Mercurial > repos > tomnl > metfrag
comparison metfrag.xml @ 0:938c818cf097 draft default tip
"planemo upload for repository https://github.com/computational-metabolomics/metfrag-galaxy commit 6bc059c100f1f968d99c1d5ad5e7259e83d386b6"
author | tomnl |
---|---|
date | Fri, 04 Oct 2019 07:16:18 -0400 |
parents | |
children |
comparison
equal
deleted
inserted
replaced
-1:000000000000 | 0:938c818cf097 |
---|---|
1 <tool id="metfrag" name="MetFrag" version="2.4.5+galaxy1"> | |
2 <description> | |
3 in silico fragmentor for compound annotation of mass spectrometry fragmentation spectra | |
4 </description> | |
5 <macros> | |
6 <import>macros.xml</import> | |
7 </macros> | |
8 <requirements> | |
9 <requirement type="package" version="2.4.5">metfrag</requirement> | |
10 </requirements> | |
11 <stdio> | |
12 <regex match="Cannot allocate memory" | |
13 source="stderr" | |
14 level="fatal_oom" | |
15 description="Out of memory error occurred" /> | |
16 </stdio> | |
17 <command detect_errors="exit_code"> | |
18 <![CDATA[ | |
19 python '$__tool_directory__/metfrag.py' | |
20 --input_pth '$input' | |
21 --result_pth '$results' | |
22 --temp_dir './temp/' | |
23 | |
24 --cores_top_level \${GALAXY_SLOTS:-4} | |
25 | |
26 --MetFragDatabaseType '$db_select.MetFragDatabaseType' | |
27 | |
28 #if $db_select.MetFragDatabaseType == 'LocalCSV': | |
29 --LocalDatabasePath '$db_select.LocalDatabasePath' | |
30 #elif $db_select.MetFragDatabaseType == 'MetChem': | |
31 --LocalMetChemDatabaseServerIp '$db_select.LocalMetChemDatabaseServerIp' | |
32 #end if | |
33 | |
34 --DatabaseSearchRelativeMassDeviation $DatabaseSearchRelativeMassDeviation | |
35 --FragmentPeakMatchRelativeMassDeviation $FragmentPeakMatchRelativeMassDeviation | |
36 --FragmentPeakMatchAbsoluteMassDeviation $FragmentPeakMatchAbsoluteMassDeviation | |
37 --polarity '$polarity' | |
38 | |
39 --MetFragScoreTypes '$suspectlist.MetFragScoreTypes' | |
40 --MetFragScoreWeights '$suspectlist.MetFragScoreWeights' | |
41 | |
42 #if $suspectlist.suspectselector == 'includesuspects': | |
43 #if $suspectlist.includesuspects_default_cond: | |
44 --ScoreSuspectLists '$__tool_directory__/UNPD_DB.inchikeys.txt' | |
45 #else | |
46 --ScoreSuspectLists '$suspectlist.includesuspects_custom_cond.ScoreSuspectLists' | |
47 #end if | |
48 #end if | |
49 | |
50 --meta_select_col $meta_select_col | |
51 --minMSMSpeaks $minMSMSpeaks | |
52 --schema $schema | |
53 | |
54 $PreProcessFilter.UnconnectedCompoundFilter | |
55 $PreProcessFilter.IsotopeFilter | |
56 | |
57 --FilterMinimumElements '$PreProcessFilter.FilterMinimumElements' | |
58 --FilterMaximumElements '$PreProcessFilter.FilterMaximumElements' | |
59 --FilterSmartsInclusionList '$PreProcessFilter.FilterSmartsInclusionList' | |
60 --FilterSmartsExclusionList '$PreProcessFilter.FilterSmartsExclusionList' | |
61 --FilterIncludedElements '$PreProcessFilter.FilterIncludedElements' | |
62 --FilterExcludedElements '$PreProcessFilter.FilterExcludedElements' | |
63 --FilterIncludedExclusiveElements '$PreProcessFilter.FilterIncludedExclusiveElements' | |
64 | |
65 $skip_invalid_adducts | |
66 --score_thrshld $PostProcessFilter.score_thrshld | |
67 --pctexplpeak_thrshld $PostProcessFilter.pctexplpeak_thrshld | |
68 | |
69 ]]></command> | |
70 <inputs> | |
71 <param name="input" type="data" format="msp" label="MSP file (Output from Create MSP tool)"/> | |
72 <conditional name="db_select"> | |
73 <param argument="--MetFragDatabaseType" type="select" label="Choose Compound Database"> | |
74 <option value="PubChem" selected="true">PubChem</option> | |
75 <option value="KEGG">KEGG</option> | |
76 <option value="LocalCSV">Local database (csv)</option> | |
77 <option value="MetChem">MetChem</option> | |
78 </param> | |
79 <when value="MetChem"> | |
