diff metfrag.xml @ 0:938c818cf097 draft default tip

"planemo upload for repository https://github.com/computational-metabolomics/metfrag-galaxy commit 6bc059c100f1f968d99c1d5ad5e7259e83d386b6"
author tomnl
date Fri, 04 Oct 2019 07:16:18 -0400
parents
children
line wrap: on
line diff
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/metfrag.xml	Fri Oct 04 07:16:18 2019 -0400
@@ -0,0 +1,473 @@
+<tool id="metfrag" name="MetFrag" version="2.4.5+galaxy1">
+    <description>
+        in silico fragmentor for compound annotation of mass spectrometry fragmentation spectra
+    </description>
+    <macros>
+        <import>macros.xml</import>
+    </macros>
+    <requirements>
+        <requirement type="package" version="2.4.5">metfrag</requirement>
+    </requirements>
+    <stdio>
+        <regex match="Cannot allocate memory"
+           source="stderr"
+           level="fatal_oom"
+           description="Out of memory error occurred" />
+    </stdio>
+    <command detect_errors="exit_code">
+    <![CDATA[
+        python '$__tool_directory__/metfrag.py'
+            --input_pth '$input'
+            --result_pth '$results'
+             --temp_dir './temp/'
+
+            --cores_top_level \${GALAXY_SLOTS:-4}
+
+            --MetFragDatabaseType '$db_select.MetFragDatabaseType'
+
+            #if $db_select.MetFragDatabaseType == 'LocalCSV':
+                --LocalDatabasePath '$db_select.LocalDatabasePath'
+            #elif  $db_select.MetFragDatabaseType == 'MetChem':
+                --LocalMetChemDatabaseServerIp '$db_select.LocalMetChemDatabaseServerIp'
+            #end if
+
+            --DatabaseSearchRelativeMassDeviation $DatabaseSearchRelativeMassDeviation
+            --FragmentPeakMatchRelativeMassDeviation $FragmentPeakMatchRelativeMassDeviation
+            --FragmentPeakMatchAbsoluteMassDeviation $FragmentPeakMatchAbsoluteMassDeviation
+            --polarity '$polarity'
+
+            --MetFragScoreTypes '$suspectlist.MetFragScoreTypes'
+            --MetFragScoreWeights '$suspectlist.MetFragScoreWeights'
+
+            #if $suspectlist.suspectselector == 'includesuspects':
+                #if $suspectlist.includesuspects_default_cond:
+                    --ScoreSuspectLists '$__tool_directory__/UNPD_DB.inchikeys.txt'
+                #else
+                    --ScoreSuspectLists '$suspectlist.includesuspects_custom_cond.ScoreSuspectLists'
+                #end if
+            #end if
+
+            --meta_select_col $meta_select_col
+            --minMSMSpeaks $minMSMSpeaks
+            --schema $schema
+
+            $PreProcessFilter.UnconnectedCompoundFilter
+            $PreProcessFilter.IsotopeFilter
+
+            --FilterMinimumElements '$PreProcessFilter.FilterMinimumElements'
+            --FilterMaximumElements '$PreProcessFilter.FilterMaximumElements'
+            --FilterSmartsInclusionList '$PreProcessFilter.FilterSmartsInclusionList'
+            --FilterSmartsExclusionList '$PreProcessFilter.FilterSmartsExclusionList'
+            --FilterIncludedElements '$PreProcessFilter.FilterIncludedElements'
+            --FilterExcludedElements '$PreProcessFilter.FilterExcludedElements'
+            --FilterIncludedExclusiveElements '$PreProcessFilter.FilterIncludedExclusiveElements'
+
+            $skip_invalid_adducts
+            --score_thrshld $PostProcessFilter.score_thrshld
+            --pctexplpeak_thrshld $PostProcessFilter.pctexplpeak_thrshld
+
+    ]]></command>
+    <inputs>
+        <param name="input" type="data" format="msp" label="MSP file (Output from Create MSP tool)"/>
+        <conditional name="db_select">
+            <param argument="--MetFragDatabaseType" type="select" label="Choose Compound Database">
+                <option value="PubChem" selected="true">PubChem</option>
+                <option value="KEGG">KEGG</option>
+                <option value="LocalCSV">Local database (csv)</option>
+                <option value="MetChem">MetChem</option>
+            </param>
+            <when value="MetChem">
+                <param argument="--LocalMetChemDatabaseServerIp" type="text" label="MetChem URL"/>
+            </when>
+            <when value="LocalCSV">
+                <param argument="--LocalDatabasePath" type="data" format="csv"
+                       label="Local database of compounds (CSV format)" />
+            </when>
+            <when value="KEGG"/>
+            <when value="PubChem"/>
+        </conditional>
