf:Bag> | |
| 1322 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/129544"/> | |
| 1323 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM48480"/> | |
| 1324 </rdf:Bag> | |
| 1325 </bqbiol:is> | |
| 1326 </rdf:Description> | |
| 1327 </rdf:RDF> | |
| 1328 </annotation> | |
| 1329 </species> | |
| 1330 <species boundaryCondition="false" compartment="l" constant="false" fbc:charge="0" fbc:chemicalFormula="H2O" hasOnlySubstanceUnits="true" id="M_m02040l" initialConcentration="0" metaid="eb95a981-8590-48ef-b0b9-b05c3507c687" name="H2O" sboTerm="SBO:0000247"> | |
| 1331 <notes> | |
| 1332 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1333 <p>lipidmaps: LMST01040128</p> | |
| 1334 <p>kegg.compound: C00001</p> | |
| 1335 <p>hmdb: HMDB02111</p> | |
| 1336 <p>bigg.metabolite: h2o</p> | |
| 1337 <p>chebi: CHEBI:15377</p> | |
| 1338 <p>pubchem.compound: 962</p> | |
| 1339 <p>metanetx.chemical: MNXM2</p> | |
| 1340 <p>formula: H2O</p> | |
| 1341 </body> | |
| 1342 </notes> | |
| 1343 <annotation> | |
| 1344 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1345 <rdf:Description rdf:about="#eb95a981-8590-48ef-b0b9-b05c3507c687"> | |
| 1346 <bqbiol:is> | |
| 1347 <rdf:Bag> | |
| 1348 <rdf:li rdf:resource="https://identifiers.org/lipidmaps/LMST01040128"/> | |
| 1349 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00001"/> | |
| 1350 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB02111"/> | |
| 1351 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/h2o"/> | |
| 1352 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:15377"/> | |
| 1353 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/962"/> | |
| 1354 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM2"/> | |
| 1355 </rdf:Bag> | |
| 1356 </bqbiol:is> | |
| 1357 </rdf:Description> | |
| 1358 </rdf:RDF> | |
| 1359 </annotation> | |
| 1360 </species> | |
| 1361 <species boundaryCondition="false" compartment="r" constant="false" fbc:charge="-2" fbc:chemicalFormula="C21H27N7O14P2" hasOnlySubstanceUnits="true" id="M_m02553r" initialConcentration="0" metaid="a2069c73-802b-49cf-8f06-0e3f0be5669b" name="NADH" sboTerm="SBO:0000247"> | |
| 1362 <notes> | |
| 1363 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1364 <p>kegg.compound: C00004</p> | |
| 1365 <p>hmdb: HMDB01487</p> | |
| 1366 <p>bigg.metabolite: nadh</p> | |
| 1367 <p>chebi: CHEBI:16908</p> | |
| 1368 <p>pubchem.compound: 928</p> | |
| 1369 <p>metanetx.chemical: MNXM10</p> | |
| 1370 <p>formula: C21H27N7O14P2</p> | |
| 1371 <p>charge: -2</p> | |
| 1372 </body> | |
| 1373 </notes> | |
| 1374 <annotation> | |
| 1375 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1376 <rdf:Description rdf:about="#a2069c73-802b-49cf-8f06-0e3f0be5669b"> | |
| 1377 <bqbiol:is> | |
| 1378 <rdf:Bag> | |
| 1379 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00004"/> | |
| 1380 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB01487"/> | |
| 1381 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/nadh"/> | |
| 1382 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:16908"/> | |
| 1383 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/928"/> | |
| 1384 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM10"/> | |
| 1385 </rdf:Bag> | |
| 1386 </bqbiol:is> | |
| 1387 </rdf:Description> | |
| 1388 </rdf:RDF> | |
| 1389 </annotation> | |
| 1390 </species> | |
| 1391 <species boundaryCondition="false" compartment="l" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H12O6" hasOnlySubstanceUnits="true" id="M_m01965l" initialConcentration="0" metaid="_25dd65f2-2228-440c-baf3-9f621a7e5ff0" name="glucose" sboTerm="SBO:0000247"> | |
| 1392 <notes> | |
| 1393 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1394 <p>kegg.compound: C00031</p> | |
| 1395 <p>hmdb: HMDB00122</p> | |
| 1396 <p>bigg.metabolite: glc__D</p> | |
| 1397 <p>chebi: CHEBI:4167</p> | |
| 1398 <p>pubchem.compound: 5793</p> | |
| 1399 <p>metanetx.chemical: MNXM41 || MNXM99</p> | |
| 1400 <p>formula: C6H12O6</p> | |
| 1401 </body> | |
| 1402 </notes> | |
| 1403 <annotation> | |
| 1404 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1405 <rdf:Description rdf:about="#_25dd65f2-2228-440c-baf3-9f621a7e5ff0"> | |
| 1406 <bqbiol:is> | |
| 1407 <rdf:Bag> | |
| 1408 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00031"/> | |
| 1409 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00122"/> | |
| 1410 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/glc__D"/> | |
| 1411 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:4167"/> | |
| 1412 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/5793"/> | |
| 1413 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM41"/> | |
| 1414 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM99"/> | |
| 1415 </rdf:Bag> | |
| 1416 </bqbiol:is> | |
| 1417 </rdf:Description> | |
| 1418 </rdf:RDF> | |
| 1419 </annotation> | |
| 1420 </species> | |
| 1421 <species boundaryCondition="false" compartment="s" constant="false" fbc:charge="-2" fbc:chemicalFormula="C21H27N7O14P2" hasOnlySubstanceUnits="true" id="M_m02553s" initialConcentration="0" metaid="c0b50a6c-29cd-4c06-82af-9fce71d23255" name="NADH" sboTerm="SBO:0000247"> | |
| 1422 <notes> | |
| 1423 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1424 <p>kegg.compound: C00004</p> | |
| 1425 <p>hmdb: HMDB01487</p> | |
| 1426 <p>bigg.metabolite: nadh</p> | |
| 1427 <p>chebi: CHEBI:16908</p> | |
| 1428 <p>pubchem.compound: 928</p> | |
| 1429 <p>metanetx.chemical: MNXM10</p> | |
| 1430 <p>formula: C21H27N7O14P2</p> | |
| 1431 <p>charge: -2</p> | |
| 1432 </body> | |
| 1433 </notes> | |
| 1434 <annotation> | |
| 1435 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1436 <rdf:Description rdf:about="#c0b50a6c-29cd-4c06-82af-9fce71d23255"> | |
| 1437 <bqbiol:is> | |
| 1438 <rdf:Bag> | |
| 1439 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00004"/> | |
| 1440 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB01487"/> | |
| 1441 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/nadh"/> | |
| 1442 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:16908"/> | |
| 1443 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/928"/> | |
| 1444 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM10"/> | |
| 1445 </rdf:Bag> | |
| 1446 </bqbiol:is> | |
| 1447 </rdf:Description> | |
| 1448 </rdf:RDF> | |
| 1449 </annotation> | |
| 1450 </species> | |
| 1451 <species boundaryCondition="false" compartment="s" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H12O6" hasOnlySubstanceUnits="true" id="M_m01965s" initialConcentration="0" metaid="ad2dbd72-4542-4c0b-8986-e308b158e31f" name="glucose" sboTerm="SBO:0000247"> | |
| 1452 <notes> | |
| 1453 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1454 <p>kegg.compound: C00031</p> | |
| 1455 <p>hmdb: HMDB00122</p> | |
| 1456 <p>bigg.metabolite: glc__D</p> | |
| 1457 <p>chebi: CHEBI:4167</p> | |
| 1458 <p>pubchem.compound: 5793</p> | |
| 1459 <p>metanetx.chemical: MNXM41 || MNXM99</p> | |
| 1460 <p>formula: C6H12O6</p> | |
| 1461 </body> | |
| 1462 </notes> | |
| 1463 <annotation> | |
| 1464 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1465 <rdf:Description rdf:about="#ad2dbd72-4542-4c0b-8986-e308b158e31f"> | |
| 1466 <bqbiol:is> | |
| 1467 <rdf:Bag> | |
| 1468 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00031"/> | |
| 1469 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00122"/> | |
| 1470 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/glc__D"/> | |
| 1471 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:4167"/> | |
| 1472 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/5793"/> | |
| 1473 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM41"/> | |
| 1474 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM99"/> | |
| 1475 </rdf:Bag> | |
| 1476 </bqbiol:is> | |
| 1477 </rdf:Description> | |
| 1478 </rdf:RDF> | |
| 1479 </annotation> | |
| 1480 </species> | |
| 1481 <species boundaryCondition="false" compartment="s" constant="false" fbc:charge="0" fbc:chemicalFormula="C9H18O8" hasOnlySubstanceUnits="true" id="M_m01913s" initialConcentration="0" metaid="ae24b707-1474-48c9-bc3e-184c9fc59f80" name="galactosylglycerol" sboTerm="SBO:0000247"> | |
| 1482 <notes> | |
| 1483 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1484 <p>kegg.compound: C05401</p> | |
| 1485 <p>chebi: CHEBI:15754</p> | |
| 1486 <p>pubchem.compound: 16048618</p> | |
| 1487 <p>metanetx.chemical: MNXM2608</p> | |
| 1488 <p>formula: C9H18O8</p> | |
| 1489 </body> | |
| 1490 </notes> | |
| 1491 <annotation> | |
| 1492 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1493 <rdf:Description rdf:about="#ae24b707-1474-48c9-bc3e-184c9fc59f80"> | |
| 1494 <bqbiol:is> | |
| 1495 <rdf:Bag> | |
| 1496 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05401"/> | |
| 1497 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:15754"/> | |
| 1498 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/16048618"/> | |
| 1499 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM2608"/> | |
| 1500 </rdf:Bag> | |
| 1501 </bqbiol:is> | |
| 1502 </rdf:Description> | |
| 1503 </rdf:RDF> | |
| 1504 </annotation> | |
| 1505 </species> | |
| 1506 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="H2O" hasOnlySubstanceUnits="true" id="M_m02040c" initialConcentration="0" metaid="dce3ae33-5567-405a-9fd7-b571c4dce0b0" name="H2O" sboTerm="SBO:0000247"> | |
| 1507 <notes> | |
| 1508 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1509 <p>lipidmaps: LMST01040128</p> | |
| 1510 <p>kegg.compound: C00001</p> | |
| 1511 <p>hmdb: HMDB02111</p> | |
| 1512 <p>bigg.metabolite: h2o</p> | |
| 1513 <p>chebi: CHEBI:15377</p> | |
| 1514 <p>pubchem.compound: 962</p> | |
| 1515 <p>metanetx.chemical: MNXM2</p> | |
| 1516 <p>formula: H2O</p> | |
| 1517 </body> | |
| 1518 </notes> | |
| 1519 <annotation> | |
| 1520 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1521 <rdf:Description rdf:about="#dce3ae33-5567-405a-9fd7-b571c4dce0b0"> | |
| 1522 <bqbiol:is> | |
| 1523 <rdf:Bag> | |
| 1524 <rdf:li rdf:resource="https://identifiers.org/lipidmaps/LMST01040128"/> | |
| 1525 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00001"/> | |
| 1526 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB02111"/> | |
| 1527 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/h2o"/> | |
| 1528 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:15377"/> | |
| 1529 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/962"/> | |
| 1530 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM2"/> | |
| 1531 </rdf:Bag> | |
| 1532 </bqbiol:is> | |
| 1533 </rdf:Description> | |
| 1534 </rdf:RDF> | |
| 1535 </annotation> | |
| 1536 </species> | |
| 1537 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-3" fbc:chemicalFormula="C10H11N4O11P2" hasOnlySubstanceUnits="true" id="M_m02161c" initialConcentration="0" metaid="_6588a61e-6e8e-4abf-b113-5c7d7bd46a74" name="IDP" sboTerm="SBO:0000247"> | |
| 1538 <notes> | |
| 1539 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1540 <p>kegg.compound: C00104</p> | |
| 1541 <p>bigg.metabolite: idp</p> | |
| 1542 <p>chebi: CHEBI:17808</p> | |
| 1543 <p>pubchem.compound: 6831</p> | |
| 1544 <p>metanetx.chemical: MNXM495</p> | |
| 1545 <p>formula: C10H11N4O11P2</p> | |
| 1546 <p>charge: -3</p> | |
| 1547 </body> | |
| 1548 </notes> | |
| 1549 <annotation> | |
| 1550 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1551 <rdf:Description rdf:about="#_6588a61e-6e8e-4abf-b113-5c7d7bd46a74"> | |
| 1552 <bqbiol:is> | |
| 1553 <rdf:Bag> | |
| 1554 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00104"/> | |
| 1555 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/idp"/> | |
| 1556 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17808"/> | |
| 1557 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/6831"/> | |
| 1558 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM495"/> | |
| 1559 </rdf:Bag> | |
| 1560 </bqbiol:is> | |
| 1561 </rdf:Description> | |
| 1562 </rdf:RDF> | |
| 1563 </annotation> | |
| 1564 </species> | |
| 1565 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-1" fbc:chemicalFormula="C21H26N7O14P2" hasOnlySubstanceUnits="true" id="M_m02552c" initialConcentration="0" metaid="c7546c47-b436-4f42-b25c-6a7ba5aae2db" name="NAD+" sboTerm="SBO:0000247"> | |
| 1566 <notes> | |
| 1567 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1568 <p>kegg.compound: C00003</p> | |
| 1569 <p>hmdb: HMDB00902</p> | |
| 1570 <p>bigg.metabolite: nad</p> | |
| 1571 <p>chebi: CHEBI:15846</p> | |
| 1572 <p>pubchem.compound: 5893</p> | |
| 1573 <p>metanetx.chemical: MNXM8</p> | |
| 1574 <p>formula: C21H26N7O14P2</p> | |
| 1575 <p>charge: -1</p> | |
| 1576 </body> | |
| 1577 </notes> | |
| 1578 <annotation> | |
| 1579 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1580 <rdf:Description rdf:about="#c7546c47-b436-4f42-b25c-6a7ba5aae2db"> | |
| 1581 <bqbiol:is> | |
| 1582 <rdf:Bag> | |
| 1583 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00003"/> | |
| 1584 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00902"/> | |
| 1585 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/nad"/> | |
| 1586 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:15846"/> | |
| 1587 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/5893"/> | |
| 1588 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM8"/> | |
| 1589 </rdf:Bag> | |
| 1590 </bqbiol:is> | |
| 1591 </rdf:Description> | |
| 1592 </rdf:RDF> | |
| 1593 </annotation> | |
| 1594 </species> | |
| 1595 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-3" fbc:chemicalFormula="C10H12N5O11P2" hasOnlySubstanceUnits="true" id="M_m01948c" initialConcentration="0" metaid="a0bbd11c-f5e5-4615-aa55-824abf6e90cf" name="GDP" sboTerm="SBO:0000247"> | |
| 1596 <notes> | |
| 1597 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1598 <p>kegg.compound: C00035</p> | |
| 1599 <p>hmdb: HMDB01201</p> | |
| 1600 <p>bigg.metabolite: gdp</p> | |
| 1601 <p>chebi: CHEBI:17552</p> | |
| 1602 <p>pubchem.compound: 8977</p> | |
| 1603 <p>metanetx.chemical: MNXM30</p> | |
| 1604 <p>formula: C10H12N5O11P2</p> | |
| 1605 <p>charge: -3</p> | |
| 1606 </body> | |
| 1607 </notes> | |
| 1608 <annotation> | |
| 1609 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1610 <rdf:Description rdf:about="#a0bbd11c-f5e5-4615-aa55-824abf6e90cf"> | |
| 1611 <bqbiol:is> | |
| 1612 <rdf:Bag> | |
| 1613 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00035"/> | |
| 1614 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB01201"/> | |
| 1615 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/gdp"/> | |
| 1616 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17552"/> | |
| 1617 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/8977"/> | |
| 1618 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM30"/> | |
| 1619 </rdf:Bag> | |
| 1620 </bqbiol:is> | |
| 1621 </rdf:Description> | |
| 1622 </rdf:RDF> | |
| 1623 </annotation> | |
| 1624 </species> | |
| 1625 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C6H11O9P" hasOnlySubstanceUnits="true" id="M_m02455c" initialConcentration="0" metaid="_45e1757e-5e64-4141-add5-c15cc95139e6" name="mannose-6-phosphate" sboTerm="SBO:0000247"> | |
| 1626 <notes> | |
| 1627 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1628 <p>kegg.compound: C00275</p> | |
| 1629 <p>bigg.metabolite: man6p</p> | |
| 1630 <p>chebi: CHEBI:17369</p> | |
| 1631 <p>pubchem.compound: 65127</p> | |
| 1632 <p>metanetx.chemical: MNXM427</p> | |
| 1633 <p>formula: C6H11O9P</p> | |
| 1634 <p>charge: -2</p> | |
| 1635 </body> | |
| 1636 </notes> | |
| 1637 <annotation> | |
| 1638 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1639 <rdf:Description rdf:about="#_45e1757e-5e64-4141-add5-c15cc95139e6"> | |
| 1640 <bqbiol:is> | |
| 1641 <rdf:Bag> | |
| 1642 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00275"/> | |
| 1643 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/man6p"/> | |
| 1644 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17369"/> | |
| 1645 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/65127"/> | |
| 1646 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM427"/> | |
| 1647 </rdf:Bag> | |
| 1648 </bqbiol:is> | |
| 1649 </rdf:Description> | |
| 1650 </rdf:RDF> | |
| 1651 </annotation> | |
| 1652 </species> | |
| 1653 <species boundaryCondition="false" compartment="s" constant="false" fbc:charge="0" fbc:chemicalFormula="C12H20O11" hasOnlySubstanceUnits="true" id="M_m00812s" initialConcentration="0" metaid="_00ff2bbd-493a-4113-b2e9-db7ee06461c7" name="3-ketolactose" sboTerm="SBO:0000247"> | |
| 1654 <notes> | |
| 1655 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1656 <p>kegg.compound: C05403</p> | |
| 1657 <p>metanetx.chemical: MNXM36578</p> | |
| 1658 <p>formula: C12H20O11</p> | |
| 1659 </body> | |
| 1660 </notes> | |
| 1661 <annotation> | |
| 1662 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1663 <rdf:Description rdf:about="#_00ff2bbd-493a-4113-b2e9-db7ee06461c7"> | |
| 1664 <bqbiol:is> | |
| 1665 <rdf:Bag> | |
| 1666 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05403"/> | |
| 1667 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM36578"/> | |
| 1668 </rdf:Bag> | |
| 1669 </bqbiol:is> | |
| 1670 </rdf:Description> | |
| 1671 </rdf:RDF> | |
| 1672 </annotation> | |
| 1673 </species> | |
| 1674 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C6H11O9P" hasOnlySubstanceUnits="true" id="M_m01746c" initialConcentration="0" metaid="_649c6e13-719a-4c6a-816c-e44a17666513" name="D-tagatose-6-phosphate" sboTerm="SBO:0000247"> | |
| 1675 <notes> | |
| 1676 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1677 <p>kegg.compound: C01097</p> | |
| 1678 <p>bigg.metabolite: tag1p__D</p> | |
| 1679 <p>chebi: CHEBI:4251</p> | |
| 1680 <p>pubchem.compound: 439396</p> | |
| 1681 <p>metanetx.chemical: MNXM795 || MNXM164716</p> | |
| 1682 <p>formula: C6H11O9P</p> | |
| 1683 <p>charge: -2</p> | |
| 1684 </body> | |
| 1685 </notes> | |
| 1686 <annotation> | |
| 1687 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1688 <rdf:Description rdf:about="#_649c6e13-719a-4c6a-816c-e44a17666513"> | |
| 1689 <bqbiol:is> | |
| 1690 <rdf:Bag> | |
| 1691 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01097"/> | |
| 1692 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/tag1p__D"/> | |
| 1693 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:4251"/> | |
| 1694 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/439396"/> | |
| 1695 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM795"/> | |
| 1696 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM164716"/> | |
| 1697 </rdf:Bag> | |
| 1698 </bqbiol:is> | |
| 1699 </rdf:Description> | |
| 1700 </rdf:RDF> | |
| 1701 </annotation> | |
| 1702 </species> | |
| 1703 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-4" fbc:chemicalFormula="C6H10O12P2" hasOnlySubstanceUnits="true" id="M_m01843c" initialConcentration="0" metaid="fd1b4759-172c-46ec-a6af-449961360664" name="fructose-2,6-bisphosphate" sboTerm="SBO:0000247"> | |
| 1704 <notes> | |
| 1705 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1706 <p>kegg.compound: C00665</p> | |
| 1707 <p>bigg.metabolite: f26bp</p> | |
| 1708 <p>chebi: CHEBI:28602</p> | |
| 1709 <p>pubchem.compound: 105021</p> | |
| 1710 <p>metanetx.chemical: MNXM651</p> | |
| 1711 <p>formula: C6H10O12P2</p> | |
| 1712 <p>charge: -4</p> | |
| 1713 </body> | |
| 1714 </notes> | |
| 1715 <annotation> | |
| 1716 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1717 <rdf:Description rdf:about="#fd1b4759-172c-46ec-a6af-449961360664"> | |
| 1718 <bqbiol:is> | |
| 1719 <rdf:Bag> | |
| 1720 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00665"/> | |
| 1721 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/f26bp"/> | |
| 1722 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:28602"/> | |
| 1723 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/105021"/> | |
| 1724 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM651"/> | |
| 1725 </rdf:Bag> | |
| 1726 </bqbiol:is> | |
| 1727 </rdf:Description> | |
| 1728 </rdf:RDF> | |
| 1729 </annotation> | |
| 1730 </species> | |
| 1731 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-4" fbc:chemicalFormula="C10H12N5O13P3" hasOnlySubstanceUnits="true" id="M_m01371c" initialConcentration="0" metaid="_7c99bce2-d604-4273-9c90-72c3d53e303d" name="ATP" sboTerm="SBO:0000247"> | |
| 1732 <notes> | |
| 1733 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1734 <p>kegg.compound: C00002</p> | |
| 1735 <p>hmdb: HMDB00538</p> | |
| 1736 <p>bigg.metabolite: atp</p> | |
| 1737 <p>chebi: CHEBI:15422</p> | |
| 1738 <p>pubchem.compound: 5957</p> | |
| 1739 <p>metanetx.chemical: MNXM3</p> | |
| 1740 <p>formula: C10H12N5O13P3</p> | |
| 1741 <p>charge: -4</p> | |
| 1742 </body> | |
| 1743 </notes> | |
| 1744 <annotation> | |
| 1745 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1746 <rdf:Description rdf:about="#_7c99bce2-d604-4273-9c90-72c3d53e303d"> | |
| 1747 <bqbiol:is> | |
| 1748 <rdf:Bag> | |
| 1749 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00002"/> | |
| 1750 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00538"/> | |
| 1751 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/atp"/> | |
| 1752 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:15422"/> | |
| 1753 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/5957"/> | |
| 1754 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM3"/> | |
| 1755 </rdf:Bag> | |
| 1756 </bqbiol:is> | |
| 1757 </rdf:Description> | |
| 1758 </rdf:RDF> | |
| 1759 </annotation> | |
| 1760 </species> | |
| 1761 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="CO2" hasOnlySubstanceUnits="true" id="M_m01596c" initialConcentration="0" metaid="_24121835-f370-42a9-89c1-f78191770ba5" name="CO2" sboTerm="SBO:0000247"> | |
| 1762 <notes> | |
| 1763 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1764 <p>kegg.compound: C00011</p> | |
| 1765 <p>hmdb: HMDB01967</p> | |
| 1766 <p>bigg.metabolite: co2</p> | |
| 1767 <p>chebi: CHEBI:16526</p> | |
| 1768 <p>inchi: InChI=1S/CO2/c2-1-3</p> | |
| 1769 <p>pubchem.compound: 280</p> | |
| 1770 <p>metanetx.chemical: MNXM13</p> | |
| 1771 <p>formula: CO2</p> | |
| 1772 </body> | |
| 1773 </notes> | |
| 1774 <annotation> | |
| 1775 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1776 <rdf:Description rdf:about="#_24121835-f370-42a9-89c1-f78191770ba5"> | |
| 1777 <bqbiol:is> | |
| 1778 <rdf:Bag> | |
| 1779 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00011"/> | |
| 1780 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB01967"/> | |
| 1781 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/co2"/> | |
| 1782 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:16526"/> | |
| 1783 <rdf:li rdf:resource="https://identifiers.org/inchi/InChI=1S/CO2/c2-1-3"/> | |
| 1784 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/280"/> | |
| 1785 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM13"/> | |
| 1786 </rdf:Bag> | |
| 1787 </bqbiol:is> | |
| 1788 </rdf:Description> | |
| 1789 </rdf:RDF> | |
| 1790 </annotation> | |
| 1791 </species> | |
| 1792 <species boundaryCondition="false" compartment="s" constant="false" fbc:charge="-1" fbc:chemicalFormula="C21H26N7O14P2" hasOnlySubstanceUnits="true" id="M_m02552s" initialConcentration="0" metaid="_81c63c25-41ec-418f-a7ae-8917ef8e605f" name="NAD+" sboTerm="SBO:0000247"> | |
| 1793 <notes> | |
| 1794 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1795 <p>kegg.compound: C00003</p> | |
| 1796 <p>hmdb: HMDB00902</p> | |
| 1797 <p>bigg.metabolite: nad</p> | |
| 1798 <p>chebi: CHEBI:15846</p> | |
| 1799 <p>pubchem.compound: 5893</p> | |
| 1800 <p>metanetx.chemical: MNXM8</p> | |
| 1801 <p>formula: C21H26N7O14P2</p> | |
| 1802 <p>charge: -1</p> | |
| 1803 </body> | |
| 1804 </notes> | |
| 1805 <annotation> | |
| 1806 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1807 <rdf:Description rdf:about="#_81c63c25-41ec-418f-a7ae-8917ef8e605f"> | |
| 1808 <bqbiol:is> | |
| 1809 <rdf:Bag> | |
| 1810 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00003"/> | |
| 1811 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00902"/> | |
| 1812 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/nad"/> | |
| 1813 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:15846"/> | |
| 1814 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/5893"/> | |
| 1815 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM8"/> | |
| 1816 </rdf:Bag> | |
| 1817 </bqbiol:is> | |
| 1818 </rdf:Description> | |
| 1819 </rdf:RDF> | |
| 1820 </annotation> | |
| 1821 </species> | |
| 1822 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C15H22N2O17P2" hasOnlySubstanceUnits="true" id="M_m03108c" initialConcentration="0" metaid="_59be01c8-ef39-4d12-ba62-dae2abc178b3" name="UDP-glucose" sboTerm="SBO:0000247"> | |
| 1823 <notes> | |
| 1824 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1825 <p>kegg.compound: C00029</p> | |
| 1826 <p>bigg.metabolite: udpg</p> | |
| 1827 <p>chebi: CHEBI:18066</p> | |
| 1828 <p>pubchem.compound: 53477679</p> | |
| 1829 <p>metanetx.chemical: MNXM52</p> | |
| 1830 <p>formula: C15H22N2O17P2</p> | |
| 1831 <p>charge: -2</p> | |
| 1832 </body> | |
| 1833 </notes> | |
| 1834 <annotation> | |
| 1835 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1836 <rdf:Description rdf:about="#_59be01c8-ef39-4d12-ba62-dae2abc178b3"> | |
| 1837 <bqbiol:is> | |
| 1838 <rdf:Bag> | |
| 1839 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00029"/> | |
| 1840 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/udpg"/> | |
| 1841 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:18066"/> | |
| 1842 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/53477679"/> | |
| 1843 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM52"/> | |
| 1844 </rdf:Bag> | |
| 1845 </bqbiol:is> | |
| 1846 </rdf:Description> | |
| 1847 </rdf:RDF> | |
| 1848 </annotation> | |
| 1849 </species> | |
| 1850 <species boundaryCondition="false" compartment="r" constant="false" fbc:charge="-1" fbc:chemicalFormula="C21H26N7O14P2" hasOnlySubstanceUnits="true" id="M_m02552r" initialConcentration="0" metaid="_97a217ca-280a-4b3d-a2b8-ef92ea5df65e" name="NAD+" sboTerm="SBO:0000247"> | |
| 1851 <notes> | |
| 1852 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1853 <p>kegg.compound: C00003</p> | |
| 1854 <p>hmdb: HMDB00902</p> | |
| 1855 <p>bigg.metabolite: nad</p> | |
| 1856 <p>chebi: CHEBI:15846</p> | |
| 1857 <p>pubchem.compound: 5893</p> | |
| 1858 <p>metanetx.chemical: MNXM8</p> | |
| 1859 <p>formula: C21H26N7O14P2</p> | |
| 1860 <p>charge: -1</p> | |
| 1861 </body> | |
| 1862 </notes> | |
| 1863 <annotation> | |
| 1864 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1865 <rdf:Description rdf:about="#_97a217ca-280a-4b3d-a2b8-ef92ea5df65e"> | |
| 1866 <bqbiol:is> | |
| 1867 <rdf:Bag> | |
| 1868 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00003"/> | |
| 1869 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00902"/> | |
| 1870 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/nad"/> | |
| 1871 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:15846"/> | |
| 1872 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/5893"/> | |
| 1873 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM8"/> | |
| 1874 </rdf:Bag> | |
| 1875 </bqbiol:is> | |
| 1876 </rdf:Description> | |
| 1877 </rdf:RDF> | |
| 1878 </annotation> | |
| 1879 </species> | |
| 1880 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-3" fbc:chemicalFormula="C9H12N3O11P2" hasOnlySubstanceUnits="true" id="M_m01424c" initialConcentration="0" metaid="_430a23d5-3b46-409f-8228-66cb698937a6" name="CDP" sboTerm="SBO:0000247"> | |
| 1881 <notes> | |
| 1882 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1883 <p>kegg.compound: C00112</p> | |
| 1884 <p>bigg.metabolite: cdp</p> | |
| 1885 <p>chebi: CHEBI:17239</p> | |
| 1886 <p>pubchem.compound: 6132</p> | |
| 1887 <p>metanetx.chemical: MNXM220</p> | |
| 1888 <p>formula: C9H12N3O11P2</p> | |
| 1889 <p>charge: -3</p> | |
| 1890 </body> | |
| 1891 </notes> | |
| 1892 <annotation> | |
| 1893 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1894 <rdf:Description rdf:about="#_430a23d5-3b46-409f-8228-66cb698937a6"> | |
| 1895 <bqbiol:is> | |
| 1896 <rdf:Bag> | |
| 1897 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00112"/> | |
| 1898 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/cdp"/> | |
| 1899 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17239"/> | |
| 1900 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/6132"/> | |
| 1901 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM220"/> | |
| 1902 </rdf:Bag> | |
| 1903 </bqbiol:is> | |
| 1904 </rdf:Description> | |
| 1905 </rdf:RDF> | |
| 1906 </annotation> | |
| 1907 </species> | |
| 1908 <species boundaryCondition="false" compartment="r" constant="false" fbc:charge="0" fbc:chemicalFormula="CO2" hasOnlySubstanceUnits="true" id="M_m01596r" initialConcentration="0" metaid="_11e6d111-bf70-414d-9f90-152505ad9772" name="CO2" sboTerm="SBO:0000247"> | |
| 1909 <notes> | |
| 1910 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1911 <p>kegg.compound: C00011</p> | |
| 1912 <p>hmdb: HMDB01967</p> | |
| 1913 <p>bigg.metabolite: co2</p> | |
| 1914 <p>chebi: CHEBI:16526</p> | |
| 1915 <p>inchi: InChI=1S/CO2/c2-1-3</p> | |
| 1916 <p>pubchem.compound: 280</p> | |
| 1917 <p>metanetx.chemical: MNXM13</p> | |
| 1918 <p>formula: CO2</p> | |
| 1919 </body> | |
| 1920 </notes> | |
| 1921 <annotation> | |
| 1922 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1923 <rdf:Description rdf:about="#_11e6d111-bf70-414d-9f90-152505ad9772"> | |
| 1924 <bqbiol:is> | |
| 1925 <rdf:Bag> | |
| 1926 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00011"/> | |
| 1927 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB01967"/> | |
| 1928 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/co2"/> | |
| 1929 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:16526"/> | |
| 1930 <rdf:li rdf:resource="https://identifiers.org/inchi/InChI=1S/CO2/c2-1-3"/> | |
| 1931 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/280"/> | |
| 1932 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM13"/> | |
| 1933 </rdf:Bag> | |
| 1934 </bqbiol:is> | |
| 1935 </rdf:Description> | |
| 1936 </rdf:RDF> | |
| 1937 </annotation> | |
| 1938 </species> | |
| 1939 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H14O6" hasOnlySubstanceUnits="true" id="M_m01909c" initialConcentration="0" metaid="_32fccb2f-e504-4de0-be7b-32b6e5e909af" name="galactitol" sboTerm="SBO:0000247"> | |
| 1940 <notes> | |
| 1941 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1942 <p>kegg.compound: C01697</p> | |
| 1943 <p>hmdb: HMDB00107</p> | |
| 1944 <p>bigg.metabolite: galt</p> | |
| 1945 <p>chebi: CHEBI:16813</p> | |
| 1946 <p>inchi: InChI=1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4+,5+,6-</p> | |
| 1947 <p>pubchem.compound: 11850</p> | |
| 1948 <p>metanetx.chemical: MNXM1233</p> | |
| 1949 <p>formula: C6H14O6</p> | |
| 1950 </body> | |
| 1951 </notes> | |
| 1952 <annotation> | |
| 1953 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1954 <rdf:Description rdf:about="#_32fccb2f-e504-4de0-be7b-32b6e5e909af"> | |
| 1955 <bqbiol:is> | |
| 1956 <rdf:Bag> | |
| 1957 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01697"/> | |
| 1958 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00107"/> | |
| 1959 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/galt"/> | |
| 1960 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:16813"/> | |
| 1961 <rdf:li rdf:resource="https://identifiers.org/inchi/InChI=1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4+,5+,6-"/> | |
| 1962 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/11850"/> | |
| 1963 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM1233"/> | |
| 1964 </rdf:Bag> | |
| 1965 </bqbiol:is> | |
| 1966 </rdf:Description> | |
| 1967 </rdf:RDF> | |
| 1968 </annotation> | |
| 1969 </species> | |
| 1970 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C6H11O9P" hasOnlySubstanceUnits="true" id="M_m02454c" initialConcentration="0" metaid="a9ce0266-f645-439d-b18d-d18a8b0913d4" name="mannose-1-phosphate" sboTerm="SBO:0000247"> | |
| 1971 <notes> | |
| 1972 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 1973 <p>kegg.compound: C00636</p> | |
| 1974 <p>hmdb: HMDB06330</p> | |
| 1975 <p>bigg.metabolite: man1p</p> | |
| 1976 <p>chebi: CHEBI:35374</p> | |
| 1977 <p>pubchem.compound: 644175</p> | |
| 1978 <p>metanetx.chemical: MNXM721</p> | |
| 1979 <p>formula: C6H11O9P</p> | |
| 1980 <p>charge: -2</p> | |
| 1981 </body> | |
| 1982 </notes> | |
| 1983 <annotation> | |
| 1984 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 1985 <rdf:Description rdf:about="#a9ce0266-f645-439d-b18d-d18a8b0913d4"> | |
| 1986 <bqbiol:is> | |
| 1987 <rdf:Bag> | |
| 1988 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00636"/> | |
| 1989 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB06330"/> | |
| 1990 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/man1p"/> | |
| 1991 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:35374"/> | |
| 1992 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/644175"/> | |
| 1993 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM721"/> | |
| 1994 </rdf:Bag> | |
| 1995 </bqbiol:is> | |
| 1996 </rdf:Description> | |
| 1997 </rdf:RDF> | |
| 1998 </annotation> | |
| 1999 </species> | |
| 2000 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H12O5" hasOnlySubstanceUnits="true" id="M_abt_D_c" initialConcentration="0" metaid="_26494228-cd48-4a29-af7c-1b74871615b2" name="D-Arabitol" sboTerm="SBO:0000247"> | |
| 2001 <notes> | |
| 2002 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2003 <p>bigg.metabolite: abt__D</p> | |
| 2004 <p>inchi: InChI=1S/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4-/m1/s1</p> | |
| 2005 <p>metanetx.chemical: MNXM1018</p> | |
| 2006 <p>formula: C5H12O5</p> | |
| 2007 </body> | |
| 2008 </notes> | |
| 2009 <annotation> | |
| 2010 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2011 <rdf:Description rdf:about="#_26494228-cd48-4a29-af7c-1b74871615b2"> | |
| 2012 <bqbiol:is> | |
| 2013 <rdf:Bag> | |
| 2014 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/abt__D"/> | |
| 2015 <rdf:li rdf:resource="https://identifiers.org/inchi/InChI=1S/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4-/m1/s1"/> | |
| 2016 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM1018"/> | |
| 2017 </rdf:Bag> | |
| 2018 </bqbiol:is> | |
| 2019 </rdf:Description> | |
| 2020 </rdf:RDF> | |
| 2021 </annotation> | |
| 2022 </species> | |
| 2023 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-4" fbc:chemicalFormula="C6H10O12P2" hasOnlySubstanceUnits="true" id="M_m01717c" initialConcentration="0" metaid="_2615d46c-444b-4efb-8351-a5365965023d" name="D-mannose-1,6-bisphosphate" sboTerm="SBO:0000247"> | |
| 2024 <notes> | |
| 2025 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2026 <p>kegg.compound: C03693</p> | |
| 2027 <p>pubchem.compound: 3036654</p> | |
| 2028 <p>metanetx.chemical: MNXM48557</p> | |
| 2029 <p>formula: C6H10O12P2</p> | |
| 2030 <p>charge: -4</p> | |
| 2031 </body> | |
| 2032 </notes> | |
| 2033 <annotation> | |
| 2034 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2035 <rdf:Description rdf:about="#_2615d46c-444b-4efb-8351-a5365965023d"> | |
| 2036 <bqbiol:is> | |
| 2037 <rdf:Bag> | |
| 2038 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C03693"/> | |
| 2039 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/3036654"/> | |
| 2040 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM48557"/> | |
| 2041 </rdf:Bag> | |
| 2042 </bqbiol:is> | |
| 2043 </rdf:Description> | |
| 2044 </rdf:RDF> | |
| 2045 </annotation> | |
| 2046 </species> | |
| 2047 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-4" fbc:chemicalFormula="C10H12N5O14P3" hasOnlySubstanceUnits="true" id="M_m02034c" initialConcentration="0" metaid="_949f82be-8e6d-4143-98fb-13e8a920d815" name="GTP" sboTerm="SBO:0000247"> | |
| 2048 <notes> | |
| 2049 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2050 <p>kegg.compound: C00044</p> | |
| 2051 <p>hmdb: HMDB01273</p> | |
| 2052 <p>bigg.metabolite: gtp</p> | |
| 2053 <p>chebi: CHEBI:15996</p> | |
| 2054 <p>pubchem.compound: 6830</p> | |
| 2055 <p>metanetx.chemical: MNXM51</p> | |
| 2056 <p>formula: C10H12N5O14P3</p> | |
| 2057 <p>charge: -4</p> | |
| 2058 </body> | |
| 2059 </notes> | |
| 2060 <annotation> | |
| 2061 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2062 <rdf:Description rdf:about="#_949f82be-8e6d-4143-98fb-13e8a920d815"> | |
| 2063 <bqbiol:is> | |
| 2064 <rdf:Bag> | |
| 2065 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00044"/> | |
| 2066 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB01273"/> | |
| 2067 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/gtp"/> | |
| 2068 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:15996"/> | |
| 2069 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/6830"/> | |
| 2070 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM51"/> | |
| 2071 </rdf:Bag> | |
| 2072 </bqbiol:is> | |
| 2073 </rdf:Description> | |
| 2074 </rdf:RDF> | |
| 2075 </annotation> | |
| 2076 </species> | |
| 2077 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C6H11O9P" hasOnlySubstanceUnits="true" id="M_m01911c" initialConcentration="0" metaid="_71807f0a-77fc-4a83-83ec-587af94cb10d" name="galactose-1-phosphate" sboTerm="SBO:0000247"> | |
| 2078 <notes> | |
| 2079 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2080 <p>kegg.compound: C03384</p> | |
| 2081 <p>metanetx.chemical: MNXM336</p> | |
| 2082 <p>formula: C6H11O9P</p> | |
| 2083 <p>charge: -2</p> | |
| 2084 </body> | |
| 2085 </notes> | |
| 2086 <annotation> | |
| 2087 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2088 <rdf:Description rdf:about="#_71807f0a-77fc-4a83-83ec-587af94cb10d"> | |
| 2089 <bqbiol:is> | |
| 2090 <rdf:Bag> | |
| 2091 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C03384"/> | |
| 2092 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM336"/> | |
| 2093 </rdf:Bag> | |
| 2094 </bqbiol:is> | |
| 2095 </rdf:Description> | |
| 2096 </rdf:RDF> | |
| 2097 </annotation> | |
| 2098 </species> | |
| 2099 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H12O6" hasOnlySubstanceUnits="true" id="M_m01745c" initialConcentration="0" metaid="a276d8cf-f71a-4d12-bd23-bd4bf3944d06" name="D-tagatose" sboTerm="SBO:0000247"> | |
| 2100 <notes> | |
| 2101 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2102 <p>kegg.compound: C00795</p> | |
| 2103 <p>hmdb: HMDB03418</p> | |
| 2104 <p>bigg.metabolite: tag__D</p> | |
| 2105 <p>chebi: CHEBI:47693</p> | |
| 2106 <p>pubchem.compound: 92092</p> | |
| 2107 <p>metanetx.chemical: MNXM92401</p> | |
| 2108 <p>formula: C6H12O6</p> | |
| 2109 </body> | |
| 2110 </notes> | |
| 2111 <annotation> | |
| 2112 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2113 <rdf:Description rdf:about="#a276d8cf-f71a-4d12-bd23-bd4bf3944d06"> | |