80 <param argument="--LocalMetChemDatabaseServerIp" type="text" label="MetChem URL"/> | |
81 </when> | |
82 <when value="LocalCSV"> | |
83 <param argument="--LocalDatabasePath" type="data" format="csv" | |
84 label="Local database of compounds (CSV format)" /> | |
85 </when> | |
86 <when value="KEGG"/> | |
87 <when value="PubChem"/> | |
88 </conditional> | |
89 <param argument="--DatabaseSearchRelativeMassDeviation" type="float" min="0" value="10" | |
90 label="Relative Mass Deviation for database search (ppm)" | |
91 help="A value in ppm that defines the deviation of theoretical masses in the database | |
92 vs. the measured masses"/> | |
93 <param argument="--FragmentPeakMatchRelativeMassDeviation" type="float" min="0" value="5" | |
94 label="Fragment Peak Match Relative Mass Deviation (ppm)" | |
95 help="Relative mass deviation in ppm of theoretical fragment peaks vs. measured fragment peaks" /> | |
96 <param argument="--FragmentPeakMatchAbsoluteMassDeviation" type="float" min="0" value="0.001" | |
97 label="Fragment Peak Match Absolute Mass Deviation (Da)" | |
98 help="Absolute mass deviation in Dalton of theoretical fragment peaks vs. measured fragment peaks" /> | |
99 <param argument="--polarity" type="select" label="Polarity" | |
100 help="The polarity used for the mode of acquisition"> | |
101 <option value="pos" selected="true">Positive</option> | |
102 <option value="neg">Negative</option> | |
103 </param> | |
104 <param argument="--schema" type="select" label="Schema" | |
105 help="The schema used for the MSP file (auto will try automatically determine the schema)"> | |
106 <option value="auto" selected="True">Auto</option> | |
107 <option value="msp">Generic MSP</option> | |
108 <option value="massbank">MassBank</option> | |
109 </param> | |
110 <param argument="--meta_select_col" type="select" | |
111 label="Choose how additional metadata columns are extracted" | |
112 help="The MetFrag output can have additional meta data columns added, these can be either extracted | |
113 from all MSP parameters or from the 'Name' and 'RECORD_TITLE' MSP parameter. Additionally, columns | |
114 can be added from the 'Name' or 'RECORD_TITLE' parameter by splitting on | and : | |
115 e.g. 'MZ:100.2 | RT:20 | xcms_grp_id:1' would create MZ,RT and xcms_grp_id columns"> | |
116 <option value="name" selected="true">Extra metadata columns from the Name or RECORD_TITLE</option> | |
117 <option value="name_split">Extra metadata columns from the Name or RECORD_TITLE (each column is split on "|" and ":" ) </option> | |
118 <option value="all">Extra metadata columns from all MSP parameters</option> | |
119 </param> | |
120 <conditional name="suspectlist"> | |
121 <param name="suspectselector" type="select" label="Suspect list" | |
122 help="Choose whether to include a suspect list"> | |
123 <option value="includesuspects" >Include suspect list</option> | |
124 <option value="excludesuspects" selected="True">Do not include suspect list</option> | |
125 </param> | |
126 <when value="includesuspects"> | |
127 <conditional name="includesuspects_default_cond"> | |
128 <param name="includesuspects_default_bool" type="boolean" | |
129 label="Use default list of suspect compounds?" | |
130 help="Either provide a file containing a list of suspect compounds or a default file | |
131 of an aggregated list of in silico predicted MS/MS spectra of natural products | |
132 from the Universal Natural Products Database (http://pkuxxj.pku.edu.cn/UNPD/index.php). | |
133 The list is an aggregated version of the github repository https://github.com/oolonek/ISDB/tree/master/Data/dbs."/> | |
134 <when value="true"/> | |
135 <when value="false"> | |
136 <param argument="--ScoreSuspectLists" type="data" format="txt" optional="True" | |