+        <param argument="--DatabaseSearchRelativeMassDeviation" type="float" min="0" value="10"
+               label="Relative Mass Deviation for database search (ppm)"
+               help="A value in ppm that defines the deviation of theoretical masses in the database
+               vs. the measured masses"/>
+        <param argument="--FragmentPeakMatchRelativeMassDeviation" type="float" min="0" value="5"
+               label="Fragment Peak Match Relative Mass Deviation (ppm)"
+               help="Relative mass deviation in ppm of theoretical fragment peaks vs. measured fragment peaks" />
+        <param argument="--FragmentPeakMatchAbsoluteMassDeviation" type="float" min="0" value="0.001"
+               label="Fragment Peak Match Absolute Mass Deviation (Da)"
+               help="Absolute mass deviation in Dalton of theoretical fragment peaks vs. measured fragment peaks" />
+        <param argument="--polarity" type="select" label="Polarity"
+               help="The polarity used for the mode of acquisition">
+            <option value="pos" selected="true">Positive</option>
+            <option value="neg">Negative</option>
+        </param>
+        <param argument="--schema" type="select" label="Schema"
+               help="The schema used for the MSP file (auto will try automatically determine the schema)">
+            <option value="auto" selected="True">Auto</option>
+            <option value="msp">Generic MSP</option>
+            <option value="massbank">MassBank</option>
+        </param>
+        <param argument="--meta_select_col" type="select"
+               label="Choose how additional metadata columns are extracted"
+               help="The MetFrag output can have additional meta data columns added, these can be either extracted
+               from all MSP parameters or from the 'Name' and 'RECORD_TITLE' MSP parameter. Additionally, columns
+               can be added from the 'Name' or 'RECORD_TITLE' parameter by splitting on | and :
+               e.g. 'MZ:100.2 | RT:20 | xcms_grp_id:1' would create MZ,RT and xcms_grp_id columns">
+            <option value="name" selected="true">Extra metadata columns from the Name or RECORD_TITLE</option>
+            <option value="name_split">Extra metadata columns from the Name or RECORD_TITLE (each column is split on "|" and ":" ) </option>
+            <option value="all">Extra metadata columns from all MSP parameters</option>
+        </param>
+        <conditional name="suspectlist">
+            <param name="suspectselector" type="select" label="Suspect list"
+                   help="Choose whether to include a suspect list">
+                <option value="includesuspects" >Include suspect list</option>
+                <option value="excludesuspects" selected="True">Do not include suspect list</option>
+            </param>
+            <when value="includesuspects">
+                <conditional name="includesuspects_default_cond">
+                    <param name="includesuspects_default_bool" type="boolean"
+                           label="Use default list of suspect compounds?"
+                           help="Either provide a file containing a list of suspect compounds or a default file
+                                 of an aggregated list of in silico predicted MS/MS spectra of natural products
+                                 from the Universal Natural Products Database (http://pkuxxj.pku.edu.cn/UNPD/index.php).
+                                  The list is an aggregated version of the github repository https://github.com/oolonek/ISDB/tree/master/Data/dbs."/>
+                    <when value="true"/>
+                    <when value="false">
+                        <param argument="--ScoreSuspectLists" type="data" format="txt" optional="True"
+                               label="Suspect list file"  help="File containing a list of suspects inchikeys" />
+                    </when>
+                </conditional>
+                <expand macro="metfrag_scoring"/>
+            </when>
+            <when value="excludesuspects">
+                <expand macro="metfrag_scoring" suspectlistscore="False" weights="1.0,1.0"/>
+            </when>
+        </conditional>
+        <param argument="--minMSMSpeaks" type="integer" label="Minimum number of MS/MS peaks" value="0"/>
+        <param argument="--skip_invalid_adducts" type="boolean" label="Skip invalid or undefined adduct types?"