| 2114 <bqbiol:is> | |
| 2115 <rdf:Bag> | |
| 2116 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00795"/> | |
| 2117 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB03418"/> | |
| 2118 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/tag__D"/> | |
| 2119 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:47693"/> | |
| 2120 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/92092"/> | |
| 2121 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM92401"/> | |
| 2122 </rdf:Bag> | |
| 2123 </bqbiol:is> | |
| 2124 </rdf:Description> | |
| 2125 </rdf:RDF> | |
| 2126 </annotation> | |
| 2127 </species> | |
| 2128 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C6H11O9P" hasOnlySubstanceUnits="true" id="M_m01842c" initialConcentration="0" metaid="_5c5c742d-cd6a-48ff-87bb-0027c8b6eefe" name="fructose-1-phosphate" sboTerm="SBO:0000247"> | |
| 2129 <notes> | |
| 2130 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2131 <p>kegg.compound: C01094</p> | |
| 2132 <p>bigg.metabolite: f1p</p> | |
| 2133 <p>chebi: CHEBI:18105</p> | |
| 2134 <p>pubchem.compound: 10400369</p> | |
| 2135 <p>metanetx.chemical: MNXM145568</p> | |
| 2136 <p>formula: C6H11O9P</p> | |
| 2137 <p>charge: -2</p> | |
| 2138 </body> | |
| 2139 </notes> | |
| 2140 <annotation> | |
| 2141 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2142 <rdf:Description rdf:about="#_5c5c742d-cd6a-48ff-87bb-0027c8b6eefe"> | |
| 2143 <bqbiol:is> | |
| 2144 <rdf:Bag> | |
| 2145 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01094"/> | |
| 2146 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/f1p"/> | |
| 2147 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:18105"/> | |
| 2148 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/10400369"/> | |
| 2149 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM145568"/> | |
| 2150 </rdf:Bag> | |
| 2151 </bqbiol:is> | |
| 2152 </rdf:Description> | |
| 2153 </rdf:RDF> | |
| 2154 </annotation> | |
| 2155 </species> | |
| 2156 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C16H23N5O16P2" hasOnlySubstanceUnits="true" id="M_m01951c" initialConcentration="0" metaid="e11e80c6-cd80-4ea3-96ca-05f1b24ed09b" name="GDP-mannose" sboTerm="SBO:0000247"> | |
| 2157 <notes> | |
| 2158 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2159 <p>kegg.compound: C00096</p> | |
| 2160 <p>bigg.metabolite: gdpmann</p> | |
| 2161 <p>chebi: CHEBI:15820</p> | |
| 2162 <p>pubchem.compound: 18396</p> | |
| 2163 <p>metanetx.chemical: MNXM82</p> | |
| 2164 <p>formula: C16H23N5O16P2</p> | |
| 2165 <p>charge: -2</p> | |
| 2166 </body> | |
| 2167 </notes> | |
| 2168 <annotation> | |
| 2169 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2170 <rdf:Description rdf:about="#e11e80c6-cd80-4ea3-96ca-05f1b24ed09b"> | |
| 2171 <bqbiol:is> | |
| 2172 <rdf:Bag> | |
| 2173 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00096"/> | |
| 2174 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/gdpmann"/> | |
| 2175 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:15820"/> | |
| 2176 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/18396"/> | |
| 2177 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM82"/> | |
| 2178 </rdf:Bag> | |
| 2179 </bqbiol:is> | |
| 2180 </rdf:Description> | |
| 2181 </rdf:RDF> | |
| 2182 </annotation> | |
| 2183 </species> | |
| 2184 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C5H9O8P" hasOnlySubstanceUnits="true" id="M_m02846c" initialConcentration="0" metaid="f88cd838-6cfd-4de1-80dd-47d8a4a5ec8c" name="ribulose-5-phosphate" sboTerm="SBO:0000247"> | |
| 2185 <notes> | |
| 2186 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2187 <p>kegg.compound: C00199</p> | |
| 2188 <p>bigg.metabolite: ru5p__D</p> | |
| 2189 <p>chebi: CHEBI:17363</p> | |
| 2190 <p>pubchem.compound: 439184</p> | |
| 2191 <p>metanetx.chemical: MNXM145 || MNXM186</p> | |
| 2192 <p>formula: C5H9O8P</p> | |
| 2193 <p>charge: -2</p> | |
| 2194 </body> | |
| 2195 </notes> | |
| 2196 <annotation> | |
| 2197 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2198 <rdf:Description rdf:about="#f88cd838-6cfd-4de1-80dd-47d8a4a5ec8c"> | |
| 2199 <bqbiol:is> | |
| 2200 <rdf:Bag> | |
| 2201 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00199"/> | |
| 2202 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/ru5p__D"/> | |
| 2203 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17363"/> | |
| 2204 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/439184"/> | |
| 2205 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM145"/> | |
| 2206 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM186"/> | |
| 2207 </rdf:Bag> | |
| 2208 </bqbiol:is> | |
| 2209 </rdf:Description> | |
| 2210 </rdf:RDF> | |
| 2211 </annotation> | |
| 2212 </species> | |
| 2213 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C4H7O7P" hasOnlySubstanceUnits="true" id="M_m01785c" initialConcentration="0" metaid="_81dee1de-9ff0-4d2b-8f6f-99cf059accdf" name="erythrose-4-phosphate" sboTerm="SBO:0000247"> | |
| 2214 <notes> | |
| 2215 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2216 <p>kegg.compound: C00279</p> | |
| 2217 <p>bigg.metabolite: e4p</p> | |
| 2218 <p>chebi: CHEBI:48153</p> | |
| 2219 <p>pubchem.compound: 122357</p> | |
| 2220 <p>metanetx.chemical: MNXM258</p> | |
| 2221 <p>formula: C4H7O7P</p> | |
| 2222 <p>charge: -2</p> | |
| 2223 </body> | |
| 2224 </notes> | |
| 2225 <annotation> | |
| 2226 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2227 <rdf:Description rdf:about="#_81dee1de-9ff0-4d2b-8f6f-99cf059accdf"> | |
| 2228 <bqbiol:is> | |
| 2229 <rdf:Bag> | |
| 2230 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00279"/> | |
| 2231 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/e4p"/> | |
| 2232 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:48153"/> | |
| 2233 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/122357"/> | |
| 2234 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM258"/> | |
| 2235 </rdf:Bag> | |
| 2236 </bqbiol:is> | |
| 2237 </rdf:Description> | |
| 2238 </rdf:RDF> | |
| 2239 </annotation> | |
| 2240 </species> | |
| 2241 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C5H9O8P" hasOnlySubstanceUnits="true" id="M_m01761c" initialConcentration="0" metaid="e6b875ce-6d49-4f17-bac7-17eeb57f18fa" name="D-xylulose-5-phosphate" sboTerm="SBO:0000247"> | |
| 2242 <notes> | |
| 2243 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2244 <p>kegg.compound: C00231</p> | |
| 2245 <p>bigg.metabolite: xu5p__D</p> | |
| 2246 <p>chebi: CHEBI:16332</p> | |
| 2247 <p>pubchem.compound: 439190</p> | |
| 2248 <p>metanetx.chemical: MNXM186</p> | |
| 2249 <p>formula: C5H9O8P</p> | |
| 2250 <p>charge: -2</p> | |
| 2251 </body> | |
| 2252 </notes> | |
| 2253 <annotation> | |
| 2254 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2255 <rdf:Description rdf:about="#e6b875ce-6d49-4f17-bac7-17eeb57f18fa"> | |
| 2256 <bqbiol:is> | |
| 2257 <rdf:Bag> | |
| 2258 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00231"/> | |
| 2259 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/xu5p__D"/> | |
| 2260 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:16332"/> | |
| 2261 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/439190"/> | |
| 2262 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM186"/> | |
| 2263 </rdf:Bag> | |
| 2264 </bqbiol:is> | |
| 2265 </rdf:Description> | |
| 2266 </rdf:RDF> | |
| 2267 </annotation> | |
| 2268 </species> | |
| 2269 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-5" fbc:chemicalFormula="C5H8O14P3" hasOnlySubstanceUnits="true" id="M_m02806c" initialConcentration="0" metaid="_1c326a8e-e821-4f60-b8b0-51d295a2d118" name="PRPP" sboTerm="SBO:0000247"> | |
| 2270 <notes> | |
| 2271 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2272 <p>kegg.compound: C00119</p> | |
| 2273 <p>bigg.metabolite: prpp</p> | |
| 2274 <p>chebi: CHEBI:17111</p> | |
| 2275 <p>pubchem.compound: 7339</p> | |
| 2276 <p>metanetx.chemical: MNXM91</p> | |
| 2277 <p>formula: C5H8O14P3</p> | |
| 2278 <p>charge: -5</p> | |
| 2279 </body> | |
| 2280 </notes> | |
| 2281 <annotation> | |
| 2282 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2283 <rdf:Description rdf:about="#_1c326a8e-e821-4f60-b8b0-51d295a2d118"> | |
| 2284 <bqbiol:is> | |
| 2285 <rdf:Bag> | |
| 2286 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00119"/> | |
| 2287 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/prpp"/> | |
| 2288 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17111"/> | |
| 2289 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/7339"/> | |
| 2290 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM91"/> | |
| 2291 </rdf:Bag> | |
| 2292 </bqbiol:is> | |
| 2293 </rdf:Description> | |
| 2294 </rdf:RDF> | |
| 2295 </annotation> | |
| 2296 </species> | |
| 2297 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C5H9O7P" hasOnlySubstanceUnits="true" id="M_m00639c" initialConcentration="0" metaid="_669cde35-0c63-4dca-9a0d-3b24adb00ab7" name="2-deoxy-D-ribose-1-phosphate" sboTerm="SBO:0000247"> | |
| 2298 <notes> | |
| 2299 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2300 <p>kegg.compound: C00672</p> | |
| 2301 <p>bigg.metabolite: 2dr1p</p> | |
| 2302 <p>chebi: CHEBI:28542</p> | |
| 2303 <p>pubchem.compound: 5460448</p> | |
| 2304 <p>metanetx.chemical: MNXM789</p> | |
| 2305 <p>formula: C5H9O7P</p> | |
| 2306 <p>charge: -2</p> | |
| 2307 </body> | |
| 2308 </notes> | |
| 2309 <annotation> | |
| 2310 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2311 <rdf:Description rdf:about="#_669cde35-0c63-4dca-9a0d-3b24adb00ab7"> | |
| 2312 <bqbiol:is> | |
| 2313 <rdf:Bag> | |
| 2314 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00672"/> | |
| 2315 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/2dr1p"/> | |
| 2316 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:28542"/> | |
| 2317 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/5460448"/> | |
| 2318 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM789"/> | |
| 2319 </rdf:Bag> | |
| 2320 </bqbiol:is> | |
| 2321 </rdf:Description> | |
| 2322 </rdf:RDF> | |
| 2323 </annotation> | |
| 2324 </species> | |
| 2325 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C15H22N2O17P2" hasOnlySubstanceUnits="true" id="M_m03107c" initialConcentration="0" metaid="_13becef8-df25-45f6-b797-6efd47ae03e2" name="UDP-galactose" sboTerm="SBO:0000247"> | |
| 2326 <notes> | |
| 2327 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2328 <p>kegg.compound: C00052</p> | |
| 2329 <p>hmdb: HMDB00302</p> | |
| 2330 <p>bigg.metabolite: udpgal</p> | |
| 2331 <p>chebi: CHEBI:67119</p> | |
| 2332 <p>pubchem.compound: 18068</p> | |
| 2333 <p>metanetx.chemical: MNXM89795</p> | |
| 2334 <p>formula: C15H22N2O17P2</p> | |
| 2335 <p>charge: -2</p> | |
| 2336 </body> | |
| 2337 </notes> | |
| 2338 <annotation> | |
| 2339 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2340 <rdf:Description rdf:about="#_13becef8-df25-45f6-b797-6efd47ae03e2"> | |
| 2341 <bqbiol:is> | |
| 2342 <rdf:Bag> | |
| 2343 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00052"/> | |
| 2344 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00302"/> | |
| 2345 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/udpgal"/> | |
| 2346 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:67119"/> | |
| 2347 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/18068"/> | |
| 2348 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM89795"/> | |
| 2349 </rdf:Bag> | |
| 2350 </bqbiol:is> | |
| 2351 </rdf:Description> | |
| 2352 </rdf:RDF> | |
| 2353 </annotation> | |
| 2354 </species> | |
| 2355 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-4" fbc:chemicalFormula="C6H10O12P2" hasOnlySubstanceUnits="true" id="M_m02955c" initialConcentration="0" metaid="_8cb2adcf-2881-4f20-8029-273b42f851bb" name="tagatose-1,6-bisphosphate" sboTerm="SBO:0000247"> | |
| 2356 <notes> | |
| 2357 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2358 <p>kegg.compound: C03785</p> | |
| 2359 <p>chebi: CHEBI:4250</p> | |
| 2360 <p>pubchem.compound: 440117</p> | |
| 2361 <p>metanetx.chemical: MNXM1324 || MNXM164715</p> | |
| 2362 <p>formula: C6H10O12P2</p> | |
| 2363 <p>charge: -4</p> | |
| 2364 </body> | |
| 2365 </notes> | |
| 2366 <annotation> | |
| 2367 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2368 <rdf:Description rdf:about="#_8cb2adcf-2881-4f20-8029-273b42f851bb"> | |
| 2369 <bqbiol:is> | |
| 2370 <rdf:Bag> | |
| 2371 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C03785"/> | |
| 2372 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:4250"/> | |
| 2373 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/440117"/> | |
| 2374 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM1324"/> | |
| 2375 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM164715"/> | |
| 2376 </rdf:Bag> | |
| 2377 </bqbiol:is> | |
| 2378 </rdf:Description> | |
| 2379 </rdf:RDF> | |
| 2380 </annotation> | |
| 2381 </species> | |
| 2382 <species boundaryCondition="false" compartment="g" constant="false" fbc:charge="-2" fbc:chemicalFormula="C15H22N2O17P2" hasOnlySubstanceUnits="true" id="M_m03107g" initialConcentration="0" metaid="def6fe8a-f42f-410d-9563-fee60d2fb154" name="UDP-galactose" sboTerm="SBO:0000247"> | |
| 2383 <notes> | |
| 2384 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2385 <p>kegg.compound: C00052</p> | |
| 2386 <p>hmdb: HMDB00302</p> | |
| 2387 <p>bigg.metabolite: udpgal</p> | |
| 2388 <p>chebi: CHEBI:67119</p> | |
| 2389 <p>pubchem.compound: 18068</p> | |
| 2390 <p>metanetx.chemical: MNXM89795</p> | |
| 2391 <p>formula: C15H22N2O17P2</p> | |
| 2392 <p>charge: -2</p> | |
| 2393 </body> | |
| 2394 </notes> | |
| 2395 <annotation> | |
| 2396 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2397 <rdf:Description rdf:about="#def6fe8a-f42f-410d-9563-fee60d2fb154"> | |
| 2398 <bqbiol:is> | |
| 2399 <rdf:Bag> | |
| 2400 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00052"/> | |
| 2401 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00302"/> | |
| 2402 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/udpgal"/> | |
| 2403 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:67119"/> | |
| 2404 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/18068"/> | |
| 2405 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM89795"/> | |
| 2406 </rdf:Bag> | |
| 2407 </bqbiol:is> | |
| 2408 </rdf:Description> | |
| 2409 </rdf:RDF> | |
| 2410 </annotation> | |
| 2411 </species> | |
| 2412 <species boundaryCondition="false" compartment="r" constant="false" fbc:charge="-2" fbc:chemicalFormula="C5H9O8P" hasOnlySubstanceUnits="true" id="M_m02846r" initialConcentration="0" metaid="_627f203c-3273-472d-98be-2227cb9aa716" name="ribulose-5-phosphate" sboTerm="SBO:0000247"> | |
| 2413 <notes> | |
| 2414 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2415 <p>kegg.compound: C00199</p> | |
| 2416 <p>bigg.metabolite: ru5p__D</p> | |
| 2417 <p>chebi: CHEBI:17363</p> | |
| 2418 <p>pubchem.compound: 439184</p> | |
| 2419 <p>metanetx.chemical: MNXM145 || MNXM186</p> | |
| 2420 <p>formula: C5H9O8P</p> | |
| 2421 <p>charge: -2</p> | |
| 2422 </body> | |
| 2423 </notes> | |
| 2424 <annotation> | |
| 2425 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2426 <rdf:Description rdf:about="#_627f203c-3273-472d-98be-2227cb9aa716"> | |
| 2427 <bqbiol:is> | |
| 2428 <rdf:Bag> | |
| 2429 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00199"/> | |
| 2430 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/ru5p__D"/> | |
| 2431 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17363"/> | |
| 2432 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/439184"/> | |
| 2433 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM145"/> | |
| 2434 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM186"/> | |
| 2435 </rdf:Bag> | |
| 2436 </bqbiol:is> | |
| 2437 </rdf:Description> | |
| 2438 </rdf:RDF> | |
| 2439 </annotation> | |
| 2440 </species> | |
| 2441 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H12O5" hasOnlySubstanceUnits="true" id="M_m02373c" initialConcentration="0" metaid="_6b685091-21fd-4e43-8051-0606e34176e9" name="L-fuculose" sboTerm="SBO:0000247"> | |
| 2442 <notes> | |
| 2443 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2444 <p>kegg.compound: C01721</p> | |
| 2445 <p>chebi: CHEBI:17617</p> | |
| 2446 <p>pubchem.compound: 6857362</p> | |
| 2447 <p>metanetx.chemical: MNXM1748</p> | |
| 2448 <p>formula: C6H12O5</p> | |
| 2449 </body> | |
| 2450 </notes> | |
| 2451 <annotation> | |
| 2452 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2453 <rdf:Description rdf:about="#_6b685091-21fd-4e43-8051-0606e34176e9"> | |
| 2454 <bqbiol:is> | |
| 2455 <rdf:Bag> | |
| 2456 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01721"/> | |
| 2457 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17617"/> | |
| 2458 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/6857362"/> | |
| 2459 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM1748"/> | |
| 2460 </rdf:Bag> | |
| 2461 </bqbiol:is> | |
| 2462 </rdf:Description> | |
| 2463 </rdf:RDF> | |
| 2464 </annotation> | |
| 2465 </species> | |
| 2466 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H12O6" hasOnlySubstanceUnits="true" id="M_m02453c" initialConcentration="0" metaid="_387d9eaf-8114-454d-9cbb-b68867f9fd37" name="mannose" sboTerm="SBO:0000247"> | |
| 2467 <notes> | |
| 2468 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2469 <p>kegg.compound: C00159</p> | |
| 2470 <p>hmdb: HMDB00169</p> | |
| 2471 <p>bigg.metabolite: man</p> | |
| 2472 <p>chebi: CHEBI:4208</p> | |
| 2473 <p>pubchem.compound: 18950</p> | |
| 2474 <p>metanetx.chemical: MNXM182</p> | |
| 2475 <p>formula: C6H12O6</p> | |
| 2476 </body> | |
| 2477 </notes> | |
| 2478 <annotation> | |
| 2479 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2480 <rdf:Description rdf:about="#_387d9eaf-8114-454d-9cbb-b68867f9fd37"> | |
| 2481 <bqbiol:is> | |
| 2482 <rdf:Bag> | |
| 2483 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00159"/> | |
| 2484 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00169"/> | |
| 2485 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/man"/> | |
| 2486 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:4208"/> | |
| 2487 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/18950"/> | |
| 2488 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM182"/> | |
| 2489 </rdf:Bag> | |
| 2490 </bqbiol:is> | |
| 2491 </rdf:Description> | |
| 2492 </rdf:RDF> | |
| 2493 </annotation> | |
| 2494 </species> | |
| 2495 <species boundaryCondition="false" compartment="s" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H10O6" hasOnlySubstanceUnits="true" id="M_m00810s" initialConcentration="0" metaid="_888b4b49-c5cf-4b3d-ae82-cbfdc5192782" name="3-keto-beta-D-galactose" sboTerm="SBO:0000247"> | |
| 2496 <notes> | |
| 2497 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2498 <p>kegg.compound: C05394</p> | |
| 2499 <p>chebi: CHEBI:27453</p> | |
| 2500 <p>pubchem.compound: 440653</p> | |
| 2501 <p>metanetx.chemical: MNXM4339</p> | |
| 2502 <p>formula: C6H10O6</p> | |
| 2503 </body> | |
| 2504 </notes> | |
| 2505 <annotation> | |
| 2506 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2507 <rdf:Description rdf:about="#_888b4b49-c5cf-4b3d-ae82-cbfdc5192782"> | |
| 2508 <bqbiol:is> | |
| 2509 <rdf:Bag> | |
| 2510 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05394"/> | |
| 2511 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:27453"/> | |
| 2512 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/440653"/> | |
| 2513 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM4339"/> | |
| 2514 </rdf:Bag> | |
| 2515 </bqbiol:is> | |
| 2516 </rdf:Description> | |
| 2517 </rdf:RDF> | |
| 2518 </annotation> | |
| 2519 </species> | |
| 2520 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H10O5" hasOnlySubstanceUnits="true" id="M_m02425c" initialConcentration="0" metaid="_1ec20d61-01eb-4ae4-b50f-08dfa29f333c" name="L-xylulose" sboTerm="SBO:0000247"> | |
| 2521 <notes> | |
| 2522 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2523 <p>kegg.compound: C00312</p> | |
| 2524 <p>hmdb: HMDB00751</p> | |
| 2525 <p>bigg.metabolite: xylu__L</p> | |
| 2526 <p>chebi: CHEBI:17399</p> | |
| 2527 <p>inchi: InChI=1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h3,5-8,10H,1-2H2/t3-,5+/m0/s1</p> | |
| 2528 <p>pubchem.compound: 22253</p> | |
| 2529 <p>metanetx.chemical: MNXM597</p> | |
| 2530 <p>formula: C5H10O5</p> | |
| 2531 </body> | |
| 2532 </notes> | |
| 2533 <annotation> | |
| 2534 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2535 <rdf:Description rdf:about="#_1ec20d61-01eb-4ae4-b50f-08dfa29f333c"> | |
| 2536 <bqbiol:is> | |
| 2537 <rdf:Bag> | |
| 2538 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00312"/> | |
| 2539 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00751"/> | |
| 2540 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/xylu__L"/> | |
| 2541 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17399"/> | |
| 2542 <rdf:li rdf:resource="https://identifiers.org/inchi/InChI=1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h3,5-8,10H,1-2H2/t3-,5+/m0/s1"/> | |
| 2543 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/22253"/> | |
| 2544 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM597"/> | |
| 2545 </rdf:Bag> | |
| 2546 </bqbiol:is> | |
| 2547 </rdf:Description> | |
| 2548 </rdf:RDF> | |
| 2549 </annotation> | |
| 2550 </species> | |
| 2551 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H12O6" hasOnlySubstanceUnits="true" id="M_m01910c" initialConcentration="0" metaid="_74a87466-9b69-4cc8-9d29-8036f2c76d6a" name="galactose" sboTerm="SBO:0000247"> | |
| 2552 <notes> | |
| 2553 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2554 <p>kegg.compound: C00984</p> | |
| 2555 <p>hmdb: HMDB00143</p> | |
| 2556 <p>bigg.metabolite: gal</p> | |
| 2557 <p>chebi: CHEBI:28061</p> | |
| 2558 <p>pubchem.compound: 439357</p> | |
| 2559 <p>metanetx.chemical: MNXM112 || MNXM390</p> | |
| 2560 <p>formula: C6H12O6</p> | |
| 2561 </body> | |
| 2562 </notes> | |
| 2563 <annotation> | |
| 2564 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2565 <rdf:Description rdf:about="#_74a87466-9b69-4cc8-9d29-8036f2c76d6a"> | |
| 2566 <bqbiol:is> | |
| 2567 <rdf:Bag> | |
| 2568 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00984"/> | |
| 2569 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00143"/> | |
| 2570 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/gal"/> | |
| 2571 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:28061"/> | |
| 2572 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/439357"/> | |
| 2573 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM112"/> | |
| 2574 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM390"/> | |
| 2575 </rdf:Bag> | |
| 2576 </bqbiol:is> | |
| 2577 </rdf:Description> | |
| 2578 </rdf:RDF> | |
| 2579 </annotation> | |
| 2580 </species> | |
| 2581 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="C9H11NO2" hasOnlySubstanceUnits="true" id="M_m02724c" initialConcentration="0" metaid="c4ed6ede-5c56-4346-acbd-7efd7f34b58b" name="phenylalanine" sboTerm="SBO:0000247"> | |
| 2582 <notes> | |
| 2583 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2584 <p>kegg.compound: C00079</p> | |
| 2585 <p>hmdb: HMDB00159</p> | |
| 2586 <p>bigg.metabolite: phe__L</p> | |
| 2587 <p>chebi: CHEBI:17295</p> | |
| 2588 <p>pubchem.compound: 6140</p> | |
| 2589 <p>metanetx.chemical: MNXM97</p> | |
| 2590 <p>formula: C9H11NO2</p> | |
| 2591 </body> | |
| 2592 </notes> | |
| 2593 <annotation> | |
| 2594 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2595 <rdf:Description rdf:about="#c4ed6ede-5c56-4346-acbd-7efd7f34b58b"> | |
| 2596 <bqbiol:is> | |
| 2597 <rdf:Bag> | |
| 2598 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00079"/> | |
| 2599 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00159"/> | |
| 2600 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/phe__L"/> | |
| 2601 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17295"/> | |
| 2602 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/6140"/> | |
| 2603 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM97"/> | |
| 2604 </rdf:Bag> | |
| 2605 </bqbiol:is> | |
| 2606 </rdf:Description> | |
| 2607 </rdf:RDF> | |
| 2608 </annotation> | |
| 2609 </species> | |
| 2610 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C5H9O8P" hasOnlySubstanceUnits="true" id="M_m02845c" initialConcentration="0" metaid="_7d86d6c1-f376-4349-a4ec-cc8fb8350868" name="ribose-5-phosphate" sboTerm="SBO:0000247"> | |
| 2611 <notes> | |
| 2612 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2613 <p>kegg.compound: C00117</p> | |
| 2614 <p>bigg.metabolite: r5p</p> | |
| 2615 <p>chebi: CHEBI:17797</p> | |
| 2616 <p>pubchem.compound: 440101</p> | |
| 2617 <p>metanetx.chemical: MNXM116 || MNXM15900</p> | |
| 2618 <p>formula: C5H9O8P</p> | |
| 2619 <p>charge: -2</p> | |
| 2620 </body> | |
| 2621 </notes> | |
| 2622 <annotation> | |
| 2623 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2624 <rdf:Description rdf:about="#_7d86d6c1-f376-4349-a4ec-cc8fb8350868"> | |
| 2625 <bqbiol:is> | |
| 2626 <rdf:Bag> | |
| 2627 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00117"/> | |
| 2628 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/r5p"/> | |
| 2629 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17797"/> | |
| 2630 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/440101"/> | |
| 2631 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM116"/> | |
| 2632 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM15900"/> | |
| 2633 </rdf:Bag> | |
| 2634 </bqbiol:is> | |
| 2635 </rdf:Description> | |
| 2636 </rdf:RDF> | |
| 2637 </annotation> | |
| 2638 </species> | |
| 2639 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-4" fbc:chemicalFormula="C9H12N3O14P3" hasOnlySubstanceUnits="true" id="M_m01623c" initialConcentration="0" metaid="b14f1569-0718-46ce-81e7-1b85790417ad" name="CTP" sboTerm="SBO:0000247"> | |
| 2640 <notes> | |
| 2641 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2642 <p>kegg.compound: C00063</p> | |
| 2643 <p>bigg.metabolite: ctp</p> | |
| 2644 <p>chebi: CHEBI:17677</p> | |
| 2645 <p>pubchem.compound: 6176</p> | |
| 2646 <p>metanetx.chemical: MNXM63</p> | |
| 2647 <p>formula: C9H12N3O14P3</p> | |
| 2648 <p>charge: -4</p> | |
| 2649 </body> | |
| 2650 </notes> | |
| 2651 <annotation> | |
| 2652 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2653 <rdf:Description rdf:about="#b14f1569-0718-46ce-81e7-1b85790417ad"> | |
| 2654 <bqbiol:is> | |
| 2655 <rdf:Bag> | |
| 2656 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00063"/> | |
| 2657 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/ctp"/> | |
| 2658 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17677"/> | |
| 2659 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/6176"/> | |
| 2660 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM63"/> | |
| 2661 </rdf:Bag> | |
| 2662 </bqbiol:is> | |
| 2663 </rdf:Description> | |
| 2664 </rdf:RDF> | |
| 2665 </annotation> | |
| 2666 </species> | |
| 2667 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C16H23N5O15P2" hasOnlySubstanceUnits="true" id="M_m01950c" initialConcentration="0" metaid="_945a262e-c045-4dfe-a70d-e948ad2a61ff" name="GDP-L-fucose" sboTerm="SBO:0000247"> | |
| 2668 <notes> | |
| 2669 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2670 <p>kegg.compound: C00325</p> | |
| 2671 <p>bigg.metabolite: gdpfuc</p> | |
| 2672 <p>chebi: CHEBI:17009</p> | |
| 2673 <p>pubchem.compound: 439211</p> | |
| 2674 <p>metanetx.chemical: MNXM193</p> | |
| 2675 <p>formula: C16H23N5O15P2</p> | |
| 2676 <p>charge: -2</p> | |
| 2677 </body> | |
| 2678 </notes> | |
| 2679 <annotation> | |
| 2680 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2681 <rdf:Description rdf:about="#_945a262e-c045-4dfe-a70d-e948ad2a61ff"> | |
| 2682 <bqbiol:is> | |
| 2683 <rdf:Bag> | |
| 2684 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00325"/> | |
| 2685 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/gdpfuc"/> | |
| 2686 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17009"/> | |
| 2687 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/439211"/> | |
| 2688 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM193"/> | |
| 2689 </rdf:Bag> | |
| 2690 </bqbiol:is> | |
| 2691 </rdf:Description> | |
| 2692 </rdf:RDF> | |
| 2693 </annotation> | |
| 2694 </species> | |
| 2695 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="C2H5NO2" hasOnlySubstanceUnits="true" id="M_m01986c" initialConcentration="0" metaid="_9866d694-865b-4df9-ab20-eb10d114f23c" name="glycine" sboTerm="SBO:0000247"> | |
| 2696 <notes> | |
| 2697 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2698 <p>kegg.compound: C00037</p> | |
| 2699 <p>hmdb: HMDB00123</p> | |
| 2700 <p>bigg.metabolite: gly</p> | |
| 2701 <p>chebi: CHEBI:15428</p> | |
| 2702 <p>inchi: InChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5)</p> | |
| 2703 <p>pubchem.compound: 750</p> | |
| 2704 <p>metanetx.chemical: MNXM29</p> | |
| 2705 <p>formula: C2H5NO2</p> | |
| 2706 </body> | |
| 2707 </notes> | |
| 2708 <annotation> | |
| 2709 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2710 <rdf:Description rdf:about="#_9866d694-865b-4df9-ab20-eb10d114f23c"> | |
| 2711 <bqbiol:is> | |
| 2712 <rdf:Bag> | |
| 2713 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00037"/> | |
| 2714 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00123"/> | |
| 2715 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/gly"/> | |
| 2716 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:15428"/> | |
| 2717 <rdf:li rdf:resource="https://identifiers.org/inchi/InChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5)"/> | |
| 2718 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/750"/> | |
| 2719 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM29"/> | |
| 2720 </rdf:Bag> | |
| 2721 </bqbiol:is> | |
| 2722 </rdf:Description> | |
| 2723 </rdf:RDF> | |
| 2724 </annotation> | |
| 2725 </species> | |
| 2726 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-3" fbc:chemicalFormula="C9H11N2O12P2" hasOnlySubstanceUnits="true" id="M_m03106c" initialConcentration="0" metaid="_97e640b3-1f1b-4e3b-abda-a1e2d84549fb" name="UDP" sboTerm="SBO:0000247"> | |
| 2727 <notes> | |
| 2728 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2729 <p>kegg.compound: C00015</p> | |
| 2730 <p>hmdb: HMDB00295</p> | |
| 2731 <p>bigg.metabolite: udp</p> | |
| 2732 <p>chebi: CHEBI:17659</p> | |
| 2733 <p>pubchem.compound: 6031</p> | |
| 2734 <p>metanetx.chemical: MNXM17</p> | |
| 2735 <p>formula: C9H11N2O12P2</p> | |
| 2736 <p>charge: -3</p> | |
| 2737 </body> | |
| 2738 </notes> | |
| 2739 <annotation> | |
| 2740 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2741 <rdf:Description rdf:about="#_97e640b3-1f1b-4e3b-abda-a1e2d84549fb"> | |
| 2742 <bqbiol:is> | |
| 2743 <rdf:Bag> | |
| 2744 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00015"/> | |
| 2745 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00295"/> | |
| 2746 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/udp"/> | |
| 2747 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17659"/> | |
| 2748 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/6031"/> | |
| 2749 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM17"/> | |
| 2750 </rdf:Bag> | |
| 2751 </bqbiol:is> | |
| 2752 </rdf:Description> | |
| 2753 </rdf:RDF> | |
| 2754 </annotation> | |
| 2755 </species> | |
| 2756 <species boundaryCondition="false" compartment="l" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H12O6" hasOnlySubstanceUnits="true" id="M_m01910l" initialConcentration="0" metaid="_76b653c7-d3c8-43c3-86cd-767b18a4ec92" name="galactose" sboTerm="SBO:0000247"> | |
| 2757 <notes> | |
| 2758 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2759 <p>kegg.compound: C00984</p> | |
| 2760 <p>hmdb: HMDB00143</p> | |
| 2761 <p>bigg.metabolite: gal</p> | |
| 2762 <p>chebi: CHEBI:28061</p> | |
| 2763 <p>pubchem.compound: 439357</p> | |
| 2764 <p>metanetx.chemical: MNXM112 || MNXM390</p> | |
| 2765 <p>formula: C6H12O6</p> | |
| 2766 </body> | |
| 2767 </notes> | |
| 2768 <annotation> | |
| 2769 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2770 <rdf:Description rdf:about="#_76b653c7-d3c8-43c3-86cd-767b18a4ec92"> | |
| 2771 <bqbiol:is> | |
| 2772 <rdf:Bag> | |
| 2773 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00984"/> | |
| 2774 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00143"/> | |
| 2775 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/gal"/> | |
| 2776 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:28061"/> | |
| 2777 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/439357"/> | |
| 2778 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM112"/> | |
| 2779 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM390"/> | |
| 2780 </rdf:Bag> | |
| 2781 </bqbiol:is> | |
| 2782 </rdf:Description> | |
| 2783 </rdf:RDF> | |
| 2784 </annotation> | |
| 2785 </species> | |
| 2786 <species boundaryCondition="false" compartment="s" constant="false" fbc:charge="0" fbc:chemicalFormula="C12H22O11" hasOnlySubstanceUnits="true" id="M_m02332s" initialConcentration="0" metaid="acda4521-1f6a-4dff-8902-9ff667fc71dd" name="lactose" sboTerm="SBO:0000247"> | |
| 2787 <notes> | |
| 2788 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2789 <p>kegg.compound: C00243</p> | |
| 2790 <p>hmdb: HMDB00186</p> | |
| 2791 <p>bigg.metabolite: lcts</p> | |
| 2792 <p>chebi: CHEBI:36219</p> | |
| 2793 <p>pubchem.compound: 84571</p> | |
| 2794 <p>metanetx.chemical: MNXM362</p> | |
| 2795 <p>formula: C12H22O11</p> | |
| 2796 </body> | |
| 2797 </notes> | |
| 2798 <annotation> | |
| 2799 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2800 <rdf:Description rdf:about="#acda4521-1f6a-4dff-8902-9ff667fc71dd"> | |
| 2801 <bqbiol:is> | |
| 2802 <rdf:Bag> | |
| 2803 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00243"/> | |
| 2804 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00186"/> | |
| 2805 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/lcts"/> | |
| 2806 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:36219"/> | |
| 2807 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/84571"/> | |
| 2808 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM362"/> | |
| 2809 </rdf:Bag> | |
| 2810 </bqbiol:is> | |
| 2811 </rdf:Description> | |
| 2812 </rdf:RDF> | |
| 2813 </annotation> | |
| 2814 </species> | |
| 2815 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H12O5" hasOnlySubstanceUnits="true" id="M_m01159c" initialConcentration="0" metaid="_5d92060a-34c2-413d-a5c9-b2061168b482" name="6-deoxy-L-galactose" sboTerm="SBO:0000247"> | |
| 2816 <notes> | |
| 2817 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2818 <p>kegg.compound: C01019</p> | |
| 2819 <p>hmdb: HMDB00174</p> | |
| 2820 <p>bigg.metabolite: fuc__L</p> | |
| 2821 <p>chebi: CHEBI:2181</p> | |
| 2822 <p>pubchem.compound: 17106</p> | |
| 2823 <p>metanetx.chemical: MNXM40586 || MNXM659</p> | |
| 2824 <p>formula: C6H12O5</p> | |
| 2825 </body> | |
| 2826 </notes> | |
| 2827 <annotation> | |
| 2828 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2829 <rdf:Description rdf:about="#_5d92060a-34c2-413d-a5c9-b2061168b482"> | |
| 2830 <bqbiol:is> | |
| 2831 <rdf:Bag> | |
| 2832 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01019"/> | |
| 2833 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00174"/> | |
| 2834 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/fuc__L"/> | |
| 2835 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:2181"/> | |
| 2836 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/17106"/> | |
| 2837 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM40586"/> | |
| 2838 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM659"/> | |
| 2839 </rdf:Bag> | |
| 2840 </bqbiol:is> | |
| 2841 </rdf:Description> | |
| 2842 </rdf:RDF> | |
| 2843 </annotation> | |
| 2844 </species> | |
| 2845 <species boundaryCondition="false" compartment="g" constant="false" fbc:charge="-3" fbc:chemicalFormula="C9H11N2O12P2" hasOnlySubstanceUnits="true" id="M_m03106g" initialConcentration="0" metaid="_00d6b0f7-372e-4bcd-b4e4-734060396c74" name="UDP" sboTerm="SBO:0000247"> | |
| 2846 <notes> | |
| 2847 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2848 <p>kegg.compound: C00015</p> | |
| 2849 <p>hmdb: HMDB00295</p> | |
| 2850 <p>bigg.metabolite: udp</p> | |
| 2851 <p>chebi: CHEBI:17659</p> | |
| 2852 <p>pubchem.compound: 6031</p> | |
| 2853 <p>metanetx.chemical: MNXM17</p> | |
| 2854 <p>formula: C9H11N2O12P2</p> | |
| 2855 <p>charge: -3</p> | |
| 2856 </body> | |
| 2857 </notes> | |
| 2858 <annotation> | |
| 2859 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2860 <rdf:Description rdf:about="#_00d6b0f7-372e-4bcd-b4e4-734060396c74"> | |
| 2861 <bqbiol:is> | |
| 2862 <rdf:Bag> | |
| 2863 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00015"/> | |
| 2864 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00295"/> | |
| 2865 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/udp"/> | |
| 2866 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17659"/> | |
| 2867 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/6031"/> | |
| 2868 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM17"/> | |
| 2869 </rdf:Bag> | |
| 2870 </bqbiol:is> | |
| 2871 </rdf:Description> | |
| 2872 </rdf:RDF> | |
| 2873 </annotation> | |
| 2874 </species> | |
| 2875 <species boundaryCondition="false" compartment="s" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H12O6" hasOnlySubstanceUnits="true" id="M_m01910s" initialConcentration="0" metaid="_3719fc9b-15c2-48f2-af95-91380ed8985c" name="galactose" sboTerm="SBO:0000247"> | |
| 2876 <notes> | |
| 2877 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2878 <p>kegg.compound: C00984</p> | |
| 2879 <p>hmdb: HMDB00143</p> | |
| 2880 <p>bigg.metabolite: gal</p> | |
| 2881 <p>chebi: CHEBI:28061</p> | |
| 2882 <p>pubchem.compound: 439357</p> | |
| 2883 <p>metanetx.chemical: MNXM112 || MNXM390</p> | |
| 2884 <p>formula: C6H12O6</p> | |
| 2885 </body> | |
| 2886 </notes> | |
| 2887 <annotation> | |
| 2888 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2889 <rdf:Description rdf:about="#_3719fc9b-15c2-48f2-af95-91380ed8985c"> | |
| 2890 <bqbiol:is> | |
| 2891 <rdf:Bag> | |
| 2892 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00984"/> | |
| 2893 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00143"/> | |
| 2894 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/gal"/> | |
| 2895 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:28061"/> | |
| 2896 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/439357"/> | |
| 2897 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM112"/> | |
| 2898 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM390"/> | |