137 label="Suspect list file" help="File containing a list of suspects inchikeys" /> | |
138 </when> | |
139 </conditional> | |
140 <expand macro="metfrag_scoring"/> | |
141 </when> | |
142 <when value="excludesuspects"> | |
143 <expand macro="metfrag_scoring" suspectlistscore="False" weights="1.0,1.0"/> | |
144 </when> | |
145 </conditional> | |
146 <param argument="--minMSMSpeaks" type="integer" label="Minimum number of MS/MS peaks" value="0"/> | |
147 <param argument="--skip_invalid_adducts" type="boolean" label="Skip invalid or undefined adduct types?" | |
148 truevalue="--skip_invalid_adducts" falsevalue="" checked="true" | |
149 help="If no adduct type is provided within the MSP file or if the adduct type is not usable | |
150 with MetFrag, set to 'yes' if these spectra should be skipped or 'no' if the default | |
151 of [M+H]+ for pos data or [M-H]- for neg data should be used"/> | |
152 <section name="PreProcessFilter" title="PreProcessing filters" expanded="False"> | |
153 <param argument="--UnconnectedCompoundFilter" type="boolean" checked="false" | |
154 truevalue="--UnconnectedCompoundFilter" falsevalue="" | |
155 label="filter non-connected compounds (e.g. salts)" help=""/> | |
156 <param argument="--IsotopeFilter" type="boolean" checked="false" truevalue="--IsotopeFilter" | |
157 falsevalue="" label="filter compounds containing non-standard isotopes" help=""/> | |
158 <param argument="--FilterMinimumElements" type="text" | |
159 optional="true" label="Minimum Elements Filter" | |
160 help="Filter by minimum of contained elements. Ex: N2O3 include compounds with at least | |
161 2 nitrogens and 3 oxygens"> | |
162 <expand macro="text-alphanumeric-regex-validator"/> | |
163 </param> | |
164 <param argument="--FilterMaximumElements" type="text" | |
165 optional="true" label="Maximum Elements Filter" | |
166 help="Filter by maximum of contained elements. Ex: N5O7 filter out compounds with at | |
167 maximum 5 nitrogens and 7 oxygens"> | |
168 <expand macro="text-alphanumeric-regex-validator"/> | |
169 </param> | |
170 <param argument="--FilterSmartsInclusionList" type="text" | |
171 optional="true" label="Include substructures" | |
172 help="Filter by presence of defined sub-structures. Ex: c1ccccc1 include compounds | |
173 containing benzene"/> | |
174 <param argument="--FilterSmartsExclusionList" type="text" | |
175 optional="true" label="Exclude substructures" | |
176 help="Filter by absence of defined sub-structures. Ex: [OX2H] filter out compounds | |
177 containing hydroxyl groups"/> | |
178 <param argument="--FilterIncludedElements" type="text" | |
179 optional="true" label="Include elements" | |
180 help="Filter by presence of defined elements (other elements are allowed). | |
181 Ex: 'N,O' include compounds containing nitrogen and oxygen" > | |
182 <expand macro="text-alphanumeric-comma-regex-validator"/> | |
183 </param> | |
184 <param argument="--FilterIncludedExclusiveElements" type="text" | |
185 optional="true" label="Include elements (exclusive)" | |
186 help="Filter by presence of defined elements (no other elements are allowed). | |
187 Ex: 'N,O' include compounds only composed of nitrogen and oxygen" > | |
188 <expand macro="text-alphanumeric-comma-regex-validator"/> | |
189 </param> | |
190 <param argument="--FilterExcludedElements" type="text" | |
191 optional="true" label="Exclude elements" | |
192 help="Filter by absence of defined sub-structures. Ex: 'Cl,Br' filter out | |
193 compounds including bromine or chlorine"> | |
194 <expand macro="text-alphanumeric-comma-regex-validator"/> | |
195 </param> | |
196 </section> | |
197 <section name="PostProcessFilter" title="PostProcessing filters" expanded="False"> | |
198 <param argument="--score_thrshld" type="float" label="Threshold for score after MetFrag search" | |