+               truevalue="--skip_invalid_adducts" falsevalue="" checked="true"
+               help="If no adduct type is provided within the MSP file or if the adduct type is not usable
+                     with MetFrag, set to 'yes' if these spectra should be skipped or 'no' if the default
+                     of [M+H]+ for pos data or [M-H]- for neg data should be used"/>
+        <section name="PreProcessFilter" title="PreProcessing filters" expanded="False">
+            <param argument="--UnconnectedCompoundFilter" type="boolean" checked="false"
+                   truevalue="--UnconnectedCompoundFilter" falsevalue=""
+                   label="filter non-connected compounds (e.g. salts)" help=""/>
+            <param argument="--IsotopeFilter" type="boolean" checked="false" truevalue="--IsotopeFilter"
+                   falsevalue="" label="filter compounds containing non-standard isotopes" help=""/>
+            <param argument="--FilterMinimumElements" type="text"
+                   optional="true" label="Minimum Elements Filter"
+                   help="Filter by minimum of contained elements. Ex: N2O3 include compounds with at least
+                         2 nitrogens and 3 oxygens">
+                <expand macro="text-alphanumeric-regex-validator"/>
+            </param>
+            <param argument="--FilterMaximumElements" type="text"
+                   optional="true" label="Maximum Elements Filter"
+                   help="Filter by maximum of contained elements. Ex: N5O7 filter out compounds with at
+                         maximum 5 nitrogens and 7 oxygens">
+                    <expand macro="text-alphanumeric-regex-validator"/>
+            </param>
+            <param argument="--FilterSmartsInclusionList" type="text"
+                   optional="true" label="Include substructures"
+                   help="Filter by presence of defined sub-structures. Ex: c1ccccc1 include compounds
+                         containing benzene"/>
+            <param argument="--FilterSmartsExclusionList" type="text"
+                   optional="true" label="Exclude substructures"
+                   help="Filter by absence of defined sub-structures. Ex: [OX2H] filter out compounds
+                         containing hydroxyl groups"/>
+            <param argument="--FilterIncludedElements" type="text"
+                   optional="true" label="Include elements"
+                   help="Filter by presence of defined elements (other elements are allowed).
+                         Ex: 'N,O' include compounds containing nitrogen and oxygen" >
+                <expand macro="text-alphanumeric-comma-regex-validator"/>
+            </param>
+            <param argument="--FilterIncludedExclusiveElements" type="text"
+                   optional="true" label="Include elements (exclusive)"
+                   help="Filter by presence of defined elements (no other elements are allowed).
+                         Ex: 'N,O' include compounds only composed of nitrogen and oxygen" >
+                <expand macro="text-alphanumeric-comma-regex-validator"/>
+            </param>
+            <param argument="--FilterExcludedElements" type="text"
+                   optional="true" label="Exclude elements"
+                   help="Filter by absence of defined sub-structures. Ex: 'Cl,Br' filter out
+                         compounds including bromine or chlorine">
+                <expand macro="text-alphanumeric-comma-regex-validator"/>
+            </param>
+        </section>
+        <section name="PostProcessFilter" title="PostProcessing filters" expanded="False">
+            <param argument="--score_thrshld" type="float" label="Threshold for score after MetFrag search"
+                   max="1" min="0" value="0"/>
+            <param argument="--pctexplpeak_thrshld" type="float" label="Minimum percentage of explain peaks"
+                   max="100" min="0" value="0"/>
+        </section>
+    </inputs>
+    <outputs>
+        <data name="results" format="tabular"/>
+    </outputs>
+    <tests>
+        <test>
+            <!-- Test "massbank" style data format  -->
+            <param name="input" value="massbank_format.txt"/>
+            <param name="schema" value="massbank"/>
+            <param name="skip_invalid_adducts" value="false"/>
+            <param name="MetFragDatabaseType" value="PubChem"/>
+            <param name="MetFragDatabaseType" value="LocalCSV"/>
+            <param name="LocalDatabasePath" value="demo_db.csv"/>
+            <output name="results" file="metfrag_massbank.tabular"/>
+        </test>
+        <test>
+            <!-- Test "generic" style data format  -->
+            <param name="input" value="generic_format.msp"/>
+            <param name="schema" value="msp"/>
+            <param name="MetFragDatabaseType" value="PubChem"/>
+            <param name="skip_invalid_adducts" value="false"/>
+            <param name="MetFragDatabaseType" value="LocalCSV"/>
+            <param name="LocalDatabasePath" value="demo_db.csv"/>
+            <output name="results" file="metfrag_msp.tabular"/>
+        </test>
+        <test>
+            <!-- Test PubChem API with "winter" dataset -->