| 2899 </rdf:Bag> | |
| 2900 </bqbiol:is> | |
| 2901 </rdf:Description> | |
| 2902 </rdf:RDF> | |
| 2903 </annotation> | |
| 2904 </species> | |
| 2905 <species boundaryCondition="false" compartment="r" constant="false" fbc:charge="-2" fbc:chemicalFormula="C5H9O8P" hasOnlySubstanceUnits="true" id="M_m02845r" initialConcentration="0" metaid="c375b7d8-5974-4e81-bae4-6ffd881176d0" name="ribose-5-phosphate" sboTerm="SBO:0000247"> | |
| 2906 <notes> | |
| 2907 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2908 <p>kegg.compound: C00117</p> | |
| 2909 <p>bigg.metabolite: r5p</p> | |
| 2910 <p>chebi: CHEBI:17797</p> | |
| 2911 <p>pubchem.compound: 440101</p> | |
| 2912 <p>metanetx.chemical: MNXM116 || MNXM15900</p> | |
| 2913 <p>formula: C5H9O8P</p> | |
| 2914 <p>charge: -2</p> | |
| 2915 </body> | |
| 2916 </notes> | |
| 2917 <annotation> | |
| 2918 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2919 <rdf:Description rdf:about="#c375b7d8-5974-4e81-bae4-6ffd881176d0"> | |
| 2920 <bqbiol:is> | |
| 2921 <rdf:Bag> | |
| 2922 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00117"/> | |
| 2923 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/r5p"/> | |
| 2924 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17797"/> | |
| 2925 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/440101"/> | |
| 2926 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM116"/> | |
| 2927 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM15900"/> | |
| 2928 </rdf:Bag> | |
| 2929 </bqbiol:is> | |
| 2930 </rdf:Description> | |
| 2931 </rdf:RDF> | |
| 2932 </annotation> | |
| 2933 </species> | |
| 2934 <species boundaryCondition="false" compartment="l" constant="false" fbc:charge="0" fbc:chemicalFormula="C12H22O11" hasOnlySubstanceUnits="true" id="M_m02332l" initialConcentration="0" metaid="_18aca9f4-b145-4984-986a-5b4334761e06" name="lactose" sboTerm="SBO:0000247"> | |
| 2935 <notes> | |
| 2936 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2937 <p>kegg.compound: C00243</p> | |
| 2938 <p>hmdb: HMDB00186</p> | |
| 2939 <p>bigg.metabolite: lcts</p> | |
| 2940 <p>chebi: CHEBI:36219</p> | |
| 2941 <p>pubchem.compound: 84571</p> | |
| 2942 <p>metanetx.chemical: MNXM362</p> | |
| 2943 <p>formula: C12H22O11</p> | |
| 2944 </body> | |
| 2945 </notes> | |
| 2946 <annotation> | |
| 2947 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2948 <rdf:Description rdf:about="#_18aca9f4-b145-4984-986a-5b4334761e06"> | |
| 2949 <bqbiol:is> | |
| 2950 <rdf:Bag> | |
| 2951 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00243"/> | |
| 2952 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00186"/> | |
| 2953 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/lcts"/> | |
| 2954 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:36219"/> | |
| 2955 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/84571"/> | |
| 2956 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM362"/> | |
| 2957 </rdf:Bag> | |
| 2958 </bqbiol:is> | |
| 2959 </rdf:Description> | |
| 2960 </rdf:RDF> | |
| 2961 </annotation> | |
| 2962 </species> | |
| 2963 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C6H11O8P" hasOnlySubstanceUnits="true" id="M_m02372c" initialConcentration="0" metaid="d64f4610-d8ec-4669-a9cf-fd3e6e1a7f44" name="L-fucose-1-phosphate" sboTerm="SBO:0000247"> | |
| 2964 <notes> | |
| 2965 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2966 <p>kegg.compound: C02985</p> | |
| 2967 <p>bigg.metabolite: fuc1p__L</p> | |
| 2968 <p>chebi: CHEBI:28319</p> | |
| 2969 <p>pubchem.compound: 439871</p> | |
| 2970 <p>metanetx.chemical: MNXM1727</p> | |
| 2971 <p>formula: C6H11O8P</p> | |
| 2972 <p>charge: -2</p> | |
| 2973 </body> | |
| 2974 </notes> | |
| 2975 <annotation> | |
| 2976 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 2977 <rdf:Description rdf:about="#d64f4610-d8ec-4669-a9cf-fd3e6e1a7f44"> | |
| 2978 <bqbiol:is> | |
| 2979 <rdf:Bag> | |
| 2980 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02985"/> | |
| 2981 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/fuc1p__L"/> | |
| 2982 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:28319"/> | |
| 2983 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/439871"/> | |
| 2984 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM1727"/> | |
| 2985 </rdf:Bag> | |
| 2986 </bqbiol:is> | |
| 2987 </rdf:Description> | |
| 2988 </rdf:RDF> | |
| 2989 </annotation> | |
| 2990 </species> | |
| 2991 <species boundaryCondition="false" compartment="g" constant="false" fbc:charge="0" fbc:chemicalFormula="C12H22O11" hasOnlySubstanceUnits="true" id="M_m02332g" initialConcentration="0" metaid="f1b8e0f2-028c-4545-a1f4-bf750504814b" name="lactose" sboTerm="SBO:0000247"> | |
| 2992 <notes> | |
| 2993 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 2994 <p>kegg.compound: C00243</p> | |
| 2995 <p>hmdb: HMDB00186</p> | |
| 2996 <p>bigg.metabolite: lcts</p> | |
| 2997 <p>chebi: CHEBI:36219</p> | |
| 2998 <p>pubchem.compound: 84571</p> | |
| 2999 <p>metanetx.chemical: MNXM362</p> | |
| 3000 <p>formula: C12H22O11</p> | |
| 3001 </body> | |
| 3002 </notes> | |
| 3003 <annotation> | |
| 3004 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3005 <rdf:Description rdf:about="#f1b8e0f2-028c-4545-a1f4-bf750504814b"> | |
| 3006 <bqbiol:is> | |
| 3007 <rdf:Bag> | |
| 3008 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00243"/> | |
| 3009 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00186"/> | |
| 3010 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/lcts"/> | |
| 3011 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:36219"/> | |
| 3012 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/84571"/> | |
| 3013 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM362"/> | |
| 3014 </rdf:Bag> | |
| 3015 </bqbiol:is> | |
| 3016 </rdf:Description> | |
| 3017 </rdf:RDF> | |
| 3018 </annotation> | |
| 3019 </species> | |
| 3020 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="HO4P" hasOnlySubstanceUnits="true" id="M_m02751c" initialConcentration="0" metaid="c289024b-4290-4c49-b993-7aacf17d0e1b" name="Pi" sboTerm="SBO:0000247"> | |
| 3021 <notes> | |
| 3022 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3023 <p>kegg.compound: C00009</p> | |
| 3024 <p>bigg.metabolite: pi</p> | |
| 3025 <p>chebi: CHEBI:18367</p> | |
| 3026 <p>pubchem.compound: 1004</p> | |
| 3027 <p>metanetx.chemical: MNXM9</p> | |
| 3028 <p>formula: HO4P</p> | |
| 3029 <p>charge: -2</p> | |
| 3030 </body> | |
| 3031 </notes> | |
| 3032 <annotation> | |
| 3033 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3034 <rdf:Description rdf:about="#c289024b-4290-4c49-b993-7aacf17d0e1b"> | |
| 3035 <bqbiol:is> | |
| 3036 <rdf:Bag> | |
| 3037 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00009"/> | |
| 3038 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/pi"/> | |
| 3039 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:18367"/> | |
| 3040 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/1004"/> | |
| 3041 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM9"/> | |
| 3042 </rdf:Bag> | |
| 3043 </bqbiol:is> | |
| 3044 </rdf:Description> | |
| 3045 </rdf:RDF> | |
| 3046 </annotation> | |
| 3047 </species> | |
| 3048 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C7H13O10P" hasOnlySubstanceUnits="true" id="M_m02884c" initialConcentration="0" metaid="_3392db14-e8b9-4ab8-9f26-2c9ecda86328" name="sedoheptulose-7-phosphate" sboTerm="SBO:0000247"> | |
| 3049 <notes> | |
| 3050 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3051 <p>kegg.compound: C05382</p> | |
| 3052 <p>bigg.metabolite: s7p</p> | |
| 3053 <p>chebi: CHEBI:15721</p> | |
| 3054 <p>pubchem.compound: 22833559</p> | |
| 3055 <p>metanetx.chemical: MNXM271</p> | |
| 3056 <p>formula: C7H13O10P</p> | |
| 3057 <p>charge: -2</p> | |
| 3058 </body> | |
| 3059 </notes> | |
| 3060 <annotation> | |
| 3061 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3062 <rdf:Description rdf:about="#_3392db14-e8b9-4ab8-9f26-2c9ecda86328"> | |
| 3063 <bqbiol:is> | |
| 3064 <rdf:Bag> | |
| 3065 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C05382"/> | |
| 3066 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/s7p"/> | |
| 3067 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:15721"/> | |
| 3068 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/22833559"/> | |
| 3069 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM271"/> | |
| 3070 </rdf:Bag> | |
| 3071 </bqbiol:is> | |
| 3072 </rdf:Description> | |
| 3073 </rdf:RDF> | |
| 3074 </annotation> | |
| 3075 </species> | |
| 3076 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C5H9O8P" hasOnlySubstanceUnits="true" id="M_m02844c" initialConcentration="0" metaid="_43c0bdf1-d836-4a9f-921f-2ac7f20fb6bf" name="ribose-1-phosphate" sboTerm="SBO:0000247"> | |
| 3077 <notes> | |
| 3078 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3079 <p>kegg.compound: C00620</p> | |
| 3080 <p>bigg.metabolite: r1p</p> | |
| 3081 <p>chebi: CHEBI:35425</p> | |
| 3082 <p>pubchem.compound: 439236</p> | |
| 3083 <p>metanetx.chemical: MNXM295</p> | |
| 3084 <p>formula: C5H9O8P</p> | |
| 3085 <p>charge: -2</p> | |
| 3086 </body> | |
| 3087 </notes> | |
| 3088 <annotation> | |
| 3089 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3090 <rdf:Description rdf:about="#_43c0bdf1-d836-4a9f-921f-2ac7f20fb6bf"> | |
| 3091 <bqbiol:is> | |
| 3092 <rdf:Bag> | |
| 3093 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00620"/> | |
| 3094 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/r1p"/> | |
| 3095 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:35425"/> | |
| 3096 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/439236"/> | |
| 3097 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM295"/> | |
| 3098 </rdf:Bag> | |
| 3099 </bqbiol:is> | |
| 3100 </rdf:Description> | |
| 3101 </rdf:RDF> | |
| 3102 </annotation> | |
| 3103 </species> | |
| 3104 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C6H9O9P" hasOnlySubstanceUnits="true" id="M_m01961c" initialConcentration="0" metaid="_24aa4d4c-882c-444d-b1e4-8191e7fe20d9" name="glucono-1,5-lactone-6-phosphate" sboTerm="SBO:0000247"> | |
| 3105 <notes> | |
| 3106 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3107 <p>kegg.compound: C01236</p> | |
| 3108 <p>bigg.metabolite: 6pgl</p> | |
| 3109 <p>chebi: CHEBI:16938</p> | |
| 3110 <p>pubchem.compound: 439452</p> | |
| 3111 <p>metanetx.chemical: MNXM429</p> | |
| 3112 <p>formula: C6H9O9P</p> | |
| 3113 <p>charge: -2</p> | |
| 3114 </body> | |
| 3115 </notes> | |
| 3116 <annotation> | |
| 3117 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3118 <rdf:Description rdf:about="#_24aa4d4c-882c-444d-b1e4-8191e7fe20d9"> | |
| 3119 <bqbiol:is> | |
| 3120 <rdf:Bag> | |
| 3121 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01236"/> | |
| 3122 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/6pgl"/> | |
| 3123 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:16938"/> | |
| 3124 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/439452"/> | |
| 3125 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM429"/> | |
| 3126 </rdf:Bag> | |
| 3127 </bqbiol:is> | |
| 3128 </rdf:Description> | |
| 3129 </rdf:RDF> | |
| 3130 </annotation> | |
| 3131 </species> | |
| 3132 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H12O6" hasOnlySubstanceUnits="true" id="M_m01840c" initialConcentration="0" metaid="_96ceef6d-b39c-45dc-a853-bd5aa0e6c22e" name="fructose" sboTerm="SBO:0000247"> | |
| 3133 <notes> | |
| 3134 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3135 <p>kegg.compound: C02336</p> | |
| 3136 <p>hmdb: HMDB00660</p> | |
| 3137 <p>bigg.metabolite: fru</p> | |
| 3138 <p>chebi: CHEBI:28645</p> | |
| 3139 <p>pubchem.compound: 439709</p> | |
| 3140 <p>metanetx.chemical: MNXM175</p> | |
| 3141 <p>formula: C6H12O6</p> | |
| 3142 </body> | |
| 3143 </notes> | |
| 3144 <annotation> | |
| 3145 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3146 <rdf:Description rdf:about="#_96ceef6d-b39c-45dc-a853-bd5aa0e6c22e"> | |
| 3147 <bqbiol:is> | |
| 3148 <rdf:Bag> | |
| 3149 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02336"/> | |
| 3150 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00660"/> | |
| 3151 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/fru"/> | |
| 3152 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:28645"/> | |
| 3153 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/439709"/> | |
| 3154 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM175"/> | |
| 3155 </rdf:Bag> | |
| 3156 </bqbiol:is> | |
| 3157 </rdf:Description> | |
| 3158 </rdf:RDF> | |
| 3159 </annotation> | |
| 3160 </species> | |
| 3161 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-3" fbc:chemicalFormula="HO7P2" hasOnlySubstanceUnits="true" id="M_m02759c" initialConcentration="0" metaid="_4cb8da7d-c29f-4ff0-92dd-f4180921a1f0" name="PPi" sboTerm="SBO:0000247"> | |
| 3162 <notes> | |
| 3163 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3164 <p>kegg.compound: C00013</p> | |
| 3165 <p>hmdb: HMDB00250</p> | |
| 3166 <p>bigg.metabolite: ppi</p> | |
| 3167 <p>chebi: CHEBI:18361</p> | |
| 3168 <p>pubchem.compound: 644102</p> | |
| 3169 <p>metanetx.chemical: MNXM11</p> | |
| 3170 <p>formula: HO7P2</p> | |
| 3171 <p>charge: -3</p> | |
| 3172 </body> | |
| 3173 </notes> | |
| 3174 <annotation> | |
| 3175 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3176 <rdf:Description rdf:about="#_4cb8da7d-c29f-4ff0-92dd-f4180921a1f0"> | |
| 3177 <bqbiol:is> | |
| 3178 <rdf:Bag> | |
| 3179 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00013"/> | |
| 3180 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00250"/> | |
| 3181 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/ppi"/> | |
| 3182 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:18361"/> | |
| 3183 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/644102"/> | |
| 3184 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM11"/> | |
| 3185 </rdf:Bag> | |
| 3186 </bqbiol:is> | |
| 3187 </rdf:Description> | |
| 3188 </rdf:RDF> | |
| 3189 </annotation> | |
| 3190 </species> | |
| 3191 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C3H5O6P" hasOnlySubstanceUnits="true" id="M_m01690c" initialConcentration="0" metaid="fe9d95be-b2e5-4c74-9c43-983a56005d1e" name="DHAP" sboTerm="SBO:0000247"> | |
| 3192 <notes> | |
| 3193 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3194 <p>kegg.compound: C00111</p> | |
| 3195 <p>bigg.metabolite: dhap</p> | |
| 3196 <p>chebi: CHEBI:16108</p> | |
| 3197 <p>pubchem.compound: 668</p> | |
| 3198 <p>metanetx.chemical: MNXM77</p> | |
| 3199 <p>formula: C3H5O6P</p> | |
| 3200 <p>charge: -2</p> | |
| 3201 </body> | |
| 3202 </notes> | |
| 3203 <annotation> | |
| 3204 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3205 <rdf:Description rdf:about="#fe9d95be-b2e5-4c74-9c43-983a56005d1e"> | |
| 3206 <bqbiol:is> | |
| 3207 <rdf:Bag> | |
| 3208 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00111"/> | |
| 3209 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/dhap"/> | |
| 3210 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:16108"/> | |
| 3211 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/668"/> | |
| 3212 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM77"/> | |
| 3213 </rdf:Bag> | |
| 3214 </bqbiol:is> | |
| 3215 </rdf:Description> | |
| 3216 </rdf:RDF> | |
| 3217 </annotation> | |
| 3218 </species> | |
| 3219 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C6H11O9P" hasOnlySubstanceUnits="true" id="M_m01322c" initialConcentration="0" metaid="ccf14f47-b931-4970-9c98-96b790907dbc" name="alpha-D-galactose-1-phosphate" sboTerm="SBO:0000247"> | |
| 3220 <notes> | |
| 3221 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3222 <p>kegg.compound: C03384</p> | |
| 3223 <p>bigg.metabolite: gal1p</p> | |
| 3224 <p>chebi: CHEBI:17973</p> | |
| 3225 <p>pubchem.compound: 123912</p> | |
| 3226 <p>metanetx.chemical: MNXM336</p> | |
| 3227 <p>formula: C6H11O9P</p> | |
| 3228 <p>charge: -2</p> | |
| 3229 </body> | |
| 3230 </notes> | |
| 3231 <annotation> | |
| 3232 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3233 <rdf:Description rdf:about="#ccf14f47-b931-4970-9c98-96b790907dbc"> | |
| 3234 <bqbiol:is> | |
| 3235 <rdf:Bag> | |
| 3236 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C03384"/> | |
| 3237 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/gal1p"/> | |
| 3238 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17973"/> | |
| 3239 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/123912"/> | |
| 3240 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM336"/> | |
| 3241 </rdf:Bag> | |
| 3242 </bqbiol:is> | |
| 3243 </rdf:Description> | |
| 3244 </rdf:RDF> | |
| 3245 </annotation> | |
| 3246 </species> | |
| 3247 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C10H12N5O7P" hasOnlySubstanceUnits="true" id="M_m01334c" initialConcentration="0" metaid="d430dc71-00bc-4d61-94b8-202046401905" name="AMP" sboTerm="SBO:0000247"> | |
| 3248 <notes> | |
| 3249 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3250 <p>kegg.compound: C00020</p> | |
| 3251 <p>hmdb: HMDB00045</p> | |
| 3252 <p>bigg.metabolite: amp</p> | |
| 3253 <p>chebi: CHEBI:16027</p> | |
| 3254 <p>pubchem.compound: 6083</p> | |
| 3255 <p>metanetx.chemical: MNXM14</p> | |
| 3256 <p>formula: C10H12N5O7P</p> | |
| 3257 <p>charge: -2</p> | |
| 3258 </body> | |
| 3259 </notes> | |
| 3260 <annotation> | |
| 3261 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3262 <rdf:Description rdf:about="#d430dc71-00bc-4d61-94b8-202046401905"> | |
| 3263 <bqbiol:is> | |
| 3264 <rdf:Bag> | |
| 3265 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00020"/> | |
| 3266 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00045"/> | |
| 3267 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/amp"/> | |
| 3268 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:16027"/> | |
| 3269 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/6083"/> | |
| 3270 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM14"/> | |
| 3271 </rdf:Bag> | |
| 3272 </bqbiol:is> | |
| 3273 </rdf:Description> | |
| 3274 </rdf:RDF> | |
| 3275 </annotation> | |
| 3276 </species> | |
| 3277 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="C2H4O" hasOnlySubstanceUnits="true" id="M_m01249c" initialConcentration="0" metaid="b26172e9-a9bb-418f-90c4-4132af1dada8" name="acetaldehyde" sboTerm="SBO:0000247"> | |
| 3278 <notes> | |
| 3279 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3280 <p>kegg.compound: C00084</p> | |
| 3281 <p>hmdb: HMDB00990</p> | |
| 3282 <p>bigg.metabolite: acald</p> | |
| 3283 <p>chebi: CHEBI:15343</p> | |
| 3284 <p>pubchem.compound: 177</p> | |
| 3285 <p>metanetx.chemical: MNXM75</p> | |
| 3286 <p>formula: C2H4O</p> | |
| 3287 </body> | |
| 3288 </notes> | |
| 3289 <annotation> | |
| 3290 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3291 <rdf:Description rdf:about="#b26172e9-a9bb-418f-90c4-4132af1dada8"> | |
| 3292 <bqbiol:is> | |
| 3293 <rdf:Bag> | |
| 3294 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00084"/> | |
| 3295 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00990"/> | |
| 3296 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/acald"/> | |
| 3297 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:15343"/> | |
| 3298 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/177"/> | |
| 3299 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM75"/> | |
| 3300 </rdf:Bag> | |
| 3301 </bqbiol:is> | |
| 3302 </rdf:Description> | |
| 3303 </rdf:RDF> | |
| 3304 </annotation> | |
| 3305 </species> | |
| 3306 <species boundaryCondition="false" compartment="r" constant="false" fbc:charge="-2" fbc:chemicalFormula="C6H9O9P" hasOnlySubstanceUnits="true" id="M_m01961r" initialConcentration="0" metaid="_3f0abace-5e5b-40c8-b067-d21e4368010d" name="glucono-1,5-lactone-6-phosphate" sboTerm="SBO:0000247"> | |
| 3307 <notes> | |
| 3308 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3309 <p>kegg.compound: C01236</p> | |
| 3310 <p>bigg.metabolite: 6pgl</p> | |
| 3311 <p>chebi: CHEBI:16938</p> | |
| 3312 <p>pubchem.compound: 439452</p> | |
| 3313 <p>metanetx.chemical: MNXM429</p> | |
| 3314 <p>formula: C6H9O9P</p> | |
| 3315 <p>charge: -2</p> | |
| 3316 </body> | |
| 3317 </notes> | |
| 3318 <annotation> | |
| 3319 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3320 <rdf:Description rdf:about="#_3f0abace-5e5b-40c8-b067-d21e4368010d"> | |
| 3321 <bqbiol:is> | |
| 3322 <rdf:Bag> | |
| 3323 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01236"/> | |
| 3324 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/6pgl"/> | |
| 3325 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:16938"/> | |
| 3326 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/439452"/> | |
| 3327 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM429"/> | |
| 3328 </rdf:Bag> | |
| 3329 </bqbiol:is> | |
| 3330 </rdf:Description> | |
| 3331 </rdf:RDF> | |
| 3332 </annotation> | |
| 3333 </species> | |
| 3334 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-4" fbc:chemicalFormula="C10H11N4O14P3" hasOnlySubstanceUnits="true" id="M_m02193c" initialConcentration="0" metaid="d86ee995-ab70-4b25-8ecf-739633917441" name="ITP" sboTerm="SBO:0000247"> | |
| 3335 <notes> | |
| 3336 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3337 <p>kegg.compound: C00081</p> | |
| 3338 <p>bigg.metabolite: itp</p> | |
| 3339 <p>chebi: CHEBI:16039</p> | |
| 3340 <p>pubchem.compound: 8583</p> | |
| 3341 <p>metanetx.chemical: MNXM423</p> | |
| 3342 <p>formula: C10H11N4O14P3</p> | |
| 3343 <p>charge: -4</p> | |
| 3344 </body> | |
| 3345 </notes> | |
| 3346 <annotation> | |
| 3347 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3348 <rdf:Description rdf:about="#d86ee995-ab70-4b25-8ecf-739633917441"> | |
| 3349 <bqbiol:is> | |
| 3350 <rdf:Bag> | |
| 3351 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00081"/> | |
| 3352 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/itp"/> | |
| 3353 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:16039"/> | |
| 3354 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/8583"/> | |
| 3355 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM423"/> | |
| 3356 </rdf:Bag> | |
| 3357 </bqbiol:is> | |
| 3358 </rdf:Description> | |
| 3359 </rdf:RDF> | |
| 3360 </annotation> | |
| 3361 </species> | |
| 3362 <species boundaryCondition="false" compartment="s" constant="false" fbc:charge="0" fbc:chemicalFormula="C6H12O6" hasOnlySubstanceUnits="true" id="M_m01840s" initialConcentration="0" metaid="b908e607-79da-478f-9bb1-e4ccd3243f7f" name="fructose" sboTerm="SBO:0000247"> | |
| 3363 <notes> | |
| 3364 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3365 <p>kegg.compound: C02336</p> | |
| 3366 <p>hmdb: HMDB00660</p> | |
| 3367 <p>bigg.metabolite: fru</p> | |
| 3368 <p>chebi: CHEBI:28645</p> | |
| 3369 <p>pubchem.compound: 439709</p> | |
| 3370 <p>metanetx.chemical: MNXM175</p> | |
| 3371 <p>formula: C6H12O6</p> | |
| 3372 </body> | |
| 3373 </notes> | |
| 3374 <annotation> | |
| 3375 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3376 <rdf:Description rdf:about="#b908e607-79da-478f-9bb1-e4ccd3243f7f"> | |
| 3377 <bqbiol:is> | |
| 3378 <rdf:Bag> | |
| 3379 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C02336"/> | |
| 3380 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00660"/> | |
| 3381 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/fru"/> | |
| 3382 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:28645"/> | |
| 3383 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/439709"/> | |
| 3384 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM175"/> | |
| 3385 </rdf:Bag> | |
| 3386 </bqbiol:is> | |
| 3387 </rdf:Description> | |
| 3388 </rdf:RDF> | |
| 3389 </annotation> | |
| 3390 </species> | |
| 3391 <species boundaryCondition="false" compartment="g" constant="false" fbc:charge="1" fbc:chemicalFormula="H" hasOnlySubstanceUnits="true" id="M_m02039g" initialConcentration="0" metaid="_42778420-d51a-415e-8fd5-a1e6dd29336f" name="H+" sboTerm="SBO:0000247"> | |
| 3392 <notes> | |
| 3393 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3394 <p>kegg.compound: C00080</p> | |
| 3395 <p>bigg.metabolite: h</p> | |
| 3396 <p>chebi: CHEBI:24636</p> | |
| 3397 <p>pubchem.compound: 1038</p> | |
| 3398 <p>metanetx.chemical: MNXM1</p> | |
| 3399 <p>formula: H</p> | |
| 3400 <p>charge: 1</p> | |
| 3401 </body> | |
| 3402 </notes> | |
| 3403 <annotation> | |
| 3404 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3405 <rdf:Description rdf:about="#_42778420-d51a-415e-8fd5-a1e6dd29336f"> | |
| 3406 <bqbiol:is> | |
| 3407 <rdf:Bag> | |
| 3408 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00080"/> | |
| 3409 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/h"/> | |
| 3410 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:24636"/> | |
| 3411 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/1038"/> | |
| 3412 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM1"/> | |
| 3413 </rdf:Bag> | |
| 3414 </bqbiol:is> | |
| 3415 </rdf:Description> | |
| 3416 </rdf:RDF> | |
| 3417 </annotation> | |
| 3418 </species> | |
| 3419 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-4" fbc:chemicalFormula="C7H12O13P2" hasOnlySubstanceUnits="true" id="M_m02883c" initialConcentration="0" metaid="_22c2c43e-d9ef-4b0b-ae59-18c23634ad89" name="sedoheptulose-1,7-bisphosphate" sboTerm="SBO:0000247"> | |
| 3420 <notes> | |
| 3421 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3422 <p>kegg.compound: C00447</p> | |
| 3423 <p>chebi: CHEBI:17969</p> | |
| 3424 <p>pubchem.compound: 164735</p> | |
| 3425 <p>metanetx.chemical: MNXM163895 || MNXM1294</p> | |
| 3426 <p>formula: C7H12O13P2</p> | |
| 3427 <p>charge: -4</p> | |
| 3428 </body> | |
| 3429 </notes> | |
| 3430 <annotation> | |
| 3431 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3432 <rdf:Description rdf:about="#_22c2c43e-d9ef-4b0b-ae59-18c23634ad89"> | |
| 3433 <bqbiol:is> | |
| 3434 <rdf:Bag> | |
| 3435 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00447"/> | |
| 3436 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17969"/> | |
| 3437 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/164735"/> | |
| 3438 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM163895"/> | |
| 3439 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM1294"/> | |
| 3440 </rdf:Bag> | |
| 3441 </bqbiol:is> | |
| 3442 </rdf:Description> | |
| 3443 </rdf:RDF> | |
| 3444 </annotation> | |
| 3445 </species> | |
| 3446 <species boundaryCondition="false" compartment="r" constant="false" fbc:charge="-3" fbc:chemicalFormula="C6H10O10P" hasOnlySubstanceUnits="true" id="M_m01169r" initialConcentration="0" metaid="_7c933ae2-cfcf-4aa9-af8d-bbf16388fed5" name="6-phospho-D-gluconate" sboTerm="SBO:0000247"> | |
| 3447 <notes> | |
| 3448 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3449 <p>kegg.compound: C00345</p> | |
| 3450 <p>hmdb: HMDB01316</p> | |
| 3451 <p>bigg.metabolite: 6pgc</p> | |
| 3452 <p>chebi: CHEBI:48928</p> | |
| 3453 <p>pubchem.compound: 91493</p> | |
| 3454 <p>metanetx.chemical: MNXM325</p> | |
| 3455 <p>formula: C6H10O10P</p> | |
| 3456 <p>charge: -3</p> | |
| 3457 </body> | |
| 3458 </notes> | |
| 3459 <annotation> | |
| 3460 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3461 <rdf:Description rdf:about="#_7c933ae2-cfcf-4aa9-af8d-bbf16388fed5"> | |
| 3462 <bqbiol:is> | |
| 3463 <rdf:Bag> | |
| 3464 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00345"/> | |
| 3465 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB01316"/> | |
| 3466 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/6pgc"/> | |
| 3467 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:48928"/> | |
| 3468 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/91493"/> | |
| 3469 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM325"/> | |
| 3470 </rdf:Bag> | |
| 3471 </bqbiol:is> | |
| 3472 </rdf:Description> | |
| 3473 </rdf:RDF> | |
| 3474 </annotation> | |
| 3475 </species> | |
| 3476 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H10O5" hasOnlySubstanceUnits="true" id="M_m02843c" initialConcentration="0" metaid="c86562cc-a38d-4105-b709-81e1ed867220" name="ribose" sboTerm="SBO:0000247"> | |
| 3477 <notes> | |
| 3478 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3479 <p>kegg.compound: C00121</p> | |
| 3480 <p>hmdb: HMDB00283</p> | |
| 3481 <p>bigg.metabolite: rib__D</p> | |
| 3482 <p>chebi: CHEBI:16988</p> | |
| 3483 <p>pubchem.compound: 5779</p> | |
| 3484 <p>metanetx.chemical: MNXM242</p> | |
| 3485 <p>formula: C5H10O5</p> | |
| 3486 </body> | |
| 3487 </notes> | |
| 3488 <annotation> | |
| 3489 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3490 <rdf:Description rdf:about="#c86562cc-a38d-4105-b709-81e1ed867220"> | |
| 3491 <bqbiol:is> | |
| 3492 <rdf:Bag> | |
| 3493 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00121"/> | |
| 3494 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00283"/> | |
| 3495 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/rib__D"/> | |
| 3496 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:16988"/> | |
| 3497 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/5779"/> | |
| 3498 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM242"/> | |
| 3499 </rdf:Bag> | |
| 3500 </bqbiol:is> | |
| 3501 </rdf:Description> | |
| 3502 </rdf:RDF> | |
| 3503 </annotation> | |
| 3504 </species> | |
| 3505 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C6H11O9P" hasOnlySubstanceUnits="true" id="M_m01968c" initialConcentration="0" metaid="_370aa63f-8947-4333-9372-c95e0079773c" name="glucose-6-phosphate" sboTerm="SBO:0000247"> | |
| 3506 <notes> | |
| 3507 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3508 <p>kegg.compound: C00092</p> | |
| 3509 <p>bigg.metabolite: g6p</p> | |
| 3510 <p>chebi: CHEBI:4170</p> | |
| 3511 <p>pubchem.compound: 5958</p> | |
| 3512 <p>metanetx.chemical: MNXM160</p> | |
| 3513 <p>formula: C6H11O9P</p> | |
| 3514 <p>charge: -2</p> | |
| 3515 </body> | |
| 3516 </notes> | |
| 3517 <annotation> | |
| 3518 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3519 <rdf:Description rdf:about="#_370aa63f-8947-4333-9372-c95e0079773c"> | |
| 3520 <bqbiol:is> | |
| 3521 <rdf:Bag> | |
| 3522 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00092"/> | |
| 3523 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/g6p"/> | |
| 3524 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:4170"/> | |
| 3525 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/5958"/> | |
| 3526 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM160"/> | |
| 3527 </rdf:Bag> | |
| 3528 </bqbiol:is> | |
| 3529 </rdf:Description> | |
| 3530 </rdf:RDF> | |
| 3531 </annotation> | |
| 3532 </species> | |
| 3533 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="1" fbc:chemicalFormula="H" hasOnlySubstanceUnits="true" id="M_m02039c" initialConcentration="0" metaid="_455b3b9e-68d4-4ea4-b895-e4ac1cc17c0d" name="H+" sboTerm="SBO:0000247"> | |
| 3534 <notes> | |
| 3535 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3536 <p>kegg.compound: C00080</p> | |
| 3537 <p>bigg.metabolite: h</p> | |
| 3538 <p>chebi: CHEBI:24636</p> | |
| 3539 <p>pubchem.compound: 1038</p> | |
| 3540 <p>metanetx.chemical: MNXM1</p> | |
| 3541 <p>formula: H</p> | |
| 3542 <p>charge: 1</p> | |
| 3543 </body> | |
| 3544 </notes> | |
| 3545 <annotation> | |
| 3546 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3547 <rdf:Description rdf:about="#_455b3b9e-68d4-4ea4-b895-e4ac1cc17c0d"> | |
| 3548 <bqbiol:is> | |
| 3549 <rdf:Bag> | |
| 3550 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00080"/> | |
| 3551 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/h"/> | |
| 3552 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:24636"/> | |
| 3553 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/1038"/> | |
| 3554 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM1"/> | |
| 3555 </rdf:Bag> | |
| 3556 </bqbiol:is> | |
| 3557 </rdf:Description> | |
| 3558 </rdf:RDF> | |
| 3559 </annotation> | |
| 3560 </species> | |
| 3561 <species boundaryCondition="false" compartment="r" constant="false" fbc:charge="-2" fbc:chemicalFormula="C6H11O9P" hasOnlySubstanceUnits="true" id="M_m01968r" initialConcentration="0" metaid="_2245cdf3-b905-4470-896d-c12a111787e7" name="glucose-6-phosphate" sboTerm="SBO:0000247"> | |
| 3562 <notes> | |
| 3563 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3564 <p>kegg.compound: C00092</p> | |
| 3565 <p>bigg.metabolite: g6p</p> | |
| 3566 <p>chebi: CHEBI:4170</p> | |
| 3567 <p>pubchem.compound: 5958</p> | |
| 3568 <p>metanetx.chemical: MNXM160</p> | |
| 3569 <p>formula: C6H11O9P</p> | |
| 3570 <p>charge: -2</p> | |
| 3571 </body> | |
| 3572 </notes> | |
| 3573 <annotation> | |
| 3574 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3575 <rdf:Description rdf:about="#_2245cdf3-b905-4470-896d-c12a111787e7"> | |
| 3576 <bqbiol:is> | |
| 3577 <rdf:Bag> | |
| 3578 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00092"/> | |
| 3579 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/g6p"/> | |
| 3580 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:4170"/> | |
| 3581 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/5958"/> | |
| 3582 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM160"/> | |
| 3583 </rdf:Bag> | |
| 3584 </bqbiol:is> | |
| 3585 </rdf:Description> | |
| 3586 </rdf:RDF> | |
| 3587 </annotation> | |
| 3588 </species> | |
| 3589 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-3" fbc:chemicalFormula="C6H10O10P" hasOnlySubstanceUnits="true" id="M_m01169c" initialConcentration="0" metaid="dfbe4e2b-1fd6-4a34-8064-53308f79888f" name="6-phospho-D-gluconate" sboTerm="SBO:0000247"> | |
| 3590 <notes> | |
| 3591 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3592 <p>kegg.compound: C00345</p> | |
| 3593 <p>hmdb: HMDB01316</p> | |
| 3594 <p>bigg.metabolite: 6pgc</p> | |
| 3595 <p>chebi: CHEBI:48928</p> | |
| 3596 <p>pubchem.compound: 91493</p> | |
| 3597 <p>metanetx.chemical: MNXM325</p> | |
| 3598 <p>formula: C6H10O10P</p> | |
| 3599 <p>charge: -3</p> | |
| 3600 </body> | |
| 3601 </notes> | |
| 3602 <annotation> | |
| 3603 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3604 <rdf:Description rdf:about="#dfbe4e2b-1fd6-4a34-8064-53308f79888f"> | |
| 3605 <bqbiol:is> | |
| 3606 <rdf:Bag> | |
| 3607 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00345"/> | |
| 3608 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB01316"/> | |
| 3609 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/6pgc"/> | |
| 3610 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:48928"/> | |
| 3611 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/91493"/> | |
| 3612 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM325"/> | |
| 3613 </rdf:Bag> | |
| 3614 </bqbiol:is> | |
| 3615 </rdf:Description> | |
| 3616 </rdf:RDF> | |
| 3617 </annotation> | |
| 3618 </species> | |
| 3619 <species boundaryCondition="false" compartment="r" constant="false" fbc:charge="1" fbc:chemicalFormula="H" hasOnlySubstanceUnits="true" id="M_m02039r" initialConcentration="0" metaid="a7079a2e-7f55-44c1-bcc2-5989ea949235" name="H+" sboTerm="SBO:0000247"> | |
| 3620 <notes> | |
| 3621 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3622 <p>kegg.compound: C00080</p> | |
| 3623 <p>bigg.metabolite: h</p> | |
| 3624 <p>chebi: CHEBI:24636</p> | |
| 3625 <p>pubchem.compound: 1038</p> | |
| 3626 <p>metanetx.chemical: MNXM1</p> | |
| 3627 <p>formula: H</p> | |
| 3628 <p>charge: 1</p> | |
| 3629 </body> | |
| 3630 </notes> | |
| 3631 <annotation> | |
| 3632 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3633 <rdf:Description rdf:about="#a7079a2e-7f55-44c1-bcc2-5989ea949235"> | |
| 3634 <bqbiol:is> | |
| 3635 <rdf:Bag> | |
| 3636 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00080"/> | |
| 3637 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/h"/> | |
| 3638 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:24636"/> | |
| 3639 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/1038"/> | |
| 3640 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM1"/> | |
| 3641 </rdf:Bag> | |
| 3642 </bqbiol:is> | |
| 3643 </rdf:Description> | |
| 3644 </rdf:RDF> | |
| 3645 </annotation> | |
| 3646 </species> | |
| 3647 <species boundaryCondition="false" compartment="s" constant="false" fbc:charge="1" fbc:chemicalFormula="H" hasOnlySubstanceUnits="true" id="M_m02039s" initialConcentration="0" metaid="_48b7ef43-d087-4f37-9392-1047b65c4dbd" name="H+" sboTerm="SBO:0000247"> | |
| 3648 <notes> | |
| 3649 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3650 <p>kegg.compound: C00080</p> | |
| 3651 <p>bigg.metabolite: h</p> | |
| 3652 <p>chebi: CHEBI:24636</p> | |
| 3653 <p>pubchem.compound: 1038</p> | |
| 3654 <p>metanetx.chemical: MNXM1</p> | |
| 3655 <p>formula: H</p> | |
| 3656 <p>charge: 1</p> | |
| 3657 </body> | |
| 3658 </notes> | |
| 3659 <annotation> | |
| 3660 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3661 <rdf:Description rdf:about="#_48b7ef43-d087-4f37-9392-1047b65c4dbd"> | |
| 3662 <bqbiol:is> | |
| 3663 <rdf:Bag> | |
| 3664 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00080"/> | |
| 3665 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/h"/> | |
| 3666 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:24636"/> | |
| 3667 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/1038"/> | |
| 3668 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM1"/> | |
| 3669 </rdf:Bag> | |
| 3670 </bqbiol:is> | |
| 3671 </rdf:Description> | |
| 3672 </rdf:RDF> | |
| 3673 </annotation> | |
| 3674 </species> | |
| 3675 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C3H5O6P" hasOnlySubstanceUnits="true" id="M_m01939c" initialConcentration="0" metaid="_6e928c86-cb07-4ee4-9da1-206e92aa5aae" name="GAP" sboTerm="SBO:0000247"> | |
| 3676 <notes> | |
| 3677 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3678 <p>kegg.compound: C00118</p> | |
| 3679 <p>bigg.metabolite: g3p</p> | |
| 3680 <p>chebi: CHEBI:29052</p> | |
| 3681 <p>pubchem.compound: 729</p> | |
| 3682 <p>metanetx.chemical: MNXM74</p> | |
| 3683 <p>formula: C3H5O6P</p> | |
| 3684 <p>charge: -2</p> | |
| 3685 </body> | |
| 3686 </notes> | |
| 3687 <annotation> | |
| 3688 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3689 <rdf:Description rdf:about="#_6e928c86-cb07-4ee4-9da1-206e92aa5aae"> | |
| 3690 <bqbiol:is> | |
| 3691 <rdf:Bag> | |
| 3692 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00118"/> | |
| 3693 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/g3p"/> | |
| 3694 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:29052"/> | |
| 3695 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/729"/> | |
| 3696 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM74"/> | |
| 3697 </rdf:Bag> | |
| 3698 </bqbiol:is> | |
| 3699 </rdf:Description> | |
| 3700 </rdf:RDF> | |
| 3701 </annotation> | |
| 3702 </species> | |