199 max="1" min="0" value="0"/> | |
200 <param argument="--pctexplpeak_thrshld" type="float" label="Minimum percentage of explain peaks" | |
201 max="100" min="0" value="0"/> | |
202 </section> | |
203 </inputs> | |
204 <outputs> | |
205 <data name="results" format="tabular"/> | |
206 </outputs> | |
207 <tests> | |
208 <test> | |
209 <!-- Test "massbank" style data format --> | |
210 <param name="input" value="massbank_format.txt"/> | |
211 <param name="schema" value="massbank"/> | |
212 <param name="skip_invalid_adducts" value="false"/> | |
213 <param name="MetFragDatabaseType" value="PubChem"/> | |
214 <param name="MetFragDatabaseType" value="LocalCSV"/> | |
215 <param name="LocalDatabasePath" value="demo_db.csv"/> | |
216 <output name="results" file="metfrag_massbank.tabular"/> | |
217 </test> | |
218 <test> | |
219 <!-- Test "generic" style data format --> | |
220 <param name="input" value="generic_format.msp"/> | |
221 <param name="schema" value="msp"/> | |
222 <param name="MetFragDatabaseType" value="PubChem"/> | |
223 <param name="skip_invalid_adducts" value="false"/> | |
224 <param name="MetFragDatabaseType" value="LocalCSV"/> | |
225 <param name="LocalDatabasePath" value="demo_db.csv"/> | |
226 <output name="results" file="metfrag_msp.tabular"/> | |
227 </test> | |
228 <test> | |
229 <!-- Test PubChem API with "winter" dataset --> | |
230 <param name="input" value="winter_pos.msp"/> | |
231 <section name="PostProcessFilter"> | |
232 <param name="score_thrshld" value="0.9"/> | |
233 </section> | |
234 <param name="MetFragDatabaseType" value="PubChem"/> | |
235 <output name="results" file="winter_pos.tabular"/> | |
236 </test> | |
237 <test> | |
238 <!-- Test actual MassBank data for Glucose --> | |
239 <param name="input" value="RP022611.txt"/> | |
240 <param name="MetFragDatabaseType" value="LocalCSV"/> | |
241 <param name="LocalDatabasePath" value="demo_db.csv"/> | |
242 <output name="results" file="RP022611.tabular"/> | |
243 </test> | |
244 <test> | |
245 <!-- Test actual MassBank data for Glucose (all metadata columns in output--> | |
246 <param name="input" value="RP022611.txt"/> | |
247 <param name="schema" value="massbank"/> | |
248 <param name="MetFragDatabaseType" value="LocalCSV"/> | |
249 <param name="LocalDatabasePath" value="demo_db.csv"/> | |
250 <param name="meta_select_col" value="all"/> | |
251 <output name="results" file="RP022611_all_col.tabular"/> | |
252 </test> | |
253 <test> | |
254 <!-- Test actual MassBank data for Glucose (include suspect list - default)--> | |
255 <param name="input" value="RP022611.txt"/> | |
256 <param name="schema" value="massbank"/> | |
257 <conditional name="suspectlist"> | |
258 <param name="suspectselector" value="includesuspects"/> | |
259 <conditional name="includesuspects_default_cond"> | |
260 <param name="includesuspects_default_bool" value="true"/> | |
261 </conditional> | |
262 </conditional> | |
263 <output name="results" file="RP022611_suspect_default.txt"/> | |
264 </test> | |
265 <test> | |
266 <!-- Test invalid adduct --> | |
267 <param name="input" value="invalid_adduct.msp"/> | |
268 <param name="skip_invalid_adducts" value="true"/> | |
269 <output name="results" file="invalid_adduct_result.txt" ftype="tabular"/> | |
270 </test> | |
271 </tests> | |
272 <help> | |
273 ------- | |
274 MetFrag | |
275 ------- | |
276 | |
277 Description | |
278 ----------- | |
279 | |
280 MetFrag is a freely available software for the annotation of high precision tandem mass spectra of metabolites which is | |
281 a first and critical step for the identification of a molecule's structure. Candidate molecules of different databases | |
282 are fragmented "in silico" and matched against mass to charge values. A score calculated using the fragment peak | |