+            <param name="input" value="winter_pos.msp"/>
+            <section name="PostProcessFilter">
+                <param name="score_thrshld" value="0.9"/>
+            </section>
+            <param name="MetFragDatabaseType" value="PubChem"/>
+            <output name="results" file="winter_pos.tabular"/>
+        </test>
+        <test>
+            <!-- Test actual MassBank data for Glucose -->
+            <param name="input" value="RP022611.txt"/>
+            <param name="MetFragDatabaseType" value="LocalCSV"/>
+            <param name="LocalDatabasePath" value="demo_db.csv"/>
+            <output name="results" file="RP022611.tabular"/>
+        </test>
+        <test>
+            <!-- Test actual MassBank data for Glucose (all metadata columns in output-->
+            <param name="input" value="RP022611.txt"/>
+            <param name="schema" value="massbank"/>
+            <param name="MetFragDatabaseType" value="LocalCSV"/>
+            <param name="LocalDatabasePath" value="demo_db.csv"/>
+            <param name="meta_select_col" value="all"/>
+            <output name="results" file="RP022611_all_col.tabular"/>
+        </test>
+        <test>
+            <!-- Test actual MassBank data for Glucose (include suspect list - default)-->
+            <param name="input" value="RP022611.txt"/>
+            <param name="schema" value="massbank"/>
+            <conditional name="suspectlist">
+                <param name="suspectselector" value="includesuspects"/>
+                <conditional name="includesuspects_default_cond">
+                    <param name="includesuspects_default_bool" value="true"/>
+                </conditional>
+            </conditional>
+            <output name="results" file="RP022611_suspect_default.txt"/>
+        </test>
+        <test>
+            <!-- Test invalid adduct -->
+            <param name="input" value="invalid_adduct.msp"/>
+            <param name="skip_invalid_adducts" value="true"/>
+            <output name="results" file="invalid_adduct_result.txt" ftype="tabular"/>
+        </test>
+    </tests>
+    <help>
+-------
+MetFrag
+-------
+
+Description
+-----------
+
+MetFrag is a freely available software for the annotation of high precision tandem mass spectra of metabolites which is
+a first and critical step for the identification of a molecule's structure. Candidate molecules of different databases
+are fragmented "in silico" and matched against mass to charge values. A score calculated using the fragment peak
+matches gives hints to the quality of the candidate spectrum assignment.
+
+Website: http://ipb-halle.github.io/MetFrag/
+
+Parameters
+----------
+
+**\1. MSP file**
+
+MSP file created using *Create MSP* tool
+
+**\2a. MetFragDatabaseType (public databases)**
+
+* PubChem
+
+* KEGG
+
+
+**\2b. MetFragDatabaseType (local CSV file database)**
+
+
+Custom database file in CSV format with the following structure:
+
++-------------+------------------+----------+---------------------------------------------+----------------------+---+
+| Identifier  | MonoisotopicMass | SMILES   | InChI                                       | Name                 |...|
++-------------+------------------+----------+---------------------------------------------+----------------------+---+
+| HMDB0000123 | 75.03202841      | NCC(O)=O | InChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5)  | Glycine              |...|
++-------------+------------------+----------+---------------------------------------------+----------------------+---+
+| HMDB0002151 | 78.0139355       | CS(C)=O  | InChI=1S/C2H6OS/c1-4(2)3/h1-2H3             | Dimethyl sulfoxide   |...|
++-------------+------------------+----------+---------------------------------------------+----------------------+---+
+| ...         | ...              | ...      | ...                                         | ...                  |...|
++-------------+------------------+----------+---------------------------------------------+----------------------+---+
+
+
+Table continued:
+
++---+------------------+-----------------------------+------------------+------------+-------------+
+|...| MolecularFormula | InChIKey                    | InChIKey1        | InChIKey2  | InChIKey3   |
++---+------------------+-----------------------------+------------------+------------+-------------+
+|...| C2H5NO2          | DHMQDGOQFOQNFH-UHFFFAOYSA-N | DHMQDGOQFOQNFH   | UHFFFAOYSA | N           |
++---+------------------+-----------------------------+------------------+------------+-------------+
+|...| C2H6OS           | IAZDPXIOMUYVGZ-UHFFFAOYSA-N | IAZDPXIOMUYVGZ   | UHFFFAOYSA | N           |
++---+------------------+-----------------------------+------------------+------------+-------------+
+|...| ...              | ...                         | ...              | ...        | ...         |
++---+------------------+-----------------------------+------------------+------------+-------------+
+
+
+
+**\2b. MetFragDatabaseType MetChem**
+
+MetChem is a modified PubChem database and can be used in replace of PubChem
+for performing API calls to the public PubChem instance.
