| Previous changeset 7:fac2c28b4c55 (2024-08-15) |
|
Commit message:
planemo upload for repository https://github.com/bgruening/galaxytools/tree/master/chemicaltoolbox/openbabel commit 1a24b53139f4c8370cf7ecc2bf8cce71cfe2663f |
|
modified:
distance_finder.py ob_prepare_ligands.xml test-data/2_mol.sdf test-data/change_title_on_CID_3033.sdf test-data/filterd_by_name.sdf test-data/molecule.fs test-data/ob_convert_on_CID2244.sdf test-data/ob_filter_on_CID2244.sdf test-data/ob_genprop_on_CID2244.sdf test-data/ob_remove_protonation_state.sdf |
|
added:
__pycache__/cheminfolib.cpython-36.pyc |
| b |
| diff -r fac2c28b4c55 -r d9d5aa013bb4 __pycache__/cheminfolib.cpython-36.pyc |
| b |
| Binary file __pycache__/cheminfolib.cpython-36.pyc has changed |
| b |
| diff -r fac2c28b4c55 -r d9d5aa013bb4 distance_finder.py --- a/distance_finder.py Thu Aug 15 11:04:16 2024 +0000 +++ b/distance_finder.py Thu Feb 19 15:05:58 2026 +0000 |
| b |
| @@ -93,8 +93,6 @@ def main(): - global work_dir - parser = argparse.ArgumentParser( description="XChem distances - measure distances to particular points" ) |
| b |
| diff -r fac2c28b4c55 -r d9d5aa013bb4 ob_prepare_ligands.xml --- a/ob_prepare_ligands.xml Thu Aug 15 11:04:16 2024 +0000 +++ b/ob_prepare_ligands.xml Thu Feb 19 15:05:58 2026 +0000 |
| [ |
| @@ -2,7 +2,7 @@ <description>Tool to prepare ligands for docking with tools like Autodock Vina</description> <macros> <import>macros.xml</import> - <token name="@GALAXY_VERSION@">0</token> + <token name="@GALAXY_VERSION@">1</token> </macros> <expand macro="requirements"/> <command detect_errors="aggressive"><![CDATA[ |
| b |
| diff -r fac2c28b4c55 -r d9d5aa013bb4 test-data/2_mol.sdf --- a/test-data/2_mol.sdf Thu Aug 15 11:04:16 2024 +0000 +++ b/test-data/2_mol.sdf Thu Feb 19 15:05:58 2026 +0000 |
| [ |
| @@ -1,5 +1,5 @@ CC(=O)Oc1ccccc1C(=O)[O-] InChI=1S/C9H8O4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3,(H,11,12)/p-1 - OpenBabel08132415422D + OpenBabel01232615512D 13 13 0 0 0 0 0 0 0 0999 V2000 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 @@ -32,7 +32,7 @@ M END $$$$ CC(=O)Oc1ccccc1C(=O)[O-] InChI=1S/C9H8O4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3,(H,11,12)/p-1 - OpenBabel08132415422D + OpenBabel01232615512D 13 13 0 0 0 0 0 0 0 0999 V2000 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 |
| b |
| diff -r fac2c28b4c55 -r d9d5aa013bb4 test-data/change_title_on_CID_3033.sdf --- a/test-data/change_title_on_CID_3033.sdf Thu Aug 15 11:04:16 2024 +0000 +++ b/test-data/change_title_on_CID_3033.sdf Thu Feb 19 15:05:58 2026 +0000 |
| b |
| @@ -1,5 +1,5 @@ 214.7 - OpenBabel06291213403D + OpenBabel01232615513D 30 31 0 0 0 0 0 0 0 0999 V2000 1.9541 1.1500 -2.5078 Cl 0 0 0 0 0 0 0 0 0 0 0 0 |
| b |
| diff -r fac2c28b4c55 -r d9d5aa013bb4 test-data/filterd_by_name.sdf --- a/test-data/filterd_by_name.sdf Thu Aug 15 11:04:16 2024 +0000 +++ b/test-data/filterd_by_name.sdf Thu Feb 19 15:05:58 2026 +0000 |
| b |
| @@ -1,5 +1,5 @@ abc_one - OpenBabel03212013422D + OpenBabel01232615512D 26 30 0 0 0 0 0 0 0 0999 V2000 -8.6396 0.9568 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 @@ -67,7 +67,7 @@ $$$$ abc_eleven - OpenBabel03212013422D + OpenBabel01232615512D 32 35 0 0 1 0 0 0 0 0999 V2000 7.1381 -2.1568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 |
| b |
| diff -r fac2c28b4c55 -r d9d5aa013bb4 test-data/molecule.fs |
| b |
| Binary file test-data/molecule.fs has changed |
| b |
| diff -r fac2c28b4c55 -r d9d5aa013bb4 test-data/ob_convert_on_CID2244.sdf --- a/test-data/ob_convert_on_CID2244.sdf Thu Aug 15 11:04:16 2024 +0000 +++ b/test-data/ob_convert_on_CID2244.sdf Thu Feb 19 15:05:58 2026 +0000 |
| b |
| @@ -1,5 +1,5 @@ 2244 - OpenBabel03291606592D + OpenBabel01232615502D 21 21 0 0 0 0 0 0 0 0999 V2000 3.7320 -0.0600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 |
| b |
| diff -r fac2c28b4c55 -r d9d5aa013bb4 test-data/ob_filter_on_CID2244.sdf --- a/test-data/ob_filter_on_CID2244.sdf Thu Aug 15 11:04:16 2024 +0000 +++ b/test-data/ob_filter_on_CID2244.sdf Thu Feb 19 15:05:58 2026 +0000 |
| b |
| @@ -1,5 +1,5 @@ 2244 - OpenBabel07101213142D + OpenBabel01232615522D 21 21 0 0 0 0 0 0 0 0999 V2000 3.7320 -0.0600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 |
| b |
| diff -r fac2c28b4c55 -r d9d5aa013bb4 test-data/ob_genprop_on_CID2244.sdf --- a/test-data/ob_genprop_on_CID2244.sdf Thu Aug 15 11:04:16 2024 +0000 +++ b/test-data/ob_genprop_on_CID2244.sdf Thu Feb 19 15:05:58 2026 +0000 |
| b |
| @@ -1,5 +1,5 @@ 2244 - OpenBabel05191718512D + OpenBabel01232615482D 21 21 0 0 0 0 0 0 0 0999 V2000 3.7320 -0.0600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 |
| b |
| diff -r fac2c28b4c55 -r d9d5aa013bb4 test-data/ob_remove_protonation_state.sdf --- a/test-data/ob_remove_protonation_state.sdf Thu Aug 15 11:04:16 2024 +0000 +++ b/test-data/ob_remove_protonation_state.sdf Thu Feb 19 15:05:58 2026 +0000 |
| b |
| @@ -1,5 +1,5 @@ 2244 - OpenBabel03291607022D + OpenBabel01232615542D 21 21 0 0 0 0 0 0 0 0999 V2000 3.7320 -0.0600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 |