| 3703 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-4" fbc:chemicalFormula="C21H26N7O17P3" hasOnlySubstanceUnits="true" id="M_m02555c" initialConcentration="0" metaid="_4713da60-2315-4728-8c49-9d80e9d06982" name="NADPH" sboTerm="SBO:0000247"> | |
| 3704 <notes> | |
| 3705 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3706 <p>kegg.compound: C00005</p> | |
| 3707 <p>hmdb: HMDB00221</p> | |
| 3708 <p>bigg.metabolite: nadph</p> | |
| 3709 <p>chebi: CHEBI:16474</p> | |
| 3710 <p>pubchem.compound: 22833512</p> | |
| 3711 <p>metanetx.chemical: MNXM6</p> | |
| 3712 <p>formula: C21H26N7O17P3</p> | |
| 3713 <p>charge: -4</p> | |
| 3714 </body> | |
| 3715 </notes> | |
| 3716 <annotation> | |
| 3717 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3718 <rdf:Description rdf:about="#_4713da60-2315-4728-8c49-9d80e9d06982"> | |
| 3719 <bqbiol:is> | |
| 3720 <rdf:Bag> | |
| 3721 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00005"/> | |
| 3722 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00221"/> | |
| 3723 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/nadph"/> | |
| 3724 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:16474"/> | |
| 3725 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/22833512"/> | |
| 3726 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM6"/> | |
| 3727 </rdf:Bag> | |
| 3728 </bqbiol:is> | |
| 3729 </rdf:Description> | |
| 3730 </rdf:RDF> | |
| 3731 </annotation> | |
| 3732 </species> | |
| 3733 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C6H11O9P" hasOnlySubstanceUnits="true" id="M_m01967c" initialConcentration="0" metaid="eb903c59-35de-4770-9346-d9840ea78b8b" name="glucose-1-phosphate" sboTerm="SBO:0000247"> | |
| 3734 <notes> | |
| 3735 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3736 <p>kegg.compound: C00103</p> | |
| 3737 <p>bigg.metabolite: g1p</p> | |
| 3738 <p>chebi: CHEBI:16077</p> | |
| 3739 <p>pubchem.compound: 65533</p> | |
| 3740 <p>metanetx.chemical: MNXM89588</p> | |
| 3741 <p>formula: C6H11O9P</p> | |
| 3742 <p>charge: -2</p> | |
| 3743 </body> | |
| 3744 </notes> | |
| 3745 <annotation> | |
| 3746 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3747 <rdf:Description rdf:about="#eb903c59-35de-4770-9346-d9840ea78b8b"> | |
| 3748 <bqbiol:is> | |
| 3749 <rdf:Bag> | |
| 3750 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00103"/> | |
| 3751 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/g1p"/> | |
| 3752 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:16077"/> | |
| 3753 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/65533"/> | |
| 3754 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM89588"/> | |
| 3755 </rdf:Bag> | |
| 3756 </bqbiol:is> | |
| 3757 </rdf:Description> | |
| 3758 </rdf:RDF> | |
| 3759 </annotation> | |
| 3760 </species> | |
| 3761 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H10O4" hasOnlySubstanceUnits="true" id="M_m01672c" initialConcentration="0" metaid="c684250e-c857-4d7b-b61e-1695a0a407a8" name="deoxyribose" sboTerm="SBO:0000247"> | |
| 3762 <notes> | |
| 3763 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3764 <p>kegg.compound: C01801</p> | |
| 3765 <p>hmdb: HMDB03224</p> | |
| 3766 <p>bigg.metabolite: drib</p> | |
| 3767 <p>chebi: CHEBI:28816</p> | |
| 3768 <p>pubchem.compound: 22833604</p> | |
| 3769 <p>metanetx.chemical: MNXM90412 || MNXM2474</p> | |
| 3770 <p>formula: C5H10O4</p> | |
| 3771 </body> | |
| 3772 </notes> | |
| 3773 <annotation> | |
| 3774 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3775 <rdf:Description rdf:about="#c684250e-c857-4d7b-b61e-1695a0a407a8"> | |
| 3776 <bqbiol:is> | |
| 3777 <rdf:Bag> | |
| 3778 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C01801"/> | |
| 3779 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB03224"/> | |
| 3780 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/drib"/> | |
| 3781 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:28816"/> | |
| 3782 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/22833604"/> | |
| 3783 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM90412"/> | |
| 3784 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM2474"/> | |
| 3785 </rdf:Bag> | |
| 3786 </bqbiol:is> | |
| 3787 </rdf:Description> | |
| 3788 </rdf:RDF> | |
| 3789 </annotation> | |
| 3790 </species> | |
| 3791 <species boundaryCondition="false" compartment="r" constant="false" fbc:charge="-4" fbc:chemicalFormula="C21H26N7O17P3" hasOnlySubstanceUnits="true" id="M_m02555r" initialConcentration="0" metaid="_9dd9e24d-3d87-43d4-a57f-7319fda9d5ae" name="NADPH" sboTerm="SBO:0000247"> | |
| 3792 <notes> | |
| 3793 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3794 <p>kegg.compound: C00005</p> | |
| 3795 <p>hmdb: HMDB00221</p> | |
| 3796 <p>bigg.metabolite: nadph</p> | |
| 3797 <p>chebi: CHEBI:16474</p> | |
| 3798 <p>pubchem.compound: 22833512</p> | |
| 3799 <p>metanetx.chemical: MNXM6</p> | |
| 3800 <p>formula: C21H26N7O17P3</p> | |
| 3801 <p>charge: -4</p> | |
| 3802 </body> | |
| 3803 </notes> | |
| 3804 <annotation> | |
| 3805 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3806 <rdf:Description rdf:about="#_9dd9e24d-3d87-43d4-a57f-7319fda9d5ae"> | |
| 3807 <bqbiol:is> | |
| 3808 <rdf:Bag> | |
| 3809 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00005"/> | |
| 3810 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00221"/> | |
| 3811 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/nadph"/> | |
| 3812 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:16474"/> | |
| 3813 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/22833512"/> | |
| 3814 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM6"/> | |
| 3815 </rdf:Bag> | |
| 3816 </bqbiol:is> | |
| 3817 </rdf:Description> | |
| 3818 </rdf:RDF> | |
| 3819 </annotation> | |
| 3820 </species> | |
| 3821 <species boundaryCondition="false" compartment="s" constant="false" fbc:charge="0" fbc:chemicalFormula="C3H8O3" hasOnlySubstanceUnits="true" id="M_m01983s" initialConcentration="0" metaid="_681859d4-f24a-406f-8efe-f13934d5ffd5" name="glycerol" sboTerm="SBO:0000247"> | |
| 3822 <notes> | |
| 3823 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3824 <p>kegg.compound: C00116</p> | |
| 3825 <p>hmdb: HMDB00131</p> | |
| 3826 <p>bigg.metabolite: glyc</p> | |
| 3827 <p>chebi: CHEBI:17522</p> | |
| 3828 <p>pubchem.compound: 753</p> | |
| 3829 <p>metanetx.chemical: MNXM89612</p> | |
| 3830 <p>formula: C3H8O3</p> | |
| 3831 </body> | |
| 3832 </notes> | |
| 3833 <annotation> | |
| 3834 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3835 <rdf:Description rdf:about="#_681859d4-f24a-406f-8efe-f13934d5ffd5"> | |
| 3836 <bqbiol:is> | |
| 3837 <rdf:Bag> | |
| 3838 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00116"/> | |
| 3839 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00131"/> | |
| 3840 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/glyc"/> | |
| 3841 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:17522"/> | |
| 3842 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/753"/> | |
| 3843 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM89612"/> | |
| 3844 </rdf:Bag> | |
| 3845 </bqbiol:is> | |
| 3846 </rdf:Description> | |
| 3847 </rdf:RDF> | |
| 3848 </annotation> | |
| 3849 </species> | |
| 3850 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-3" fbc:chemicalFormula="C21H25N7O17P3" hasOnlySubstanceUnits="true" id="M_m02554c" initialConcentration="0" metaid="_9d6ff91d-ad3d-4e8d-9c4a-fce47e8acd53" name="NADP+" sboTerm="SBO:0000247"> | |
| 3851 <notes> | |
| 3852 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3853 <p>kegg.compound: C00006</p> | |
| 3854 <p>hmdb: HMDB00217</p> | |
| 3855 <p>bigg.metabolite: nadp</p> | |
| 3856 <p>chebi: CHEBI:18009</p> | |
| 3857 <p>pubchem.compound: 5886</p> | |
| 3858 <p>metanetx.chemical: MNXM5</p> | |
| 3859 <p>formula: C21H25N7O17P3</p> | |
| 3860 <p>charge: -3</p> | |
| 3861 </body> | |
| 3862 </notes> | |
| 3863 <annotation> | |
| 3864 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3865 <rdf:Description rdf:about="#_9d6ff91d-ad3d-4e8d-9c4a-fce47e8acd53"> | |
| 3866 <bqbiol:is> | |
| 3867 <rdf:Bag> | |
| 3868 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00006"/> | |
| 3869 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00217"/> | |
| 3870 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/nadp"/> | |
| 3871 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:18009"/> | |
| 3872 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/5886"/> | |
| 3873 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM5"/> | |
| 3874 </rdf:Bag> | |
| 3875 </bqbiol:is> | |
| 3876 </rdf:Description> | |
| 3877 </rdf:RDF> | |
| 3878 </annotation> | |
| 3879 </species> | |
| 3880 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="0" fbc:chemicalFormula="C5H12O5" hasOnlySubstanceUnits="true" id="M_m02841c" initialConcentration="0" metaid="eb784776-6b61-4d67-9441-2af7f5d1e57f" name="ribitol" sboTerm="SBO:0000247"> | |
| 3881 <notes> | |
| 3882 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3883 <p>kegg.compound: C00474</p> | |
| 3884 <p>hmdb: HMDB00508</p> | |
| 3885 <p>bigg.metabolite: rbt</p> | |
| 3886 <p>chebi: CHEBI:15963</p> | |
| 3887 <p>pubchem.compound: 827</p> | |
| 3888 <p>metanetx.chemical: MNXM1820</p> | |
| 3889 <p>formula: C5H12O5</p> | |
| 3890 </body> | |
| 3891 </notes> | |
| 3892 <annotation> | |
| 3893 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3894 <rdf:Description rdf:about="#eb784776-6b61-4d67-9441-2af7f5d1e57f"> | |
| 3895 <bqbiol:is> | |
| 3896 <rdf:Bag> | |
| 3897 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00474"/> | |
| 3898 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00508"/> | |
| 3899 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/rbt"/> | |
| 3900 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:15963"/> | |
| 3901 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/827"/> | |
| 3902 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM1820"/> | |
| 3903 </rdf:Bag> | |
| 3904 </bqbiol:is> | |
| 3905 </rdf:Description> | |
| 3906 </rdf:RDF> | |
| 3907 </annotation> | |
| 3908 </species> | |
| 3909 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C6H11O9P" hasOnlySubstanceUnits="true" id="M_m01845c" initialConcentration="0" metaid="_435773db-71ea-408f-b0f1-852fadf7ea80" name="fructose-6-phosphate" sboTerm="SBO:0000247"> | |
| 3910 <notes> | |
| 3911 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3912 <p>kegg.compound: C00085</p> | |
| 3913 <p>bigg.metabolite: f6p</p> | |
| 3914 <p>chebi: CHEBI:15946</p> | |
| 3915 <p>pubchem.compound: 69507</p> | |
| 3916 <p>metanetx.chemical: MNXM89621 || MNXM162235</p> | |
| 3917 <p>formula: C6H11O9P</p> | |
| 3918 <p>charge: -2</p> | |
| 3919 </body> | |
| 3920 </notes> | |
| 3921 <annotation> | |
| 3922 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3923 <rdf:Description rdf:about="#_435773db-71ea-408f-b0f1-852fadf7ea80"> | |
| 3924 <bqbiol:is> | |
| 3925 <rdf:Bag> | |
| 3926 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00085"/> | |
| 3927 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/f6p"/> | |
| 3928 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:15946"/> | |
| 3929 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/69507"/> | |
| 3930 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM89621"/> | |
| 3931 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM162235"/> | |
| 3932 </rdf:Bag> | |
| 3933 </bqbiol:is> | |
| 3934 </rdf:Description> | |
| 3935 </rdf:RDF> | |
| 3936 </annotation> | |
| 3937 </species> | |
| 3938 <species boundaryCondition="false" compartment="s" constant="false" fbc:charge="0" fbc:chemicalFormula="H2O" hasOnlySubstanceUnits="true" id="M_m02040s" initialConcentration="0" metaid="edc2812f-d50e-40df-9c9b-c62283dd5dfa" name="H2O" sboTerm="SBO:0000247"> | |
| 3939 <notes> | |
| 3940 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3941 <p>lipidmaps: LMST01040128</p> | |
| 3942 <p>kegg.compound: C00001</p> | |
| 3943 <p>hmdb: HMDB02111</p> | |
| 3944 <p>bigg.metabolite: h2o</p> | |
| 3945 <p>chebi: CHEBI:15377</p> | |
| 3946 <p>pubchem.compound: 962</p> | |
| 3947 <p>metanetx.chemical: MNXM2</p> | |
| 3948 <p>formula: H2O</p> | |
| 3949 </body> | |
| 3950 </notes> | |
| 3951 <annotation> | |
| 3952 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3953 <rdf:Description rdf:about="#edc2812f-d50e-40df-9c9b-c62283dd5dfa"> | |
| 3954 <bqbiol:is> | |
| 3955 <rdf:Bag> | |
| 3956 <rdf:li rdf:resource="https://identifiers.org/lipidmaps/LMST01040128"/> | |
| 3957 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00001"/> | |
| 3958 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB02111"/> | |
| 3959 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/h2o"/> | |
| 3960 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:15377"/> | |
| 3961 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/962"/> | |
| 3962 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM2"/> | |
| 3963 </rdf:Bag> | |
| 3964 </bqbiol:is> | |
| 3965 </rdf:Description> | |
| 3966 </rdf:RDF> | |
| 3967 </annotation> | |
| 3968 </species> | |
| 3969 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-4" fbc:chemicalFormula="C9H11N2O15P3" hasOnlySubstanceUnits="true" id="M_m03130c" initialConcentration="0" metaid="_623bdee5-7e3f-429d-8798-39cae174c79d" name="UTP" sboTerm="SBO:0000247"> | |
| 3970 <notes> | |
| 3971 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 3972 <p>kegg.compound: C00075</p> | |
| 3973 <p>hmdb: HMDB00285</p> | |
| 3974 <p>bigg.metabolite: utp</p> | |
| 3975 <p>chebi: CHEBI:15713</p> | |
| 3976 <p>pubchem.compound: 6133</p> | |
| 3977 <p>metanetx.chemical: MNXM121</p> | |
| 3978 <p>formula: C9H11N2O15P3</p> | |
| 3979 <p>charge: -4</p> | |
| 3980 </body> | |
| 3981 </notes> | |
| 3982 <annotation> | |
| 3983 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 3984 <rdf:Description rdf:about="#_623bdee5-7e3f-429d-8798-39cae174c79d"> | |
| 3985 <bqbiol:is> | |
| 3986 <rdf:Bag> | |
| 3987 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00075"/> | |
| 3988 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00285"/> | |
| 3989 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/utp"/> | |
| 3990 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:15713"/> | |
| 3991 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/6133"/> | |
| 3992 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM121"/> | |
| 3993 </rdf:Bag> | |
| 3994 </bqbiol:is> | |
| 3995 </rdf:Description> | |
| 3996 </rdf:RDF> | |
| 3997 </annotation> | |
| 3998 </species> | |
| 3999 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C7H13O10P" hasOnlySubstanceUnits="true" id="M_m03166c" initialConcentration="0" metaid="be62933b-1dd6-4a8b-87c9-a14eb36e9b49" name="sedoheptulose-1-phosphate" sboTerm="SBO:0000247"> | |
| 4000 <notes> | |
| 4001 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4002 <p>kegg.compound: C06222</p> | |
| 4003 <p>chebi: CHEBI:9082</p> | |
| 4004 <p>metanetx.chemical: MNXM12925</p> | |
| 4005 <p>formula: C7H13O10P</p> | |
| 4006 <p>charge: -2</p> | |
| 4007 </body> | |
| 4008 </notes> | |
| 4009 <annotation> | |
| 4010 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4011 <rdf:Description rdf:about="#be62933b-1dd6-4a8b-87c9-a14eb36e9b49"> | |
| 4012 <bqbiol:is> | |
| 4013 <rdf:Bag> | |
| 4014 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C06222"/> | |
| 4015 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:9082"/> | |
| 4016 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM12925"/> | |
| 4017 </rdf:Bag> | |
| 4018 </bqbiol:is> | |
| 4019 </rdf:Description> | |
| 4020 </rdf:RDF> | |
| 4021 </annotation> | |
| 4022 </species> | |
| 4023 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-1" fbc:chemicalFormula="C6H11O7" hasOnlySubstanceUnits="true" id="M_m01683c" initialConcentration="0" metaid="_7e64183c-bff4-44e2-bdb9-41d69f6bed98" name="D-gluconic acid" sboTerm="SBO:0000247"> | |
| 4024 <notes> | |
| 4025 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4026 <p>kegg.compound: C00257</p> | |
| 4027 <p>hmdb: HMDB00625</p> | |
| 4028 <p>chebi: CHEBI:33198</p> | |
| 4029 <p>pubchem.compound: 10690</p> | |
| 4030 <p>metanetx.chemical: MNXM341</p> | |
| 4031 <p>formula: C6H11O7</p> | |
| 4032 <p>charge: -1</p> | |
| 4033 </body> | |
| 4034 </notes> | |
| 4035 <annotation> | |
| 4036 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4037 <rdf:Description rdf:about="#_7e64183c-bff4-44e2-bdb9-41d69f6bed98"> | |
| 4038 <bqbiol:is> | |
| 4039 <rdf:Bag> | |
| 4040 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00257"/> | |
| 4041 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00625"/> | |
| 4042 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:33198"/> | |
| 4043 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/10690"/> | |
| 4044 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM341"/> | |
| 4045 </rdf:Bag> | |
| 4046 </bqbiol:is> | |
| 4047 </rdf:Description> | |
| 4048 </rdf:RDF> | |
| 4049 </annotation> | |
| 4050 </species> | |
| 4051 <species boundaryCondition="false" compartment="r" constant="false" fbc:charge="0" fbc:chemicalFormula="H2O" hasOnlySubstanceUnits="true" id="M_m02040r" initialConcentration="0" metaid="e3ae9f2d-61b6-4fc2-b932-c251c833a03e" name="H2O" sboTerm="SBO:0000247"> | |
| 4052 <notes> | |
| 4053 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4054 <p>lipidmaps: LMST01040128</p> | |
| 4055 <p>kegg.compound: C00001</p> | |
| 4056 <p>hmdb: HMDB02111</p> | |
| 4057 <p>bigg.metabolite: h2o</p> | |
| 4058 <p>chebi: CHEBI:15377</p> | |
| 4059 <p>pubchem.compound: 962</p> | |
| 4060 <p>metanetx.chemical: MNXM2</p> | |
| 4061 <p>formula: H2O</p> | |
| 4062 </body> | |
| 4063 </notes> | |
| 4064 <annotation> | |
| 4065 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4066 <rdf:Description rdf:about="#e3ae9f2d-61b6-4fc2-b932-c251c833a03e"> | |
| 4067 <bqbiol:is> | |
| 4068 <rdf:Bag> | |
| 4069 <rdf:li rdf:resource="https://identifiers.org/lipidmaps/LMST01040128"/> | |
| 4070 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00001"/> | |
| 4071 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB02111"/> | |
| 4072 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/h2o"/> | |
| 4073 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:15377"/> | |
| 4074 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/962"/> | |
| 4075 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM2"/> | |
| 4076 </rdf:Bag> | |
| 4077 </bqbiol:is> | |
| 4078 </rdf:Description> | |
| 4079 </rdf:RDF> | |
| 4080 </annotation> | |
| 4081 </species> | |
| 4082 <species boundaryCondition="false" compartment="r" constant="false" fbc:charge="-3" fbc:chemicalFormula="C21H25N7O17P3" hasOnlySubstanceUnits="true" id="M_m02554r" initialConcentration="0" metaid="_2dffc121-cbfa-4ef2-bf72-85b96310b284" name="NADP+" sboTerm="SBO:0000247"> | |
| 4083 <notes> | |
| 4084 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4085 <p>kegg.compound: C00006</p> | |
| 4086 <p>hmdb: HMDB00217</p> | |
| 4087 <p>bigg.metabolite: nadp</p> | |
| 4088 <p>chebi: CHEBI:18009</p> | |
| 4089 <p>pubchem.compound: 5886</p> | |
| 4090 <p>metanetx.chemical: MNXM5</p> | |
| 4091 <p>formula: C21H25N7O17P3</p> | |
| 4092 <p>charge: -3</p> | |
| 4093 </body> | |
| 4094 </notes> | |
| 4095 <annotation> | |
| 4096 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4097 <rdf:Description rdf:about="#_2dffc121-cbfa-4ef2-bf72-85b96310b284"> | |
| 4098 <bqbiol:is> | |
| 4099 <rdf:Bag> | |
| 4100 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00006"/> | |
| 4101 <rdf:li rdf:resource="https://identifiers.org/hmdb/HMDB00217"/> | |
| 4102 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/nadp"/> | |
| 4103 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:18009"/> | |
| 4104 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/5886"/> | |
| 4105 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM5"/> | |
| 4106 </rdf:Bag> | |
| 4107 </bqbiol:is> | |
| 4108 </rdf:Description> | |
| 4109 </rdf:RDF> | |
| 4110 </annotation> | |
| 4111 </species> | |
| 4112 <species boundaryCondition="false" compartment="c" constant="false" fbc:charge="-2" fbc:chemicalFormula="C5H9O7P" hasOnlySubstanceUnits="true" id="M_m00640c" initialConcentration="0" metaid="_646e6e22-6191-458f-b8cb-359247dfbf5f" name="2-deoxy-D-ribose-5-phosphate" sboTerm="SBO:0000247"> | |
| 4113 <notes> | |
| 4114 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4115 <p>kegg.compound: C00673</p> | |
| 4116 <p>bigg.metabolite: 2dr5p</p> | |
| 4117 <p>chebi: CHEBI:16132</p> | |
| 4118 <p>pubchem.compound: 45934311</p> | |
| 4119 <p>metanetx.chemical: MNXM2179</p> | |
| 4120 <p>formula: C5H9O7P</p> | |
| 4121 <p>charge: -2</p> | |
| 4122 </body> | |
| 4123 </notes> | |
| 4124 <annotation> | |
| 4125 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4126 <rdf:Description rdf:about="#_646e6e22-6191-458f-b8cb-359247dfbf5f"> | |
| 4127 <bqbiol:is> | |
| 4128 <rdf:Bag> | |
| 4129 <rdf:li rdf:resource="https://identifiers.org/kegg.compound/C00673"/> | |
| 4130 <rdf:li rdf:resource="https://identifiers.org/bigg.metabolite/2dr5p"/> | |
| 4131 <rdf:li rdf:resource="https://identifiers.org/chebi/CHEBI:16132"/> | |
| 4132 <rdf:li rdf:resource="https://identifiers.org/pubchem.compound/45934311"/> | |
| 4133 <rdf:li rdf:resource="https://identifiers.org/metanetx.chemical/MNXM2179"/> | |
| 4134 </rdf:Bag> | |
| 4135 </bqbiol:is> | |
| 4136 </rdf:Description> | |
| 4137 </rdf:RDF> | |
| 4138 </annotation> | |
| 4139 </species> | |
| 4140 </listOfSpecies> | |
| 4141 <listOfParameters> | |
| 4142 <parameter constant="true" id="UPPER_BOUND_1000_0" units="mmol_per_gDW_per_hr" value="1000"/> | |
| 4143 <parameter constant="true" id="LOWER_BOUND_1000_0" units="mmol_per_gDW_per_hr" value="-1000"/> | |
| 4144 <parameter constant="true" id="LOWER_BOUND_0_0" units="mmol_per_gDW_per_hr" value="0"/> | |
| 4145 </listOfParameters> | |
| 4146 <listOfReactions> | |
| 4147 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4831" metaid="a3b700c3-d335-4df3-bb92-f8fc04db5f3d" name="R_HMR_4831" reversible="true" sboTerm="SBO:0000176"> | |
| 4148 <notes> | |
| 4149 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4150 <p>Confidence Level: 0</p> | |
| 4151 <p>ec-code: 1.1.99.13</p> | |
| 4152 <p>metanetx.reaction: MNXR107115</p> | |
| 4153 <p>kegg.reaction: R01680</p> | |
| 4154 <p>SUBSYSTEM: Galactose metabolism</p> | |
| 4155 <p>EC_NUMBER: 1.1.99.13</p> | |
| 4156 </body> | |
| 4157 </notes> | |
| 4158 <annotation> | |
| 4159 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4160 <rdf:Description rdf:about="#a3b700c3-d335-4df3-bb92-f8fc04db5f3d"> | |
| 4161 <bqbiol:is> | |
| 4162 <rdf:Bag> | |
| 4163 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.99.13"/> | |
| 4164 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR107115"/> | |
| 4165 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01680"/> | |
| 4166 </rdf:Bag> | |
| 4167 </bqbiol:is> | |
| 4168 </rdf:Description> | |
| 4169 </rdf:RDF> | |
| 4170 </annotation> | |
| 4171 <listOfReactants> | |
| 4172 <speciesReference constant="true" species="M_m02552s" stoichiometry="1"/> | |
| 4173 <speciesReference constant="true" species="M_m02332s" stoichiometry="1"/> | |
| 4174 </listOfReactants> | |
| 4175 <listOfProducts> | |
| 4176 <speciesReference constant="true" species="M_m02553s" stoichiometry="1"/> | |
| 4177 <speciesReference constant="true" species="M_m00812s" stoichiometry="1"/> | |
| 4178 <speciesReference constant="true" species="M_m02039s" stoichiometry="1"/> | |
| 4179 </listOfProducts> | |
| 4180 </reaction> | |
| 4181 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4710" metaid="e6a0e367-66fa-4310-a86d-7dde3669eac3" name="R_HMR_4710" reversible="true" sboTerm="SBO:0000176"> | |
| 4182 <notes> | |
| 4183 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4184 <p>Confidence Level: 0</p> | |
| 4185 <p>AUTHORS: PMID:3023765</p> | |
| 4186 <p>ec-code: 5.4.2.7</p> | |
| 4187 <p>metanetx.reaction: MNXR103116</p> | |
| 4188 <p>kegg.reaction: R02749</p> | |
| 4189 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
| 4190 <p>EC_NUMBER: 5.4.2.7</p> | |
| 4191 <p>pmids: 3023765</p> | |
| 4192 <p>GENE_ASSOCIATION: ( ENSG00000169299 ) OR ( ENSG00000180953 )</p> | |
| 4193 </body> | |
| 4194 </notes> | |
| 4195 <annotation> | |
| 4196 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4197 <rdf:Description rdf:about="#e6a0e367-66fa-4310-a86d-7dde3669eac3"> | |
| 4198 <bqbiol:is> | |
| 4199 <rdf:Bag> | |
| 4200 <rdf:li rdf:resource="https://identifiers.org/ec-code/5.4.2.7"/> | |
| 4201 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR103116"/> | |
| 4202 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R02749"/> | |
| 4203 </rdf:Bag> | |
| 4204 </bqbiol:is> | |
| 4205 <bqbiol:isDescribedBy> | |
| 4206 <rdf:Bag> | |
| 4207 <rdf:li rdf:resource="https://identifiers.org/pubmed/3023765"/> | |
| 4208 </rdf:Bag> | |
| 4209 </bqbiol:isDescribedBy> | |
| 4210 </rdf:Description> | |
| 4211 </rdf:RDF> | |
| 4212 </annotation> | |
| 4213 <fbc:geneProductAssociation> | |
| 4214 <fbc:or> | |
| 4215 <fbc:geneProductRef fbc:geneProduct="ENSG00000169299"/> | |
| 4216 <fbc:geneProductRef fbc:geneProduct="ENSG00000180953"/> | |
| 4217 </fbc:or> | |
| 4218 </fbc:geneProductAssociation> | |
| 4219 <listOfReactants> | |
| 4220 <speciesReference constant="true" species="M_m00639c" stoichiometry="1"/> | |
| 4221 </listOfReactants> | |
| 4222 <listOfProducts> | |
| 4223 <speciesReference constant="true" species="M_m00640c" stoichiometry="1"/> | |
| 4224 </listOfProducts> | |
| 4225 </reaction> | |
| 4226 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4832" metaid="_0a972dea-1cbc-4140-9dc6-ed7934752c06" name="R_HMR_4832" reversible="true" sboTerm="SBO:0000176"> | |
| 4227 <notes> | |
| 4228 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4229 <p>Confidence Level: 0</p> | |
| 4230 <p>AUTHORS: PMID:3109378;UNIPROT:P16278</p> | |
| 4231 <p>ec-code: 3.2.1.23</p> | |
| 4232 <p>metanetx.reaction: MNXR109113 || MNXR105374</p> | |
| 4233 <p>kegg.reaction: R04783</p> | |
| 4234 <p>SUBSYSTEM: Galactose metabolism</p> | |
| 4235 <p>EC_NUMBER: 3.2.1.23</p> | |
| 4236 <p>pmids: 3109378</p> | |
| 4237 <p>GENE_ASSOCIATION: ENSG00000115850 AND ENSG00000163521 AND ENSG00000170266 AND ENSG00000188167</p> | |
| 4238 </body> | |
| 4239 </notes> | |
| 4240 <annotation> | |
| 4241 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4242 <rdf:Description rdf:about="#_0a972dea-1cbc-4140-9dc6-ed7934752c06"> | |
| 4243 <bqbiol:is> | |
| 4244 <rdf:Bag> | |
| 4245 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.2.1.23"/> | |
| 4246 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR109113"/> | |
| 4247 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR105374"/> | |
| 4248 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R04783"/> | |
| 4249 </rdf:Bag> | |
| 4250 </bqbiol:is> | |
| 4251 <bqbiol:isDescribedBy> | |
| 4252 <rdf:Bag> | |
| 4253 <rdf:li rdf:resource="https://identifiers.org/pubmed/3109378"/> | |
| 4254 </rdf:Bag> | |
| 4255 </bqbiol:isDescribedBy> | |
| 4256 </rdf:Description> | |
| 4257 </rdf:RDF> | |
| 4258 </annotation> | |
| 4259 <fbc:geneProductAssociation> | |
| 4260 <fbc:and> | |
| 4261 <fbc:geneProductRef fbc:geneProduct="ENSG00000170266"/> | |
| 4262 <fbc:geneProductRef fbc:geneProduct="ENSG00000163521"/> | |
| 4263 <fbc:geneProductRef fbc:geneProduct="ENSG00000188167"/> | |
| 4264 <fbc:geneProductRef fbc:geneProduct="ENSG00000115850"/> | |
| 4265 </fbc:and> | |
| 4266 </fbc:geneProductAssociation> | |
| 4267 <listOfReactants> | |
| 4268 <speciesReference constant="true" species="M_m00810s" stoichiometry="1"/> | |
| 4269 <speciesReference constant="true" species="M_m01965s" stoichiometry="1"/> | |
| 4270 </listOfReactants> | |
| 4271 <listOfProducts> | |
| 4272 <speciesReference constant="true" species="M_m02040s" stoichiometry="1"/> | |
| 4273 <speciesReference constant="true" species="M_m00812s" stoichiometry="1"/> | |
| 4274 </listOfProducts> | |
| 4275 </reaction> | |
| 4276 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4315" metaid="_47e92709-8d94-4b33-a876-2890e1758a66" name="R_HMR_4315" reversible="true" sboTerm="SBO:0000176"> | |
| 4277 <notes> | |
| 4278 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4279 <p>Confidence Level: 0</p> | |
| 4280 <p>ec-code: 1.1.1.14</p> | |
| 4281 <p>metanetx.reaction: MNXR104283</p> | |
| 4282 <p>kegg.reaction: R00875</p> | |
| 4283 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
| 4284 <p>EC_NUMBER: 1.1.1.14</p> | |
| 4285 <p>GENE_ASSOCIATION: ENSG00000140263</p> | |
| 4286 </body> | |
| 4287 </notes> | |
| 4288 <annotation> | |
| 4289 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4290 <rdf:Description rdf:about="#_47e92709-8d94-4b33-a876-2890e1758a66"> | |
| 4291 <bqbiol:is> | |
| 4292 <rdf:Bag> | |
| 4293 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.14"/> | |
| 4294 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR104283"/> | |
| 4295 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R00875"/> | |
| 4296 </rdf:Bag> | |
| 4297 </bqbiol:is> | |
| 4298 </rdf:Description> | |
| 4299 </rdf:RDF> | |
| 4300 </annotation> | |
| 4301 <fbc:geneProductAssociation> | |
| 4302 <fbc:geneProductRef fbc:geneProduct="ENSG00000140263"/> | |
| 4303 </fbc:geneProductAssociation> | |
| 4304 <listOfReactants> | |
| 4305 <speciesReference constant="true" species="M_m02552c" stoichiometry="1"/> | |
| 4306 <speciesReference constant="true" species="M_m01682c" stoichiometry="1"/> | |
| 4307 </listOfReactants> | |
| 4308 <listOfProducts> | |
| 4309 <speciesReference constant="true" species="M_m01840c" stoichiometry="1"/> | |
| 4310 <speciesReference constant="true" species="M_m02553c" stoichiometry="1"/> | |
| 4311 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
| 4312 </listOfProducts> | |
| 4313 </reaction> | |
| 4314 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4316" metaid="dc10854d-832c-4e85-a025-26973915eb3c" name="R_HMR_4316" reversible="true" sboTerm="SBO:0000176"> | |
| 4315 <notes> | |
| 4316 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4317 <p>Confidence Level: 0</p> | |
| 4318 <p>ec-code: 1.1.1.21</p> | |
| 4319 <p>metanetx.reaction: MNXR104287</p> | |
| 4320 <p>kegg.reaction: R01787</p> | |
| 4321 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
| 4322 <p>EC_NUMBER: 1.1.1.21</p> | |
| 4323 <p>GENE_ASSOCIATION: ( ENSG00000085662 ) OR ( ENSG00000198074 )</p> | |
| 4324 </body> | |
| 4325 </notes> | |
| 4326 <annotation> | |
| 4327 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4328 <rdf:Description rdf:about="#dc10854d-832c-4e85-a025-26973915eb3c"> | |
| 4329 <bqbiol:is> | |
| 4330 <rdf:Bag> | |
| 4331 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.21"/> | |
| 4332 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR104287"/> | |
| 4333 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01787"/> | |
| 4334 </rdf:Bag> | |
| 4335 </bqbiol:is> | |
| 4336 </rdf:Description> | |
| 4337 </rdf:RDF> | |
| 4338 </annotation> | |
| 4339 <fbc:geneProductAssociation> | |
| 4340 <fbc:or> | |
| 4341 <fbc:geneProductRef fbc:geneProduct="ENSG00000198074"/> | |
| 4342 <fbc:geneProductRef fbc:geneProduct="ENSG00000085662"/> | |
| 4343 </fbc:or> | |
| 4344 </fbc:geneProductAssociation> | |
| 4345 <listOfReactants> | |
| 4346 <speciesReference constant="true" species="M_m02554c" stoichiometry="1"/> | |
| 4347 <speciesReference constant="true" species="M_m01682c" stoichiometry="1"/> | |
| 4348 </listOfReactants> | |
| 4349 <listOfProducts> | |
| 4350 <speciesReference constant="true" species="M_m01965c" stoichiometry="1"/> | |
| 4351 <speciesReference constant="true" species="M_m02555c" stoichiometry="1"/> | |
| 4352 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
| 4353 </listOfProducts> | |
| 4354 </reaction> | |
| 4355 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4317" metaid="_36d1db72-1f57-4631-aff2-71a5a6395889" name="R_HMR_4317" reversible="false" sboTerm="SBO:0000176"> | |
| 4356 <notes> | |
| 4357 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4358 <p>Confidence Level: 0</p> | |
| 4359 <p>AUTHORS: PMID:2211634</p> | |
| 4360 <p>ec-code: 2.7.1.-</p> | |
| 4361 <p>metanetx.reaction: MNXR103725</p> | |
| 4362 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
| 4363 <p>EC_NUMBER: 2.7.1.-</p> | |
| 4364 <p>pmids: 2211634</p> | |
| 4365 <p>GENE_ASSOCIATION: ( ENSG00000116199 ) OR ( ENSG00000141560 ) OR ( ENSG00000162408 ) OR ( ENSG00000167363 ) OR ( ENSG00000172456 )</p> | |
| 4366 </body> | |
| 4367 </notes> | |
| 4368 <annotation> | |
| 4369 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4370 <rdf:Description rdf:about="#_36d1db72-1f57-4631-aff2-71a5a6395889"> | |
| 4371 <bqbiol:is> | |
| 4372 <rdf:Bag> | |
| 4373 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.-"/> | |
| 4374 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR103725"/> | |
| 4375 </rdf:Bag> | |
| 4376 </bqbiol:is> | |
| 4377 <bqbiol:isDescribedBy> | |
| 4378 <rdf:Bag> | |
| 4379 <rdf:li rdf:resource="https://identifiers.org/pubmed/2211634"/> | |
| 4380 </rdf:Bag> | |
| 4381 </bqbiol:isDescribedBy> | |
| 4382 </rdf:Description> | |
| 4383 </rdf:RDF> | |
| 4384 </annotation> | |
| 4385 <fbc:geneProductAssociation> | |
| 4386 <fbc:or> | |
| 4387 <fbc:geneProductRef fbc:geneProduct="ENSG00000116199"/> | |
| 4388 <fbc:geneProductRef fbc:geneProduct="ENSG00000141560"/> | |
| 4389 <fbc:geneProductRef fbc:geneProduct="ENSG00000162408"/> | |
| 4390 <fbc:geneProductRef fbc:geneProduct="ENSG00000172456"/> | |
| 4391 <fbc:geneProductRef fbc:geneProduct="ENSG00000167363"/> | |
| 4392 </fbc:or> | |
| 4393 </fbc:geneProductAssociation> | |
| 4394 <listOfReactants> | |
| 4395 <speciesReference constant="true" species="M_m01371c" stoichiometry="1"/> | |
| 4396 <speciesReference constant="true" species="M_m01682c" stoichiometry="1"/> | |
| 4397 </listOfReactants> | |
| 4398 <listOfProducts> | |
| 4399 <speciesReference constant="true" species="M_m02917c" stoichiometry="1"/> | |
| 4400 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
| 4401 <speciesReference constant="true" species="M_m01285c" stoichiometry="1"/> | |
| 4402 </listOfProducts> | |
| 4403 </reaction> | |
| 4404 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4318" metaid="_008e8008-7d8f-4404-bca8-d5c7e6a2b321" name="R_HMR_4318" reversible="false" sboTerm="SBO:0000176"> | |
| 4405 <notes> | |
| 4406 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4407 <p>Confidence Level: 0</p> | |
| 4408 <p>ec-code: 2.7.1.-</p> | |
| 4409 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
| 4410 <p>EC_NUMBER: 2.7.1.-</p> | |
| 4411 <p>GENE_ASSOCIATION: ( ENSG00000116199 ) OR ( ENSG00000141560 ) OR ( ENSG00000162408 ) OR ( ENSG00000167363 ) OR ( ENSG00000172456 )</p> | |
| 4412 </body> | |
| 4413 </notes> | |
| 4414 <annotation> | |
| 4415 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4416 <rdf:Description rdf:about="#_008e8008-7d8f-4404-bca8-d5c7e6a2b321"> | |
| 4417 <bqbiol:is> | |
| 4418 <rdf:Bag> | |
| 4419 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.-"/> | |
| 4420 </rdf:Bag> | |
| 4421 </bqbiol:is> | |
| 4422 </rdf:Description> | |
| 4423 </rdf:RDF> | |
| 4424 </annotation> | |
| 4425 <fbc:geneProductAssociation> | |
| 4426 <fbc:or> | |
| 4427 <fbc:geneProductRef fbc:geneProduct="ENSG00000116199"/> | |
| 4428 <fbc:geneProductRef fbc:geneProduct="ENSG00000141560"/> | |
| 4429 <fbc:geneProductRef fbc:geneProduct="ENSG00000162408"/> | |
| 4430 <fbc:geneProductRef fbc:geneProduct="ENSG00000172456"/> | |
| 4431 <fbc:geneProductRef fbc:geneProduct="ENSG00000167363"/> | |
| 4432 </fbc:or> | |
| 4433 </fbc:geneProductAssociation> | |
| 4434 <listOfReactants> | |
| 4435 <speciesReference constant="true" species="M_m01371c" stoichiometry="1"/> | |
| 4436 <speciesReference constant="true" species="M_m01840c" stoichiometry="1"/> | |
| 4437 </listOfReactants> | |
| 4438 <listOfProducts> | |
| 4439 <speciesReference constant="true" species="M_m01844c" stoichiometry="1"/> | |
| 4440 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
| 4441 <speciesReference constant="true" species="M_m01285c" stoichiometry="1"/> | |
| 4442 </listOfProducts> | |
| 4443 </reaction> | |
| 4444 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_3944" metaid="e3f7be38-4458-4c4b-9e00-ba70676d46ba" name="R_HMR_3944" reversible="false" sboTerm="SBO:0000176"> | |
| 4445 <notes> | |
| 4446 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4447 <p>Confidence Level: 0</p> | |
| 4448 <p>AUTHORS: PMID:223665;PMID:4433565;PMID:4436332;PMID:6318818;PMID:6320876;PMID:8612650</p> | |
| 4449 <p>ec-code: 2.7.7.9</p> | |
| 4450 <p>metanetx.reaction: MNXR100022</p> | |
| 4451 <p>kegg.reaction: R00289</p> | |
| 4452 <p>bigg.reaction: GALUi</p> | |
| 4453 <p>SUBSYSTEM: Galactose metabolism</p> | |
| 4454 <p>EC_NUMBER: 2.7.7.9</p> | |
| 4455 <p>pmids: 223665,4433565,4436332,6318818,6320876,8612650</p> | |
| 4456 <p>GENE_ASSOCIATION: ENSG00000169764</p> | |
| 4457 </body> | |
| 4458 </notes> | |
| 4459 <annotation> | |
| 4460 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4461 <rdf:Description rdf:about="#e3f7be38-4458-4c4b-9e00-ba70676d46ba"> | |
| 4462 <bqbiol:is> | |
| 4463 <rdf:Bag> | |
| 4464 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.7.9"/> | |
| 4465 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR100022"/> | |
| 4466 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R00289"/> | |
| 4467 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/GALUi"/> | |
| 4468 </rdf:Bag> | |
| 4469 </bqbiol:is> | |
| 4470 <bqbiol:isDescribedBy> | |
| 4471 <rdf:Bag> | |
| 4472 <rdf:li rdf:resource="https://identifiers.org/pubmed/223665"/> | |
| 4473 <rdf:li rdf:resource="https://identifiers.org/pubmed/6318818"/> | |
| 4474 <rdf:li rdf:resource="https://identifiers.org/pubmed/8612650"/> | |
| 4475 <rdf:li rdf:resource="https://identifiers.org/pubmed/6320876"/> | |
| 4476 <rdf:li rdf:resource="https://identifiers.org/pubmed/4433565"/> | |
| 4477 <rdf:li rdf:resource="https://identifiers.org/pubmed/4436332"/> | |
| 4478 </rdf:Bag> | |
| 4479 </bqbiol:isDescribedBy> | |
| 4480 </rdf:Description> | |
| 4481 </rdf:RDF> | |
| 4482 </annotation> | |
| 4483 <fbc:geneProductAssociation> | |
| 4484 <fbc:geneProductRef fbc:geneProduct="ENSG00000169764"/> | |
| 4485 </fbc:geneProductAssociation> | |
| 4486 <listOfReactants> | |
| 4487 <speciesReference constant="true" species="M_m03130c" stoichiometry="1"/> | |
| 4488 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
| 4489 <speciesReference constant="true" species="M_m01967c" stoichiometry="1"/> | |
| 4490 </listOfReactants> | |
| 4491 <listOfProducts> | |
| 4492 <speciesReference constant="true" species="M_m03108c" stoichiometry="1"/> | |
| 4493 <speciesReference constant="true" species="M_m02759c" stoichiometry="1"/> | |
| 4494 </listOfProducts> | |