+
+**\3. Database Search Relative Mass Deviation - ppm**
+
+A value in ppm that defines the deviation of theoretical masses in the database vs. the measured masses.
+
+**\4. Fragment Peak Match Relative Mass Deviation - ppm**
+
+Relative mass deviation in ppm of theoretical fragment peaks vs. measured fragment peaks.
+
+**\5. Fragment Peak Match Absolute Mass Deviation (Da)**
+
+Absolute mass deviation in Dalton of theoretical fragment peaks vs. measured fragment peaks.
+
+**\6. Polarity**
+
+The polarity used for the mode of acquisition.
+
+**\7. Schema**
+
+The Schema used by the MSP file (e.g. generic MSP format or MassBank format)
+
+**\8. Suspect list**
+
+Choose whether to include a file containing a list of suspects.
+
+**\9. MetFrag Score Types**
+
+The type of scores MetFrac is using for the calculations. Please do not change the values unless you know what you are doing!
+
+**\10. MetFrag Score Weights**
+
+The weights of the different score types, separated with a comma and without whitespaces. 1.0 means 100%.
+
+**\11. MetFrag Database Type**
+
+Database to choose from.
+
+**\12. minMSMSpeaks**
+
+Minimum MS/MS peaks within a MS/MS spectra to be used for the MetFrag calculation
+
+**\13. PreProcessFilter**
+
+Various filters can be performed on the potential compounds prior to predicting the in silico spectra
+
+**\14. PostProcessFilter**
+
+To make the output more manageble results below certain criteria can be removed from the various filters can be
+performed on the potential compounds prior to predicting the in silico spectra
+
+Output
+-------
+
+These columns are derived from any metadata in the MSP input file (additional columns can included if they are recorded in the MSP file)
+
++-------------+--------------------------------------------+---+
+| adduct      | name                                       |...|
++-------------+--------------------------------------------+---+
+| [M-H]-      | D-Glucose; LC-ESI-QTOF; MS2; CE: 10; R=;   |...|
++-------------+--------------------------------------------+---+
+| [M-H]-      | D-Glucose; LC-ESI-QTOF; MS2; CE: 10; R=;   |...|
++-------------+--------------------------------------------+---+
+| ...         | ...                                        |...|
++-------------+--------------------------------------------+---+
+
+Table continued (these columns are derived from the MetFrag result):
+
++---+------------------+----------------------------------------------------------+-------------------------------------------------------------------------------------+-----+
+|...| sample_name      | ExplPeaks                                                | FormulasOfExplPeaks                                                                 | ... |
++---+------------------+----------------------------------------------------------+-------------------------------------------------------------------------------------+-----+
+|...| 1_metfrag_result | 59.0138_715.8;71.014_679.7;89.0251_999.0;101.0234_103.0  | 59.0138:[C2H4O2]-H-;71.014:[C3H5O2-H]-H-;89.0251:[C3H6O3]-H-;101.0234:[C4H7O3-H]-H- | ... |
++---+------------------+----------------------------------------------------------+-------------------------------------------------------------------------------------+-----+
+|...| 1_metfrag_result | 59.0138_715.8;71.014_679.7;89.0251_999.0;101.0234_103.0  | 59.0138:[C2H4O2]-H-;71.014:[C3H5O2-H]-H-;89.0251:[C3H6O3]-H-;101.0234:[C4H7O3-H]-H- | ... |
++---+------------------+----------------------------------------------------------+-------------------------------------------------------------------------------------+-----+
+|...| ...              | ...                                                      | ...                                                                                 | ... |
++---+------------------+----------------------------------------------------------+-------------------------------------------------------------------------------------+-----+
+
+
+Table continued (columns are derived from the MetFrag result):
+
++---+------------------+----------------------------+------------------------------------------------------+------------+---------------------------------------------------------------------------------+---+