283 matches gives hints to the quality of the candidate spectrum assignment. | |
284 | |
285 Website: http://ipb-halle.github.io/MetFrag/ | |
286 | |
287 Parameters | |
288 ---------- | |
289 | |
290 **\1. MSP file** | |
291 | |
292 MSP file created using *Create MSP* tool | |
293 | |
294 **\2a. MetFragDatabaseType (public databases)** | |
295 | |
296 * PubChem | |
297 | |
298 * KEGG | |
299 | |
300 | |
301 **\2b. MetFragDatabaseType (local CSV file database)** | |
302 | |
303 | |
304 Custom database file in CSV format with the following structure: | |
305 | |
306 +-------------+------------------+----------+---------------------------------------------+----------------------+---+ | |
307 | Identifier | MonoisotopicMass | SMILES | InChI | Name |...| | |
308 +-------------+------------------+----------+---------------------------------------------+----------------------+---+ | |
309 | HMDB0000123 | 75.03202841 | NCC(O)=O | InChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5) | Glycine |...| | |
310 +-------------+------------------+----------+---------------------------------------------+----------------------+---+ | |
311 | HMDB0002151 | 78.0139355 | CS(C)=O | InChI=1S/C2H6OS/c1-4(2)3/h1-2H3 | Dimethyl sulfoxide |...| | |
312 +-------------+------------------+----------+---------------------------------------------+----------------------+---+ | |
313 | ... | ... | ... | ... | ... |...| | |
314 +-------------+------------------+----------+---------------------------------------------+----------------------+---+ | |
315 | |
316 | |
317 Table continued: | |
318 | |
319 +---+------------------+-----------------------------+------------------+------------+-------------+ | |
320 |...| MolecularFormula | InChIKey | InChIKey1 | InChIKey2 | InChIKey3 | | |
321 +---+------------------+-----------------------------+------------------+------------+-------------+ | |
322 |...| C2H5NO2 | DHMQDGOQFOQNFH-UHFFFAOYSA-N | DHMQDGOQFOQNFH | UHFFFAOYSA | N | | |
323 +---+------------------+-----------------------------+------------------+------------+-------------+ | |
324 |...| C2H6OS | IAZDPXIOMUYVGZ-UHFFFAOYSA-N | IAZDPXIOMUYVGZ | UHFFFAOYSA | N | | |
325 +---+------------------+-----------------------------+------------------+------------+-------------+ | |
326 |...| ... | ... | ... | ... | ... | | |
327 +---+------------------+-----------------------------+------------------+------------+-------------+ | |
328 | |
329 | |
330 | |
331 **\2b. MetFragDatabaseType MetChem** | |
332 | |
333 MetChem is a modified PubChem database and can be used in replace of PubChem | |
334 for performing API calls to the public PubChem instance. | |
335 | |
336 **\3. Database Search Relative Mass Deviation - ppm** | |
337 | |
338 A value in ppm that defines the deviation of theoretical masses in the database vs. the measured masses. | |
339 | |
340 **\4. Fragment Peak Match Relative Mass Deviation - ppm** | |
341 | |
342 Relative mass deviation in ppm of theoretical fragment peaks vs. measured fragment peaks. | |
343 | |
344 **\5. Fragment Peak Match Absolute Mass Deviation (Da)** | |
345 | |
346 Absolute mass deviation in Dalton of theoretical fragment peaks vs. measured fragment peaks. | |
347 | |
348 **\6. Polarity** | |
349 | |
350 The polarity used for the mode of acquisition. | |
351 | |
352 **\7. Schema** | |
353 | |
354 The Schema used by the MSP file (e.g. generic MSP format or MassBank format) | |
355 | |
356 **\8. Suspect list** | |
357 | |
358 Choose whether to include a file containing a list of suspects. | |
359 | |
360 **\9. MetFrag Score Types** | |
361 | |
362 The type of scores MetFrac is using for the calculations. Please do not change the values unless you know what you are doing! | |
363 | |
364 **\10. MetFrag Score Weights** | |