| 4495 </reaction> | |
| 4496 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4319" metaid="_45d0d167-05cb-4738-8b64-49f3791a4688" name="R_HMR_4319" reversible="false" sboTerm="SBO:0000176"> | |
| 4497 <notes> | |
| 4498 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4499 <p>Confidence Level: 0</p> | |
| 4500 <p>AUTHORS: PMID:16906315;PMID:7061426;PMID:7150652;PMID:8717435</p> | |
| 4501 <p>ec-code: 2.7.1.1</p> | |
| 4502 <p>metanetx.reaction: MNXR100614</p> | |
| 4503 <p>kegg.reaction: R00760</p> | |
| 4504 <p>bigg.reaction: HEX7</p> | |
| 4505 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
| 4506 <p>EC_NUMBER: 2.7.1.1</p> | |
| 4507 <p>pmids: 7061426,7150652,8717435,16906315</p> | |
| 4508 <p>GENE_ASSOCIATION: ( ENSG00000156510 ) OR ( ENSG00000156515 ) OR ( ENSG00000159399 ) OR ( ENSG00000160883 )</p> | |
| 4509 </body> | |
| 4510 </notes> | |
| 4511 <annotation> | |
| 4512 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4513 <rdf:Description rdf:about="#_45d0d167-05cb-4738-8b64-49f3791a4688"> | |
| 4514 <bqbiol:is> | |
| 4515 <rdf:Bag> | |
| 4516 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.1"/> | |
| 4517 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR100614"/> | |
| 4518 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R00760"/> | |
| 4519 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/HEX7"/> | |
| 4520 </rdf:Bag> | |
| 4521 </bqbiol:is> | |
| 4522 <bqbiol:isDescribedBy> | |
| 4523 <rdf:Bag> | |
| 4524 <rdf:li rdf:resource="https://identifiers.org/pubmed/7150652"/> | |
| 4525 <rdf:li rdf:resource="https://identifiers.org/pubmed/7061426"/> | |
| 4526 <rdf:li rdf:resource="https://identifiers.org/pubmed/16906315"/> | |
| 4527 <rdf:li rdf:resource="https://identifiers.org/pubmed/8717435"/> | |
| 4528 </rdf:Bag> | |
| 4529 </bqbiol:isDescribedBy> | |
| 4530 </rdf:Description> | |
| 4531 </rdf:RDF> | |
| 4532 </annotation> | |
| 4533 <fbc:geneProductAssociation> | |
| 4534 <fbc:or> | |
| 4535 <fbc:geneProductRef fbc:geneProduct="ENSG00000159399"/> | |
| 4536 <fbc:geneProductRef fbc:geneProduct="ENSG00000160883"/> | |
| 4537 <fbc:geneProductRef fbc:geneProduct="ENSG00000156510"/> | |
| 4538 <fbc:geneProductRef fbc:geneProduct="ENSG00000156515"/> | |
| 4539 </fbc:or> | |
| 4540 </fbc:geneProductAssociation> | |
| 4541 <listOfReactants> | |
| 4542 <speciesReference constant="true" species="M_m01371c" stoichiometry="1"/> | |
| 4543 <speciesReference constant="true" species="M_m01840c" stoichiometry="1"/> | |
| 4544 </listOfReactants> | |
| 4545 <listOfProducts> | |
| 4546 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
| 4547 <speciesReference constant="true" species="M_m01285c" stoichiometry="1"/> | |
| 4548 <speciesReference constant="true" species="M_m01845c" stoichiometry="1"/> | |
| 4549 </listOfProducts> | |
| 4550 </reaction> | |
| 4551 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_RPEc" metaid="_060005cd-e77c-4aec-9a9e-9953a24e631e" name="Ribulose 5-Phosphate 3-Epimerase" reversible="true" sboTerm="SBO:0000176"> | |
| 4552 <notes> | |
| 4553 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4554 <p>Confidence Level: 0</p> | |
| 4555 <p>AUTHORS: PMID: 4382012, PMID: 13575411, Harpers illustrated Biochemistry (2009) 28th edition pages 174-183</p> | |
| 4556 <p>ec-code: 5.1.3.1</p> | |
| 4557 <p>bigg.reaction: RPEc</p> | |
| 4558 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
| 4559 <p>EC_NUMBER: 5.1.3.1</p> | |
| 4560 <p>pmids: 4382012,13575411</p> | |
| 4561 <p>GENE_ASSOCIATION: ENSG00000197713</p> | |
| 4562 </body> | |
| 4563 </notes> | |
| 4564 <annotation> | |
| 4565 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4566 <rdf:Description rdf:about="#_060005cd-e77c-4aec-9a9e-9953a24e631e"> | |
| 4567 <bqbiol:is> | |
| 4568 <rdf:Bag> | |
| 4569 <rdf:li rdf:resource="https://identifiers.org/ec-code/5.1.3.1"/> | |
| 4570 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/RPEc"/> | |
| 4571 </rdf:Bag> | |
| 4572 </bqbiol:is> | |
| 4573 <bqbiol:isDescribedBy> | |
| 4574 <rdf:Bag> | |
| 4575 <rdf:li rdf:resource="https://identifiers.org/pubmed/13575411"/> | |
| 4576 <rdf:li rdf:resource="https://identifiers.org/pubmed/4382012"/> | |
| 4577 </rdf:Bag> | |
| 4578 </bqbiol:isDescribedBy> | |
| 4579 </rdf:Description> | |
| 4580 </rdf:RDF> | |
| 4581 </annotation> | |
| 4582 <fbc:geneProductAssociation> | |
| 4583 <fbc:geneProductRef fbc:geneProduct="ENSG00000197713"/> | |
| 4584 </fbc:geneProductAssociation> | |
| 4585 <listOfReactants> | |
| 4586 <speciesReference constant="true" species="M_m02846c" stoichiometry="2"/> | |
| 4587 </listOfReactants> | |
| 4588 <listOfProducts> | |
| 4589 <speciesReference constant="true" species="M_m01761c" stoichiometry="2"/> | |
| 4590 </listOfProducts> | |
| 4591 </reaction> | |
| 4592 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_GLYPHEHYc" metaid="_841ed12c-3095-4d2d-88c0-b2d51dc181bc" name="Hydrolysis of Glycylphenylalanine" reversible="true" sboTerm="SBO:0000176"> | |
| 4593 <notes> | |
| 4594 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4595 <p>Confidence Level: 0</p> | |
| 4596 <p>AUTHORS: most probable reaction. added during gap filling.</p> | |
| 4597 <p>metanetx.reaction: MNXR100357</p> | |
| 4598 <p>bigg.reaction: GLYPHEHYc</p> | |
| 4599 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
| 4600 </body> | |
| 4601 </notes> | |
| 4602 <annotation> | |
| 4603 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4604 <rdf:Description rdf:about="#_841ed12c-3095-4d2d-88c0-b2d51dc181bc"> | |
| 4605 <bqbiol:is> | |
| 4606 <rdf:Bag> | |
| 4607 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR100357"/> | |
| 4608 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/GLYPHEHYc"/> | |
| 4609 </rdf:Bag> | |
| 4610 </bqbiol:is> | |
| 4611 </rdf:Description> | |
| 4612 </rdf:RDF> | |
| 4613 </annotation> | |
| 4614 <listOfReactants> | |
| 4615 <speciesReference constant="true" species="M_glyphe_c" stoichiometry="1"/> | |
| 4616 <speciesReference constant="true" species="M_m02040c" stoichiometry="1"/> | |
| 4617 </listOfReactants> | |
| 4618 <listOfProducts> | |
| 4619 <speciesReference constant="true" species="M_m02724c" stoichiometry="1"/> | |
| 4620 <speciesReference constant="true" species="M_m01986c" stoichiometry="1"/> | |
| 4621 </listOfProducts> | |
| 4622 </reaction> | |
| 4623 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_8762" metaid="b7a3dbfa-eb0f-42d0-890e-a21c45957a2f" name="R_HMR_8762" reversible="true" sboTerm="SBO:0000176"> | |
| 4624 <notes> | |
| 4625 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4626 <p>Confidence Level: 0</p> | |
| 4627 <p>ec-code: 4.1.2.13</p> | |
| 4628 <p>metanetx.reaction: MNXR99466</p> | |
| 4629 <p>bigg.reaction: FBP26</p> | |
| 4630 <p>SUBSYSTEM: Galactose metabolism</p> | |
| 4631 <p>EC_NUMBER: 4.1.2.13</p> | |
| 4632 <p>GENE_ASSOCIATION: ( ENSG00000109107 ) OR ( ENSG00000136872 ) OR ( ENSG00000149925 ) OR ( ENSG00000285043 )</p> | |
| 4633 </body> | |
| 4634 </notes> | |
| 4635 <annotation> | |
| 4636 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4637 <rdf:Description rdf:about="#b7a3dbfa-eb0f-42d0-890e-a21c45957a2f"> | |
| 4638 <bqbiol:is> | |
| 4639 <rdf:Bag> | |
| 4640 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.1.2.13"/> | |
| 4641 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR99466"/> | |
| 4642 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/FBP26"/> | |
| 4643 </rdf:Bag> | |
| 4644 </bqbiol:is> | |
| 4645 </rdf:Description> | |
| 4646 </rdf:RDF> | |
| 4647 </annotation> | |
| 4648 <fbc:geneProductAssociation> | |
| 4649 <fbc:or> | |
| 4650 <fbc:geneProductRef fbc:geneProduct="ENSG00000136872"/> | |
| 4651 <fbc:geneProductRef fbc:geneProduct="ENSG00000149925"/> | |
| 4652 <fbc:geneProductRef fbc:geneProduct="ENSG00000109107"/> | |
| 4653 <fbc:geneProductRef fbc:geneProduct="ENSG00000285043"/> | |
| 4654 </fbc:or> | |
| 4655 </fbc:geneProductAssociation> | |
| 4656 <listOfReactants> | |
| 4657 <speciesReference constant="true" species="M_m01746c" stoichiometry="1"/> | |
| 4658 </listOfReactants> | |
| 4659 <listOfProducts> | |
| 4660 <speciesReference constant="true" species="M_m01690c" stoichiometry="1"/> | |
| 4661 <speciesReference constant="true" species="M_m01981c" stoichiometry="1"/> | |
| 4662 </listOfProducts> | |
| 4663 </reaction> | |
| 4664 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_7674" metaid="_3217a74c-f7b4-467b-a857-58e20a23c963" name="R_HMR_7674" reversible="false" sboTerm="SBO:0000176"> | |
| 4665 <notes> | |
| 4666 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4667 <p>Confidence Level: 0</p> | |
| 4668 <p>ec-code: 2.4.1.22</p> | |
| 4669 <p>metanetx.reaction: MNXR105080</p> | |
| 4670 <p>kegg.reaction: R00503</p> | |
| 4671 <p>bigg.reaction: UGALGTg</p> | |
| 4672 <p>SUBSYSTEM: Galactose metabolism</p> | |
| 4673 <p>EC_NUMBER: 2.4.1.22</p> | |
| 4674 <p>GENE_ASSOCIATION: ( ENSG00000086062 ) OR ( ENSG00000117411 ) OR ( ENSG00000167531 )</p> | |
| 4675 </body> | |
| 4676 </notes> | |
| 4677 <annotation> | |
| 4678 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4679 <rdf:Description rdf:about="#_3217a74c-f7b4-467b-a857-58e20a23c963"> | |
| 4680 <bqbiol:is> | |
| 4681 <rdf:Bag> | |
| 4682 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.4.1.22"/> | |
| 4683 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR105080"/> | |
| 4684 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R00503"/> | |
| 4685 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/UGALGTg"/> | |
| 4686 </rdf:Bag> | |
| 4687 </bqbiol:is> | |
| 4688 </rdf:Description> | |
| 4689 </rdf:RDF> | |
| 4690 </annotation> | |
| 4691 <fbc:geneProductAssociation> | |
| 4692 <fbc:or> | |
| 4693 <fbc:geneProductRef fbc:geneProduct="ENSG00000167531"/> | |
| 4694 <fbc:geneProductRef fbc:geneProduct="ENSG00000086062"/> | |
| 4695 <fbc:geneProductRef fbc:geneProduct="ENSG00000117411"/> | |
| 4696 </fbc:or> | |
| 4697 </fbc:geneProductAssociation> | |
| 4698 <listOfReactants> | |
| 4699 <speciesReference constant="true" species="M_m01965g" stoichiometry="1"/> | |
| 4700 <speciesReference constant="true" species="M_m03107g" stoichiometry="1"/> | |
| 4701 </listOfReactants> | |
| 4702 <listOfProducts> | |
| 4703 <speciesReference constant="true" species="M_m02039g" stoichiometry="1"/> | |
| 4704 <speciesReference constant="true" species="M_m03106g" stoichiometry="1"/> | |
| 4705 <speciesReference constant="true" species="M_m02332g" stoichiometry="1"/> | |
| 4706 </listOfProducts> | |
| 4707 </reaction> | |
| 4708 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_8761" metaid="_9b5f5c01-dd04-4b3e-a91e-008503d581a0" name="R_HMR_8761" reversible="false" sboTerm="SBO:0000176"> | |
| 4709 <notes> | |
| 4710 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4711 <p>Confidence Level: 0</p> | |
| 4712 <p>ec-code: 2.7.1.3</p> | |
| 4713 <p>metanetx.reaction: MNXR100938</p> | |
| 4714 <p>kegg.reaction: R02927</p> | |
| 4715 <p>bigg.reaction: KHK3</p> | |
| 4716 <p>SUBSYSTEM: Galactose metabolism</p> | |
| 4717 <p>EC_NUMBER: 2.7.1.3</p> | |
| 4718 <p>GENE_ASSOCIATION: ENSG00000138030</p> | |
| 4719 </body> | |
| 4720 </notes> | |
| 4721 <annotation> | |
| 4722 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4723 <rdf:Description rdf:about="#_9b5f5c01-dd04-4b3e-a91e-008503d581a0"> | |
| 4724 <bqbiol:is> | |
| 4725 <rdf:Bag> | |
| 4726 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.3"/> | |
| 4727 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR100938"/> | |
| 4728 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R02927"/> | |
| 4729 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/KHK3"/> | |
| 4730 </rdf:Bag> | |
| 4731 </bqbiol:is> | |
| 4732 </rdf:Description> | |
| 4733 </rdf:RDF> | |
| 4734 </annotation> | |
| 4735 <fbc:geneProductAssociation> | |
| 4736 <fbc:geneProductRef fbc:geneProduct="ENSG00000138030"/> | |
| 4737 </fbc:geneProductAssociation> | |
| 4738 <listOfReactants> | |
| 4739 <speciesReference constant="true" species="M_m01371c" stoichiometry="1"/> | |
| 4740 <speciesReference constant="true" species="M_m01745c" stoichiometry="1"/> | |
| 4741 </listOfReactants> | |
| 4742 <listOfProducts> | |
| 4743 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
| 4744 <speciesReference constant="true" species="M_m01285c" stoichiometry="1"/> | |
| 4745 <speciesReference constant="true" species="M_m01746c" stoichiometry="1"/> | |
| 4746 </listOfProducts> | |
| 4747 </reaction> | |
| 4748 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4320" metaid="a8abfc18-6328-4a50-8b08-d17a3f28c8b2" name="R_HMR_4320" reversible="false" sboTerm="SBO:0000176"> | |
| 4749 <notes> | |
| 4750 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4751 <p>Confidence Level: 0</p> | |
| 4752 <p>AUTHORS: PMID:10085245</p> | |
| 4753 <p>ec-code: 2.7.1.-</p> | |
| 4754 <p>metanetx.reaction: MNXR103514</p> | |
| 4755 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
| 4756 <p>EC_NUMBER: 2.7.1.-</p> | |
| 4757 <p>pmids: 10085245</p> | |
| 4758 <p>GENE_ASSOCIATION: ( ENSG00000116199 ) OR ( ENSG00000141560 ) OR ( ENSG00000162408 ) OR ( ENSG00000167363 ) OR ( ENSG00000172456 )</p> | |
| 4759 </body> | |
| 4760 </notes> | |
| 4761 <annotation> | |
| 4762 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4763 <rdf:Description rdf:about="#a8abfc18-6328-4a50-8b08-d17a3f28c8b2"> | |
| 4764 <bqbiol:is> | |
| 4765 <rdf:Bag> | |
| 4766 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.-"/> | |
| 4767 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR103514"/> | |
| 4768 </rdf:Bag> | |
| 4769 </bqbiol:is> | |
| 4770 <bqbiol:isDescribedBy> | |
| 4771 <rdf:Bag> | |
| 4772 <rdf:li rdf:resource="https://identifiers.org/pubmed/10085245"/> | |
| 4773 </rdf:Bag> | |
| 4774 </bqbiol:isDescribedBy> | |
| 4775 </rdf:Description> | |
| 4776 </rdf:RDF> | |
| 4777 </annotation> | |
| 4778 <fbc:geneProductAssociation> | |
| 4779 <fbc:or> | |
| 4780 <fbc:geneProductRef fbc:geneProduct="ENSG00000116199"/> | |
| 4781 <fbc:geneProductRef fbc:geneProduct="ENSG00000141560"/> | |
| 4782 <fbc:geneProductRef fbc:geneProduct="ENSG00000162408"/> | |
| 4783 <fbc:geneProductRef fbc:geneProduct="ENSG00000172456"/> | |
| 4784 <fbc:geneProductRef fbc:geneProduct="ENSG00000167363"/> | |
| 4785 </fbc:or> | |
| 4786 </fbc:geneProductAssociation> | |
| 4787 <listOfReactants> | |
| 4788 <speciesReference constant="true" species="M_m02454c" stoichiometry="1"/> | |
| 4789 <speciesReference constant="true" species="M_m01371c" stoichiometry="1"/> | |
| 4790 </listOfReactants> | |
| 4791 <listOfProducts> | |
| 4792 <speciesReference constant="true" species="M_m01717c" stoichiometry="1"/> | |
| 4793 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
| 4794 <speciesReference constant="true" species="M_m01285c" stoichiometry="1"/> | |
| 4795 </listOfProducts> | |
| 4796 </reaction> | |
| 4797 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_8766" metaid="_67a27b12-ccf1-4623-a972-3aff79c6f80d" name="R_HMR_8766" reversible="true" sboTerm="SBO:0000176"> | |
| 4798 <notes> | |
| 4799 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4800 <p>Confidence Level: 0</p> | |
| 4801 <p>ec-code: 1.1.1.21</p> | |
| 4802 <p>metanetx.reaction: MNXR100012</p> | |
| 4803 <p>kegg.reaction: R01095</p> | |
| 4804 <p>bigg.reaction: GALSIDEtl</p> | |
| 4805 <p>SUBSYSTEM: Galactose metabolism</p> | |
| 4806 <p>EC_NUMBER: 1.1.1.21</p> | |
| 4807 <p>GENE_ASSOCIATION: ( ENSG00000085662 ) OR ( ENSG00000198074 )</p> | |
| 4808 </body> | |
| 4809 </notes> | |
| 4810 <annotation> | |
| 4811 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4812 <rdf:Description rdf:about="#_67a27b12-ccf1-4623-a972-3aff79c6f80d"> | |
| 4813 <bqbiol:is> | |
| 4814 <rdf:Bag> | |
| 4815 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.21"/> | |
| 4816 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR100012"/> | |
| 4817 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01095"/> | |
| 4818 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/GALSIDEtl"/> | |
| 4819 </rdf:Bag> | |
| 4820 </bqbiol:is> | |
| 4821 </rdf:Description> | |
| 4822 </rdf:RDF> | |
| 4823 </annotation> | |
| 4824 <fbc:geneProductAssociation> | |
| 4825 <fbc:or> | |
| 4826 <fbc:geneProductRef fbc:geneProduct="ENSG00000198074"/> | |
| 4827 <fbc:geneProductRef fbc:geneProduct="ENSG00000085662"/> | |
| 4828 </fbc:or> | |
| 4829 </fbc:geneProductAssociation> | |
| 4830 <listOfReactants> | |
| 4831 <speciesReference constant="true" species="M_m01910c" stoichiometry="1"/> | |
| 4832 <speciesReference constant="true" species="M_m02555c" stoichiometry="1"/> | |
| 4833 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
| 4834 </listOfReactants> | |
| 4835 <listOfProducts> | |
| 4836 <speciesReference constant="true" species="M_m02554c" stoichiometry="1"/> | |
| 4837 <speciesReference constant="true" species="M_m01909c" stoichiometry="1"/> | |
| 4838 </listOfProducts> | |
| 4839 </reaction> | |
| 4840 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_8767" metaid="_8b416bb5-ba06-4ea8-a781-6758242e28a2" name="R_HMR_8767" reversible="false" sboTerm="SBO:0000176"> | |
| 4841 <notes> | |
| 4842 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4843 <p>Confidence Level: 0</p> | |
| 4844 <p>ec-code: 2.7.7.12</p> | |
| 4845 <p>metanetx.reaction: MNXR100027</p> | |
| 4846 <p>kegg.reaction: R00502</p> | |
| 4847 <p>bigg.reaction: GALt2_2</p> | |
| 4848 <p>SUBSYSTEM: Galactose metabolism</p> | |
| 4849 <p>EC_NUMBER: 2.7.7.12</p> | |
| 4850 <p>GENE_ASSOCIATION: ENSG00000213930</p> | |
| 4851 </body> | |
| 4852 </notes> | |
| 4853 <annotation> | |
| 4854 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4855 <rdf:Description rdf:about="#_8b416bb5-ba06-4ea8-a781-6758242e28a2"> | |
| 4856 <bqbiol:is> | |
| 4857 <rdf:Bag> | |
| 4858 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.7.12"/> | |
| 4859 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR100027"/> | |
| 4860 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R00502"/> | |
| 4861 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/GALt2_2"/> | |
| 4862 </rdf:Bag> | |
| 4863 </bqbiol:is> | |
| 4864 </rdf:Description> | |
| 4865 </rdf:RDF> | |
| 4866 </annotation> | |
| 4867 <fbc:geneProductAssociation> | |
| 4868 <fbc:geneProductRef fbc:geneProduct="ENSG00000213930"/> | |
| 4869 </fbc:geneProductAssociation> | |
| 4870 <listOfReactants> | |
| 4871 <speciesReference constant="true" species="M_m03130c" stoichiometry="1"/> | |
| 4872 <speciesReference constant="true" species="M_m01322c" stoichiometry="1"/> | |
| 4873 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
| 4874 </listOfReactants> | |
| 4875 <listOfProducts> | |
| 4876 <speciesReference constant="true" species="M_m02759c" stoichiometry="1"/> | |
| 4877 <speciesReference constant="true" species="M_m03107c" stoichiometry="1"/> | |
| 4878 </listOfProducts> | |
| 4879 </reaction> | |
| 4880 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_8764" metaid="_4a18991c-afe6-4ab4-9518-7eea4183c3a8" name="R_HMR_8764" reversible="false" sboTerm="SBO:0000176"> | |
| 4881 <notes> | |
| 4882 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4883 <p>Confidence Level: 0</p> | |
| 4884 <p>ec-code: 3.2.1.108</p> | |
| 4885 <p>metanetx.reaction: MNXR101000</p> | |
| 4886 <p>kegg.reaction: R06114</p> | |
| 4887 <p>bigg.reaction: LACZly</p> | |
| 4888 <p>SUBSYSTEM: Galactose metabolism</p> | |
| 4889 <p>EC_NUMBER: 3.2.1.108</p> | |
| 4890 <p>GENE_ASSOCIATION: ENSG00000115850</p> | |
| 4891 </body> | |
| 4892 </notes> | |
| 4893 <annotation> | |
| 4894 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4895 <rdf:Description rdf:about="#_4a18991c-afe6-4ab4-9518-7eea4183c3a8"> | |
| 4896 <bqbiol:is> | |
| 4897 <rdf:Bag> | |
| 4898 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.2.1.108"/> | |
| 4899 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR101000"/> | |
| 4900 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R06114"/> | |
| 4901 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/LACZly"/> | |
| 4902 </rdf:Bag> | |
| 4903 </bqbiol:is> | |
| 4904 </rdf:Description> | |
| 4905 </rdf:RDF> | |
| 4906 </annotation> | |
| 4907 <fbc:geneProductAssociation> | |
| 4908 <fbc:geneProductRef fbc:geneProduct="ENSG00000115850"/> | |
| 4909 </fbc:geneProductAssociation> | |
| 4910 <listOfReactants> | |
| 4911 <speciesReference constant="true" species="M_m02040l" stoichiometry="1"/> | |
| 4912 <speciesReference constant="true" species="M_m02332l" stoichiometry="1"/> | |
| 4913 </listOfReactants> | |
| 4914 <listOfProducts> | |
| 4915 <speciesReference constant="true" species="M_m01910l" stoichiometry="1"/> | |
| 4916 <speciesReference constant="true" species="M_m01965l" stoichiometry="1"/> | |
| 4917 </listOfProducts> | |
| 4918 </reaction> | |
| 4919 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4400" metaid="_24e2c246-dc4f-43cb-b817-8363e45ca0f0" name="R_HMR_4400" reversible="false" sboTerm="SBO:0000176"> | |
| 4920 <notes> | |
| 4921 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4922 <p>Confidence Level: 0</p> | |
| 4923 <p>AUTHORS: PMID:10410995;PMID:2428310;PMID:9603974</p> | |
| 4924 <p>ec-code: 1.1.1.271</p> | |
| 4925 <p>metanetx.reaction: MNXR100108 || MNXR105384</p> | |
| 4926 <p>kegg.reaction: R05692</p> | |
| 4927 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
| 4928 <p>EC_NUMBER: 1.1.1.271</p> | |
| 4929 <p>pmids: 2428310,9603974,10410995</p> | |
| 4930 <p>GENE_ASSOCIATION: ENSG00000104522</p> | |
| 4931 </body> | |
| 4932 </notes> | |
| 4933 <annotation> | |
| 4934 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4935 <rdf:Description rdf:about="#_24e2c246-dc4f-43cb-b817-8363e45ca0f0"> | |
| 4936 <bqbiol:is> | |
| 4937 <rdf:Bag> | |
| 4938 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.271"/> | |
| 4939 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR100108"/> | |
| 4940 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR105384"/> | |
| 4941 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R05692"/> | |
| 4942 </rdf:Bag> | |
| 4943 </bqbiol:is> | |
| 4944 <bqbiol:isDescribedBy> | |
| 4945 <rdf:Bag> | |
| 4946 <rdf:li rdf:resource="https://identifiers.org/pubmed/2428310"/> | |
| 4947 <rdf:li rdf:resource="https://identifiers.org/pubmed/9603974"/> | |
| 4948 <rdf:li rdf:resource="https://identifiers.org/pubmed/10410995"/> | |
| 4949 </rdf:Bag> | |
| 4950 </bqbiol:isDescribedBy> | |
| 4951 </rdf:Description> | |
| 4952 </rdf:RDF> | |
| 4953 </annotation> | |
| 4954 <fbc:geneProductAssociation> | |
| 4955 <fbc:geneProductRef fbc:geneProduct="ENSG00000104522"/> | |
| 4956 </fbc:geneProductAssociation> | |
| 4957 <listOfReactants> | |
| 4958 <speciesReference constant="true" species="M_m01949c" stoichiometry="1"/> | |
| 4959 <speciesReference constant="true" species="M_m02553c" stoichiometry="1"/> | |
| 4960 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
| 4961 </listOfReactants> | |
| 4962 <listOfProducts> | |
| 4963 <speciesReference constant="true" species="M_m02552c" stoichiometry="1"/> | |
| 4964 <speciesReference constant="true" species="M_m01950c" stoichiometry="1"/> | |
| 4965 </listOfProducts> | |
| 4966 </reaction> | |
| 4967 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4565" metaid="dc55ec50-f182-42db-834f-d0cf1b380879" name="R_HMR_4565" reversible="true" sboTerm="SBO:0000176"> | |
| 4968 <notes> | |
| 4969 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 4970 <p>Confidence Level: 0</p> | |
| 4971 <p>AUTHORS: PMID:8549825;UNIPROT:P37837</p> | |
| 4972 <p>ec-code: 2.2.1.2</p> | |
| 4973 <p>metanetx.reaction: MNXR104715</p> | |
| 4974 <p>kegg.reaction: R08575</p> | |
| 4975 <p>bigg.reaction: TALA</p> | |
| 4976 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
| 4977 <p>EC_NUMBER: 2.2.1.2</p> | |
| 4978 <p>pmids: 8549825</p> | |
| 4979 <p>GENE_ASSOCIATION: ENSG00000177156</p> | |
| 4980 </body> | |
| 4981 </notes> | |
| 4982 <annotation> | |
| 4983 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 4984 <rdf:Description rdf:about="#dc55ec50-f182-42db-834f-d0cf1b380879"> | |
| 4985 <bqbiol:is> | |
| 4986 <rdf:Bag> | |
| 4987 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.2.1.2"/> | |
| 4988 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR104715"/> | |
| 4989 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R08575"/> | |
| 4990 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/TALA"/> | |
| 4991 </rdf:Bag> | |
| 4992 </bqbiol:is> | |
| 4993 <bqbiol:isDescribedBy> | |
| 4994 <rdf:Bag> | |
| 4995 <rdf:li rdf:resource="https://identifiers.org/pubmed/8549825"/> | |
| 4996 </rdf:Bag> | |
| 4997 </bqbiol:isDescribedBy> | |
| 4998 </rdf:Description> | |
| 4999 </rdf:RDF> | |
| 5000 </annotation> | |
| 5001 <fbc:geneProductAssociation> | |
| 5002 <fbc:geneProductRef fbc:geneProduct="ENSG00000177156"/> | |
| 5003 </fbc:geneProductAssociation> | |
| 5004 <listOfReactants> | |
| 5005 <speciesReference constant="true" species="M_m01939c" stoichiometry="1"/> | |
| 5006 <speciesReference constant="true" species="M_m02884c" stoichiometry="1"/> | |
| 5007 </listOfReactants> | |
| 5008 <listOfProducts> | |
| 5009 <speciesReference constant="true" species="M_m01785c" stoichiometry="1"/> | |
| 5010 <speciesReference constant="true" species="M_m01845c" stoichiometry="1"/> | |
| 5011 </listOfProducts> | |
| 5012 </reaction> | |
| 5013 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4841" metaid="f74d8639-e4ff-4f06-b6de-2c4de6cff989" name="R_HMR_4841" reversible="true" sboTerm="SBO:0000176"> | |
| 5014 <notes> | |
| 5015 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5016 <p>Confidence Level: 0</p> | |
| 5017 <p>AUTHORS: PMID:15234337</p> | |
| 5018 <p>ec-code: 1.2.1.5</p> | |
| 5019 <p>metanetx.reaction: MNXR105388</p> | |
| 5020 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
| 5021 <p>EC_NUMBER: 1.2.1.5</p> | |
| 5022 <p>pmids: 15234337</p> | |
| 5023 <p>GENE_ASSOCIATION: ( ENSG00000006534 ) OR ( ENSG00000108602 ) OR ( ENSG00000132746 ) OR ( ENSG00000184254 )</p> | |
| 5024 </body> | |
| 5025 </notes> | |
| 5026 <annotation> | |
| 5027 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5028 <rdf:Description rdf:about="#f74d8639-e4ff-4f06-b6de-2c4de6cff989"> | |
| 5029 <bqbiol:is> | |
| 5030 <rdf:Bag> | |
| 5031 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.2.1.5"/> | |
| 5032 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR105388"/> | |
| 5033 </rdf:Bag> | |
| 5034 </bqbiol:is> | |
| 5035 <bqbiol:isDescribedBy> | |
| 5036 <rdf:Bag> | |
| 5037 <rdf:li rdf:resource="https://identifiers.org/pubmed/15234337"/> | |
| 5038 </rdf:Bag> | |
| 5039 </bqbiol:isDescribedBy> | |
| 5040 </rdf:Description> | |
| 5041 </rdf:RDF> | |
| 5042 </annotation> | |
| 5043 <fbc:geneProductAssociation> | |
| 5044 <fbc:or> | |
| 5045 <fbc:geneProductRef fbc:geneProduct="ENSG00000108602"/> | |
| 5046 <fbc:geneProductRef fbc:geneProduct="ENSG00000132746"/> | |
| 5047 <fbc:geneProductRef fbc:geneProduct="ENSG00000184254"/> | |
| 5048 <fbc:geneProductRef fbc:geneProduct="ENSG00000006534"/> | |
| 5049 </fbc:or> | |
| 5050 </fbc:geneProductAssociation> | |
| 5051 <listOfReactants> | |
| 5052 <speciesReference constant="true" species="M_m02553c" stoichiometry="1"/> | |
| 5053 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
| 5054 <speciesReference constant="true" species="M_m02843c" stoichiometry="1"/> | |
| 5055 </listOfReactants> | |
| 5056 <listOfProducts> | |
| 5057 <speciesReference constant="true" species="M_m02552c" stoichiometry="1"/> | |
| 5058 <speciesReference constant="true" species="M_m02841c" stoichiometry="1"/> | |
| 5059 </listOfProducts> | |
| 5060 </reaction> | |
| 5061 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4401" metaid="_784dbb17-65c3-4806-8d58-6101b6f50cb1" name="R_HMR_4401" reversible="true" sboTerm="SBO:0000176"> | |
| 5062 <notes> | |
| 5063 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5064 <p>Confidence Level: 0</p> | |
| 5065 <p>AUTHORS: PMID:5646162;PMID:6251080</p> | |
| 5066 <p>ec-code: 2.7.7.30</p> | |
| 5067 <p>metanetx.reaction: MNXR99061</p> | |
| 5068 <p>kegg.reaction: R01951</p> | |
| 5069 <p>bigg.reaction: F1PGT</p> | |
| 5070 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
| 5071 <p>EC_NUMBER: 2.7.7.30</p> | |
| 5072 <p>pmids: 5646162,6251080</p> | |
| 5073 <p>GENE_ASSOCIATION: ( ENSG00000116783 ) OR ( ENSG00000254685 ) OR ( ENSG00000259030 )</p> | |
| 5074 </body> | |
| 5075 </notes> | |
| 5076 <annotation> | |
| 5077 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5078 <rdf:Description rdf:about="#_784dbb17-65c3-4806-8d58-6101b6f50cb1"> | |
| 5079 <bqbiol:is> | |
| 5080 <rdf:Bag> | |
| 5081 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.7.30"/> | |
| 5082 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR99061"/> | |
| 5083 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01951"/> | |
| 5084 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/F1PGT"/> | |
| 5085 </rdf:Bag> | |
| 5086 </bqbiol:is> | |
| 5087 <bqbiol:isDescribedBy> | |
| 5088 <rdf:Bag> | |
| 5089 <rdf:li rdf:resource="https://identifiers.org/pubmed/5646162"/> | |
| 5090 <rdf:li rdf:resource="https://identifiers.org/pubmed/6251080"/> | |
| 5091 </rdf:Bag> | |
| 5092 </bqbiol:isDescribedBy> | |
| 5093 </rdf:Description> | |
| 5094 </rdf:RDF> | |
| 5095 </annotation> | |
| 5096 <fbc:geneProductAssociation> | |
| 5097 <fbc:or> | |
| 5098 <fbc:geneProductRef fbc:geneProduct="ENSG00000116783"/> | |
| 5099 <fbc:geneProductRef fbc:geneProduct="ENSG00000254685"/> | |
| 5100 <fbc:geneProductRef fbc:geneProduct="ENSG00000259030"/> | |
| 5101 </fbc:or> | |
| 5102 </fbc:geneProductAssociation> | |
| 5103 <listOfReactants> | |
| 5104 <speciesReference constant="true" species="M_m01950c" stoichiometry="1"/> | |
| 5105 <speciesReference constant="true" species="M_m02759c" stoichiometry="1"/> | |
| 5106 </listOfReactants> | |
| 5107 <listOfProducts> | |
| 5108 <speciesReference constant="true" species="M_m02034c" stoichiometry="1"/> | |
| 5109 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
| 5110 <speciesReference constant="true" species="M_m02372c" stoichiometry="1"/> | |
| 5111 </listOfProducts> | |
| 5112 </reaction> | |
| 5113 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_RE1342C" metaid="_35970be8-355d-4991-bcbd-bf773e56c260" name="Aldehyde Reductase" reversible="true" sboTerm="SBO:0000176"> | |
| 5114 <notes> | |
| 5115 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5116 <p>Confidence Level: 0</p> | |
| 5117 <p>AUTHORS: PMID:9537432</p> | |
| 5118 <p>ec-code: 1.1.1.21</p> | |
| 5119 <p>metanetx.reaction: MNXR103511</p> | |
| 5120 <p>bigg.reaction: RE1342C</p> | |
| 5121 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
| 5122 <p>EC_NUMBER: 1.1.1.21</p> | |
| 5123 <p>pmids: 9537432</p> | |
| 5124 </body> | |
| 5125 </notes> | |
| 5126 <annotation> | |
| 5127 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5128 <rdf:Description rdf:about="#_35970be8-355d-4991-bcbd-bf773e56c260"> | |
| 5129 <bqbiol:is> | |
| 5130 <rdf:Bag> | |
| 5131 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.21"/> | |
| 5132 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR103511"/> | |
| 5133 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/RE1342C"/> | |
| 5134 </rdf:Bag> | |
| 5135 </bqbiol:is> | |
| 5136 <bqbiol:isDescribedBy> | |
| 5137 <rdf:Bag> | |
| 5138 <rdf:li rdf:resource="https://identifiers.org/pubmed/9537432"/> | |
| 5139 </rdf:Bag> | |
| 5140 </bqbiol:isDescribedBy> | |
| 5141 </rdf:Description> | |
| 5142 </rdf:RDF> | |
| 5143 </annotation> | |
| 5144 <listOfReactants> | |
| 5145 <speciesReference constant="true" species="M_m02552c" stoichiometry="1"/> | |
| 5146 <speciesReference constant="true" species="M_m01682c" stoichiometry="1"/> | |
| 5147 </listOfReactants> | |
| 5148 <listOfProducts> | |
| 5149 <speciesReference constant="true" species="M_m02553c" stoichiometry="1"/> | |
| 5150 <speciesReference constant="true" species="M_m01965c" stoichiometry="1"/> | |
| 5151 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
| 5152 </listOfProducts> | |
| 5153 </reaction> | |
| 5154 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4402" metaid="f3a0a958-fed9-477e-ae39-8cdedad1f5bc" name="R_HMR_4402" reversible="true" sboTerm="SBO:0000176"> | |
| 5155 <notes> | |
| 5156 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5157 <p>Confidence Level: 0</p> | |
| 5158 <p>AUTHORS: PMID:12056818;PMID:12413479</p> | |
| 5159 <p>ec-code: 2.7.1.52</p> | |
| 5160 <p>metanetx.reaction: MNXR99595 || MNXR107992</p> | |
| 5161 <p>kegg.reaction: R03161</p> | |
| 5162 <p>bigg.reaction: FK</p> | |
| 5163 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
| 5164 <p>EC_NUMBER: 2.7.1.52</p> | |
| 5165 <p>pmids: 12056818,12413479</p> | |
| 5166 <p>GENE_ASSOCIATION: ENSG00000157353</p> | |
| 5167 </body> | |
| 5168 </notes> | |
| 5169 <annotation> | |
| 5170 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5171 <rdf:Description rdf:about="#f3a0a958-fed9-477e-ae39-8cdedad1f5bc"> | |
| 5172 <bqbiol:is> | |
| 5173 <rdf:Bag> | |
| 5174 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.52"/> | |
| 5175 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR99595"/> | |
| 5176 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR107992"/> | |
| 5177 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R03161"/> | |
| 5178 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/FK"/> | |
| 5179 </rdf:Bag> | |
| 5180 </bqbiol:is> | |
| 5181 <bqbiol:isDescribedBy> | |
| 5182 <rdf:Bag> | |
| 5183 <rdf:li rdf:resource="https://identifiers.org/pubmed/12056818"/> | |
| 5184 <rdf:li rdf:resource="https://identifiers.org/pubmed/12413479"/> | |
| 5185 </rdf:Bag> | |
| 5186 </bqbiol:isDescribedBy> | |
| 5187 </rdf:Description> | |
| 5188 </rdf:RDF> | |
| 5189 </annotation> | |
| 5190 <fbc:geneProductAssociation> | |
| 5191 <fbc:geneProductRef fbc:geneProduct="ENSG00000157353"/> | |
| 5192 </fbc:geneProductAssociation> | |
| 5193 <listOfReactants> | |
| 5194 <speciesReference constant="true" species="M_m01159c" stoichiometry="1"/> | |
| 5195 <speciesReference constant="true" species="M_m01371c" stoichiometry="1"/> | |
| 5196 </listOfReactants> | |
| 5197 <listOfProducts> | |
| 5198 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
| 5199 <speciesReference constant="true" species="M_m01285c" stoichiometry="1"/> | |
| 5200 <speciesReference constant="true" species="M_m02372c" stoichiometry="1"/> | |
| 5201 </listOfProducts> | |
| 5202 </reaction> | |
| 5203 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4567" metaid="_9ff90316-748a-4f8a-91f7-86e61fbd681e" name="R_HMR_4567" reversible="true" sboTerm="SBO:0000176"> | |
| 5204 <notes> | |
| 5205 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5206 <p>Confidence Level: 0</p> | |
| 5207 <p>AUTHORS: PMID:4084320;PMID:4272358</p> | |
| 5208 <p>ec-code: 2.7.1.11</p> | |
| 5209 <p>metanetx.reaction: MNXR105338 || MNXR102510</p> | |
| 5210 <p>kegg.reaction: R01843</p> | |
| 5211 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
| 5212 <p>EC_NUMBER: 2.7.1.11</p> | |
| 5213 <p>pmids: 4084320,4272358</p> | |
| 5214 <p>GENE_ASSOCIATION: ( ENSG00000067057 ) OR ( ENSG00000141959 ) OR ( ENSG00000152556 )</p> | |
| 5215 </body> | |
| 5216 </notes> | |
| 5217 <annotation> | |
| 5218 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5219 <rdf:Description rdf:about="#_9ff90316-748a-4f8a-91f7-86e61fbd681e"> | |
| 5220 <bqbiol:is> | |
| 5221 <rdf:Bag> | |
| 5222 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.11"/> | |
| 5223 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR105338"/> | |
| 5224 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR102510"/> | |
| 5225 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01843"/> | |
| 5226 </rdf:Bag> | |
| 5227 </bqbiol:is> | |
| 5228 <bqbiol:isDescribedBy> | |
| 5229 <rdf:Bag> | |
| 5230 <rdf:li rdf:resource="https://identifiers.org/pubmed/4272358"/> | |
| 5231 <rdf:li rdf:resource="https://identifiers.org/pubmed/4084320"/> | |
| 5232 </rdf:Bag> | |
| 5233 </bqbiol:isDescribedBy> | |
| 5234 </rdf:Description> | |
| 5235 </rdf:RDF> | |
| 5236 </annotation> | |
| 5237 <fbc:geneProductAssociation> | |
| 5238 <fbc:or> | |
| 5239 <fbc:geneProductRef fbc:geneProduct="ENSG00000067057"/> | |
| 5240 <fbc:geneProductRef fbc:geneProduct="ENSG00000141959"/> | |
| 5241 <fbc:geneProductRef fbc:geneProduct="ENSG00000152556"/> | |
| 5242 </fbc:or> | |
| 5243 </fbc:geneProductAssociation> | |
| 5244 <listOfReactants> | |
| 5245 <speciesReference constant="true" species="M_m02883c" stoichiometry="1"/> | |
| 5246 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
| 5247 <speciesReference constant="true" species="M_m01285c" stoichiometry="1"/> | |
| 5248 </listOfReactants> | |
| 5249 <listOfProducts> | |
| 5250 <speciesReference constant="true" species="M_m01371c" stoichiometry="1"/> | |
| 5251 <speciesReference constant="true" species="M_m02884c" stoichiometry="1"/> | |
| 5252 </listOfProducts> | |
| 5253 </reaction> | |
| 5254 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4403" metaid="_41178734-fe7b-47f2-b84a-e69e20728adb" name="R_HMR_4403" reversible="false" sboTerm="SBO:0000176"> | |
| 5255 <notes> | |
| 5256 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5257 <p>Confidence Level: 0</p> | |
| 5258 <p>AUTHORS: PMID:457669;PMID:5050937</p> | |
| 5259 <p>ec-code: 5.3.1.25</p> | |
| 5260 <p>metanetx.reaction: MNXR99468 || MNXR107994</p> | |
| 5261 <p>kegg.reaction: R03163</p> | |
| 5262 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
| 5263 <p>EC_NUMBER: 5.3.1.25</p> | |
| 5264 <p>pmids: 457669,5050937</p> | |
| 5265 </body> | |
| 5266 </notes> | |
| 5267 <annotation> | |
| 5268 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5269 <rdf:Description rdf:about="#_41178734-fe7b-47f2-b84a-e69e20728adb"> | |
| 5270 <bqbiol:is> | |
| 5271 <rdf:Bag> | |
| 5272 <rdf:li rdf:resource="https://identifiers.org/ec-code/5.3.1.25"/> | |
| 5273 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR99468"/> | |
| 5274 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR107994"/> | |
| 5275 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R03163"/> | |
| 5276 </rdf:Bag> | |
| 5277 </bqbiol:is> | |
| 5278 <bqbiol:isDescribedBy> | |
| 5279 <rdf:Bag> | |
| 5280 <rdf:li rdf:resource="https://identifiers.org/pubmed/457669"/> | |
| 5281 <rdf:li rdf:resource="https://identifiers.org/pubmed/5050937"/> | |
| 5282 </rdf:Bag> | |
| 5283 </bqbiol:isDescribedBy> | |
| 5284 </rdf:Description> | |
| 5285 </rdf:RDF> | |
| 5286 </annotation> | |
| 5287 <listOfReactants> | |
| 5288 <speciesReference constant="true" species="M_m01159c" stoichiometry="1"/> | |
| 5289 </listOfReactants> | |
| 5290 <listOfProducts> | |
| 5291 <speciesReference constant="true" species="M_m02373c" stoichiometry="1"/> | |
| 5292 </listOfProducts> | |
| 5293 </reaction> | |
| 5294 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4568" metaid="_414cb744-0f0d-4837-b547-ca5fc7b2529a" name="R_HMR_4568" reversible="true" sboTerm="SBO:0000176"> | |