+|...| FragmenterScore  | FragmenterScore_Values     | FormulasOfExplPeaks                                  | Identifier | InChI                                                                           |...|
++---+------------------+----------------------------+------------------------------------------------------+------------+---------------------------------------------------------------------------------+---+
+|...| 105.844569063138 | 696.0;1156.0;696.0;1156.0  | 6-(hydroxymethyl)oxane-2,3,4,5-tetrol                |  206       | InChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H                        |...|
++---+------------------+----------------------------+------------------------------------------------------+------------+---------------------------------------------------------------------------------+---+
+|...| 105.844569063138 | 696.0;1156.0;696.0;1156.0  | (3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol  |  5793      | InChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5-,6?/m1/s1 |...|
++---+------------------+----------------------------+------------------------------------------------------+------------+---------------------------------------------------------------------------------+---+
+|...| ...              | ...                        | ...                                                  | ...        | ...                                                                             |...|
++---+------------------+----------------------------+------------------------------------------------------+------------+---------------------------------------------------------------------------------+---+
+
+Table continued (columns are derived from the MetFrag result):
+
+
++---+-------------+-----------------+-----------------------+----------------------------------------------+------------------+------------------+--------+
+|...| NoExplPeaks | NumberPeaksUsed | OfflineMetFusionScore | SMILES	                                   | Score            | SuspectListScore | XlogP3 |
++---+-------------+-----------------+-----------------------+----------------------------------------------+------------------+------------------+--------+
+|...| 4           | 5	            | 2.84566828424078	    | C(C1C(C(C(C(O1)O)O)O)O)O                     | 1.82678219603441 | 1                | -2.6   |
++---+-------------+-----------------+-----------------------+----------------------------------------------+------------------+------------------+--------+
+|...| 4           | 5               | 2.84566828424078      | C([C@@H]1[C@H]([C@@H]([C@H](C(O1)O)O)O)O)O   | 1.82678219603441 | 1                | -2.6   |
++---+-------------+-----------------+-----------------------+----------------------------------------------+------------------+------------------+--------+
+|...| ...         | ...             | ...                   | ...                                          | ...              | ...              | ...    |
++---+-------------+-----------------+-----------------------+----------------------------------------------+------------------+------------------+--------+
+
+
+Additional notes
+--------------------
+
+The following adducts (and format) are currently supported in the MSP file. The neutral mass is automatically
+ calculated for the precursor m/z by subtracting the adduct mass
+
+- '[M+H]+': 1.007276,
+- '[M+NH4]+': 18.034374,
+- '[M+Na]+': 22.989218,
+- '[M+K]+': 38.963158,
+- '[M+CH3OH+H]+': 33.033489,
+- '[M+ACN+H]+': 42.033823,
+- '[M+ACN+Na]+': 64.015765,
+- '[M+2ACN+H]+': 83.06037,
+- '[M-H]-': -1.007276,
+- '[M+Cl]-': 34.969402,
+- '[M+HCOO]-': 44.99819,
+- '[M-H+HCOOH]-': 44.99819,
+- '[M+CH3COO]-': 59.01385,
+- '[M-H+CH3COOH]-': 59.01385
+
+Developers and contributors
+---------------------------
+- **Jordi Capellades (j.capellades.to@gmail.com) - Universitat Rovira i Virgili (SP)**
+- **Julien Saint-Vanne (julien.saint-vanne@sb-roscoff.fr) - ABiMS (France)**
+- **Tom Lawson (t.n.lawson@bham.ac.uk) - University of Birmingham (UK)**
+- **Ralf Weber (r.j.weber@bham.ac.uk) - University of Birmingham (UK)**
+- **Kristian Peters (kpeters@ipb-halle.de) - IPB Halle (Germany)**
+- **Payam Emami (payam.emami@medsci.uu.se) - Uppsala Universitet (Sweden)**
+- **Christoph Ruttkies (christoph.ruttkies@ipb-halle.de) - IPB Halle (Germany)**
+    </help>
+    <citations>
+        <citation type="doi">10.1186/s13321-016-0115-9</citation>
+    </citations>
+</tool>