365 | |
366 The weights of the different score types, separated with a comma and without whitespaces. 1.0 means 100%. | |
367 | |
368 **\11. MetFrag Database Type** | |
369 | |
370 Database to choose from. | |
371 | |
372 **\12. minMSMSpeaks** | |
373 | |
374 Minimum MS/MS peaks within a MS/MS spectra to be used for the MetFrag calculation | |
375 | |
376 **\13. PreProcessFilter** | |
377 | |
378 Various filters can be performed on the potential compounds prior to predicting the in silico spectra | |
379 | |
380 **\14. PostProcessFilter** | |
381 | |
382 To make the output more manageble results below certain criteria can be removed from the various filters can be | |
383 performed on the potential compounds prior to predicting the in silico spectra | |
384 | |
385 Output | |
386 ------- | |
387 | |
388 These columns are derived from any metadata in the MSP input file (additional columns can included if they are recorded in the MSP file) | |
389 | |
390 +-------------+--------------------------------------------+---+ | |
391 | adduct | name |...| | |
392 +-------------+--------------------------------------------+---+ | |
393 | [M-H]- | D-Glucose; LC-ESI-QTOF; MS2; CE: 10; R=; |...| | |
394 +-------------+--------------------------------------------+---+ | |
395 | [M-H]- | D-Glucose; LC-ESI-QTOF; MS2; CE: 10; R=; |...| | |
396 +-------------+--------------------------------------------+---+ | |
397 | ... | ... |...| | |
398 +-------------+--------------------------------------------+---+ | |
399 | |
400 Table continued (these columns are derived from the MetFrag result): | |
401 | |
402 +---+------------------+----------------------------------------------------------+-------------------------------------------------------------------------------------+-----+ | |
403 |...| sample_name | ExplPeaks | FormulasOfExplPeaks | ... | | |
404 +---+------------------+----------------------------------------------------------+-------------------------------------------------------------------------------------+-----+ | |
405 |...| 1_metfrag_result | 59.0138_715.8;71.014_679.7;89.0251_999.0;101.0234_103.0 | 59.0138:[C2H4O2]-H-;71.014:[C3H5O2-H]-H-;89.0251:[C3H6O3]-H-;101.0234:[C4H7O3-H]-H- | ... | | |
406 +---+------------------+----------------------------------------------------------+-------------------------------------------------------------------------------------+-----+ | |
407 |...| 1_metfrag_result | 59.0138_715.8;71.014_679.7;89.0251_999.0;101.0234_103.0 | 59.0138:[C2H4O2]-H-;71.014:[C3H5O2-H]-H-;89.0251:[C3H6O3]-H-;101.0234:[C4H7O3-H]-H- | ... | | |
408 +---+------------------+----------------------------------------------------------+-------------------------------------------------------------------------------------+-----+ | |
409 |...| ... | ... | ... | ... | | |
410 +---+------------------+----------------------------------------------------------+-------------------------------------------------------------------------------------+-----+ | |
411 | |
412 | |
413 Table continued (columns are derived from the MetFrag result): | |
414 | |
415 +---+------------------+----------------------------+------------------------------------------------------+------------+---------------------------------------------------------------------------------+---+ | |
416 |...| FragmenterScore | FragmenterScore_Values | FormulasOfExplPeaks | Identifier | InChI |...| | |
417 +---+------------------+----------------------------+------------------------------------------------------+------------+---------------------------------------------------------------------------------+---+ | |
418 |...| 105.844569063138 | 696.0;1156.0;696.0;1156.0 | 6-(hydroxymethyl)oxane-2,3,4,5-tetrol | 206 | InChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H |...| | |