| 5295 <notes> | |
| 5296 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5297 <p>Confidence Level: 0</p> | |
| 5298 <p>AUTHORS: PMID:11945275</p> | |
| 5299 <p>ec-code: 2.7.1.11</p> | |
| 5300 <p>metanetx.reaction: MNXR105339</p> | |
| 5301 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
| 5302 <p>EC_NUMBER: 2.7.1.11</p> | |
| 5303 <p>pmids: 11945275</p> | |
| 5304 <p>GENE_ASSOCIATION: ( ENSG00000067057 ) OR ( ENSG00000141959 ) OR ( ENSG00000152556 )</p> | |
| 5305 </body> | |
| 5306 </notes> | |
| 5307 <annotation> | |
| 5308 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5309 <rdf:Description rdf:about="#_414cb744-0f0d-4837-b547-ca5fc7b2529a"> | |
| 5310 <bqbiol:is> | |
| 5311 <rdf:Bag> | |
| 5312 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.11"/> | |
| 5313 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR105339"/> | |
| 5314 </rdf:Bag> | |
| 5315 </bqbiol:is> | |
| 5316 <bqbiol:isDescribedBy> | |
| 5317 <rdf:Bag> | |
| 5318 <rdf:li rdf:resource="https://identifiers.org/pubmed/11945275"/> | |
| 5319 </rdf:Bag> | |
| 5320 </bqbiol:isDescribedBy> | |
| 5321 </rdf:Description> | |
| 5322 </rdf:RDF> | |
| 5323 </annotation> | |
| 5324 <fbc:geneProductAssociation> | |
| 5325 <fbc:or> | |
| 5326 <fbc:geneProductRef fbc:geneProduct="ENSG00000067057"/> | |
| 5327 <fbc:geneProductRef fbc:geneProduct="ENSG00000141959"/> | |
| 5328 <fbc:geneProductRef fbc:geneProduct="ENSG00000152556"/> | |
| 5329 </fbc:or> | |
| 5330 </fbc:geneProductAssociation> | |
| 5331 <listOfReactants> | |
| 5332 <speciesReference constant="true" species="M_m03106c" stoichiometry="1"/> | |
| 5333 <speciesReference constant="true" species="M_m02883c" stoichiometry="1"/> | |
| 5334 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
| 5335 </listOfReactants> | |
| 5336 <listOfProducts> | |
| 5337 <speciesReference constant="true" species="M_m03130c" stoichiometry="1"/> | |
| 5338 <speciesReference constant="true" species="M_m02884c" stoichiometry="1"/> | |
| 5339 </listOfProducts> | |
| 5340 </reaction> | |
| 5341 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4128" metaid="_093ee677-4ba5-4528-856e-60f371fedfe8" name="R_HMR_4128" reversible="true" sboTerm="SBO:0000176"> | |
| 5342 <notes> | |
| 5343 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5344 <p>Confidence Level: 0</p> | |
| 5345 <p>AUTHORS: PMID:191453;PMID:845161</p> | |
| 5346 <p>ec-code: 5.1.3.2</p> | |
| 5347 <p>metanetx.reaction: MNXR105057</p> | |
| 5348 <p>kegg.reaction: R00291</p> | |
| 5349 <p>bigg.reaction: UDPG4E</p> | |
| 5350 <p>SUBSYSTEM: Galactose metabolism</p> | |
| 5351 <p>EC_NUMBER: 5.1.3.2</p> | |
| 5352 <p>pmids: 191453,845161</p> | |
| 5353 <p>GENE_ASSOCIATION: ENSG00000117308</p> | |
| 5354 </body> | |
| 5355 </notes> | |
| 5356 <annotation> | |
| 5357 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5358 <rdf:Description rdf:about="#_093ee677-4ba5-4528-856e-60f371fedfe8"> | |
| 5359 <bqbiol:is> | |
| 5360 <rdf:Bag> | |
| 5361 <rdf:li rdf:resource="https://identifiers.org/ec-code/5.1.3.2"/> | |
| 5362 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR105057"/> | |
| 5363 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R00291"/> | |
| 5364 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/UDPG4E"/> | |
| 5365 </rdf:Bag> | |
| 5366 </bqbiol:is> | |
| 5367 <bqbiol:isDescribedBy> | |
| 5368 <rdf:Bag> | |
| 5369 <rdf:li rdf:resource="https://identifiers.org/pubmed/845161"/> | |
| 5370 <rdf:li rdf:resource="https://identifiers.org/pubmed/191453"/> | |
| 5371 </rdf:Bag> | |
| 5372 </bqbiol:isDescribedBy> | |
| 5373 </rdf:Description> | |
| 5374 </rdf:RDF> | |
| 5375 </annotation> | |
| 5376 <fbc:geneProductAssociation> | |
| 5377 <fbc:geneProductRef fbc:geneProduct="ENSG00000117308"/> | |
| 5378 </fbc:geneProductAssociation> | |
| 5379 <listOfReactants> | |
| 5380 <speciesReference constant="true" species="M_m03107c" stoichiometry="1"/> | |
| 5381 </listOfReactants> | |
| 5382 <listOfProducts> | |
| 5383 <speciesReference constant="true" species="M_m03108c" stoichiometry="1"/> | |
| 5384 </listOfProducts> | |
| 5385 </reaction> | |
| 5386 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_8768" metaid="_8bcb4fd6-2dbe-4ec7-a1ff-10766373c9c1" name="R_HMR_8768" reversible="false" sboTerm="SBO:0000176"> | |
| 5387 <notes> | |
| 5388 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5389 <p>Confidence Level: 0</p> | |
| 5390 <p>ec-code: 1.1.1.271</p> | |
| 5391 <p>metanetx.reaction: MNXR100108</p> | |
| 5392 <p>kegg.reaction: R05692</p> | |
| 5393 <p>bigg.reaction: GFUCS</p> | |
| 5394 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
| 5395 <p>EC_NUMBER: 1.1.1.271</p> | |
| 5396 <p>GENE_ASSOCIATION: ENSG00000104522</p> | |
| 5397 </body> | |
| 5398 </notes> | |
| 5399 <annotation> | |
| 5400 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5401 <rdf:Description rdf:about="#_8bcb4fd6-2dbe-4ec7-a1ff-10766373c9c1"> | |
| 5402 <bqbiol:is> | |
| 5403 <rdf:Bag> | |
| 5404 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.271"/> | |
| 5405 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR100108"/> | |
| 5406 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R05692"/> | |
| 5407 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/GFUCS"/> | |
| 5408 </rdf:Bag> | |
| 5409 </bqbiol:is> | |
| 5410 </rdf:Description> | |
| 5411 </rdf:RDF> | |
| 5412 </annotation> | |
| 5413 <fbc:geneProductAssociation> | |
| 5414 <fbc:geneProductRef fbc:geneProduct="ENSG00000104522"/> | |
| 5415 </fbc:geneProductAssociation> | |
| 5416 <listOfReactants> | |
| 5417 <speciesReference constant="true" species="M_m01949c" stoichiometry="1"/> | |
| 5418 <speciesReference constant="true" species="M_m02555c" stoichiometry="1"/> | |
| 5419 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
| 5420 </listOfReactants> | |
| 5421 <listOfProducts> | |
| 5422 <speciesReference constant="true" species="M_m01950c" stoichiometry="1"/> | |
| 5423 <speciesReference constant="true" species="M_m02554c" stoichiometry="1"/> | |
| 5424 </listOfProducts> | |
| 5425 </reaction> | |
| 5426 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4404" metaid="_53153327-0fb7-4573-bd62-024a6dbd9d90" name="R_HMR_4404" reversible="true" sboTerm="SBO:0000176"> | |
| 5427 <notes> | |
| 5428 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5429 <p>Confidence Level: 0</p> | |
| 5430 <p>AUTHORS: PMID:234468;PMID:2495942;PMID:2843500;PMID:3089282;PMID:5141430;PMID:7115375;PMID:7154948;PMID:9924800</p> | |
| 5431 <p>ec-code: 2.2.1.1</p> | |
| 5432 <p>metanetx.reaction: MNXR104869 || MNXR106812</p> | |
| 5433 <p>kegg.reaction: R01067</p> | |
| 5434 <p>bigg.reaction: TKT2</p> | |
| 5435 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
| 5436 <p>EC_NUMBER: 2.2.1.1</p> | |
| 5437 <p>pmids: 234468,2495942,2843500,3089282,5141430,7115375,7154948,9924800</p> | |
| 5438 <p>GENE_ASSOCIATION: ( ENSG00000007350 ) OR ( ENSG00000151005 ) OR ( ENSG00000163931 )</p> | |
| 5439 </body> | |
| 5440 </notes> | |
| 5441 <annotation> | |
| 5442 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5443 <rdf:Description rdf:about="#_53153327-0fb7-4573-bd62-024a6dbd9d90"> | |
| 5444 <bqbiol:is> | |
| 5445 <rdf:Bag> | |
| 5446 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.2.1.1"/> | |
| 5447 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR104869"/> | |
| 5448 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR106812"/> | |
| 5449 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01067"/> | |
| 5450 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/TKT2"/> | |
| 5451 </rdf:Bag> | |
| 5452 </bqbiol:is> | |
| 5453 <bqbiol:isDescribedBy> | |
| 5454 <rdf:Bag> | |
| 5455 <rdf:li rdf:resource="https://identifiers.org/pubmed/2495942"/> | |
| 5456 <rdf:li rdf:resource="https://identifiers.org/pubmed/7115375"/> | |
| 5457 <rdf:li rdf:resource="https://identifiers.org/pubmed/234468"/> | |
| 5458 <rdf:li rdf:resource="https://identifiers.org/pubmed/2843500"/> | |
| 5459 <rdf:li rdf:resource="https://identifiers.org/pubmed/9924800"/> | |
| 5460 <rdf:li rdf:resource="https://identifiers.org/pubmed/5141430"/> | |
| 5461 <rdf:li rdf:resource="https://identifiers.org/pubmed/7154948"/> | |
| 5462 <rdf:li rdf:resource="https://identifiers.org/pubmed/3089282"/> | |
| 5463 </rdf:Bag> | |
| 5464 </bqbiol:isDescribedBy> | |
| 5465 </rdf:Description> | |
| 5466 </rdf:RDF> | |
| 5467 </annotation> | |
| 5468 <fbc:geneProductAssociation> | |
| 5469 <fbc:or> | |
| 5470 <fbc:geneProductRef fbc:geneProduct="ENSG00000163931"/> | |
| 5471 <fbc:geneProductRef fbc:geneProduct="ENSG00000007350"/> | |
| 5472 <fbc:geneProductRef fbc:geneProduct="ENSG00000151005"/> | |
| 5473 </fbc:or> | |
| 5474 </fbc:geneProductAssociation> | |
| 5475 <listOfReactants> | |
| 5476 <speciesReference constant="true" species="M_m01761c" stoichiometry="1"/> | |
| 5477 <speciesReference constant="true" species="M_m01785c" stoichiometry="1"/> | |
| 5478 </listOfReactants> | |
| 5479 <listOfProducts> | |
| 5480 <speciesReference constant="true" species="M_m01939c" stoichiometry="1"/> | |
| 5481 <speciesReference constant="true" species="M_m01845c" stoichiometry="1"/> | |
| 5482 </listOfProducts> | |
| 5483 </reaction> | |
| 5484 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4490" metaid="f0088831-0d71-400f-b3b3-78d25c47e1f4" name="R_HMR_4490" reversible="false" sboTerm="SBO:0000176"> | |
| 5485 <notes> | |
| 5486 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5487 <p>Confidence Level: 0</p> | |
| 5488 <p>AUTHORS: PMID:16906315;PMID:7061426;PMID:7150652;PMID:8717435</p> | |
| 5489 <p>ec-code: 2.7.1.1</p> | |
| 5490 <p>metanetx.reaction: MNXR95795</p> | |
| 5491 <p>kegg.reaction: R01326</p> | |
| 5492 <p>bigg.reaction: HEX4</p> | |
| 5493 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
| 5494 <p>EC_NUMBER: 2.7.1.1</p> | |
| 5495 <p>pmids: 7061426,7150652,8717435,16906315</p> | |
| 5496 <p>GENE_ASSOCIATION: ( ENSG00000156510 ) OR ( ENSG00000156515 ) OR ( ENSG00000159399 ) OR ( ENSG00000160883 )</p> | |
| 5497 </body> | |
| 5498 </notes> | |
| 5499 <annotation> | |
| 5500 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5501 <rdf:Description rdf:about="#f0088831-0d71-400f-b3b3-78d25c47e1f4"> | |
| 5502 <bqbiol:is> | |
| 5503 <rdf:Bag> | |
| 5504 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.1"/> | |
| 5505 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR95795"/> | |
| 5506 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01326"/> | |
| 5507 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/HEX4"/> | |
| 5508 </rdf:Bag> | |
| 5509 </bqbiol:is> | |
| 5510 <bqbiol:isDescribedBy> | |
| 5511 <rdf:Bag> | |
| 5512 <rdf:li rdf:resource="https://identifiers.org/pubmed/7150652"/> | |
| 5513 <rdf:li rdf:resource="https://identifiers.org/pubmed/7061426"/> | |
| 5514 <rdf:li rdf:resource="https://identifiers.org/pubmed/16906315"/> | |
| 5515 <rdf:li rdf:resource="https://identifiers.org/pubmed/8717435"/> | |
| 5516 </rdf:Bag> | |
| 5517 </bqbiol:isDescribedBy> | |
| 5518 </rdf:Description> | |
| 5519 </rdf:RDF> | |
| 5520 </annotation> | |
| 5521 <fbc:geneProductAssociation> | |
| 5522 <fbc:or> | |
| 5523 <fbc:geneProductRef fbc:geneProduct="ENSG00000159399"/> | |
| 5524 <fbc:geneProductRef fbc:geneProduct="ENSG00000160883"/> | |
| 5525 <fbc:geneProductRef fbc:geneProduct="ENSG00000156510"/> | |
| 5526 <fbc:geneProductRef fbc:geneProduct="ENSG00000156515"/> | |
| 5527 </fbc:or> | |
| 5528 </fbc:geneProductAssociation> | |
| 5529 <listOfReactants> | |
| 5530 <speciesReference constant="true" species="M_m01371c" stoichiometry="1"/> | |
| 5531 <speciesReference constant="true" species="M_m02453c" stoichiometry="1"/> | |
| 5532 </listOfReactants> | |
| 5533 <listOfProducts> | |
| 5534 <speciesReference constant="true" species="M_m02455c" stoichiometry="1"/> | |
| 5535 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
| 5536 <speciesReference constant="true" species="M_m01285c" stoichiometry="1"/> | |
| 5537 </listOfProducts> | |
| 5538 </reaction> | |
| 5539 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4052" metaid="f3773fb2-a697-4ad0-b9c8-70f626e44da0" name="R_HMR_4052" reversible="false" sboTerm="SBO:0000176"> | |
| 5540 <notes> | |
| 5541 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5542 <p>Confidence Level: 0</p> | |
| 5543 <p>AUTHORS: PMID:11101685;PMID:7572345</p> | |
| 5544 <p>ec-code: 2.7.6.1</p> | |
| 5545 <p>metanetx.reaction: MNXR106802 || MNXR103215</p> | |
| 5546 <p>kegg.reaction: R01049</p> | |
| 5547 <p>bigg.reaction: PRPPS</p> | |
| 5548 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
| 5549 <p>EC_NUMBER: 2.7.6.1</p> | |
| 5550 <p>pmids: 7572345,11101685</p> | |
| 5551 <p>GENE_ASSOCIATION: ( ENSG00000101911 ) OR ( ENSG00000147224 ) OR ( ENSG00000229937 )</p> | |
| 5552 </body> | |
| 5553 </notes> | |
| 5554 <annotation> | |
| 5555 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5556 <rdf:Description rdf:about="#f3773fb2-a697-4ad0-b9c8-70f626e44da0"> | |
| 5557 <bqbiol:is> | |
| 5558 <rdf:Bag> | |
| 5559 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.6.1"/> | |
| 5560 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR106802"/> | |
| 5561 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR103215"/> | |
| 5562 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01049"/> | |
| 5563 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/PRPPS"/> | |
| 5564 </rdf:Bag> | |
| 5565 </bqbiol:is> | |
| 5566 <bqbiol:isDescribedBy> | |
| 5567 <rdf:Bag> | |
| 5568 <rdf:li rdf:resource="https://identifiers.org/pubmed/7572345"/> | |
| 5569 <rdf:li rdf:resource="https://identifiers.org/pubmed/11101685"/> | |
| 5570 </rdf:Bag> | |
| 5571 </bqbiol:isDescribedBy> | |
| 5572 </rdf:Description> | |
| 5573 </rdf:RDF> | |
| 5574 </annotation> | |
| 5575 <fbc:geneProductAssociation> | |
| 5576 <fbc:or> | |
| 5577 <fbc:geneProductRef fbc:geneProduct="ENSG00000147224"/> | |
| 5578 <fbc:geneProductRef fbc:geneProduct="ENSG00000229937"/> | |
| 5579 <fbc:geneProductRef fbc:geneProduct="ENSG00000101911"/> | |
| 5580 </fbc:or> | |
| 5581 </fbc:geneProductAssociation> | |
| 5582 <listOfReactants> | |
| 5583 <speciesReference constant="true" species="M_m02845c" stoichiometry="1"/> | |
| 5584 <speciesReference constant="true" species="M_m01371c" stoichiometry="1"/> | |
| 5585 </listOfReactants> | |
| 5586 <listOfProducts> | |
| 5587 <speciesReference constant="true" species="M_m01334c" stoichiometry="1"/> | |
| 5588 <speciesReference constant="true" species="M_m02806c" stoichiometry="1"/> | |
| 5589 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
| 5590 </listOfProducts> | |
| 5591 </reaction> | |
| 5592 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4130" metaid="a1e6f11c-2c01-45d7-aa41-39764568a681" name="R_HMR_4130" reversible="false" sboTerm="SBO:0000176"> | |
| 5593 <notes> | |
| 5594 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5595 <p>Confidence Level: 0</p> | |
| 5596 <p>ec-code: 2.7.1.6</p> | |
| 5597 <p>metanetx.reaction: MNXR99985</p> | |
| 5598 <p>bigg.reaction: GALKr</p> | |
| 5599 <p>SUBSYSTEM: Galactose metabolism</p> | |
| 5600 <p>EC_NUMBER: 2.7.1.6</p> | |
| 5601 <p>GENE_ASSOCIATION: ( ENSG00000108479 ) OR ( ENSG00000156958 )</p> | |
| 5602 </body> | |
| 5603 </notes> | |
| 5604 <annotation> | |
| 5605 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5606 <rdf:Description rdf:about="#a1e6f11c-2c01-45d7-aa41-39764568a681"> | |
| 5607 <bqbiol:is> | |
| 5608 <rdf:Bag> | |
| 5609 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.6"/> | |
| 5610 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR99985"/> | |
| 5611 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/GALKr"/> | |
| 5612 </rdf:Bag> | |
| 5613 </bqbiol:is> | |
| 5614 </rdf:Description> | |
| 5615 </rdf:RDF> | |
| 5616 </annotation> | |
| 5617 <fbc:geneProductAssociation> | |
| 5618 <fbc:or> | |
| 5619 <fbc:geneProductRef fbc:geneProduct="ENSG00000108479"/> | |
| 5620 <fbc:geneProductRef fbc:geneProduct="ENSG00000156958"/> | |
| 5621 </fbc:or> | |
| 5622 </fbc:geneProductAssociation> | |
| 5623 <listOfReactants> | |
| 5624 <speciesReference constant="true" species="M_m01910c" stoichiometry="1"/> | |
| 5625 <speciesReference constant="true" species="M_m01371c" stoichiometry="1"/> | |
| 5626 </listOfReactants> | |
| 5627 <listOfProducts> | |
| 5628 <speciesReference constant="true" species="M_m01322c" stoichiometry="1"/> | |
| 5629 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
| 5630 <speciesReference constant="true" species="M_m01285c" stoichiometry="1"/> | |
| 5631 </listOfProducts> | |
| 5632 </reaction> | |
| 5633 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_8653" metaid="_22f2d06f-d7c0-4287-a929-46293b17c7af" name="R_HMR_8653" reversible="true" sboTerm="SBO:0000176"> | |
| 5634 <notes> | |
| 5635 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5636 <p>Confidence Level: 0</p> | |
| 5637 <p>ec-code: 3.1.1.31</p> | |
| 5638 <p>metanetx.reaction: MNXR99907</p> | |
| 5639 <p>kegg.reaction: R10520</p> | |
| 5640 <p>bigg.reaction: G6PDH2r</p> | |
| 5641 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
| 5642 <p>EC_NUMBER: 3.1.1.31</p> | |
| 5643 <p>GENE_ASSOCIATION: ( ENSG00000049239 ) OR ( ENSG00000130313 )</p> | |
| 5644 </body> | |
| 5645 </notes> | |
| 5646 <annotation> | |
| 5647 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5648 <rdf:Description rdf:about="#_22f2d06f-d7c0-4287-a929-46293b17c7af"> | |
| 5649 <bqbiol:is> | |
| 5650 <rdf:Bag> | |
| 5651 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.1.1.31"/> | |
| 5652 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR99907"/> | |
| 5653 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R10520"/> | |
| 5654 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/G6PDH2r"/> | |
| 5655 </rdf:Bag> | |
| 5656 </bqbiol:is> | |
| 5657 </rdf:Description> | |
| 5658 </rdf:RDF> | |
| 5659 </annotation> | |
| 5660 <fbc:geneProductAssociation> | |
| 5661 <fbc:or> | |
| 5662 <fbc:geneProductRef fbc:geneProduct="ENSG00000049239"/> | |
| 5663 <fbc:geneProductRef fbc:geneProduct="ENSG00000130313"/> | |
| 5664 </fbc:or> | |
| 5665 </fbc:geneProductAssociation> | |
| 5666 <listOfReactants> | |
| 5667 <speciesReference constant="true" species="M_m01961r" stoichiometry="1"/> | |
| 5668 <speciesReference constant="true" species="M_m02553r" stoichiometry="1"/> | |
| 5669 <speciesReference constant="true" species="M_m02039r" stoichiometry="1"/> | |
| 5670 </listOfReactants> | |
| 5671 <listOfProducts> | |
| 5672 <speciesReference constant="true" species="M_m01968r" stoichiometry="1"/> | |
| 5673 <speciesReference constant="true" species="M_m02552r" stoichiometry="1"/> | |
| 5674 </listOfProducts> | |
| 5675 </reaction> | |
| 5676 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4131" metaid="fba7f9cd-fa2b-4c7a-a4a5-02318cc57a68" name="R_HMR_4131" reversible="true" sboTerm="SBO:0000176"> | |
| 5677 <notes> | |
| 5678 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5679 <p>Confidence Level: 0</p> | |
| 5680 <p>ec-code: 2.7.7.12</p> | |
| 5681 <p>metanetx.reaction: MNXR105090</p> | |
| 5682 <p>kegg.reaction: R00955</p> | |
| 5683 <p>bigg.reaction: UGLT</p> | |
| 5684 <p>SUBSYSTEM: Galactose metabolism</p> | |
| 5685 <p>EC_NUMBER: 2.7.7.12</p> | |
| 5686 <p>GENE_ASSOCIATION: ENSG00000213930</p> | |
| 5687 </body> | |
| 5688 </notes> | |
| 5689 <annotation> | |
| 5690 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5691 <rdf:Description rdf:about="#fba7f9cd-fa2b-4c7a-a4a5-02318cc57a68"> | |
| 5692 <bqbiol:is> | |
| 5693 <rdf:Bag> | |
| 5694 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.7.12"/> | |
| 5695 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR105090"/> | |
| 5696 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R00955"/> | |
| 5697 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/UGLT"/> | |
| 5698 </rdf:Bag> | |
| 5699 </bqbiol:is> | |
| 5700 </rdf:Description> | |
| 5701 </rdf:RDF> | |
| 5702 </annotation> | |
| 5703 <fbc:geneProductAssociation> | |
| 5704 <fbc:geneProductRef fbc:geneProduct="ENSG00000213930"/> | |
| 5705 </fbc:geneProductAssociation> | |
| 5706 <listOfReactants> | |
| 5707 <speciesReference constant="true" species="M_m03107c" stoichiometry="1"/> | |
| 5708 <speciesReference constant="true" species="M_m01967c" stoichiometry="1"/> | |
| 5709 </listOfReactants> | |
| 5710 <listOfProducts> | |
| 5711 <speciesReference constant="true" species="M_m03108c" stoichiometry="1"/> | |
| 5712 <speciesReference constant="true" species="M_m01322c" stoichiometry="1"/> | |
| 5713 </listOfProducts> | |
| 5714 </reaction> | |
| 5715 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4297" metaid="c5cf5503-7811-4ea5-b3d5-159879fdbf6a" name="R_HMR_4297" reversible="false" sboTerm="SBO:0000176"> | |
| 5716 <notes> | |
| 5717 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5718 <p>Confidence Level: 0</p> | |
| 5719 <p>AUTHORS: PMID:7506254;PMID:7688733</p> | |
| 5720 <p>ec-code: 2.7.1.105</p> | |
| 5721 <p>metanetx.reaction: MNXR102508</p> | |
| 5722 <p>kegg.reaction: R00757</p> | |
| 5723 <p>bigg.reaction: PFK26</p> | |
| 5724 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
| 5725 <p>EC_NUMBER: 2.7.1.105</p> | |
| 5726 <p>pmids: 7506254,7688733</p> | |
| 5727 <p>GENE_ASSOCIATION: ( ENSG00000114268 ) OR ( ENSG00000123836 ) OR ( ENSG00000158571 ) OR ( ENSG00000170525 )</p> | |
| 5728 </body> | |
| 5729 </notes> | |
| 5730 <annotation> | |
| 5731 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5732 <rdf:Description rdf:about="#c5cf5503-7811-4ea5-b3d5-159879fdbf6a"> | |
| 5733 <bqbiol:is> | |
| 5734 <rdf:Bag> | |
| 5735 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.105"/> | |
| 5736 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR102508"/> | |
| 5737 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R00757"/> | |
| 5738 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/PFK26"/> | |
| 5739 </rdf:Bag> | |
| 5740 </bqbiol:is> | |
| 5741 <bqbiol:isDescribedBy> | |
| 5742 <rdf:Bag> | |
| 5743 <rdf:li rdf:resource="https://identifiers.org/pubmed/7688733"/> | |
| 5744 <rdf:li rdf:resource="https://identifiers.org/pubmed/7506254"/> | |
| 5745 </rdf:Bag> | |
| 5746 </bqbiol:isDescribedBy> | |
| 5747 </rdf:Description> | |
| 5748 </rdf:RDF> | |
| 5749 </annotation> | |
| 5750 <fbc:geneProductAssociation> | |
| 5751 <fbc:or> | |
| 5752 <fbc:geneProductRef fbc:geneProduct="ENSG00000123836"/> | |
| 5753 <fbc:geneProductRef fbc:geneProduct="ENSG00000170525"/> | |
| 5754 <fbc:geneProductRef fbc:geneProduct="ENSG00000114268"/> | |
| 5755 <fbc:geneProductRef fbc:geneProduct="ENSG00000158571"/> | |
| 5756 </fbc:or> | |
| 5757 </fbc:geneProductAssociation> | |
| 5758 <listOfReactants> | |
| 5759 <speciesReference constant="true" species="M_m01371c" stoichiometry="1"/> | |
| 5760 <speciesReference constant="true" species="M_m01845c" stoichiometry="1"/> | |
| 5761 </listOfReactants> | |
| 5762 <listOfProducts> | |
| 5763 <speciesReference constant="true" species="M_m01843c" stoichiometry="1"/> | |
| 5764 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
| 5765 <speciesReference constant="true" species="M_m01285c" stoichiometry="1"/> | |
| 5766 </listOfProducts> | |
| 5767 </reaction> | |
| 5768 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4132" metaid="_7fd1e0ad-5113-42aa-963e-6215ef481843" name="R_HMR_4132" reversible="false" sboTerm="SBO:0000176"> | |
| 5769 <notes> | |
| 5770 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5771 <p>Confidence Level: 0</p> | |
| 5772 <p>AUTHORS: PMID:10993714</p> | |
| 5773 <p>ec-code: 2.7.7.12</p> | |
| 5774 <p>metanetx.reaction: MNXR105090</p> | |
| 5775 <p>kegg.reaction: R00955</p> | |
| 5776 <p>SUBSYSTEM: Galactose metabolism</p> | |
| 5777 <p>EC_NUMBER: 2.7.7.12</p> | |
| 5778 <p>pmids: 10993714</p> | |
| 5779 <p>GENE_ASSOCIATION: ENSG00000213930</p> | |
| 5780 </body> | |
| 5781 </notes> | |
| 5782 <annotation> | |
| 5783 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5784 <rdf:Description rdf:about="#_7fd1e0ad-5113-42aa-963e-6215ef481843"> | |
| 5785 <bqbiol:is> | |
| 5786 <rdf:Bag> | |
| 5787 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.7.12"/> | |
| 5788 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR105090"/> | |
| 5789 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R00955"/> | |
| 5790 </rdf:Bag> | |
| 5791 </bqbiol:is> | |
| 5792 <bqbiol:isDescribedBy> | |
| 5793 <rdf:Bag> | |
| 5794 <rdf:li rdf:resource="https://identifiers.org/pubmed/10993714"/> | |
| 5795 </rdf:Bag> | |
| 5796 </bqbiol:isDescribedBy> | |
| 5797 </rdf:Description> | |
| 5798 </rdf:RDF> | |
| 5799 </annotation> | |
| 5800 <fbc:geneProductAssociation> | |
| 5801 <fbc:geneProductRef fbc:geneProduct="ENSG00000213930"/> | |
| 5802 </fbc:geneProductAssociation> | |
| 5803 <listOfReactants> | |
| 5804 <speciesReference constant="true" species="M_m01911c" stoichiometry="1"/> | |
| 5805 <speciesReference constant="true" species="M_m03108c" stoichiometry="1"/> | |
| 5806 </listOfReactants> | |
| 5807 <listOfProducts> | |
| 5808 <speciesReference constant="true" species="M_m03107c" stoichiometry="1"/> | |
| 5809 <speciesReference constant="true" species="M_m01967c" stoichiometry="1"/> | |
| 5810 </listOfProducts> | |
| 5811 </reaction> | |
| 5812 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_0454" metaid="c76ba226-384c-4b57-84b2-6140f038c756" name="R_HMR_0454" reversible="false" sboTerm="SBO:0000176"> | |
| 5813 <notes> | |
| 5814 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5815 <p>Confidence Level: 0</p> | |
| 5816 <p>AUTHORS: PMID:12125098</p> | |
| 5817 <p>ec-code: 2.7.1.28</p> | |
| 5818 <p>metanetx.reaction: MNXR104940</p> | |
| 5819 <p>kegg.reaction: R01059</p> | |
| 5820 <p>bigg.reaction: TRIOK</p> | |
| 5821 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
| 5822 <p>EC_NUMBER: 2.7.1.28</p> | |
| 5823 <p>pmids: 12125098</p> | |
| 5824 </body> | |
| 5825 </notes> | |
| 5826 <annotation> | |
| 5827 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5828 <rdf:Description rdf:about="#c76ba226-384c-4b57-84b2-6140f038c756"> | |
| 5829 <bqbiol:is> | |
| 5830 <rdf:Bag> | |
| 5831 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.28"/> | |
| 5832 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR104940"/> | |
| 5833 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01059"/> | |
| 5834 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/TRIOK"/> | |
| 5835 </rdf:Bag> | |
| 5836 </bqbiol:is> | |
| 5837 <bqbiol:isDescribedBy> | |
| 5838 <rdf:Bag> | |
| 5839 <rdf:li rdf:resource="https://identifiers.org/pubmed/12125098"/> | |
| 5840 </rdf:Bag> | |
| 5841 </bqbiol:isDescribedBy> | |
| 5842 </rdf:Description> | |
| 5843 </rdf:RDF> | |
| 5844 </annotation> | |
| 5845 <listOfReactants> | |
| 5846 <speciesReference constant="true" species="M_m01371c" stoichiometry="1"/> | |
| 5847 <speciesReference constant="true" species="M_m01981c" stoichiometry="1"/> | |
| 5848 </listOfReactants> | |
| 5849 <listOfProducts> | |
| 5850 <speciesReference constant="true" species="M_m01939c" stoichiometry="1"/> | |
| 5851 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
| 5852 <speciesReference constant="true" species="M_m01285c" stoichiometry="1"/> | |
| 5853 </listOfProducts> | |
| 5854 </reaction> | |
| 5855 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4774" metaid="_3d04496d-3c88-44ef-a0f4-1566551ef2a7" name="R_HMR_4774" reversible="true" sboTerm="SBO:0000176"> | |
| 5856 <notes> | |
| 5857 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5858 <p>Confidence Level: 0</p> | |
| 5859 <p>AUTHORS: PMID:131802;PMID:1810251;PMID:193556;PMID:2987258;PMID:6091737</p> | |
| 5860 <p>ec-code: 2.7.1.11</p> | |
| 5861 <p>metanetx.reaction: MNXR108039 || MNXR105355</p> | |
| 5862 <p>kegg.reaction: R03237</p> | |
| 5863 <p>SUBSYSTEM: Galactose metabolism</p> | |
| 5864 <p>EC_NUMBER: 2.7.1.11</p> | |
| 5865 <p>pmids: 131802,193556,1810251,2987258,6091737</p> | |
| 5866 <p>GENE_ASSOCIATION: ( ENSG00000067057 ) OR ( ENSG00000141959 ) OR ( ENSG00000152556 )</p> | |
| 5867 </body> | |
| 5868 </notes> | |
| 5869 <annotation> | |
| 5870 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5871 <rdf:Description rdf:about="#_3d04496d-3c88-44ef-a0f4-1566551ef2a7"> | |
| 5872 <bqbiol:is> | |
| 5873 <rdf:Bag> | |
| 5874 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.11"/> | |
| 5875 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR108039"/> | |
| 5876 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR105355"/> | |
| 5877 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R03237"/> | |
| 5878 </rdf:Bag> | |
| 5879 </bqbiol:is> | |
| 5880 <bqbiol:isDescribedBy> | |
| 5881 <rdf:Bag> | |
| 5882 <rdf:li rdf:resource="https://identifiers.org/pubmed/1810251"/> | |
| 5883 <rdf:li rdf:resource="https://identifiers.org/pubmed/6091737"/> | |
| 5884 <rdf:li rdf:resource="https://identifiers.org/pubmed/193556"/> | |
| 5885 <rdf:li rdf:resource="https://identifiers.org/pubmed/2987258"/> | |
| 5886 <rdf:li rdf:resource="https://identifiers.org/pubmed/131802"/> | |
| 5887 </rdf:Bag> | |
| 5888 </bqbiol:isDescribedBy> | |
| 5889 </rdf:Description> | |
| 5890 </rdf:RDF> | |
| 5891 </annotation> | |
| 5892 <fbc:geneProductAssociation> | |
| 5893 <fbc:or> | |
| 5894 <fbc:geneProductRef fbc:geneProduct="ENSG00000067057"/> | |
| 5895 <fbc:geneProductRef fbc:geneProduct="ENSG00000141959"/> | |
| 5896 <fbc:geneProductRef fbc:geneProduct="ENSG00000152556"/> | |
| 5897 </fbc:or> | |
| 5898 </fbc:geneProductAssociation> | |
| 5899 <listOfReactants> | |
| 5900 <speciesReference constant="true" species="M_m01424c" stoichiometry="1"/> | |
| 5901 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
| 5902 <speciesReference constant="true" species="M_m02955c" stoichiometry="1"/> | |
| 5903 </listOfReactants> | |
| 5904 <listOfProducts> | |
| 5905 <speciesReference constant="true" species="M_m01623c" stoichiometry="1"/> | |
| 5906 <speciesReference constant="true" species="M_m01746c" stoichiometry="1"/> | |
| 5907 </listOfProducts> | |
| 5908 </reaction> | |
| 5909 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4775" metaid="b71ca27b-2233-4904-bf68-12c5c97c9300" name="R_HMR_4775" reversible="true" sboTerm="SBO:0000176"> | |
| 5910 <notes> | |
| 5911 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5912 <p>Confidence Level: 0</p> | |
| 5913 <p>AUTHORS: PMID:131802;PMID:1810251</p> | |
| 5914 <p>ec-code: 2.7.1.11</p> | |
| 5915 <p>metanetx.reaction: MNXR105356 || MNXR108041</p> | |
| 5916 <p>kegg.reaction: R03239</p> | |
| 5917 <p>SUBSYSTEM: Galactose metabolism</p> | |
| 5918 <p>EC_NUMBER: 2.7.1.11</p> | |
| 5919 <p>pmids: 131802,1810251</p> | |
| 5920 <p>GENE_ASSOCIATION: ( ENSG00000067057 ) OR ( ENSG00000141959 ) OR ( ENSG00000152556 )</p> | |
| 5921 </body> | |
| 5922 </notes> | |
| 5923 <annotation> | |
| 5924 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5925 <rdf:Description rdf:about="#b71ca27b-2233-4904-bf68-12c5c97c9300"> | |
| 5926 <bqbiol:is> | |
| 5927 <rdf:Bag> | |
| 5928 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.11"/> | |
| 5929 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR105356"/> | |
| 5930 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR108041"/> | |
| 5931 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R03239"/> | |
| 5932 </rdf:Bag> | |
| 5933 </bqbiol:is> | |
| 5934 <bqbiol:isDescribedBy> | |
| 5935 <rdf:Bag> | |
| 5936 <rdf:li rdf:resource="https://identifiers.org/pubmed/1810251"/> | |
| 5937 <rdf:li rdf:resource="https://identifiers.org/pubmed/131802"/> | |
| 5938 </rdf:Bag> | |
| 5939 </bqbiol:isDescribedBy> | |
| 5940 </rdf:Description> | |
| 5941 </rdf:RDF> | |
| 5942 </annotation> | |
| 5943 <fbc:geneProductAssociation> | |
| 5944 <fbc:or> | |
| 5945 <fbc:geneProductRef fbc:geneProduct="ENSG00000067057"/> | |
| 5946 <fbc:geneProductRef fbc:geneProduct="ENSG00000141959"/> | |
| 5947 <fbc:geneProductRef fbc:geneProduct="ENSG00000152556"/> | |
| 5948 </fbc:or> | |
| 5949 </fbc:geneProductAssociation> | |
| 5950 <listOfReactants> | |
| 5951 <speciesReference constant="true" species="M_m02193c" stoichiometry="1"/> | |
| 5952 <speciesReference constant="true" species="M_m01746c" stoichiometry="1"/> | |
| 5953 </listOfReactants> | |
| 5954 <listOfProducts> | |
| 5955 <speciesReference constant="true" species="M_m02161c" stoichiometry="1"/> | |
| 5956 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
| 5957 <speciesReference constant="true" species="M_m02955c" stoichiometry="1"/> | |
| 5958 </listOfProducts> | |
| 5959 </reaction> | |
| 5960 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4414" metaid="b4722a38-261b-454e-93b5-c84c4aa10035" name="R_HMR_4414" reversible="false" sboTerm="SBO:0000176"> | |
| 5961 <notes> | |
| 5962 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 5963 <p>Confidence Level: 0</p> | |
| 5964 <p>AUTHORS: PMID:8908517</p> | |
| 5965 <p>ec-code: 2.7.1.6</p> | |
| 5966 <p>metanetx.reaction: MNXR99985</p> | |
| 5967 <p>kegg.reaction: R01092</p> | |
| 5968 <p>SUBSYSTEM: Galactose metabolism</p> | |
| 5969 <p>EC_NUMBER: 2.7.1.6</p> | |
| 5970 <p>pmids: 8908517</p> | |
| 5971 <p>GENE_ASSOCIATION: ( ENSG00000108479 ) OR ( ENSG00000156958 ) OR ( ENSG00000166262 )</p> | |
| 5972 </body> | |
| 5973 </notes> | |
| 5974 <annotation> | |
| 5975 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 5976 <rdf:Description rdf:about="#b4722a38-261b-454e-93b5-c84c4aa10035"> | |
| 5977 <bqbiol:is> | |
| 5978 <rdf:Bag> | |
| 5979 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.6"/> | |
| 5980 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR99985"/> | |
| 5981 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01092"/> | |
| 5982 </rdf:Bag> | |
| 5983 </bqbiol:is> | |
| 5984 <bqbiol:isDescribedBy> | |
| 5985 <rdf:Bag> | |
| 5986 <rdf:li rdf:resource="https://identifiers.org/pubmed/8908517"/> | |
| 5987 </rdf:Bag> | |
| 5988 </bqbiol:isDescribedBy> | |
| 5989 </rdf:Description> | |
| 5990 </rdf:RDF> | |
| 5991 </annotation> | |
| 5992 <fbc:geneProductAssociation> | |
| 5993 <fbc:or> | |
| 5994 <fbc:geneProductRef fbc:geneProduct="ENSG00000108479"/> | |
| 5995 <fbc:geneProductRef fbc:geneProduct="ENSG00000156958"/> | |
| 5996 <fbc:geneProductRef fbc:geneProduct="ENSG00000166262"/> | |
| 5997 </fbc:or> | |
| 5998 </fbc:geneProductAssociation> | |
| 5999 <listOfReactants> | |
| 6000 <speciesReference constant="true" species="M_m01910c" stoichiometry="1"/> | |
| 6001 <speciesReference constant="true" species="M_m01371c" stoichiometry="1"/> | |
| 6002 </listOfReactants> | |
| 6003 <listOfProducts> | |
| 6004 <speciesReference constant="true" species="M_m01911c" stoichiometry="1"/> | |
| 6005 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
| 6006 <speciesReference constant="true" species="M_m01285c" stoichiometry="1"/> | |
| 6007 </listOfProducts> | |
| 6008 </reaction> | |
| 6009 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4415" metaid="_0e1118fe-ec5c-4f40-b7ba-0a043f91a0d0" name="R_HMR_4415" reversible="false" sboTerm="SBO:0000176"> | |
| 6010 <notes> | |
| 6011 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6012 <p>Confidence Level: 0</p> | |
| 6013 <p>AUTHORS: PMID:6786877</p> | |
| 6014 <p>ec-code: 3.2.1.108 || 3.2.1.23</p> | |
| 6015 <p>metanetx.reaction: MNXR101000</p> | |
| 6016 <p>kegg.reaction: R01100</p> | |
| 6017 <p>bigg.reaction: LACZe</p> | |
| 6018 <p>SUBSYSTEM: Galactose metabolism</p> | |
| 6019 <p>EC_NUMBER: 3.2.1.23;3.2.1.108</p> | |
| 6020 <p>pmids: 6786877</p> | |
| 6021 <p>GENE_ASSOCIATION: ENSG00000115850 AND ENSG00000163521 AND ENSG00000170266 AND ENSG00000188167</p> | |
| 6022 </body> | |
| 6023 </notes> | |
| 6024 <annotation> | |
| 6025 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6026 <rdf:Description rdf:about="#_0e1118fe-ec5c-4f40-b7ba-0a043f91a0d0"> | |
| 6027 <bqbiol:is> | |
| 6028 <rdf:Bag> | |
| 6029 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.2.1.108"/> | |
| 6030 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.2.1.23"/> | |
| 6031 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR101000"/> | |
| 6032 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01100"/> | |
| 6033 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/LACZe"/> | |
| 6034 </rdf:Bag> | |
| 6035 </bqbiol:is> | |
| 6036 <bqbiol:isDescribedBy> | |
| 6037 <rdf:Bag> | |
| 6038 <rdf:li rdf:resource="https://identifiers.org/pubmed/6786877"/> | |
| 6039 </rdf:Bag> | |
| 6040 </bqbiol:isDescribedBy> | |
| 6041 </rdf:Description> | |
| 6042 </rdf:RDF> | |
| 6043 </annotation> | |
| 6044 <fbc:geneProductAssociation> | |
| 6045 <fbc:and> | |
| 6046 <fbc:geneProductRef fbc:geneProduct="ENSG00000170266"/> | |
| 6047 <fbc:geneProductRef fbc:geneProduct="ENSG00000163521"/> | |
| 6048 <fbc:geneProductRef fbc:geneProduct="ENSG00000188167"/> | |
| 6049 <fbc:geneProductRef fbc:geneProduct="ENSG00000115850"/> | |
| 6050 </fbc:and> | |
| 6051 </fbc:geneProductAssociation> | |
| 6052 <listOfReactants> | |
| 6053 <speciesReference constant="true" species="M_m02040s" stoichiometry="1"/> | |
| 6054 <speciesReference constant="true" species="M_m02332s" stoichiometry="1"/> | |
| 6055 </listOfReactants> | |
| 6056 <listOfProducts> | |
| 6057 <speciesReference constant="true" species="M_m01910s" stoichiometry="1"/> | |
| 6058 <speciesReference constant="true" species="M_m01965s" stoichiometry="1"/> | |
| 6059 </listOfProducts> | |
| 6060 </reaction> | |
| 6061 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4416" metaid="b1a0bbd3-03c8-481d-87b1-808aebb90ef2" name="R_HMR_4416" reversible="false" sboTerm="SBO:0000176"> | |
| 6062 <notes> | |
| 6063 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6064 <p>Confidence Level: 0</p> | |
| 6065 <p>AUTHORS: PMID:3569296</p> | |
| 6066 <p>ec-code: 3.2.1.23 || 3.2.1.22</p> | |
| 6067 <p>metanetx.reaction: MNXR100115</p> | |
| 6068 <p>kegg.reaction: R01104</p> | |
| 6069 <p>SUBSYSTEM: Galactose metabolism</p> | |
| 6070 <p>EC_NUMBER: 3.2.1.22;3.2.1.23</p> | |
| 6071 <p>pmids: 3569296</p> | |
| 6072 <p>GENE_ASSOCIATION: ( ENSG00000102393 ) OR ( ENSG00000170266 ) OR ( ENSG00000241343 )</p> | |
| 6073 </body> | |
| 6074 </notes> | |
| 6075 <annotation> | |
| 6076 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6077 <rdf:Description rdf:about="#b1a0bbd3-03c8-481d-87b1-808aebb90ef2"> | |
| 6078 <bqbiol:is> | |
| 6079 <rdf:Bag> | |
| 6080 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.2.1.23"/> | |
| 6081 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.2.1.22"/> | |
| 6082 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR100115"/> | |
| 6083 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01104"/> | |
| 6084 </rdf:Bag> | |
| 6085 </bqbiol:is> | |
| 6086 <bqbiol:isDescribedBy> | |
| 6087 <rdf:Bag> | |
| 6088 <rdf:li rdf:resource="https://identifiers.org/pubmed/3569296"/> | |
| 6089 </rdf:Bag> | |
| 6090 </bqbiol:isDescribedBy> | |
| 6091 </rdf:Description> | |
| 6092 </rdf:RDF> | |
| 6093 </annotation> | |
| 6094 <fbc:geneProductAssociation> | |
| 6095 <fbc:or> | |
| 6096 <fbc:geneProductRef fbc:geneProduct="ENSG00000102393"/> | |
| 6097 <fbc:geneProductRef fbc:geneProduct="ENSG00000170266"/> | |
| 6098 <fbc:geneProductRef fbc:geneProduct="ENSG00000241343"/> | |
| 6099 </fbc:or> | |
| 6100 </fbc:geneProductAssociation> | |
| 6101 <listOfReactants> | |
| 6102 <speciesReference constant="true" species="M_m02040s" stoichiometry="1"/> | |
| 6103 <speciesReference constant="true" species="M_m01913s" stoichiometry="1"/> | |
| 6104 </listOfReactants> | |
| 6105 <listOfProducts> | |
| 6106 <speciesReference constant="true" species="M_m01910s" stoichiometry="1"/> | |
| 6107 <speciesReference constant="true" species="M_m01983s" stoichiometry="1"/> | |
| 6108 </listOfProducts> | |
| 6109 </reaction> | |
| 6110 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_FBA5" metaid="f429561f-98d2-434a-860a-ddff29f21ebd" name="D-Tagatose 1-Phosphate D-Glyceraldehyde-3-Phosphate-Lyase" reversible="true" sboTerm="SBO:0000176"> | |
| 6111 <notes> | |
| 6112 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6113 <p>Confidence Level: 0</p> | |
| 6114 <p>AUTHORS: PMID:2996495,PMID:6284103,PMID:6298387</p> | |
| 6115 <p>ec-code: 4.1.2.13</p> | |
| 6116 <p>metanetx.reaction: MNXR99463</p> | |
| 6117 <p>bigg.reaction: FBA5</p> | |
| 6118 <p>SUBSYSTEM: Galactose metabolism</p> | |
| 6119 <p>EC_NUMBER: 4.1.2.13</p> | |
| 6120 <p>pmids: 2996495,6284103,6298387</p> | |
| 6121 <p>GENE_ASSOCIATION: ENSG00000136872</p> | |
| 6122 </body> | |
| 6123 </notes> | |
| 6124 <annotation> | |
| 6125 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6126 <rdf:Description rdf:about="#f429561f-98d2-434a-860a-ddff29f21ebd"> | |
| 6127 <bqbiol:is> | |
| 6128 <rdf:Bag> | |
| 6129 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.1.2.13"/> | |
| 6130 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR99463"/> | |
| 6131 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/FBA5"/> | |
| 6132 </rdf:Bag> | |
| 6133 </bqbiol:is> | |
| 6134 <bqbiol:isDescribedBy> | |
| 6135 <rdf:Bag> | |
| 6136 <rdf:li rdf:resource="https://identifiers.org/pubmed/2996495"/> | |
| 6137 <rdf:li rdf:resource="https://identifiers.org/pubmed/6298387"/> | |
| 6138 <rdf:li rdf:resource="https://identifiers.org/pubmed/6284103"/> | |
| 6139 </rdf:Bag> | |
| 6140 </bqbiol:isDescribedBy> | |
| 6141 </rdf:Description> | |
| 6142 </rdf:RDF> | |
| 6143 </annotation> | |
| 6144 <fbc:geneProductAssociation> | |
| 6145 <fbc:geneProductRef fbc:geneProduct="ENSG00000136872"/> | |
| 6146 </fbc:geneProductAssociation> | |
| 6147 <listOfReactants> | |
| 6148 <speciesReference constant="true" species="M_tag1p_D_c" stoichiometry="1"/> | |
| 6149 </listOfReactants> | |
| 6150 <listOfProducts> | |
| 6151 <speciesReference constant="true" species="M_m01690c" stoichiometry="1"/> | |
| 6152 <speciesReference constant="true" species="M_m01981c" stoichiometry="1"/> | |
| 6153 </listOfProducts> | |
| 6154 </reaction> | |
| 6155 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_PGLc" metaid="_3648fd3f-6668-495c-b2e0-e7ce9105a0bd" name="6-Phosphogluconolactonase" reversible="false" sboTerm="SBO:0000176"> | |
| 6156 <notes> | |
| 6157 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6158 <p>Confidence Level: 0</p> | |
| 6159 <p>AUTHORS: PMID: 4382012, PMID: 13575411, Harpers illustrated Biochemistry (2009) 28th edition pages 174-183</p> | |
| 6160 <p>ec-code: 3.1.1.31</p> | |
| 6161 <p>bigg.reaction: PGLc</p> | |
| 6162 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
| 6163 <p>EC_NUMBER: 3.1.1.31</p> | |
| 6164 <p>pmids: 4382012,13575411</p> | |
| 6165 <p>GENE_ASSOCIATION: ENSG00000130313</p> | |
| 6166 </body> | |
| 6167 </notes> | |
| 6168 <annotation> | |
| 6169 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6170 <rdf:Description rdf:about="#_3648fd3f-6668-495c-b2e0-e7ce9105a0bd"> | |
| 6171 <bqbiol:is> | |
| 6172 <rdf:Bag> | |
| 6173 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.1.1.31"/> | |
| 6174 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/PGLc"/> | |
| 6175 </rdf:Bag> | |
| 6176 </bqbiol:is> | |
| 6177 <bqbiol:isDescribedBy> | |
| 6178 <rdf:Bag> | |
| 6179 <rdf:li rdf:resource="https://identifiers.org/pubmed/13575411"/> | |
| 6180 <rdf:li rdf:resource="https://identifiers.org/pubmed/4382012"/> | |
| 6181 </rdf:Bag> | |
| 6182 </bqbiol:isDescribedBy> | |
| 6183 </rdf:Description> | |
| 6184 </rdf:RDF> | |
| 6185 </annotation> | |
| 6186 <fbc:geneProductAssociation> | |
| 6187 <fbc:geneProductRef fbc:geneProduct="ENSG00000130313"/> | |
| 6188 </fbc:geneProductAssociation> | |
| 6189 <listOfReactants> | |
| 6190 <speciesReference constant="true" species="M_m02040c" stoichiometry="3"/> | |
| 6191 <speciesReference constant="true" species="M_m01961c" stoichiometry="3"/> | |
| 6192 </listOfReactants> | |
| 6193 <listOfProducts> | |
| 6194 <speciesReference constant="true" species="M_m01169c" stoichiometry="3"/> | |
| 6195 <speciesReference constant="true" species="M_m02039c" stoichiometry="3"/> | |
| 6196 </listOfProducts> | |
| 6197 </reaction> | |
| 6198 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4383" metaid="_0ea26d9f-b8bd-4193-8626-31efb5856906" name="R_HMR_4383" reversible="true" sboTerm="SBO:0000176"> | |
| 6199 <notes> | |
| 6200 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6201 <p>Confidence Level: 0</p> | |
| 6202 <p>AUTHORS: PMID:10571009;PMID:12231825;PMID:15033941;PMID:2085314;PMID:7702210;PMID:8381960</p> | |
| 6203 <p>ec-code: 5.3.1.8</p> | |
| 6204 <p>metanetx.reaction: MNXR106679 || MNXR101382</p> | |
| 6205 <p>kegg.reaction: R00772</p> | |
| 6206 <p>bigg.reaction: MAN6PI</p> | |
| 6207 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
| 6208 <p>EC_NUMBER: 5.3.1.8</p> | |
| 6209 <p>pmids: 2085314,7702210,8381960,10571009,12231825,15033941</p> | |
| 6210 <p>GENE_ASSOCIATION: ENSG00000178802</p> | |
| 6211 </body> | |
| 6212 </notes> | |
| 6213 <annotation> | |
| 6214 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6215 <rdf:Description rdf:about="#_0ea26d9f-b8bd-4193-8626-31efb5856906"> | |
| 6216 <bqbiol:is> | |
| 6217 <rdf:Bag> | |
| 6218 <rdf:li rdf:resource="https://identifiers.org/ec-code/5.3.1.8"/> | |
| 6219 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR106679"/> | |
| 6220 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR101382"/> | |
| 6221 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R00772"/> | |
| 6222 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/MAN6PI"/> | |
| 6223 </rdf:Bag> | |
| 6224 </bqbiol:is> | |
| 6225 <bqbiol:isDescribedBy> | |
| 6226 <rdf:Bag> | |
| 6227 <rdf:li rdf:resource="https://identifiers.org/pubmed/10571009"/> | |
| 6228 <rdf:li rdf:resource="https://identifiers.org/pubmed/15033941"/> | |
| 6229 <rdf:li rdf:resource="https://identifiers.org/pubmed/7702210"/> | |
| 6230 <rdf:li rdf:resource="https://identifiers.org/pubmed/8381960"/> | |
| 6231 <rdf:li rdf:resource="https://identifiers.org/pubmed/12231825"/> | |
| 6232 <rdf:li rdf:resource="https://identifiers.org/pubmed/2085314"/> | |
| 6233 </rdf:Bag> | |
| 6234 </bqbiol:isDescribedBy> | |
| 6235 </rdf:Description> | |
| 6236 </rdf:RDF> | |
| 6237 </annotation> | |
| 6238 <fbc:geneProductAssociation> | |
| 6239 <fbc:geneProductRef fbc:geneProduct="ENSG00000178802"/> | |
| 6240 </fbc:geneProductAssociation> | |
| 6241 <listOfReactants> | |
| 6242 <speciesReference constant="true" species="M_m01845c" stoichiometry="1"/> | |
| 6243 </listOfReactants> | |
| 6244 <listOfProducts> | |
| 6245 <speciesReference constant="true" species="M_m02455c" stoichiometry="1"/> | |
| 6246 </listOfProducts> | |
| 6247 </reaction> | |
| 6248 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_GNDc" metaid="ef163958-45f6-498d-acb0-0e2d72945b19" name="Phosphogluconate Dehydrogenase" reversible="false" sboTerm="SBO:0000176"> | |
| 6249 <notes> | |
| 6250 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6251 <p>Confidence Level: 0</p> | |
| 6252 <p>AUTHORS: PMID: 4382012, PMID: 13575411, Harpers illustrated Biochemistry (2009) 28th edition pages 174-183</p> | |
| 6253 <p>ec-code: 1.1.1.44</p> | |
| 6254 <p>bigg.reaction: GNDc</p> | |
| 6255 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
| 6256 <p>EC_NUMBER: 1.1.1.44</p> | |
| 6257 <p>pmids: 4382012,13575411</p> | |
| 6258 <p>GENE_ASSOCIATION: ENSG00000142657</p> | |
| 6259 </body> | |
| 6260 </notes> | |
| 6261 <annotation> | |
| 6262 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6263 <rdf:Description rdf:about="#ef163958-45f6-498d-acb0-0e2d72945b19"> | |
| 6264 <bqbiol:is> | |
| 6265 <rdf:Bag> | |
| 6266 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.44"/> | |
| 6267 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/GNDc"/> | |
| 6268 </rdf:Bag> | |
| 6269 </bqbiol:is> | |
| 6270 <bqbiol:isDescribedBy> | |
| 6271 <rdf:Bag> | |
| 6272 <rdf:li rdf:resource="https://identifiers.org/pubmed/13575411"/> | |
| 6273 <rdf:li rdf:resource="https://identifiers.org/pubmed/4382012"/> | |
| 6274 </rdf:Bag> | |
| 6275 </bqbiol:isDescribedBy> | |
| 6276 </rdf:Description> | |
| 6277 </rdf:RDF> | |
| 6278 </annotation> | |
| 6279 <fbc:geneProductAssociation> | |
| 6280 <fbc:geneProductRef fbc:geneProduct="ENSG00000142657"/> | |
| 6281 </fbc:geneProductAssociation> | |
| 6282 <listOfReactants> | |
| 6283 <speciesReference constant="true" species="M_m01169c" stoichiometry="3"/> | |
| 6284 <speciesReference constant="true" species="M_m02554c" stoichiometry="3"/> | |
| 6285 </listOfReactants> | |
| 6286 <listOfProducts> | |
| 6287 <speciesReference constant="true" species="M_m02846c" stoichiometry="3"/> | |
| 6288 <speciesReference constant="true" species="M_m02555c" stoichiometry="3"/> | |
| 6289 <speciesReference constant="true" species="M_m01596c" stoichiometry="3"/> | |
| 6290 </listOfProducts> | |
| 6291 </reaction> | |
| 6292 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4385" metaid="_83fb9834-0745-47d2-b88f-9cb966a0eefd" name="R_HMR_4385" reversible="false" sboTerm="SBO:0000176"> | |
| 6293 <notes> | |
| 6294 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6295 <p>Confidence Level: 0</p> | |
| 6296 <p>AUTHORS: PMID:10593562;PMID:12889654;PMID:15361947</p> | |
| 6297 <p>ec-code: 5.4.2.8</p> | |
| 6298 <p>metanetx.reaction: MNXR101729</p> | |
| 6299 <p>kegg.reaction: R01818</p> | |
| 6300 <p>bigg.reaction: PMANM</p> | |
| 6301 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
| 6302 <p>EC_NUMBER: 5.4.2.8</p> | |
| 6303 <p>pmids: 10593562,12889654,15361947</p> | |
| 6304 <p>GENE_ASSOCIATION: ( ENSG00000100413 ) OR ( ENSG00000100417 ) OR ( ENSG00000140650 )</p> | |
| 6305 </body> | |
| 6306 </notes> | |
| 6307 <annotation> | |
| 6308 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6309 <rdf:Description rdf:about="#_83fb9834-0745-47d2-b88f-9cb966a0eefd"> | |
| 6310 <bqbiol:is> | |
| 6311 <rdf:Bag> | |
| 6312 <rdf:li rdf:resource="https://identifiers.org/ec-code/5.4.2.8"/> | |
| 6313 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR101729"/> | |
| 6314 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01818"/> | |
| 6315 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/PMANM"/> | |
| 6316 </rdf:Bag> | |
| 6317 </bqbiol:is> | |
| 6318 <bqbiol:isDescribedBy> | |
| 6319 <rdf:Bag> | |
| 6320 <rdf:li rdf:resource="https://identifiers.org/pubmed/15361947"/> | |
| 6321 <rdf:li rdf:resource="https://identifiers.org/pubmed/12889654"/> | |
| 6322 <rdf:li rdf:resource="https://identifiers.org/pubmed/10593562"/> | |
| 6323 </rdf:Bag> | |
| 6324 </bqbiol:isDescribedBy> | |
| 6325 </rdf:Description> | |
| 6326 </rdf:RDF> | |
| 6327 </annotation> | |
| 6328 <fbc:geneProductAssociation> | |
| 6329 <fbc:or> | |
| 6330 <fbc:geneProductRef fbc:geneProduct="ENSG00000140650"/> | |
| 6331 <fbc:geneProductRef fbc:geneProduct="ENSG00000100417"/> | |
| 6332 <fbc:geneProductRef fbc:geneProduct="ENSG00000100413"/> | |
| 6333 </fbc:or> | |
| 6334 </fbc:geneProductAssociation> | |
| 6335 <listOfReactants> | |
| 6336 <speciesReference constant="true" species="M_m02455c" stoichiometry="1"/> | |
| 6337 </listOfReactants> | |
| 6338 <listOfProducts> | |
| 6339 <speciesReference constant="true" species="M_m02454c" stoichiometry="1"/> | |
| 6340 </listOfProducts> | |
| 6341 </reaction> | |
| 6342 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4386" metaid="_1b139dd2-60dd-4d29-b9db-c7cd0c97d62b" name="R_HMR_4386" reversible="false" sboTerm="SBO:0000176"> | |
| 6343 <notes> | |
| 6344 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6345 <p>Confidence Level: 0</p> | |
| 6346 <p>AUTHORS: PMID:13876695</p> | |
| 6347 <p>ec-code: 2.7.7.13 || 2.7.7.22</p> | |
| 6348 <p>metanetx.reaction: MNXR101376</p> | |
| 6349 <p>kegg.reaction: R00883</p> | |
| 6350 <p>bigg.reaction: MAN1PT2</p> | |
| 6351 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
| 6352 <p>EC_NUMBER: 2.7.7.22;2.7.7.13</p> | |
| 6353 <p>pmids: 13876695</p> | |
| 6354 <p>GENE_ASSOCIATION: ( ENSG00000144591 ) OR ( ENSG00000164068 ) OR ( ENSG00000173540 ) OR ( ENSG00000176020 )</p> | |
| 6355 </body> | |
| 6356 </notes> | |
| 6357 <annotation> | |
| 6358 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6359 <rdf:Description rdf:about="#_1b139dd2-60dd-4d29-b9db-c7cd0c97d62b"> | |
| 6360 <bqbiol:is> | |
| 6361 <rdf:Bag> | |
| 6362 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.7.13"/> | |
| 6363 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.7.22"/> | |
| 6364 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR101376"/> | |
| 6365 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R00883"/> | |
| 6366 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/MAN1PT2"/> | |
| 6367 </rdf:Bag> | |
| 6368 </bqbiol:is> | |
| 6369 <bqbiol:isDescribedBy> | |
| 6370 <rdf:Bag> | |
| 6371 <rdf:li rdf:resource="https://identifiers.org/pubmed/13876695"/> | |
| 6372 </rdf:Bag> | |
| 6373 </bqbiol:isDescribedBy> | |
| 6374 </rdf:Description> | |
| 6375 </rdf:RDF> | |
| 6376 </annotation> | |
| 6377 <fbc:geneProductAssociation> | |
| 6378 <fbc:or> | |
| 6379 <fbc:geneProductRef fbc:geneProduct="ENSG00000164068"/> | |
| 6380 <fbc:geneProductRef fbc:geneProduct="ENSG00000176020"/> | |
| 6381 <fbc:geneProductRef fbc:geneProduct="ENSG00000173540"/> | |
| 6382 <fbc:geneProductRef fbc:geneProduct="ENSG00000144591"/> | |
| 6383 </fbc:or> | |
| 6384 </fbc:geneProductAssociation> | |
| 6385 <listOfReactants> | |
| 6386 <speciesReference constant="true" species="M_m01948c" stoichiometry="1"/> | |
| 6387 <speciesReference constant="true" species="M_m02454c" stoichiometry="1"/> | |
| 6388 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
| 6389 </listOfReactants> | |
| 6390 <listOfProducts> | |
| 6391 <speciesReference constant="true" species="M_m01951c" stoichiometry="1"/> | |
| 6392 <speciesReference constant="true" species="M_m02751c" stoichiometry="1"/> | |
| 6393 </listOfProducts> | |
| 6394 </reaction> | |
| 6395 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_ABTD1" metaid="_030d6c02-c016-4e4d-a3a0-100f8b573715" name="L-Arabinitol 4-Dehydrogenase" reversible="true" sboTerm="SBO:0000176"> | |
| 6396 <notes> | |
| 6397 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6398 <p>Confidence Level: 0</p> | |
| 6399 <p>AUTHORS: PMID: 16435225</p> | |
| 6400 <p>ec-code: 3.1.1.4</p> | |
| 6401 <p>bigg.reaction: ABTD1</p> | |
| 6402 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
| 6403 <p>EC_NUMBER: 3.1.1.4</p> | |
| 6404 <p>pmids: 16435225</p> | |
| 6405 </body> | |
| 6406 </notes> | |
| 6407 <annotation> | |
| 6408 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6409 <rdf:Description rdf:about="#_030d6c02-c016-4e4d-a3a0-100f8b573715"> | |
| 6410 <bqbiol:is> | |
| 6411 <rdf:Bag> | |
| 6412 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.1.1.4"/> | |
| 6413 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/ABTD1"/> | |
| 6414 </rdf:Bag> | |
| 6415 </bqbiol:is> | |
| 6416 <bqbiol:isDescribedBy> | |
| 6417 <rdf:Bag> | |
| 6418 <rdf:li rdf:resource="https://identifiers.org/pubmed/16435225"/> | |
| 6419 </rdf:Bag> | |
| 6420 </bqbiol:isDescribedBy> | |
| 6421 </rdf:Description> | |
| 6422 </rdf:RDF> | |
| 6423 </annotation> | |
| 6424 <listOfReactants> | |
| 6425 <speciesReference constant="true" species="M_m02552c" stoichiometry="1"/> | |
| 6426 <speciesReference constant="true" species="M_abt_D_c" stoichiometry="1"/> | |
| 6427 </listOfReactants> | |
| 6428 <listOfProducts> | |
| 6429 <speciesReference constant="true" species="M_m02553c" stoichiometry="1"/> | |
| 6430 <speciesReference constant="true" species="M_m02425c" stoichiometry="1"/> | |
| 6431 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
| 6432 </listOfProducts> | |
| 6433 </reaction> | |
| 6434 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4387" metaid="_642e9305-23e4-4e3a-b6ef-fe32f9051987" name="R_HMR_4387" reversible="false" sboTerm="SBO:0000176"> | |
| 6435 <notes> | |
| 6436 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6437 <p>Confidence Level: 0</p> | |
| 6438 <p>AUTHORS: PMID:10025667;PMID:8549746;PMID:9451026</p> | |
| 6439 <p>ec-code: 2.7.7.13</p> | |
| 6440 <p>metanetx.reaction: MNXR101375</p> | |
| 6441 <p>kegg.reaction: R00885</p> | |
| 6442 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
| 6443 <p>EC_NUMBER: 2.7.7.13</p> | |
| 6444 <p>pmids: 8549746,9451026,10025667</p> | |
| 6445 <p>GENE_ASSOCIATION: ( ENSG00000144591 ) OR ( ENSG00000173540 ) OR ( ENSG00000176020 )</p> | |
| 6446 </body> | |
| 6447 </notes> | |
| 6448 <annotation> | |
| 6449 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6450 <rdf:Description rdf:about="#_642e9305-23e4-4e3a-b6ef-fe32f9051987"> | |
| 6451 <bqbiol:is> | |
| 6452 <rdf:Bag> | |
| 6453 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.7.13"/> | |
| 6454 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR101375"/> | |
| 6455 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R00885"/> | |
| 6456 </rdf:Bag> | |
| 6457 </bqbiol:is> | |
| 6458 <bqbiol:isDescribedBy> | |
| 6459 <rdf:Bag> | |
| 6460 <rdf:li rdf:resource="https://identifiers.org/pubmed/8549746"/> | |
| 6461 <rdf:li rdf:resource="https://identifiers.org/pubmed/9451026"/> | |
| 6462 <rdf:li rdf:resource="https://identifiers.org/pubmed/10025667"/> | |
| 6463 </rdf:Bag> | |
| 6464 </bqbiol:isDescribedBy> | |
| 6465 </rdf:Description> | |
| 6466 </rdf:RDF> | |
| 6467 </annotation> | |
| 6468 <fbc:geneProductAssociation> | |
| 6469 <fbc:or> | |
| 6470 <fbc:geneProductRef fbc:geneProduct="ENSG00000176020"/> | |
| 6471 <fbc:geneProductRef fbc:geneProduct="ENSG00000173540"/> | |
| 6472 <fbc:geneProductRef fbc:geneProduct="ENSG00000144591"/> | |
| 6473 </fbc:or> | |
| 6474 </fbc:geneProductAssociation> | |
| 6475 <listOfReactants> | |
| 6476 <speciesReference constant="true" species="M_m02454c" stoichiometry="1"/> | |
| 6477 <speciesReference constant="true" species="M_m02034c" stoichiometry="1"/> | |
| 6478 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
| 6479 </listOfReactants> | |
| 6480 <listOfProducts> | |
| 6481 <speciesReference constant="true" species="M_m01951c" stoichiometry="1"/> | |
| 6482 <speciesReference constant="true" species="M_m02759c" stoichiometry="1"/> | |
| 6483 </listOfProducts> | |
| 6484 </reaction> | |
| 6485 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_9799" metaid="_57352ce2-7ff7-4510-8c37-fe046275ab37" name="R_HMR_9799" reversible="true" sboTerm="SBO:0000176"> | |
| 6486 <notes> | |
| 6487 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6488 <p>Confidence Level: 0</p> | |
| 6489 <p>ec-code: 2.7.1.14</p> | |
| 6490 <p>metanetx.reaction: MNXR107202</p> | |
| 6491 <p>kegg.reaction: R01844</p> | |
| 6492 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
| 6493 <p>EC_NUMBER: 2.7.1.14</p> | |
| 6494 <p>GENE_ASSOCIATION: ENSG00000197417</p> | |
| 6495 </body> | |
| 6496 </notes> | |
| 6497 <annotation> | |
| 6498 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6499 <rdf:Description rdf:about="#_57352ce2-7ff7-4510-8c37-fe046275ab37"> | |
| 6500 <bqbiol:is> | |
| 6501 <rdf:Bag> | |
| 6502 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.14"/> | |
| 6503 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR107202"/> | |
| 6504 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01844"/> | |
| 6505 </rdf:Bag> | |
| 6506 </bqbiol:is> | |
| 6507 </rdf:Description> | |
| 6508 </rdf:RDF> | |
| 6509 </annotation> | |
| 6510 <fbc:geneProductAssociation> | |
| 6511 <fbc:geneProductRef fbc:geneProduct="ENSG00000197417"/> | |
| 6512 </fbc:geneProductAssociation> | |
| 6513 <listOfReactants> | |
| 6514 <speciesReference constant="true" species="M_m01371c" stoichiometry="1"/> | |
| 6515 <speciesReference constant="true" species="M_m03165c" stoichiometry="1"/> | |
| 6516 </listOfReactants> | |
| 6517 <listOfProducts> | |
| 6518 <speciesReference constant="true" species="M_m02884c" stoichiometry="1"/> | |
| 6519 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
| 6520 <speciesReference constant="true" species="M_m01285c" stoichiometry="1"/> | |
| 6521 </listOfProducts> | |
| 6522 </reaction> | |
| 6523 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4303" metaid="_073189d4-50c2-4cf1-b826-23bdb07507f8" name="R_HMR_4303" reversible="false" sboTerm="SBO:0000176"> | |
| 6524 <notes> | |
| 6525 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6526 <p>Confidence Level: 0</p> | |
| 6527 <p>AUTHORS: PMID:12055199</p> | |
| 6528 <p>ec-code: 3.2.1.48 || 3.2.1.10 || 3.2.1.20</p> | |
| 6529 <p>metanetx.reaction: MNXR104638</p> | |
| 6530 <p>kegg.reaction: R00801</p> | |
| 6531 <p>bigg.reaction: SUCRe</p> | |
| 6532 <p>SUBSYSTEM: Galactose metabolism</p> | |
| 6533 <p>EC_NUMBER: 3.2.1.10;3.2.1.20;3.2.1.48</p> | |
| 6534 <p>pmids: 12055199</p> | |
| 6535 <p>GENE_ASSOCIATION: ( ENSG00000090402 ) OR ( ENSG00000171298 ) OR ( ENSG00000214013 ) OR ( ENSG00000257335 )</p> | |
| 6536 </body> | |
| 6537 </notes> | |
| 6538 <annotation> | |
| 6539 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6540 <rdf:Description rdf:about="#_073189d4-50c2-4cf1-b826-23bdb07507f8"> | |
| 6541 <bqbiol:is> | |
| 6542 <rdf:Bag> | |
| 6543 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.2.1.48"/> | |
| 6544 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.2.1.10"/> | |
| 6545 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.2.1.20"/> | |
| 6546 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR104638"/> | |
| 6547 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R00801"/> | |
| 6548 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/SUCRe"/> | |
| 6549 </rdf:Bag> | |
| 6550 </bqbiol:is> | |
| 6551 <bqbiol:isDescribedBy> | |
| 6552 <rdf:Bag> | |
| 6553 <rdf:li rdf:resource="https://identifiers.org/pubmed/12055199"/> | |
| 6554 </rdf:Bag> | |
| 6555 </bqbiol:isDescribedBy> | |
| 6556 </rdf:Description> | |
| 6557 </rdf:RDF> | |
| 6558 </annotation> | |
| 6559 <fbc:geneProductAssociation> | |
| 6560 <fbc:or> | |
| 6561 <fbc:geneProductRef fbc:geneProduct="ENSG00000171298"/> | |
| 6562 <fbc:geneProductRef fbc:geneProduct="ENSG00000257335"/> | |
| 6563 <fbc:geneProductRef fbc:geneProduct="ENSG00000090402"/> | |
| 6564 <fbc:geneProductRef fbc:geneProduct="ENSG00000214013"/> | |
| 6565 </fbc:or> | |
| 6566 </fbc:geneProductAssociation> | |
| 6567 <listOfReactants> | |
| 6568 <speciesReference constant="true" species="M_m02040s" stoichiometry="1"/> | |
| 6569 <speciesReference constant="true" species="M_m02945s" stoichiometry="1"/> | |
| 6570 </listOfReactants> | |
| 6571 <listOfProducts> | |
| 6572 <speciesReference constant="true" species="M_m01965s" stoichiometry="1"/> | |
| 6573 <speciesReference constant="true" species="M_m01840s" stoichiometry="1"/> | |
| 6574 </listOfProducts> | |
| 6575 </reaction> | |
| 6576 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4501" metaid="_94343e1c-c62d-4149-953b-237ef55a08ca" name="R_HMR_4501" reversible="true" sboTerm="SBO:0000176"> | |
| 6577 <notes> | |
| 6578 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6579 <p>Confidence Level: 0</p> | |
| 6580 <p>AUTHORS: PMID:13385248;PMID:2495942;UNIPROT:P29401</p> | |
| 6581 <p>ec-code: 2.2.1.1</p> | |
| 6582 <p>metanetx.reaction: MNXR107105 || MNXR104868</p> | |
| 6583 <p>kegg.reaction: R01641</p> | |
| 6584 <p>bigg.reaction: TKT1</p> | |
| 6585 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
| 6586 <p>EC_NUMBER: 2.2.1.1</p> | |
| 6587 <p>pmids: 2495942,13385248</p> | |
| 6588 <p>GENE_ASSOCIATION: ( ENSG00000007350 ) OR ( ENSG00000151005 ) OR ( ENSG00000163931 )</p> | |
| 6589 </body> | |
| 6590 </notes> | |
| 6591 <annotation> | |
| 6592 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6593 <rdf:Description rdf:about="#_94343e1c-c62d-4149-953b-237ef55a08ca"> | |
| 6594 <bqbiol:is> | |
| 6595 <rdf:Bag> | |
| 6596 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.2.1.1"/> | |
| 6597 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR107105"/> | |
| 6598 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR104868"/> | |
| 6599 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01641"/> | |
| 6600 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/TKT1"/> | |
| 6601 </rdf:Bag> | |
| 6602 </bqbiol:is> | |
| 6603 <bqbiol:isDescribedBy> | |
| 6604 <rdf:Bag> | |
| 6605 <rdf:li rdf:resource="https://identifiers.org/pubmed/2495942"/> | |
| 6606 <rdf:li rdf:resource="https://identifiers.org/pubmed/13385248"/> | |
| 6607 </rdf:Bag> | |
| 6608 </bqbiol:isDescribedBy> | |
| 6609 </rdf:Description> | |
| 6610 </rdf:RDF> | |
| 6611 </annotation> | |
| 6612 <fbc:geneProductAssociation> | |
| 6613 <fbc:or> | |
| 6614 <fbc:geneProductRef fbc:geneProduct="ENSG00000163931"/> | |
| 6615 <fbc:geneProductRef fbc:geneProduct="ENSG00000007350"/> | |
| 6616 <fbc:geneProductRef fbc:geneProduct="ENSG00000151005"/> | |
| 6617 </fbc:or> | |
| 6618 </fbc:geneProductAssociation> | |
| 6619 <listOfReactants> | |
| 6620 <speciesReference constant="true" species="M_m02845c" stoichiometry="1"/> | |
| 6621 <speciesReference constant="true" species="M_m01761c" stoichiometry="1"/> | |
| 6622 </listOfReactants> | |
| 6623 <listOfProducts> | |
| 6624 <speciesReference constant="true" species="M_m01939c" stoichiometry="1"/> | |
| 6625 <speciesReference constant="true" species="M_m02884c" stoichiometry="1"/> | |
| 6626 </listOfProducts> | |
| 6627 </reaction> | |
| 6628 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4304" metaid="_4a19056f-9291-4536-aee2-1f674e94327c" name="R_HMR_4304" reversible="false" sboTerm="SBO:0000176"> | |
| 6629 <notes> | |
| 6630 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6631 <p>Confidence Level: 0</p> | |
| 6632 <p>AUTHORS: PMID:15774558;PMID:16756494;PMID:2753047;PMID:4169027</p> | |
| 6633 <p>ec-code: 1.1.1.49</p> | |
| 6634 <p>metanetx.reaction: MNXR99907</p> | |
| 6635 <p>kegg.reaction: R00835</p> | |
| 6636 <p>bigg.reaction: G6PDH2er</p> | |
| 6637 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
| 6638 <p>EC_NUMBER: 1.1.1.49</p> | |
| 6639 <p>pmids: 2753047,4169027,15774558,16756494</p> | |
| 6640 <p>GENE_ASSOCIATION: ENSG00000160211</p> | |
| 6641 </body> | |
| 6642 </notes> | |
| 6643 <annotation> | |
| 6644 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6645 <rdf:Description rdf:about="#_4a19056f-9291-4536-aee2-1f674e94327c"> | |
| 6646 <bqbiol:is> | |
| 6647 <rdf:Bag> | |
| 6648 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.49"/> | |
| 6649 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR99907"/> | |
| 6650 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R00835"/> | |
| 6651 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/G6PDH2er"/> | |
| 6652 </rdf:Bag> | |
| 6653 </bqbiol:is> | |
| 6654 <bqbiol:isDescribedBy> | |
| 6655 <rdf:Bag> | |
| 6656 <rdf:li rdf:resource="https://identifiers.org/pubmed/16756494"/> | |
| 6657 <rdf:li rdf:resource="https://identifiers.org/pubmed/4169027"/> | |
| 6658 <rdf:li rdf:resource="https://identifiers.org/pubmed/2753047"/> | |
| 6659 <rdf:li rdf:resource="https://identifiers.org/pubmed/15774558"/> | |
| 6660 </rdf:Bag> | |
| 6661 </bqbiol:isDescribedBy> | |
| 6662 </rdf:Description> | |
| 6663 </rdf:RDF> | |
| 6664 </annotation> | |
| 6665 <fbc:geneProductAssociation> | |
| 6666 <fbc:geneProductRef fbc:geneProduct="ENSG00000160211"/> | |
| 6667 </fbc:geneProductAssociation> | |
| 6668 <listOfReactants> | |
| 6669 <speciesReference constant="true" species="M_m01968r" stoichiometry="1"/> | |
| 6670 <speciesReference constant="true" species="M_m02554r" stoichiometry="1"/> | |
| 6671 </listOfReactants> | |
| 6672 <listOfProducts> | |
| 6673 <speciesReference constant="true" species="M_m01961r" stoichiometry="1"/> | |
| 6674 <speciesReference constant="true" species="M_m02555r" stoichiometry="1"/> | |
| 6675 <speciesReference constant="true" species="M_m02039r" stoichiometry="1"/> | |
| 6676 </listOfProducts> | |
| 6677 </reaction> | |
| 6678 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4623" metaid="_977981ea-549f-4af8-8bc9-8f06a599033d" name="R_HMR_4623" reversible="false" sboTerm="SBO:0000176"> | |
| 6679 <notes> | |
| 6680 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6681 <p>Confidence Level: 0</p> | |
| 6682 <p>AUTHORS: PMID:3858849;PMID:3932573;PMID:6852020;PMID:971315</p> | |
| 6683 <p>ec-code: 3.1.1.31</p> | |
| 6684 <p>metanetx.reaction: MNXR102539</p> | |
| 6685 <p>kegg.reaction: R02035</p> | |
| 6686 <p>bigg.reaction: PGLer</p> | |
| 6687 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
| 6688 <p>EC_NUMBER: 3.1.1.31</p> | |
| 6689 <p>pmids: 971315,3858849,3932573,6852020</p> | |
| 6690 <p>GENE_ASSOCIATION: ( ENSG00000049239 ) OR ( ENSG00000130313 )</p> | |
| 6691 </body> | |
| 6692 </notes> | |
| 6693 <annotation> | |
| 6694 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6695 <rdf:Description rdf:about="#_977981ea-549f-4af8-8bc9-8f06a599033d"> | |
| 6696 <bqbiol:is> | |
| 6697 <rdf:Bag> | |
| 6698 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.1.1.31"/> | |
| 6699 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR102539"/> | |
| 6700 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R02035"/> | |
| 6701 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/PGLer"/> | |
| 6702 </rdf:Bag> | |
| 6703 </bqbiol:is> | |
| 6704 <bqbiol:isDescribedBy> | |
| 6705 <rdf:Bag> | |
| 6706 <rdf:li rdf:resource="https://identifiers.org/pubmed/3932573"/> | |
| 6707 <rdf:li rdf:resource="https://identifiers.org/pubmed/3858849"/> | |
| 6708 <rdf:li rdf:resource="https://identifiers.org/pubmed/6852020"/> | |
| 6709 <rdf:li rdf:resource="https://identifiers.org/pubmed/971315"/> | |
| 6710 </rdf:Bag> | |
| 6711 </bqbiol:isDescribedBy> | |
| 6712 </rdf:Description> | |
| 6713 </rdf:RDF> | |
| 6714 </annotation> | |
| 6715 <fbc:geneProductAssociation> | |
| 6716 <fbc:or> | |
| 6717 <fbc:geneProductRef fbc:geneProduct="ENSG00000049239"/> | |
| 6718 <fbc:geneProductRef fbc:geneProduct="ENSG00000130313"/> | |
| 6719 </fbc:or> | |
| 6720 </fbc:geneProductAssociation> | |
| 6721 <listOfReactants> | |
| 6722 <speciesReference constant="true" species="M_m01961r" stoichiometry="1"/> | |
| 6723 <speciesReference constant="true" species="M_m02040r" stoichiometry="1"/> | |
| 6724 </listOfReactants> | |
| 6725 <listOfProducts> | |
| 6726 <speciesReference constant="true" species="M_m01169r" stoichiometry="1"/> | |
| 6727 <speciesReference constant="true" species="M_m02039r" stoichiometry="1"/> | |
| 6728 </listOfProducts> | |
| 6729 </reaction> | |
| 6730 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4306" metaid="c51de190-dee0-491f-93ed-9eebe9f571ff" name="R_HMR_4306" reversible="true" sboTerm="SBO:0000176"> | |
| 6731 <notes> | |
| 6732 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6733 <p>Confidence Level: 0</p> | |
| 6734 <p>AUTHORS: PMID:15774558;PMID:16756494;PMID:2753047;PMID:4169027</p> | |
| 6735 <p>ec-code: 1.1.1.49</p> | |
| 6736 <p>metanetx.reaction: MNXR99907</p> | |
| 6737 <p>kegg.reaction: R00835</p> | |
| 6738 <p>bigg.reaction: G6PDH2r</p> | |
| 6739 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
| 6740 <p>EC_NUMBER: 1.1.1.49</p> | |
| 6741 <p>pmids: 2753047,4169027,15774558,16756494</p> | |
| 6742 <p>GENE_ASSOCIATION: ENSG00000160211</p> | |
| 6743 </body> | |
| 6744 </notes> | |
| 6745 <annotation> | |
| 6746 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6747 <rdf:Description rdf:about="#c51de190-dee0-491f-93ed-9eebe9f571ff"> | |
| 6748 <bqbiol:is> | |
| 6749 <rdf:Bag> | |
| 6750 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.49"/> | |
| 6751 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR99907"/> | |
| 6752 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R00835"/> | |
| 6753 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/G6PDH2r"/> | |
| 6754 </rdf:Bag> | |
| 6755 </bqbiol:is> | |
| 6756 <bqbiol:isDescribedBy> | |
| 6757 <rdf:Bag> | |
| 6758 <rdf:li rdf:resource="https://identifiers.org/pubmed/16756494"/> | |
| 6759 <rdf:li rdf:resource="https://identifiers.org/pubmed/4169027"/> | |
| 6760 <rdf:li rdf:resource="https://identifiers.org/pubmed/2753047"/> | |
| 6761 <rdf:li rdf:resource="https://identifiers.org/pubmed/15774558"/> | |
| 6762 </rdf:Bag> | |
| 6763 </bqbiol:isDescribedBy> | |
| 6764 </rdf:Description> | |
| 6765 </rdf:RDF> | |
| 6766 </annotation> | |
| 6767 <fbc:geneProductAssociation> | |
| 6768 <fbc:geneProductRef fbc:geneProduct="ENSG00000160211"/> | |
| 6769 </fbc:geneProductAssociation> | |
| 6770 <listOfReactants> | |
| 6771 <speciesReference constant="true" species="M_m01961c" stoichiometry="1"/> | |
| 6772 <speciesReference constant="true" species="M_m02555c" stoichiometry="1"/> | |
| 6773 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
| 6774 </listOfReactants> | |
| 6775 <listOfProducts> | |
| 6776 <speciesReference constant="true" species="M_m02554c" stoichiometry="1"/> | |
| 6777 <speciesReference constant="true" species="M_m01968c" stoichiometry="1"/> | |
| 6778 </listOfProducts> | |
| 6779 </reaction> | |
| 6780 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4625" metaid="ce25ac8c-d5cd-45bf-aa0f-b5091cc8f920" name="R_HMR_4625" reversible="false" sboTerm="SBO:0000176"> | |
| 6781 <notes> | |
| 6782 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6783 <p>Confidence Level: 0</p> | |
| 6784 <p>AUTHORS: PMID:3858849;PMID:3932573;PMID:6852020;PMID:971315</p> | |
| 6785 <p>ec-code: 3.1.1.31</p> | |
| 6786 <p>metanetx.reaction: MNXR102539</p> | |
| 6787 <p>kegg.reaction: R02035</p> | |
| 6788 <p>bigg.reaction: PGL</p> | |
| 6789 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
| 6790 <p>EC_NUMBER: 3.1.1.31</p> | |
| 6791 <p>pmids: 971315,3858849,3932573,6852020</p> | |
| 6792 <p>GENE_ASSOCIATION: ( ENSG00000049239 ) OR ( ENSG00000130313 )</p> | |
| 6793 </body> | |
| 6794 </notes> | |
| 6795 <annotation> | |
| 6796 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6797 <rdf:Description rdf:about="#ce25ac8c-d5cd-45bf-aa0f-b5091cc8f920"> | |
| 6798 <bqbiol:is> | |
| 6799 <rdf:Bag> | |
| 6800 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.1.1.31"/> | |
| 6801 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR102539"/> | |
| 6802 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R02035"/> | |
| 6803 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/PGL"/> | |
| 6804 </rdf:Bag> | |
| 6805 </bqbiol:is> | |
| 6806 <bqbiol:isDescribedBy> | |
| 6807 <rdf:Bag> | |
| 6808 <rdf:li rdf:resource="https://identifiers.org/pubmed/3932573"/> | |
| 6809 <rdf:li rdf:resource="https://identifiers.org/pubmed/3858849"/> | |
| 6810 <rdf:li rdf:resource="https://identifiers.org/pubmed/6852020"/> | |
| 6811 <rdf:li rdf:resource="https://identifiers.org/pubmed/971315"/> | |
| 6812 </rdf:Bag> | |
| 6813 </bqbiol:isDescribedBy> | |
| 6814 </rdf:Description> | |
| 6815 </rdf:RDF> | |
| 6816 </annotation> | |
| 6817 <fbc:geneProductAssociation> | |
| 6818 <fbc:or> | |
| 6819 <fbc:geneProductRef fbc:geneProduct="ENSG00000049239"/> | |
| 6820 <fbc:geneProductRef fbc:geneProduct="ENSG00000130313"/> | |
| 6821 </fbc:or> | |
| 6822 </fbc:geneProductAssociation> | |
| 6823 <listOfReactants> | |
| 6824 <speciesReference constant="true" species="M_m02040c" stoichiometry="1"/> | |
| 6825 <speciesReference constant="true" species="M_m01961c" stoichiometry="1"/> | |
| 6826 </listOfReactants> | |
| 6827 <listOfProducts> | |
| 6828 <speciesReference constant="true" species="M_m01169c" stoichiometry="1"/> | |
| 6829 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
| 6830 </listOfProducts> | |
| 6831 </reaction> | |
| 6832 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4706" metaid="_76f44f32-e827-409c-9f89-d39564cf363b" name="R_HMR_4706" reversible="false" sboTerm="SBO:0000176"> | |
| 6833 <notes> | |
| 6834 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6835 <p>Confidence Level: 0</p> | |
| 6836 <p>AUTHORS: PMID:11245921;PMID:12379646;PMID:15170386;PMID:15581487;PMID:16316985;PMID:2837207</p> | |
| 6837 <p>ec-code: 3.1.3.46 || 3.1.3.11</p> | |
| 6838 <p>metanetx.reaction: MNXR106671 || MNXR99466</p> | |
| 6839 <p>kegg.reaction: R00763</p> | |
| 6840 <p>bigg.reaction: FBP26</p> | |
| 6841 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
| 6842 <p>EC_NUMBER: 3.1.3.46;3.1.3.11</p> | |
| 6843 <p>pmids: 2837207,11245921,12379646,15170386,15581487,16316985</p> | |
| 6844 <p>GENE_ASSOCIATION: ( ENSG00000078237 ) OR ( ENSG00000108813 ) OR ( ENSG00000114268 ) OR ( ENSG00000123836 ) OR ( ENSG00000158571 ) OR ( ENSG00000170525 )</p> | |
| 6845 </body> | |
| 6846 </notes> | |
| 6847 <annotation> | |
| 6848 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6849 <rdf:Description rdf:about="#_76f44f32-e827-409c-9f89-d39564cf363b"> | |
| 6850 <bqbiol:is> | |
| 6851 <rdf:Bag> | |
| 6852 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.1.3.46"/> | |
| 6853 <rdf:li rdf:resource="https://identifiers.org/ec-code/3.1.3.11"/> | |
| 6854 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR106671"/> | |
| 6855 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR99466"/> | |
| 6856 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R00763"/> | |
| 6857 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/FBP26"/> | |
| 6858 </rdf:Bag> | |
| 6859 </bqbiol:is> | |
| 6860 <bqbiol:isDescribedBy> | |
| 6861 <rdf:Bag> | |
| 6862 <rdf:li rdf:resource="https://identifiers.org/pubmed/16316985"/> | |
| 6863 <rdf:li rdf:resource="https://identifiers.org/pubmed/12379646"/> | |
| 6864 <rdf:li rdf:resource="https://identifiers.org/pubmed/15581487"/> | |
| 6865 <rdf:li rdf:resource="https://identifiers.org/pubmed/15170386"/> | |
| 6866 <rdf:li rdf:resource="https://identifiers.org/pubmed/11245921"/> | |
| 6867 <rdf:li rdf:resource="https://identifiers.org/pubmed/2837207"/> | |
| 6868 </rdf:Bag> | |
| 6869 </bqbiol:isDescribedBy> | |
| 6870 </rdf:Description> | |
| 6871 </rdf:RDF> | |
| 6872 </annotation> | |
| 6873 <fbc:geneProductAssociation> | |
| 6874 <fbc:or> | |
| 6875 <fbc:geneProductRef fbc:geneProduct="ENSG00000123836"/> | |
| 6876 <fbc:geneProductRef fbc:geneProduct="ENSG00000170525"/> | |