419 +---+------------------+----------------------------+------------------------------------------------------+------------+---------------------------------------------------------------------------------+---+ | |
420 |...| 105.844569063138 | 696.0;1156.0;696.0;1156.0 | (3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol | 5793 | InChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5-,6?/m1/s1 |...| | |
421 +---+------------------+----------------------------+------------------------------------------------------+------------+---------------------------------------------------------------------------------+---+ | |
422 |...| ... | ... | ... | ... | ... |...| | |
423 +---+------------------+----------------------------+------------------------------------------------------+------------+---------------------------------------------------------------------------------+---+ | |
424 | |
425 Table continued (columns are derived from the MetFrag result): | |
426 | |
427 | |
428 +---+-------------+-----------------+-----------------------+----------------------------------------------+------------------+------------------+--------+ | |
429 |...| NoExplPeaks | NumberPeaksUsed | OfflineMetFusionScore | SMILES | Score | SuspectListScore | XlogP3 | | |
430 +---+-------------+-----------------+-----------------------+----------------------------------------------+------------------+------------------+--------+ | |
431 |...| 4 | 5 | 2.84566828424078 | C(C1C(C(C(C(O1)O)O)O)O)O | 1.82678219603441 | 1 | -2.6 | | |
432 +---+-------------+-----------------+-----------------------+----------------------------------------------+------------------+------------------+--------+ | |
433 |...| 4 | 5 | 2.84566828424078 | C([C@@H]1[C@H]([C@@H]([C@H](C(O1)O)O)O)O)O | 1.82678219603441 | 1 | -2.6 | | |
434 +---+-------------+-----------------+-----------------------+----------------------------------------------+------------------+------------------+--------+ | |
435 |...| ... | ... | ... | ... | ... | ... | ... | | |
436 +---+-------------+-----------------+-----------------------+----------------------------------------------+------------------+------------------+--------+ | |
437 | |
438 | |
439 Additional notes | |
440 -------------------- | |
441 | |
442 The following adducts (and format) are currently supported in the MSP file. The neutral mass is automatically | |
443 calculated for the precursor m/z by subtracting the adduct mass | |
444 | |
445 - '[M+H]+': 1.007276, | |
446 - '[M+NH4]+': 18.034374, | |
447 - '[M+Na]+': 22.989218, | |
448 - '[M+K]+': 38.963158, | |
449 - '[M+CH3OH+H]+': 33.033489, | |
450 - '[M+ACN+H]+': 42.033823, | |
451 - '[M+ACN+Na]+': 64.015765, | |
452 - '[M+2ACN+H]+': 83.06037, | |
453 - '[M-H]-': -1.007276, | |
454 - '[M+Cl]-': 34.969402, | |
455 - '[M+HCOO]-': 44.99819, | |
456 - '[M-H+HCOOH]-': 44.99819, | |
457 - '[M+CH3COO]-': 59.01385, | |
458 - '[M-H+CH3COOH]-': 59.01385 | |
459 | |
460 Developers and contributors | |
461 --------------------------- | |
462 - **Jordi Capellades (j.capellades.to@gmail.com) - Universitat Rovira i Virgili (SP)** | |
463 - **Julien Saint-Vanne (julien.saint-vanne@sb-roscoff.fr) - ABiMS (France)** | |
464 - **Tom Lawson (t.n.lawson@bham.ac.uk) - University of Birmingham (UK)** | |
465 - **Ralf Weber (r.j.weber@bham.ac.uk) - University of Birmingham (UK)** | |
466 - **Kristian Peters (kpeters@ipb-halle.de) - IPB Halle (Germany)** | |
467 - **Payam Emami (payam.emami@medsci.uu.se) - Uppsala Universitet (Sweden)** | |
468 - **Christoph Ruttkies (christoph.ruttkies@ipb-halle.de) - IPB Halle (Germany)** | |
469 </help> | |
470 <citations> | |
471 <citation type="doi">10.1186/s13321-016-0115-9</citation> | |
472 </citations> | |
473 </tool> |