| 6877 <fbc:geneProductRef fbc:geneProduct="ENSG00000108813"/> | |
| 6878 <fbc:geneProductRef fbc:geneProduct="ENSG00000158571"/> | |
| 6879 <fbc:geneProductRef fbc:geneProduct="ENSG00000078237"/> | |
| 6880 <fbc:geneProductRef fbc:geneProduct="ENSG00000114268"/> | |
| 6881 </fbc:or> | |
| 6882 </fbc:geneProductAssociation> | |
| 6883 <listOfReactants> | |
| 6884 <speciesReference constant="true" species="M_m02040c" stoichiometry="1"/> | |
| 6885 <speciesReference constant="true" species="M_m01843c" stoichiometry="1"/> | |
| 6886 </listOfReactants> | |
| 6887 <listOfProducts> | |
| 6888 <speciesReference constant="true" species="M_m02751c" stoichiometry="1"/> | |
| 6889 <speciesReference constant="true" species="M_m01845c" stoichiometry="1"/> | |
| 6890 </listOfProducts> | |
| 6891 </reaction> | |
| 6892 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_G6PDH2c" metaid="_65f65765-bf14-48a2-8308-72aa949d0dd7" name="Glucose 6-Phosphate Dehydrogenase" reversible="false" sboTerm="SBO:0000176"> | |
| 6893 <notes> | |
| 6894 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6895 <p>Confidence Level: 0</p> | |
| 6896 <p>AUTHORS: PMID: 4382012, PMID: 13575411, Harpers illustrated Biochemistry (2009) 28th edition pages 174-183</p> | |
| 6897 <p>bigg.reaction: G6PDH2c</p> | |
| 6898 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
| 6899 <p>pmids: 4382012,13575411</p> | |
| 6900 <p>GENE_ASSOCIATION: ENSG00000160211</p> | |
| 6901 </body> | |
| 6902 </notes> | |
| 6903 <annotation> | |
| 6904 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6905 <rdf:Description rdf:about="#_65f65765-bf14-48a2-8308-72aa949d0dd7"> | |
| 6906 <bqbiol:is> | |
| 6907 <rdf:Bag> | |
| 6908 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/G6PDH2c"/> | |
| 6909 </rdf:Bag> | |
| 6910 </bqbiol:is> | |
| 6911 <bqbiol:isDescribedBy> | |
| 6912 <rdf:Bag> | |
| 6913 <rdf:li rdf:resource="https://identifiers.org/pubmed/13575411"/> | |
| 6914 <rdf:li rdf:resource="https://identifiers.org/pubmed/4382012"/> | |
| 6915 </rdf:Bag> | |
| 6916 </bqbiol:isDescribedBy> | |
| 6917 </rdf:Description> | |
| 6918 </rdf:RDF> | |
| 6919 </annotation> | |
| 6920 <fbc:geneProductAssociation> | |
| 6921 <fbc:geneProductRef fbc:geneProduct="ENSG00000160211"/> | |
| 6922 </fbc:geneProductAssociation> | |
| 6923 <listOfReactants> | |
| 6924 <speciesReference constant="true" species="M_m02554c" stoichiometry="3"/> | |
| 6925 <speciesReference constant="true" species="M_m01968c" stoichiometry="3"/> | |
| 6926 </listOfReactants> | |
| 6927 <listOfProducts> | |
| 6928 <speciesReference constant="true" species="M_m01961c" stoichiometry="3"/> | |
| 6929 <speciesReference constant="true" species="M_m02555c" stoichiometry="3"/> | |
| 6930 <speciesReference constant="true" species="M_m02039c" stoichiometry="3"/> | |
| 6931 </listOfProducts> | |
| 6932 </reaction> | |
| 6933 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_8074" metaid="c6249ea1-2eba-44b9-b389-c3bb870070af" name="R_HMR_8074" reversible="false" sboTerm="SBO:0000176"> | |
| 6934 <notes> | |
| 6935 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6936 <p>Confidence Level: 0</p> | |
| 6937 <p>ec-code: 2.7.1.15</p> | |
| 6938 <p>metanetx.reaction: MNXR97787</p> | |
| 6939 <p>kegg.reaction: R02750</p> | |
| 6940 <p>bigg.reaction: DRPA</p> | |
| 6941 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
| 6942 <p>EC_NUMBER: 2.7.1.15</p> | |
| 6943 <p>GENE_ASSOCIATION: ( ENSG00000158019 ) OR ( ENSG00000171174 )</p> | |
| 6944 </body> | |
| 6945 </notes> | |
| 6946 <annotation> | |
| 6947 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6948 <rdf:Description rdf:about="#c6249ea1-2eba-44b9-b389-c3bb870070af"> | |
| 6949 <bqbiol:is> | |
| 6950 <rdf:Bag> | |
| 6951 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.15"/> | |
| 6952 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR97787"/> | |
| 6953 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R02750"/> | |
| 6954 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/DRPA"/> | |
| 6955 </rdf:Bag> | |
| 6956 </bqbiol:is> | |
| 6957 </rdf:Description> | |
| 6958 </rdf:RDF> | |
| 6959 </annotation> | |
| 6960 <fbc:geneProductAssociation> | |
| 6961 <fbc:or> | |
| 6962 <fbc:geneProductRef fbc:geneProduct="ENSG00000171174"/> | |
| 6963 <fbc:geneProductRef fbc:geneProduct="ENSG00000158019"/> | |
| 6964 </fbc:or> | |
| 6965 </fbc:geneProductAssociation> | |
| 6966 <listOfReactants> | |
| 6967 <speciesReference constant="true" species="M_m01371c" stoichiometry="1"/> | |
| 6968 <speciesReference constant="true" species="M_m01672c" stoichiometry="1"/> | |
| 6969 </listOfReactants> | |
| 6970 <listOfProducts> | |
| 6971 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
| 6972 <speciesReference constant="true" species="M_m00640c" stoichiometry="1"/> | |
| 6973 <speciesReference constant="true" species="M_m01285c" stoichiometry="1"/> | |
| 6974 </listOfProducts> | |
| 6975 </reaction> | |
| 6976 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4350" metaid="cd869f58-5452-4226-8cfe-b859d4054a8f" name="R_HMR_4350" reversible="true" sboTerm="SBO:0000176"> | |
| 6977 <notes> | |
| 6978 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 6979 <p>Confidence Level: 0</p> | |
| 6980 <p>AUTHORS: PMID:13295274;PMID:17618002</p> | |
| 6981 <p>ec-code: 2.7.1.15</p> | |
| 6982 <p>metanetx.reaction: MNXR106804 || MNXR103431</p> | |
| 6983 <p>kegg.reaction: R01051</p> | |
| 6984 <p>bigg.reaction: RBK</p> | |
| 6985 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
| 6986 <p>EC_NUMBER: 2.7.1.15</p> | |
| 6987 <p>pmids: 13295274,17618002</p> | |
| 6988 <p>GENE_ASSOCIATION: ( ENSG00000158019 ) OR ( ENSG00000171174 )</p> | |
| 6989 </body> | |
| 6990 </notes> | |
| 6991 <annotation> | |
| 6992 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 6993 <rdf:Description rdf:about="#cd869f58-5452-4226-8cfe-b859d4054a8f"> | |
| 6994 <bqbiol:is> | |
| 6995 <rdf:Bag> | |
| 6996 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.15"/> | |
| 6997 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR106804"/> | |
| 6998 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR103431"/> | |
| 6999 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01051"/> | |
| 7000 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/RBK"/> | |
| 7001 </rdf:Bag> | |
| 7002 </bqbiol:is> | |
| 7003 <bqbiol:isDescribedBy> | |
| 7004 <rdf:Bag> | |
| 7005 <rdf:li rdf:resource="https://identifiers.org/pubmed/13295274"/> | |
| 7006 <rdf:li rdf:resource="https://identifiers.org/pubmed/17618002"/> | |
| 7007 </rdf:Bag> | |
| 7008 </bqbiol:isDescribedBy> | |
| 7009 </rdf:Description> | |
| 7010 </rdf:RDF> | |
| 7011 </annotation> | |
| 7012 <fbc:geneProductAssociation> | |
| 7013 <fbc:or> | |
| 7014 <fbc:geneProductRef fbc:geneProduct="ENSG00000171174"/> | |
| 7015 <fbc:geneProductRef fbc:geneProduct="ENSG00000158019"/> | |
| 7016 </fbc:or> | |
| 7017 </fbc:geneProductAssociation> | |
| 7018 <listOfReactants> | |
| 7019 <speciesReference constant="true" species="M_m02845c" stoichiometry="1"/> | |
| 7020 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
| 7021 <speciesReference constant="true" species="M_m01285c" stoichiometry="1"/> | |
| 7022 </listOfReactants> | |
| 7023 <listOfProducts> | |
| 7024 <speciesReference constant="true" species="M_m01371c" stoichiometry="1"/> | |
| 7025 <speciesReference constant="true" species="M_m02843c" stoichiometry="1"/> | |
| 7026 </listOfProducts> | |
| 7027 </reaction> | |
| 7028 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_KHK3" metaid="_2f83a279-1e91-4c20-ab35-0fbd94c31885" name="Ketohexokinase (D-Tagatose)" reversible="false" sboTerm="SBO:0000176"> | |
| 7029 <notes> | |
| 7030 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7031 <p>Confidence Level: 0</p> | |
| 7032 <p>AUTHORS: PMID:2996495,PMID:6284103,PMID:6298387</p> | |
| 7033 <p>ec-code: 2.7.1.3</p> | |
| 7034 <p>metanetx.reaction: MNXR100938</p> | |
| 7035 <p>bigg.reaction: KHK3</p> | |
| 7036 <p>SUBSYSTEM: Galactose metabolism</p> | |
| 7037 <p>EC_NUMBER: 2.7.1.3</p> | |
| 7038 <p>pmids: 2996495,6284103,6298387</p> | |
| 7039 <p>GENE_ASSOCIATION: ENSG00000138030</p> | |
| 7040 </body> | |
| 7041 </notes> | |
| 7042 <annotation> | |
| 7043 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7044 <rdf:Description rdf:about="#_2f83a279-1e91-4c20-ab35-0fbd94c31885"> | |
| 7045 <bqbiol:is> | |
| 7046 <rdf:Bag> | |
| 7047 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.3"/> | |
| 7048 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR100938"/> | |
| 7049 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/KHK3"/> | |
| 7050 </rdf:Bag> | |
| 7051 </bqbiol:is> | |
| 7052 <bqbiol:isDescribedBy> | |
| 7053 <rdf:Bag> | |
| 7054 <rdf:li rdf:resource="https://identifiers.org/pubmed/2996495"/> | |
| 7055 <rdf:li rdf:resource="https://identifiers.org/pubmed/6298387"/> | |
| 7056 <rdf:li rdf:resource="https://identifiers.org/pubmed/6284103"/> | |
| 7057 </rdf:Bag> | |
| 7058 </bqbiol:isDescribedBy> | |
| 7059 </rdf:Description> | |
| 7060 </rdf:RDF> | |
| 7061 </annotation> | |
| 7062 <fbc:geneProductAssociation> | |
| 7063 <fbc:geneProductRef fbc:geneProduct="ENSG00000138030"/> | |
| 7064 </fbc:geneProductAssociation> | |
| 7065 <listOfReactants> | |
| 7066 <speciesReference constant="true" species="M_m01371c" stoichiometry="1"/> | |
| 7067 <speciesReference constant="true" species="M_m01745c" stoichiometry="1"/> | |
| 7068 </listOfReactants> | |
| 7069 <listOfProducts> | |
| 7070 <speciesReference constant="true" species="M_tag1p_D_c" stoichiometry="1"/> | |
| 7071 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
| 7072 <speciesReference constant="true" species="M_m01285c" stoichiometry="1"/> | |
| 7073 </listOfProducts> | |
| 7074 </reaction> | |
| 7075 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4351" metaid="_6bfc4346-8d59-4fd8-af6b-41405b4de8a1" name="R_HMR_4351" reversible="true" sboTerm="SBO:0000176"> | |
| 7076 <notes> | |
| 7077 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7078 <p>Confidence Level: 0</p> | |
| 7079 <p>AUTHORS: PMID:14690456;PMID:14988808;PMID:15234337;PMID:2843500</p> | |
| 7080 <p>ec-code: 5.3.1.6</p> | |
| 7081 <p>metanetx.reaction: MNXR104084 || MNXR106809</p> | |
| 7082 <p>kegg.reaction: R01056</p> | |
| 7083 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
| 7084 <p>EC_NUMBER: 5.3.1.6</p> | |
| 7085 <p>pmids: 2843500,14690456,14988808,15234337</p> | |
| 7086 <p>GENE_ASSOCIATION: ENSG00000153574</p> | |
| 7087 </body> | |
| 7088 </notes> | |
| 7089 <annotation> | |
| 7090 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7091 <rdf:Description rdf:about="#_6bfc4346-8d59-4fd8-af6b-41405b4de8a1"> | |
| 7092 <bqbiol:is> | |
| 7093 <rdf:Bag> | |
| 7094 <rdf:li rdf:resource="https://identifiers.org/ec-code/5.3.1.6"/> | |
| 7095 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR104084"/> | |
| 7096 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR106809"/> | |
| 7097 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01056"/> | |
| 7098 </rdf:Bag> | |
| 7099 </bqbiol:is> | |
| 7100 <bqbiol:isDescribedBy> | |
| 7101 <rdf:Bag> | |
| 7102 <rdf:li rdf:resource="https://identifiers.org/pubmed/2843500"/> | |
| 7103 <rdf:li rdf:resource="https://identifiers.org/pubmed/14690456"/> | |
| 7104 <rdf:li rdf:resource="https://identifiers.org/pubmed/15234337"/> | |
| 7105 <rdf:li rdf:resource="https://identifiers.org/pubmed/14988808"/> | |
| 7106 </rdf:Bag> | |
| 7107 </bqbiol:isDescribedBy> | |
| 7108 </rdf:Description> | |
| 7109 </rdf:RDF> | |
| 7110 </annotation> | |
| 7111 <fbc:geneProductAssociation> | |
| 7112 <fbc:geneProductRef fbc:geneProduct="ENSG00000153574"/> | |
| 7113 </fbc:geneProductAssociation> | |
| 7114 <listOfReactants> | |
| 7115 <speciesReference constant="true" species="M_m02845r" stoichiometry="1"/> | |
| 7116 </listOfReactants> | |
| 7117 <listOfProducts> | |
| 7118 <speciesReference constant="true" species="M_m02846r" stoichiometry="1"/> | |
| 7119 </listOfProducts> | |
| 7120 </reaction> | |
| 7121 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4473" metaid="c7c1f092-4aea-48a2-8d25-feb3f47ea431" name="R_HMR_4473" reversible="false" sboTerm="SBO:0000176"> | |
| 7122 <notes> | |
| 7123 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7124 <p>Confidence Level: 0</p> | |
| 7125 <p>AUTHORS: PMID:12398160;PMID:1504088;PMID:15558954;PMID:16756494;PMID:2753047;PMID:3943305;PMID:6212636;PMID:7194116;PMID:7225115;PMID:7623792</p> | |
| 7126 <p>ec-code: 1.1.1.44</p> | |
| 7127 <p>metanetx.reaction: MNXR100389</p> | |
| 7128 <p>kegg.reaction: R01528</p> | |
| 7129 <p>bigg.reaction: GNDer</p> | |
| 7130 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
| 7131 <p>EC_NUMBER: 1.1.1.44</p> | |
| 7132 <p>pmids: 1504088,2753047,3943305,6212636,7194116,7225115,7623792,12398160,15558954,16756494</p> | |
| 7133 <p>GENE_ASSOCIATION: ENSG00000142657</p> | |
| 7134 </body> | |
| 7135 </notes> | |
| 7136 <annotation> | |
| 7137 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7138 <rdf:Description rdf:about="#c7c1f092-4aea-48a2-8d25-feb3f47ea431"> | |
| 7139 <bqbiol:is> | |
| 7140 <rdf:Bag> | |
| 7141 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.44"/> | |
| 7142 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR100389"/> | |
| 7143 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01528"/> | |
| 7144 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/GNDer"/> | |
| 7145 </rdf:Bag> | |
| 7146 </bqbiol:is> | |
| 7147 <bqbiol:isDescribedBy> | |
| 7148 <rdf:Bag> | |
| 7149 <rdf:li rdf:resource="https://identifiers.org/pubmed/16756494"/> | |
| 7150 <rdf:li rdf:resource="https://identifiers.org/pubmed/6212636"/> | |
| 7151 <rdf:li rdf:resource="https://identifiers.org/pubmed/7623792"/> | |
| 7152 <rdf:li rdf:resource="https://identifiers.org/pubmed/3943305"/> | |
| 7153 <rdf:li rdf:resource="https://identifiers.org/pubmed/7225115"/> | |
| 7154 <rdf:li rdf:resource="https://identifiers.org/pubmed/15558954"/> | |
| 7155 <rdf:li rdf:resource="https://identifiers.org/pubmed/7194116"/> | |
| 7156 <rdf:li rdf:resource="https://identifiers.org/pubmed/12398160"/> | |
| 7157 <rdf:li rdf:resource="https://identifiers.org/pubmed/2753047"/> | |
| 7158 <rdf:li rdf:resource="https://identifiers.org/pubmed/1504088"/> | |
| 7159 </rdf:Bag> | |
| 7160 </bqbiol:isDescribedBy> | |
| 7161 </rdf:Description> | |
| 7162 </rdf:RDF> | |
| 7163 </annotation> | |
| 7164 <fbc:geneProductAssociation> | |
| 7165 <fbc:geneProductRef fbc:geneProduct="ENSG00000142657"/> | |
| 7166 </fbc:geneProductAssociation> | |
| 7167 <listOfReactants> | |
| 7168 <speciesReference constant="true" species="M_m01169r" stoichiometry="1"/> | |
| 7169 <speciesReference constant="true" species="M_m02554r" stoichiometry="1"/> | |
| 7170 </listOfReactants> | |
| 7171 <listOfProducts> | |
| 7172 <speciesReference constant="true" species="M_m02846r" stoichiometry="1"/> | |
| 7173 <speciesReference constant="true" species="M_m02555r" stoichiometry="1"/> | |
| 7174 <speciesReference constant="true" species="M_m01596r" stoichiometry="1"/> | |
| 7175 </listOfProducts> | |
| 7176 </reaction> | |
| 7177 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4352" metaid="be77e7e9-9978-4d8f-9533-2dd900d0bde5" name="R_HMR_4352" reversible="true" sboTerm="SBO:0000176"> | |
| 7178 <notes> | |
| 7179 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7180 <p>Confidence Level: 0</p> | |
| 7181 <p>AUTHORS: PMID:14690456;PMID:14988808;PMID:15234337;PMID:2843500</p> | |
| 7182 <p>ec-code: 5.3.1.6</p> | |
| 7183 <p>metanetx.reaction: MNXR104084 || MNXR106809</p> | |
| 7184 <p>kegg.reaction: R01056</p> | |
| 7185 <p>bigg.reaction: RPI</p> | |
| 7186 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
| 7187 <p>EC_NUMBER: 5.3.1.6</p> | |
| 7188 <p>pmids: 2843500,14690456,14988808,15234337</p> | |
| 7189 <p>GENE_ASSOCIATION: ENSG00000153574</p> | |
| 7190 </body> | |
| 7191 </notes> | |
| 7192 <annotation> | |
| 7193 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7194 <rdf:Description rdf:about="#be77e7e9-9978-4d8f-9533-2dd900d0bde5"> | |
| 7195 <bqbiol:is> | |
| 7196 <rdf:Bag> | |
| 7197 <rdf:li rdf:resource="https://identifiers.org/ec-code/5.3.1.6"/> | |
| 7198 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR104084"/> | |
| 7199 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR106809"/> | |
| 7200 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01056"/> | |
| 7201 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/RPI"/> | |
| 7202 </rdf:Bag> | |
| 7203 </bqbiol:is> | |
| 7204 <bqbiol:isDescribedBy> | |
| 7205 <rdf:Bag> | |
| 7206 <rdf:li rdf:resource="https://identifiers.org/pubmed/2843500"/> | |
| 7207 <rdf:li rdf:resource="https://identifiers.org/pubmed/14690456"/> | |
| 7208 <rdf:li rdf:resource="https://identifiers.org/pubmed/15234337"/> | |
| 7209 <rdf:li rdf:resource="https://identifiers.org/pubmed/14988808"/> | |
| 7210 </rdf:Bag> | |
| 7211 </bqbiol:isDescribedBy> | |
| 7212 </rdf:Description> | |
| 7213 </rdf:RDF> | |
| 7214 </annotation> | |
| 7215 <fbc:geneProductAssociation> | |
| 7216 <fbc:geneProductRef fbc:geneProduct="ENSG00000153574"/> | |
| 7217 </fbc:geneProductAssociation> | |
| 7218 <listOfReactants> | |
| 7219 <speciesReference constant="true" species="M_m02845c" stoichiometry="1"/> | |
| 7220 </listOfReactants> | |
| 7221 <listOfProducts> | |
| 7222 <speciesReference constant="true" species="M_m02846c" stoichiometry="1"/> | |
| 7223 </listOfProducts> | |
| 7224 </reaction> | |
| 7225 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4474" metaid="_83d5dfd1-ca06-416b-8f50-068a6b157458" name="R_HMR_4474" reversible="false" sboTerm="SBO:0000176"> | |
| 7226 <notes> | |
| 7227 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7228 <p>Confidence Level: 0</p> | |
| 7229 <p>AUTHORS: PMID:12398160;PMID:1504088;PMID:15558954;PMID:16756494;PMID:2753047;PMID:3943305;PMID:6212636;PMID:7194116;PMID:7225115;PMID:7623792</p> | |
| 7230 <p>ec-code: 1.1.1.44</p> | |
| 7231 <p>metanetx.reaction: MNXR100389</p> | |
| 7232 <p>kegg.reaction: R01528</p> | |
| 7233 <p>bigg.reaction: GND</p> | |
| 7234 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
| 7235 <p>EC_NUMBER: 1.1.1.44</p> | |
| 7236 <p>pmids: 1504088,2753047,3943305,6212636,7194116,7225115,7623792,12398160,15558954,16756494</p> | |
| 7237 <p>GENE_ASSOCIATION: ENSG00000142657</p> | |
| 7238 </body> | |
| 7239 </notes> | |
| 7240 <annotation> | |
| 7241 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7242 <rdf:Description rdf:about="#_83d5dfd1-ca06-416b-8f50-068a6b157458"> | |
| 7243 <bqbiol:is> | |
| 7244 <rdf:Bag> | |
| 7245 <rdf:li rdf:resource="https://identifiers.org/ec-code/1.1.1.44"/> | |
| 7246 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR100389"/> | |
| 7247 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01528"/> | |
| 7248 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/GND"/> | |
| 7249 </rdf:Bag> | |
| 7250 </bqbiol:is> | |
| 7251 <bqbiol:isDescribedBy> | |
| 7252 <rdf:Bag> | |
| 7253 <rdf:li rdf:resource="https://identifiers.org/pubmed/16756494"/> | |
| 7254 <rdf:li rdf:resource="https://identifiers.org/pubmed/6212636"/> | |
| 7255 <rdf:li rdf:resource="https://identifiers.org/pubmed/7623792"/> | |
| 7256 <rdf:li rdf:resource="https://identifiers.org/pubmed/3943305"/> | |
| 7257 <rdf:li rdf:resource="https://identifiers.org/pubmed/7225115"/> | |
| 7258 <rdf:li rdf:resource="https://identifiers.org/pubmed/15558954"/> | |
| 7259 <rdf:li rdf:resource="https://identifiers.org/pubmed/7194116"/> | |
| 7260 <rdf:li rdf:resource="https://identifiers.org/pubmed/12398160"/> | |
| 7261 <rdf:li rdf:resource="https://identifiers.org/pubmed/2753047"/> | |
| 7262 <rdf:li rdf:resource="https://identifiers.org/pubmed/1504088"/> | |
| 7263 </rdf:Bag> | |
| 7264 </bqbiol:isDescribedBy> | |
| 7265 </rdf:Description> | |
| 7266 </rdf:RDF> | |
| 7267 </annotation> | |
| 7268 <fbc:geneProductAssociation> | |
| 7269 <fbc:geneProductRef fbc:geneProduct="ENSG00000142657"/> | |
| 7270 </fbc:geneProductAssociation> | |
| 7271 <listOfReactants> | |
| 7272 <speciesReference constant="true" species="M_m01169c" stoichiometry="1"/> | |
| 7273 <speciesReference constant="true" species="M_m02554c" stoichiometry="1"/> | |
| 7274 </listOfReactants> | |
| 7275 <listOfProducts> | |
| 7276 <speciesReference constant="true" species="M_m02846c" stoichiometry="1"/> | |
| 7277 <speciesReference constant="true" species="M_m02555c" stoichiometry="1"/> | |
| 7278 <speciesReference constant="true" species="M_m01596c" stoichiometry="1"/> | |
| 7279 </listOfProducts> | |
| 7280 </reaction> | |
| 7281 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_9800" metaid="_329c99c1-064e-4527-a8da-785581323147" name="R_HMR_9800" reversible="true" sboTerm="SBO:0000176"> | |
| 7282 <notes> | |
| 7283 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7284 <p>Confidence Level: 0</p> | |
| 7285 <p>ec-code: 2.7.1.3</p> | |
| 7286 <p>metanetx.reaction: MNXR108451</p> | |
| 7287 <p>kegg.reaction: R03819</p> | |
| 7288 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
| 7289 <p>EC_NUMBER: 2.7.1.3</p> | |
| 7290 <p>GENE_ASSOCIATION: ENSG00000138030</p> | |
| 7291 </body> | |
| 7292 </notes> | |
| 7293 <annotation> | |
| 7294 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7295 <rdf:Description rdf:about="#_329c99c1-064e-4527-a8da-785581323147"> | |
| 7296 <bqbiol:is> | |
| 7297 <rdf:Bag> | |
| 7298 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.3"/> | |
| 7299 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR108451"/> | |
| 7300 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R03819"/> | |
| 7301 </rdf:Bag> | |
| 7302 </bqbiol:is> | |
| 7303 </rdf:Description> | |
| 7304 </rdf:RDF> | |
| 7305 </annotation> | |
| 7306 <fbc:geneProductAssociation> | |
| 7307 <fbc:geneProductRef fbc:geneProduct="ENSG00000138030"/> | |
| 7308 </fbc:geneProductAssociation> | |
| 7309 <listOfReactants> | |
| 7310 <speciesReference constant="true" species="M_m01371c" stoichiometry="1"/> | |
| 7311 <speciesReference constant="true" species="M_m03165c" stoichiometry="1"/> | |
| 7312 </listOfReactants> | |
| 7313 <listOfProducts> | |
| 7314 <speciesReference constant="true" species="M_m03166c" stoichiometry="1"/> | |
| 7315 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
| 7316 <speciesReference constant="true" species="M_m01285c" stoichiometry="1"/> | |
| 7317 </listOfProducts> | |
| 7318 </reaction> | |
| 7319 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4398" metaid="c2e9d022-c156-4c88-a796-2bc148714535" name="R_HMR_4398" reversible="true" sboTerm="SBO:0000176"> | |
| 7320 <notes> | |
| 7321 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7322 <p>Confidence Level: 0</p> | |
| 7323 <p>AUTHORS: PMID:4989681;PMID:9226884</p> | |
| 7324 <p>ec-code: 4.1.2.4</p> | |
| 7325 <p>metanetx.reaction: MNXR97787</p> | |
| 7326 <p>kegg.reaction: R01066</p> | |
| 7327 <p>bigg.reaction: DRPA</p> | |
| 7328 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
| 7329 <p>EC_NUMBER: 4.1.2.4</p> | |
| 7330 <p>pmids: 4989681,9226884</p> | |
| 7331 <p>GENE_ASSOCIATION: ENSG00000023697</p> | |
| 7332 </body> | |
| 7333 </notes> | |
| 7334 <annotation> | |
| 7335 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7336 <rdf:Description rdf:about="#c2e9d022-c156-4c88-a796-2bc148714535"> | |
| 7337 <bqbiol:is> | |
| 7338 <rdf:Bag> | |
| 7339 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.1.2.4"/> | |
| 7340 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR97787"/> | |
| 7341 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01066"/> | |
| 7342 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/DRPA"/> | |
| 7343 </rdf:Bag> | |
| 7344 </bqbiol:is> | |
| 7345 <bqbiol:isDescribedBy> | |
| 7346 <rdf:Bag> | |
| 7347 <rdf:li rdf:resource="https://identifiers.org/pubmed/9226884"/> | |
| 7348 <rdf:li rdf:resource="https://identifiers.org/pubmed/4989681"/> | |
| 7349 </rdf:Bag> | |
| 7350 </bqbiol:isDescribedBy> | |
| 7351 </rdf:Description> | |
| 7352 </rdf:RDF> | |
| 7353 </annotation> | |
| 7354 <fbc:geneProductAssociation> | |
| 7355 <fbc:geneProductRef fbc:geneProduct="ENSG00000023697"/> | |
| 7356 </fbc:geneProductAssociation> | |
| 7357 <listOfReactants> | |
| 7358 <speciesReference constant="true" species="M_m00640c" stoichiometry="1"/> | |
| 7359 </listOfReactants> | |
| 7360 <listOfProducts> | |
| 7361 <speciesReference constant="true" species="M_m01939c" stoichiometry="1"/> | |
| 7362 <speciesReference constant="true" species="M_m01249c" stoichiometry="1"/> | |
| 7363 </listOfProducts> | |
| 7364 </reaction> | |
| 7365 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4354" metaid="f7108fb4-b7e5-49a3-ada1-a6024a22b77c" name="R_HMR_4354" reversible="true" sboTerm="SBO:0000176"> | |
| 7366 <notes> | |
| 7367 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7368 <p>Confidence Level: 0</p> | |
| 7369 <p>AUTHORS: PMID:14953458;PMID:3023765;PMID:5769188;PMID:8050998</p> | |
| 7370 <p>ec-code: 5.4.2.2 || 5.4.2.7</p> | |
| 7371 <p>metanetx.reaction: MNXR106810 || MNXR103115</p> | |
| 7372 <p>kegg.reaction: R01057</p> | |
| 7373 <p>bigg.reaction: PPM</p> | |
| 7374 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
| 7375 <p>EC_NUMBER: 5.4.2.2;5.4.2.7</p> | |
| 7376 <p>pmids: 3023765,5769188,8050998,14953458</p> | |
| 7377 <p>GENE_ASSOCIATION: ( ENSG00000079739 ) OR ( ENSG00000169299 )</p> | |
| 7378 </body> | |
| 7379 </notes> | |
| 7380 <annotation> | |
| 7381 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7382 <rdf:Description rdf:about="#f7108fb4-b7e5-49a3-ada1-a6024a22b77c"> | |
| 7383 <bqbiol:is> | |
| 7384 <rdf:Bag> | |
| 7385 <rdf:li rdf:resource="https://identifiers.org/ec-code/5.4.2.2"/> | |
| 7386 <rdf:li rdf:resource="https://identifiers.org/ec-code/5.4.2.7"/> | |
| 7387 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR106810"/> | |
| 7388 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR103115"/> | |
| 7389 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01057"/> | |
| 7390 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/PPM"/> | |
| 7391 </rdf:Bag> | |
| 7392 </bqbiol:is> | |
| 7393 <bqbiol:isDescribedBy> | |
| 7394 <rdf:Bag> | |
| 7395 <rdf:li rdf:resource="https://identifiers.org/pubmed/14953458"/> | |
| 7396 <rdf:li rdf:resource="https://identifiers.org/pubmed/3023765"/> | |
| 7397 <rdf:li rdf:resource="https://identifiers.org/pubmed/5769188"/> | |
| 7398 <rdf:li rdf:resource="https://identifiers.org/pubmed/8050998"/> | |
| 7399 </rdf:Bag> | |
| 7400 </bqbiol:isDescribedBy> | |
| 7401 </rdf:Description> | |
| 7402 </rdf:RDF> | |
| 7403 </annotation> | |
| 7404 <fbc:geneProductAssociation> | |
| 7405 <fbc:or> | |
| 7406 <fbc:geneProductRef fbc:geneProduct="ENSG00000169299"/> | |
| 7407 <fbc:geneProductRef fbc:geneProduct="ENSG00000079739"/> | |
| 7408 </fbc:or> | |
| 7409 </fbc:geneProductAssociation> | |
| 7410 <listOfReactants> | |
| 7411 <speciesReference constant="true" species="M_m02844c" stoichiometry="1"/> | |
| 7412 </listOfReactants> | |
| 7413 <listOfProducts> | |
| 7414 <speciesReference constant="true" species="M_m02845c" stoichiometry="1"/> | |
| 7415 </listOfProducts> | |
| 7416 </reaction> | |
| 7417 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4310" metaid="_9239b4c7-a967-4956-b094-a7de9aff2cba" name="R_HMR_4310" reversible="false" sboTerm="SBO:0000176"> | |
| 7418 <notes> | |
| 7419 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7420 <p>Confidence Level: 0</p> | |
| 7421 <p>AUTHORS: PMID:2996495;PMID:7833921</p> | |
| 7422 <p>ec-code: 2.7.1.3</p> | |
| 7423 <p>metanetx.reaction: MNXR100936</p> | |
| 7424 <p>kegg.reaction: R00866</p> | |
| 7425 <p>bigg.reaction: KHK</p> | |
| 7426 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
| 7427 <p>EC_NUMBER: 2.7.1.3</p> | |
| 7428 <p>pmids: 2996495,7833921</p> | |
| 7429 <p>GENE_ASSOCIATION: ENSG00000138030</p> | |
| 7430 </body> | |
| 7431 </notes> | |
| 7432 <annotation> | |
| 7433 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7434 <rdf:Description rdf:about="#_9239b4c7-a967-4956-b094-a7de9aff2cba"> | |
| 7435 <bqbiol:is> | |
| 7436 <rdf:Bag> | |
| 7437 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.7.1.3"/> | |
| 7438 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR100936"/> | |
| 7439 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R00866"/> | |
| 7440 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/KHK"/> | |
| 7441 </rdf:Bag> | |
| 7442 </bqbiol:is> | |
| 7443 <bqbiol:isDescribedBy> | |
| 7444 <rdf:Bag> | |
| 7445 <rdf:li rdf:resource="https://identifiers.org/pubmed/2996495"/> | |
| 7446 <rdf:li rdf:resource="https://identifiers.org/pubmed/7833921"/> | |
| 7447 </rdf:Bag> | |
| 7448 </bqbiol:isDescribedBy> | |
| 7449 </rdf:Description> | |
| 7450 </rdf:RDF> | |
| 7451 </annotation> | |
| 7452 <fbc:geneProductAssociation> | |
| 7453 <fbc:geneProductRef fbc:geneProduct="ENSG00000138030"/> | |
| 7454 </fbc:geneProductAssociation> | |
| 7455 <listOfReactants> | |
| 7456 <speciesReference constant="true" species="M_m01371c" stoichiometry="1"/> | |
| 7457 <speciesReference constant="true" species="M_m01840c" stoichiometry="1"/> | |
| 7458 </listOfReactants> | |
| 7459 <listOfProducts> | |
| 7460 <speciesReference constant="true" species="M_m01842c" stoichiometry="1"/> | |
| 7461 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
| 7462 <speciesReference constant="true" species="M_m01285c" stoichiometry="1"/> | |
| 7463 </listOfProducts> | |
| 7464 </reaction> | |
| 7465 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4476" metaid="_9560c25f-9d92-4a3c-bfbb-374877a611c3" name="R_HMR_4476" reversible="true" sboTerm="SBO:0000176"> | |
| 7466 <notes> | |
| 7467 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7468 <p>Confidence Level: 0</p> | |
| 7469 <p>AUTHORS: PMID:10978316</p> | |
| 7470 <p>ec-code: 2.3.1.57</p> | |
| 7471 <p>metanetx.reaction: MNXR100390</p> | |
| 7472 <p>kegg.reaction: R01737</p> | |
| 7473 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
| 7474 <p>EC_NUMBER: 2.3.1.57</p> | |
| 7475 <p>pmids: 10978316</p> | |
| 7476 <p>GENE_ASSOCIATION: ( ENSG00000130066 ) OR ( ENSG00000141504 )</p> | |
| 7477 </body> | |
| 7478 </notes> | |
| 7479 <annotation> | |
| 7480 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7481 <rdf:Description rdf:about="#_9560c25f-9d92-4a3c-bfbb-374877a611c3"> | |
| 7482 <bqbiol:is> | |
| 7483 <rdf:Bag> | |
| 7484 <rdf:li rdf:resource="https://identifiers.org/ec-code/2.3.1.57"/> | |
| 7485 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR100390"/> | |
| 7486 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01737"/> | |
| 7487 </rdf:Bag> | |
| 7488 </bqbiol:is> | |
| 7489 <bqbiol:isDescribedBy> | |
| 7490 <rdf:Bag> | |
| 7491 <rdf:li rdf:resource="https://identifiers.org/pubmed/10978316"/> | |
| 7492 </rdf:Bag> | |
| 7493 </bqbiol:isDescribedBy> | |
| 7494 </rdf:Description> | |
| 7495 </rdf:RDF> | |
| 7496 </annotation> | |
| 7497 <fbc:geneProductAssociation> | |
| 7498 <fbc:or> | |
| 7499 <fbc:geneProductRef fbc:geneProduct="ENSG00000141504"/> | |
| 7500 <fbc:geneProductRef fbc:geneProduct="ENSG00000130066"/> | |
| 7501 </fbc:or> | |
| 7502 </fbc:geneProductAssociation> | |
| 7503 <listOfReactants> | |
| 7504 <speciesReference constant="true" species="M_m01169c" stoichiometry="1"/> | |
| 7505 <speciesReference constant="true" species="M_m02039c" stoichiometry="1"/> | |
| 7506 <speciesReference constant="true" species="M_m01285c" stoichiometry="1"/> | |
| 7507 </listOfReactants> | |
| 7508 <listOfProducts> | |
| 7509 <speciesReference constant="true" species="M_m01371c" stoichiometry="1"/> | |
| 7510 <speciesReference constant="true" species="M_m01683c" stoichiometry="1"/> | |
| 7511 </listOfProducts> | |
| 7512 </reaction> | |
| 7513 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4399" metaid="_961e9144-e77b-430b-8dd8-8001acf778ea" name="R_HMR_4399" reversible="false" sboTerm="SBO:0000176"> | |
| 7514 <notes> | |
| 7515 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7516 <p>Confidence Level: 0</p> | |
| 7517 <p>AUTHORS: PMID:9893952</p> | |
| 7518 <p>ec-code: 4.2.1.47</p> | |
| 7519 <p>metanetx.reaction: MNXR100377</p> | |
| 7520 <p>kegg.reaction: R00888</p> | |
| 7521 <p>bigg.reaction: GMAND</p> | |
| 7522 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
| 7523 <p>EC_NUMBER: 4.2.1.47</p> | |
| 7524 <p>pmids: 9893952</p> | |
| 7525 <p>GENE_ASSOCIATION: ENSG00000112699</p> | |
| 7526 </body> | |
| 7527 </notes> | |
| 7528 <annotation> | |
| 7529 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7530 <rdf:Description rdf:about="#_961e9144-e77b-430b-8dd8-8001acf778ea"> | |
| 7531 <bqbiol:is> | |
| 7532 <rdf:Bag> | |
| 7533 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.2.1.47"/> | |
| 7534 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR100377"/> | |
| 7535 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R00888"/> | |
| 7536 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/GMAND"/> | |
| 7537 </rdf:Bag> | |
| 7538 </bqbiol:is> | |
| 7539 <bqbiol:isDescribedBy> | |
| 7540 <rdf:Bag> | |
| 7541 <rdf:li rdf:resource="https://identifiers.org/pubmed/9893952"/> | |
| 7542 </rdf:Bag> | |
| 7543 </bqbiol:isDescribedBy> | |
| 7544 </rdf:Description> | |
| 7545 </rdf:RDF> | |
| 7546 </annotation> | |
| 7547 <fbc:geneProductAssociation> | |
| 7548 <fbc:geneProductRef fbc:geneProduct="ENSG00000112699"/> | |
| 7549 </fbc:geneProductAssociation> | |
| 7550 <listOfReactants> | |
| 7551 <speciesReference constant="true" species="M_m01951c" stoichiometry="1"/> | |
| 7552 </listOfReactants> | |
| 7553 <listOfProducts> | |
| 7554 <speciesReference constant="true" species="M_m02040c" stoichiometry="1"/> | |
| 7555 <speciesReference constant="true" species="M_m01949c" stoichiometry="1"/> | |
| 7556 </listOfProducts> | |
| 7557 </reaction> | |
| 7558 <reaction fbc:lowerFluxBound="LOWER_BOUND_1000_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4477" metaid="_44d922a9-9c8a-409b-b662-408d43f39b21" name="R_HMR_4477" reversible="true" sboTerm="SBO:0000176"> | |
| 7559 <notes> | |
| 7560 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7561 <p>Confidence Level: 0</p> | |
| 7562 <p>AUTHORS: PMID:15234337;PMID:234468;PMID:2843500</p> | |
| 7563 <p>ec-code: 5.1.3.1</p> | |
| 7564 <p>metanetx.reaction: MNXR104083</p> | |
| 7565 <p>kegg.reaction: R01529</p> | |
| 7566 <p>bigg.reaction: RPE</p> | |
| 7567 <p>SUBSYSTEM: Pentose phosphate pathway</p> | |
| 7568 <p>EC_NUMBER: 5.1.3.1</p> | |
| 7569 <p>pmids: 234468,2843500,15234337</p> | |
| 7570 <p>GENE_ASSOCIATION: ( ENSG00000197713 ) OR ( ENSG00000235376 )</p> | |
| 7571 </body> | |
| 7572 </notes> | |
| 7573 <annotation> | |
| 7574 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7575 <rdf:Description rdf:about="#_44d922a9-9c8a-409b-b662-408d43f39b21"> | |
| 7576 <bqbiol:is> | |
| 7577 <rdf:Bag> | |
| 7578 <rdf:li rdf:resource="https://identifiers.org/ec-code/5.1.3.1"/> | |
| 7579 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR104083"/> | |
| 7580 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R01529"/> | |
| 7581 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/RPE"/> | |
| 7582 </rdf:Bag> | |
| 7583 </bqbiol:is> | |
| 7584 <bqbiol:isDescribedBy> | |
| 7585 <rdf:Bag> | |
| 7586 <rdf:li rdf:resource="https://identifiers.org/pubmed/234468"/> | |
| 7587 <rdf:li rdf:resource="https://identifiers.org/pubmed/2843500"/> | |
| 7588 <rdf:li rdf:resource="https://identifiers.org/pubmed/15234337"/> | |
| 7589 </rdf:Bag> | |
| 7590 </bqbiol:isDescribedBy> | |
| 7591 </rdf:Description> | |
| 7592 </rdf:RDF> | |
| 7593 </annotation> | |
| 7594 <fbc:geneProductAssociation> | |
| 7595 <fbc:or> | |
| 7596 <fbc:geneProductRef fbc:geneProduct="ENSG00000197713"/> | |
| 7597 <fbc:geneProductRef fbc:geneProduct="ENSG00000235376"/> | |
| 7598 </fbc:or> | |
| 7599 </fbc:geneProductAssociation> | |
| 7600 <listOfReactants> | |
| 7601 <speciesReference constant="true" species="M_m01761c" stoichiometry="1"/> | |
| 7602 </listOfReactants> | |
| 7603 <listOfProducts> | |
| 7604 <speciesReference constant="true" species="M_m02846c" stoichiometry="1"/> | |
| 7605 </listOfProducts> | |
| 7606 </reaction> | |
| 7607 <reaction fbc:lowerFluxBound="LOWER_BOUND_0_0" fbc:upperFluxBound="UPPER_BOUND_1000_0" id="R_HMR_4356" metaid="e6efa094-5aeb-412c-8390-f6707d0794e0" name="R_HMR_4356" reversible="false" sboTerm="SBO:0000176"> | |
| 7608 <notes> | |
| 7609 <body xmlns="http://www.w3.org/1999/xhtml"> | |
| 7610 <p>Confidence Level: 0</p> | |
| 7611 <p>AUTHORS: PMID:5114731;PMID:5655259;PMID:6054986</p> | |
| 7612 <p>ec-code: 4.1.2.13</p> | |
| 7613 <p>metanetx.reaction: MNXR99460</p> | |
| 7614 <p>kegg.reaction: R02568</p> | |
| 7615 <p>bigg.reaction: FBA2</p> | |
| 7616 <p>SUBSYSTEM: Fructose and mannose metabolism</p> | |
| 7617 <p>EC_NUMBER: 4.1.2.13</p> | |
| 7618 <p>pmids: 5114731,5655259,6054986</p> | |
| 7619 <p>GENE_ASSOCIATION: ( ENSG00000109107 ) OR ( ENSG00000136872 ) OR ( ENSG00000149925 ) OR ( ENSG00000285043 )</p> | |
| 7620 </body> | |
| 7621 </notes> | |
| 7622 <annotation> | |
| 7623 <rdf:RDF xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:bqbiol="http://biomodels.net/biology-qualifiers/"> | |
| 7624 <rdf:Description rdf:about="#e6efa094-5aeb-412c-8390-f6707d0794e0"> | |
| 7625 <bqbiol:is> | |
| 7626 <rdf:Bag> | |
| 7627 <rdf:li rdf:resource="https://identifiers.org/ec-code/4.1.2.13"/> | |
| 7628 <rdf:li rdf:resource="https://identifiers.org/metanetx.reaction/MNXR99460"/> | |
| 7629 <rdf:li rdf:resource="https://identifiers.org/kegg.reaction/R02568"/> | |
| 7630 <rdf:li rdf:resource="https://identifiers.org/bigg.reaction/FBA2"/> | |
| 7631 </rdf:Bag> | |
| 7632 </bqbiol:is> | |
| 7633 <bqbiol:isDescribedBy> | |
| 7634 <rdf:Bag> | |
| 7635 <rdf:li rdf:resource="https://identifiers.org/pubmed/5114731"/> | |
| 7636 <rdf:li rdf:resource="https://identifiers.org/pubmed/6054986"/> | |
| 7637 <rdf:li rdf:resource="https://identifiers.org/pubmed/5655259"/> | |
| 7638 </rdf:Bag> | |
| 7639 </bqbiol:isDescribedBy> | |
| 7640 </rdf:Description> | |
| 7641 </rdf:RDF> | |
| 7642 </annotation> | |
| 7643 <fbc:geneProductAssociation> | |
| 7644 <fbc:or> | |
| 7645 <fbc:geneProductRef fbc:geneProduct="ENSG00000136872"/> | |
| 7646 <fbc:geneProductRef fbc:geneProduct="ENSG00000149925"/> | |
| 7647 <fbc:geneProductRef fbc:geneProduct="ENSG00000109107"/> | |
| 7648 <fbc:geneProductRef fbc:geneProduct="ENSG00000285043"/> | |
| 7649 </fbc:or> | |
| 7650 </fbc:geneProductAssociation> | |
| 7651 <listOfReactants> | |
| 7652 <speciesReference constant="true" species="M_m01690c" stoichiometry="1"/> | |
| 7653 <speciesReference constant="true" species="M_m01981c" stoichiometry="1"/> | |
| 7654 </listOfReactants> | |
| 7655 <listOfProducts> | |
| 7656 <speciesReference constant="true" species="M_m01842c" stoichiometry="1"/> | |
| 7657 </listOfProducts> | |
| 7658 </reaction> | |
| 7659 </listOfReactions> | |
| 7660 </model> | |
| 7661 </sbml> |
